{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7763597e-0b54-44b8-9acf-020632656ea5",
          "code": "112529-15-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=112529-15-4",
          "code_system": "CAS",
          "references": [
            "d6922ede-5ba5-4136-8c2f-9fc3f5fbbd3a",
            "5e3c1913-f241-4bba-9c3f-da8ee29c1661"
          ]
        },
        {
          "uuid": "320fb29d-dfc7-4b52-ba5d-ac32baf35bfe",
          "code": "C29367",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29367",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d6922ede-5ba5-4136-8c2f-9fc3f5fbbd3a"
          ]
        },
        {
          "uuid": "abd92dc4-4760-41be-b7a6-059cd42569f7",
          "code": "127676-30-6",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=127676-30-6",
          "code_system": "CAS",
          "references": [
            "d6922ede-5ba5-4136-8c2f-9fc3f5fbbd3a",
            "5db304cd-1110-49b4-8d56-a01dc96aaca7"
          ]
        },
        {
          "uuid": "fc409762-b619-4aa2-8cc7-22771702bfa4",
          "code": "259319",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/259319/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d6922ede-5ba5-4136-8c2f-9fc3f5fbbd3a"
          ]
        },
        {
          "uuid": "65415087-0dde-4936-9cdf-6bcec60f2c5c",
          "code": "m8835",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8835?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d6922ede-5ba5-4136-8c2f-9fc3f5fbbd3a"
          ]
        },
        {
          "uuid": "8cb0ff49-c7cd-4ec9-af9e-6f837cd1388b",
          "code": "SUB03834MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d6922ede-5ba5-4136-8c2f-9fc3f5fbbd3a"
          ]
        },
        {
          "uuid": "6e7ec527-9307-4f94-bfa3-2509fed9faa2",
          "code": "CHEMBL595",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL595",
          "code_system": "ChEMBL",
          "references": [
            "d6922ede-5ba5-4136-8c2f-9fc3f5fbbd3a"
          ]
        },
        {
          "uuid": "996943b4-28d3-bc8c-dbf1-1e7b8e43622e",
          "code": "DTXSID3044203",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3044203",
          "code_system": "EPA CompTox",
          "references": [
            "d2e41817-c0d0-b0f7-8c7b-16d24daafb35"
          ]
        },
        {
          "uuid": "f5a539fc-cd41-f4cd-ff32-6f57aebeaaa7",
          "code": "C98241",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Anti-diabetic Agent[C29711]|Thiazolidinedione Antidiabetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C98241",
          "code_system": "NCI_THESAURUS",
          "references": [
            "95118153-4d96-0895-72b8-c0ced1b9ef42"
          ]
        },
        {
          "uuid": "5bf41fd2-bb34-ea39-b712-2c92f6c64d85",
          "code": "EU/3/16/1823",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of sudden sensorineural hearing loss",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3161823",
          "code_system": "EU-Orphan Drug",
          "references": [
            "95118153-4d96-0895-72b8-c0ced1b9ef42"
          ]
        },
        {
          "uuid": "5d84ac24-0068-8e84-5238-3eb1fe6d3106",
          "code": "60560",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/60560",
          "code_system": "PUBCHEM",
          "references": [
            "a3341405-d1a2-2f96-ad59-0b4a98d206de"
          ]
        },
        {
          "uuid": "96f94fba-f8f9-4f78-b1a0-f32efe9226d5",
          "code": "JQT35NPK6C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "51ff3211-94cd-e317-79ca-598ace4bff0a",
          "code": "DBSALT000555",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT000555",
          "code_system": "DRUG BANK",
          "references": [
            "95118153-4d96-0895-72b8-c0ced1b9ef42"
          ]
        },
        {
          "uuid": "edea174b-f71c-de33-ce03-fc834f9b39b8",
          "code": "1539905",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1539905",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "95118153-4d96-0895-72b8-c0ced1b9ef42"
          ]
        },
        {
          "uuid": "4c76623a-efb6-f5a3-d582-9621d564e85a",
          "code": "890822",
          "comments": "ORPHAN DRUG|Designated|Treatment of childhood onset idiopathic nephrotic syndrome (defined as steroid dependent or frequently relapsing NS).",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=890822",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "95118153-4d96-0895-72b8-c0ced1b9ef42"
          ]
        },
        {
          "uuid": "19ef39f5-09b3-966a-3d57-69d2e452c6f5",
          "code": "JQT35NPK6C",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=JQT35NPK6C",
          "code_system": "DAILYMED",
          "references": [
            "b102853d-952b-01ad-0908-0aacfcde6295"
          ]
        },
        {
          "uuid": "8fda2266-ec8d-0858-194d-29166413aa7c",
          "code": "100000091439",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cfcfc82b-f76a-6c92-647d-5f7cbafd855d"
          ]
        },
        {
          "uuid": "be7ed4ad-7b42-f90d-db0b-dfa6cdded51d",
          "code": "AA-22",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/AA-22/relevant/1/",
          "code_system": "USAN",
          "references": [
            "5f7d7e8c-19ba-4990-a667-63cd27dc873c"
          ]
        },
        {
          "uuid": "ae5d2707-bf32-30fe-6ec5-3096b195abae",
          "code": "758876",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758876",
          "code_system": "NSC",
          "references": [
            "4e62d5f4-e0e1-4316-b57f-094788f4f6c0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1bc112e9-ffcb-4a76-8402-1f16a8df60ee",
          "amount": {
            "uuid": "0b0d6dce-ec1f-4175-b416-df9464ce64f1",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 98
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "a2695b82-f625-4887-8ab6-4960b3ba09eb"
          ],
          "related_substance": {
            "uuid": "c704fcd2-4ffa-43f8-9fc9-ae0a82c8d5e4",
            "refuuid": "c9139ac3-199f-4659-abe7-e191d58d6340",
            "name": "PIOGLITAZONE HYDROCHLORIDE",
            "unii": "JQT35NPK6C",
            "linking_id": "JQT35NPK6C",
            "ref_pname": "PIOGLITAZONE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e56e4eda-1ede-40f0-b70b-c32bbabd45a2",
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "references": [
            "affcd043-6ddf-4b3c-8c22-82336d5fc062"
          ],
          "related_substance": {
            "uuid": "bdbf51d8-04ee-4a44-9ad7-95afa2d98b3f",
            "refuuid": "a6e9ee02-dee4-4d9a-9cfb-7192f55b641b",
            "name": "5-HYDROXY PIOGLITAZONE",
            "unii": "TP637L2U5K",
            "linking_id": "TP637L2U5K",
            "ref_pname": "5-HYDROXY PIOGLITAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b643c06f-9c28-46a2-b771-be35038722dc",
          "amount": {
            "uuid": "40e9b4a8-017e-4879-9eee-3eca127d7dcf",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a2695b82-f625-4887-8ab6-4960b3ba09eb"
          ],
          "related_substance": {
            "uuid": "98a9eac1-2035-4f12-b073-8312d661ece9",
            "refuuid": "a6e9ee02-dee4-4d9a-9cfb-7192f55b641b",
            "name": "5-HYDROXY PIOGLITAZONE",
            "unii": "TP637L2U5K",
            "linking_id": "TP637L2U5K",
            "ref_pname": "5-HYDROXY PIOGLITAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "38c320b5-e9b6-41bf-b43e-2265fcb8ca9a",
          "amount": {
            "uuid": "645ade25-70f7-4be0-9e4b-d70650a5c1fb",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "affcd043-6ddf-4b3c-8c22-82336d5fc062"
          ],
          "related_substance": {
            "uuid": "b8104a2e-67a5-45cd-9f06-90a22f9c0c78",
            "refuuid": "3a5db035-92e1-4f7d-94ef-78aa2d811748",
            "name": "DIDEHYDROPIOGLITAZONE, (5Z)-",
            "unii": "6SE873CO82",
            "linking_id": "6SE873CO82",
            "ref_pname": "DIDEHYDROPIOGLITAZONE, (5Z)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b1500280-5311-4796-b7ac-d03c5fe8c392",
          "amount": {
            "uuid": "1b574e71-e978-4dd5-a0df-d08de37f7f93",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a2695b82-f625-4887-8ab6-4960b3ba09eb"
          ],
          "related_substance": {
            "uuid": "c6e21eb1-3b90-496a-8188-ea9a3d08ef63",
            "refuuid": "3a5db035-92e1-4f7d-94ef-78aa2d811748",
            "name": "DIDEHYDROPIOGLITAZONE, (5Z)-",
            "unii": "6SE873CO82",
            "linking_id": "6SE873CO82",
            "ref_pname": "DIDEHYDROPIOGLITAZONE, (5Z)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "99441904-e12e-4a39-a0a3-51baf2c5cdd2",
          "amount": {
            "uuid": "9d4b4c60-b626-4fc5-9e7e-00248d23d3cb",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "affcd043-6ddf-4b3c-8c22-82336d5fc062"
          ],
          "related_substance": {
            "uuid": "f15ac44f-e6f9-433c-9a0f-8acd9f903a72",
            "refuuid": "7c828be5-a560-4324-84f2-27dc7887190a",
            "name": "N-(ETHYL-(2-PYRIDYL-5-ETHYL)) PIOGLITAZONE",
            "unii": "0A40W8CWPF",
            "linking_id": "0A40W8CWPF",
            "ref_pname": "N-(ETHYL-(2-PYRIDYL-5-ETHYL)) PIOGLITAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "abd88c7e-6fa6-4a58-8945-c29e69f40f36",
          "amount": {
            "uuid": "084ef973-6c2a-47e4-ac0e-bb28cae4f07f",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a2695b82-f625-4887-8ab6-4960b3ba09eb"
          ],
          "related_substance": {
            "uuid": "db8cd488-3d46-4c3b-a6f8-32bc1414f6c7",
            "refuuid": "7c828be5-a560-4324-84f2-27dc7887190a",
            "name": "N-(ETHYL-(2-PYRIDYL-5-ETHYL)) PIOGLITAZONE",
            "unii": "0A40W8CWPF",
            "linking_id": "0A40W8CWPF",
            "ref_pname": "N-(ETHYL-(2-PYRIDYL-5-ETHYL)) PIOGLITAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7f1e4322-87a5-4528-a317-f83a5a6581c0",
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "references": [
            "affcd043-6ddf-4b3c-8c22-82336d5fc062"
          ],
          "related_substance": {
            "uuid": "3af76ad6-f06b-48a5-a697-6809f19b24b9",
            "refuuid": "8af9a9c6-3616-4c17-997f-bd93d7d171f0",
            "name": "ETHYL (2RS)-2-(CARBAMOYLSULFANYL)-3-(4-(2-(5-ETHYLPYRIDIN-2-YL)ETHOXY)PHENYL)PROPANOATE",
            "unii": "6N6H6PIN5L",
            "linking_id": "6N6H6PIN5L",
            "ref_pname": "ETHYL (2RS)-2-(CARBAMOYLSULFANYL)-3-(4-(2-(5-ETHYLPYRIDIN-2-YL)ETHOXY)PHENYL)PROPANOATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ad99201a-bebe-4d47-8b41-771565cde1d1",
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "references": [
            "affcd043-6ddf-4b3c-8c22-82336d5fc062"
          ],
          "related_substance": {
            "uuid": "0dcd5b87-4e2e-4677-b6eb-a47d722430d9",
            "refuuid": "37f9b783-a3fe-429c-aed7-3a7f5cd6df28",
            "name": "ETHYL 3-(4-(2-(5-ETHYLPYRIDIN-2-YL)ETHOXY)PHENYL)PROPANOATE",
            "unii": "Q2RVO1NCOQ",
            "linking_id": "Q2RVO1NCOQ",
            "ref_pname": "ETHYL 3-(4-(2-(5-ETHYLPYRIDIN-2-YL)ETHOXY)PHENYL)PROPANOATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d7d1ce05-40d6-4dc5-b8c0-b0baa8e76440",
          "amount": {
            "uuid": "47ba43c0-5568-424c-8438-8224c3d2a05a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 98
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "affcd043-6ddf-4b3c-8c22-82336d5fc062"
          ],
          "related_substance": {
            "uuid": "bba57c90-dfab-41f4-832c-826495b9c534",
            "refuuid": "c9139ac3-199f-4659-abe7-e191d58d6340",
            "name": "PIOGLITAZONE HYDROCHLORIDE",
            "unii": "JQT35NPK6C",
            "linking_id": "JQT35NPK6C",
            "ref_pname": "PIOGLITAZONE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e6132fb1-8715-4bea-86b0-1277f6758f7f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4f5c24cb-c092-4396-a97c-26b104ce6d78",
            "refuuid": "09aa033f-572b-4aec-9fda-b64c6aee1eda",
            "name": "PIOGLITAZONE",
            "unii": "X4OV71U42S",
            "linking_id": "X4OV71U42S",
            "ref_pname": "PIOGLITAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b146c4f5-8b7c-446a-a769-2c2b5628f2a0",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "2255ee62-2663-4b48-8b75-6b069d884072",
            "refuuid": "09aa033f-572b-4aec-9fda-b64c6aee1eda",
            "name": "PIOGLITAZONE",
            "unii": "X4OV71U42S",
            "linking_id": "X4OV71U42S",
            "ref_pname": "PIOGLITAZONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c9686111-c0b8-4404-99f5-1695cb512d81",
          "name": "(±)-5-(P-(2-(5-ETHYL-2-PYRIDYL)ETHOXY)BENZYL)-2,4-THIAZOLIDINEDIONE MONOHYDROCHLORIDE",
          "stdName": "(+/-)-5-(P-(2-(5-ETHYL-2-PYRIDYL)ETHOXY)BENZYL)-2,4-THIAZOLIDINEDIONE MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4daab2df-88b5-41f7-9413-a4b29754ee1e"
          ],
          "display_name": false
        },
        {
          "uuid": "c21c6d67-fc52-4417-94b2-426710f97c53",
          "name": "2,4-THIAZOLIDINEDIONE, 5-((4-(2-(5-ETHYL-2-PYRIDINYL)ETHOXY)PHENYL)METHYL)-, HYDROCHLORIDE (1:1)",
          "stdName": "2,4-THIAZOLIDINEDIONE, 5-((4-(2-(5-ETHYL-2-PYRIDINYL)ETHOXY)PHENYL)METHYL)-, HYDROCHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3524ed01-fc33-4c10-95fe-a83f93987ffb"
          ],
          "display_name": false
        },
        {
          "uuid": "ed2cd5c5-1919-4a93-aaea-fe959e647a0d",
          "name": "2,4-THIAZOLIDINEDIONE, 5-((4-(2-(5-ETHYL-2-PYRIDINYL)ETHOXY)PHENYL)METHYL)-, MONOHYDROCHLORIDE",
          "stdName": "2,4-THIAZOLIDINEDIONE, 5-((4-(2-(5-ETHYL-2-PYRIDINYL)ETHOXY)PHENYL)METHYL)-, MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3524ed01-fc33-4c10-95fe-a83f93987ffb"
          ],
          "display_name": false
        },
        {
          "uuid": "624a5402-b996-4e7f-ba87-0ec14274e076",
          "name": "2,4-THIAZOLIDINEDIONE, 5-((4-(2-(5-ETHYL-2-PYRIDINYL)ETHOXY)PHENYL)METHYL)-, MONOHYDROCHLORIDE, (±)-",
          "stdName": "2,4-THIAZOLIDINEDIONE, 5-((4-(2-(5-ETHYL-2-PYRIDINYL)ETHOXY)PHENYL)METHYL)-, MONOHYDROCHLORIDE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4daab2df-88b5-41f7-9413-a4b29754ee1e"
          ],
          "display_name": false
        },
        {
          "uuid": "aa21853d-19af-4611-80be-04fa5a2295ff",
          "name": "ACTOPLUS MET COMPONENT PIOGLITAZONE HYDROCHLORIDE",
          "stdName": "ACTOPLUS MET COMPONENT PIOGLITAZONE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0447bf11-0801-47f3-b93a-91574b14fb78",
            "c95c5fea-1ea1-41a3-abdb-0493d50d6daf"
          ],
          "display_name": false
        },
        {
          "uuid": "33cb90fc-1026-4e02-8c24-319785d24382",
          "name": "ACTOS",
          "stdName": "ACTOS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e96c5179-f256-4d79-968b-da35fc11208e"
          ],
          "display_name": false
        },
        {
          "uuid": "ea8f9eca-60d6-41ce-86ad-6c36ec805c2f",
          "name": "DUETACT COMPONENT PIOGLITAZONE HYDROCHLORIDE",
          "stdName": "DUETACT COMPONENT PIOGLITAZONE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0447bf11-0801-47f3-b93a-91574b14fb78",
            "c95c5fea-1ea1-41a3-abdb-0493d50d6daf"
          ],
          "display_name": false
        },
        {
          "uuid": "5b4306ff-991c-e76d-4cb7-ae7c57a6cc08",
          "name": "NSC-758876",
          "stdName": "NSC-758876",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e62d5f4-e0e1-4316-b57f-094788f4f6c0"
          ],
          "display_name": false
        },
        {
          "uuid": "203f0edc-7aff-464f-ada7-e0434737bb21",
          "name": "OSENI COMPONENT PIOGLITAZONE HYDROCHLORIDE",
          "stdName": "OSENI COMPONENT PIOGLITAZONE HYDROCHLORIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01dddc98-3bf0-49dc-9fed-aad634922b34"
          ],
          "display_name": false
        },
        {
          "uuid": "5cdeb249-c5ab-4414-a787-d60d7255e731",
          "name": "PIOGLITAZONE (AS HYDROCHLORIDE)",
          "stdName": "PIOGLITAZONE (AS HYDROCHLORIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51529e94-157f-4644-aa18-3a932b988891"
          ],
          "display_name": false
        },
        {
          "uuid": "041cfe4e-4ccf-430f-baca-a3bb8c18c0a4",
          "name": "PIOGLITAZONE HCL",
          "stdName": "PIOGLITAZONE HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01319971-3a8d-4c2d-a694-77ba5454793d",
            "74d2b22f-288b-4f72-ab2c-5edfd9e9024e",
            "e8d2007b-27f3-4a70-9040-8cc6d6b8d434"
          ],
          "display_name": false
        },
        {
          "uuid": "61b7be6e-593a-4e51-b574-785add28ddb4",
          "name": "PIOGLITAZONE HCL [VANDF]",
          "stdName": "PIOGLITAZONE HCL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d2b22f-288b-4f72-ab2c-5edfd9e9024e"
          ],
          "display_name": false
        },
        {
          "uuid": "246e8aa1-dfd4-4dbf-aad9-e42d61486ee0",
          "name": "PIOGLITAZONE HYDROCHLORIDE",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "319c7684-2bd1-4406-bdeb-8706db46ffdc",
            "e0412951-1745-4be1-ab75-503464524f68",
            "74d2b22f-288b-4f72-ab2c-5edfd9e9024e",
            "635cd58a-1272-4737-a323-788df1cafac3",
            "fbb98767-6e44-42d5-957a-80b8e685b183",
            "880dc6c9-3e99-4946-9671-374d398ff53a",
            "4daab2df-88b5-41f7-9413-a4b29754ee1e",
            "7a357713-668a-4424-b096-dd5803aae170",
            "a04a0347-c66a-49de-9983-8ace3d27dcb4",
            "fe3afa2d-1b92-4c4e-8c16-acde760218e7",
            "f9e40c92-ee52-4b28-8e9f-62240ac917b9",
            "ce6f6cda-e251-479d-82df-5afeb8f12c9c",
            "5d987a16-e51f-4465-ae7f-b4ca407cbb3c",
            "0452b4a8-7aef-4b64-a47d-61a656a513cd",
            "03ec6bc6-840b-4594-9217-f798ff69d338",
            "d0c99dd9-20f7-4b98-b307-af61cd83c03f",
            "6087d119-612e-4852-b323-516f71d40b44"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "23ed7ffd-661f-4f99-bc7e-50e039b19297",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "9cc3b311-2f85-6308-8774-12e47f1eeccd",
          "name": "PIOGLITAZONE HYDROCHLORIDE [EP MONOGRAPH]",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d7b73af-c83a-f7ae-8b77-b4146ce5d714"
          ],
          "display_name": false
        },
        {
          "uuid": "7dff1104-6354-4583-8d94-e30a14f67de8",
          "name": "PIOGLITAZONE HYDROCHLORIDE [JAN]",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0c99dd9-20f7-4b98-b307-af61cd83c03f"
          ],
          "display_name": false
        },
        {
          "uuid": "ae012cab-8b6f-46a1-9472-a728e20b834f",
          "name": "PIOGLITAZONE HYDROCHLORIDE [MART.]",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9e40c92-ee52-4b28-8e9f-62240ac917b9"
          ],
          "display_name": false
        },
        {
          "uuid": "5ee56c4f-e5e7-47e1-9dd8-083ea18b9ffa",
          "name": "PIOGLITAZONE HYDROCHLORIDE [MI]",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a04a0347-c66a-49de-9983-8ace3d27dcb4"
          ],
          "display_name": false
        },
        {
          "uuid": "219634e2-3c9e-40b8-8452-7651ddf6ba84",
          "name": "PIOGLITAZONE HYDROCHLORIDE [ORANGE BOOK]",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce6f6cda-e251-479d-82df-5afeb8f12c9c"
          ],
          "display_name": false
        },
        {
          "uuid": "01306299-2bba-4127-9b0a-476e07fe07b7",
          "name": "PIOGLITAZONE HYDROCHLORIDE [USAN]",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe3afa2d-1b92-4c4e-8c16-acde760218e7"
          ],
          "display_name": false
        },
        {
          "uuid": "2c8a72a1-f3ef-16b3-774f-cbc31568ed29",
          "name": "PIOGLITAZONE HYDROCHLORIDE [USP MONOGRAPH]",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d81c9e69-2463-335e-0f36-76e76a114d61"
          ],
          "display_name": false
        },
        {
          "uuid": "b766b4be-fe4b-4132-a02e-ab9819d3f626",
          "name": "PIOGLITAZONE HYDROCHLORIDE [USP-RS]",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d987a16-e51f-4465-ae7f-b4ca407cbb3c"
          ],
          "display_name": false
        },
        {
          "uuid": "e3aa83e3-613f-49d6-adcf-8b4774b51103",
          "name": "PIOGLITAZONE HYDROCHLORIDE [VANDF]",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d2b22f-288b-4f72-ab2c-5edfd9e9024e"
          ],
          "display_name": false
        },
        {
          "uuid": "1558a03e-b772-483c-b96f-f210cb3eeb26",
          "name": "PIOMED",
          "stdName": "PIOMED",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3524ed01-fc33-4c10-95fe-a83f93987ffb"
          ],
          "display_name": false
        },
        {
          "uuid": "fc6a0789-a3c4-4f08-8c14-5d2272708e5a",
          "name": "POZE",
          "stdName": "POZE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3524ed01-fc33-4c10-95fe-a83f93987ffb"
          ],
          "display_name": false
        },
        {
          "uuid": "696a4b27-c2c0-1d71-903b-5f2521fdf425",
          "name": "Pioglitazone hydrochloride [WHO-DD]",
          "stdName": "PIOGLITAZONE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d961f934-29b3-ee6c-07ec-74769e87a05c"
          ],
          "display_name": false
        },
        {
          "uuid": "ad737c96-d63b-8e9c-d24b-03d3476acf8a",
          "name": "STR-001",
          "stdName": "STR-001",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ae323e4-efd5-00f2-1aaa-f9c80c360262"
          ],
          "display_name": false
        },
        {
          "uuid": "8d84b8fc-9106-42f5-89f5-ecdd8c29ff78",
          "name": "U-72107A",
          "stdName": "U-72107A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4daab2df-88b5-41f7-9413-a4b29754ee1e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4daab2df-88b5-41f7-9413-a4b29754ee1e",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e8d2007b-27f3-4a70-9040-8cc6d6b8d434",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e96c5179-f256-4d79-968b-da35fc11208e",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe3afa2d-1b92-4c4e-8c16-acde760218e7",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0c99dd9-20f7-4b98-b307-af61cd83c03f",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c95c5fea-1ea1-41a3-abdb-0493d50d6daf",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0447bf11-0801-47f3-b93a-91574b14fb78",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce6f6cda-e251-479d-82df-5afeb8f12c9c",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9e40c92-ee52-4b28-8e9f-62240ac917b9",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d987a16-e51f-4465-ae7f-b4ca407cbb3c",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03ec6bc6-840b-4594-9217-f798ff69d338",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74d2b22f-288b-4f72-ab2c-5edfd9e9024e",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01dddc98-3bf0-49dc-9fed-aad634922b34",
          "citation": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=4c619ed9-fe3e-4158-9938-80c6c3493d55",
          "url": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=4c619ed9-fe3e-4158-9938-80c6c3493d55",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a04a0347-c66a-49de-9983-8ace3d27dcb4",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51529e94-157f-4644-aa18-3a932b988891",
          "citation": "http://www.drugoffice.gov.hk/eps/productDetailActionNew.do?lang=en&section=consumer&id=119942",
          "url": "http://www.drugoffice.gov.hk/eps/productDetailActionNew.do?lang=en&section=consumer&id=119942",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3524ed01-fc33-4c10-95fe-a83f93987ffb",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6922ede-5ba5-4136-8c2f-9fc3f5fbbd3a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390758000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "affcd043-6ddf-4b3c-8c22-82336d5fc062",
          "citation": "EP 7.8 PIOGLITAZONE HYDROCHLORIDE MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2695b82-f625-4887-8ab6-4960b3ba09eb",
          "citation": "USP 36 PIOGLITAZONE HYDROCHLORIDE MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7813d830-3e64-4aae-b52c-e14430c48544",
          "citation": "SRS import [JQT35NPK6C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JQT35NPK6C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390758000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a357713-668a-4424-b096-dd5803aae170",
          "citation": "PIOGLITAZONE HYDROCHLORIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "635cd58a-1272-4737-a323-788df1cafac3",
          "citation": "PIOGLITAZONE HYDROCHLORIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6087d119-612e-4852-b323-516f71d40b44",
          "citation": "PIOGLITAZONE HYDROCHLORIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "880dc6c9-3e99-4946-9671-374d398ff53a",
          "citation": "PIOGLITAZONE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "319c7684-2bd1-4406-bdeb-8706db46ffdc",
          "citation": "PIOGLITAZONE HYDROCHLORIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e0412951-1745-4be1-ab75-503464524f68",
          "citation": "PIOGLITAZONE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01319971-3a8d-4c2d-a694-77ba5454793d",
          "citation": "PIOGLITAZONE HCL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0452b4a8-7aef-4b64-a47d-61a656a513cd",
          "citation": "PIOGLITAZONE HYDROCHLORIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fbb98767-6e44-42d5-957a-80b8e685b183",
          "citation": "PIOGLITAZONE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d2e41817-c0d0-b0f7-8c7b-16d24daafb35",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=112529-15-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ae323e4-efd5-00f2-1aaa-f9c80c360262",
          "citation": "http://adisinsight.springer.com/drugs/800043817",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "95118153-4d96-0895-72b8-c0ced1b9ef42",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5f7d7e8c-19ba-4990-a667-63cd27dc873c",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "5db304cd-1110-49b4-8d56-a01dc96aaca7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5e3c1913-f241-4bba-9c3f-da8ee29c1661",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a3341405-d1a2-2f96-ad59-0b4a98d206de",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "d81c9e69-2463-335e-0f36-76e76a114d61",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "4e62d5f4-e0e1-4316-b57f-094788f4f6c0",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1d7b73af-c83a-f7ae-8b77-b4146ce5d714",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "d961f934-29b3-ee6c-07ec-74769e87a05c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b102853d-952b-01ad-0908-0aacfcde6295",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "cfcfc82b-f76a-6c92-647d-5f7cbafd855d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ccd96e1e-9405-48cf-815b-aa2a2d4728c4",
          "id": "ccd96e1e-9405-48cf-815b-aa2a2d4728c4",
          "molfile": "\n  Marvin  01132110352D          \n\n  1  0  0  0  0  0            999 V2000\n    8.4725   -3.9435    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "17d309e5-5d8b-46d7-9f0e-8d304a7d10ef"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "ea525fee-fe2b-4cac-b51d-8e7182504807",
          "id": "ea525fee-fe2b-4cac-b51d-8e7182504807",
          "molfile": "\n  Marvin  01132112072D          \n\n 25 27  0  0  0  0            999 V2000\n    8.1020   -6.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2781   -6.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8583   -5.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0215   -5.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6147   -4.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0215   -3.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5991   -3.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7856   -3.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3787   -2.5314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5574   -2.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1377   -1.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3111   -1.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8940   -2.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0675   -2.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6503   -3.2362    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.1762   -3.3295    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3446   -4.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1064   -4.4721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3757   -4.5498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9742   -3.9902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7826   -4.1560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3034   -3.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1377   -3.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8583   -3.9435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2703   -4.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 25  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 24  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 23 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 22 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 23 22  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "CCc1ccc(CCOc2ccc(cc2)CC3C(=O)NC(=O)S3)nc1",
          "formula": "C19H20N2O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "430c0e6b-4890-4f36-a6e1-f28ae95b50be"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "356.4405",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c9139ac3-199f-4659-abe7-e191d58d6340",
      "version": "37",
      "structure": {
        "id": "c6d4d48d-5979-4959-ab4c-7e8202b588f5",
        "molfile": "\n  Marvin  01132110172D          \n\n 26 27  0  0  0  0            999 V2000\n    0.3757   -4.5498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3446   -4.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9742   -3.9902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1762   -3.3295    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6503   -3.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8583   -3.9435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1064   -4.4721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7826   -4.1560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0675   -2.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0215   -3.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2703   -4.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8940   -2.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5574   -2.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5991   -3.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8583   -5.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6147   -4.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3111   -1.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3034   -3.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7856   -3.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1377   -1.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1377   -3.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0215   -5.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3787   -2.5314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2781   -6.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1020   -6.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4725   -3.9435    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  2  2  0  0  0  0\n  8  3  2  0  0  0  0\n  5  9  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11  6  2  0  0  0  0\n 12  9  1  0  0  0  0\n 13 20  1  0  0  0  0\n 14 19  1  0  0  0  0\n 15 22  2  0  0  0  0\n 16 10  2  0  0  0  0\n 17 12  1  0  0  0  0\n 18 12  2  0  0  0  0\n 19 23  1  0  0  0  0\n 20 17  2  0  0  0  0\n 21 18  1  0  0  0  0\n 22 16  1  0  0  0  0\n 23 13  1  0  0  0  0\n 24 15  1  0  0  0  0\n 25 24  1  0  0  0  0\n  5  4  1  0  0  0  0\n 21 13  2  0  0  0  0\n 15 11  1  0  0  0  0\nM  END",
        "smiles": "CCc1ccc(CCOc2ccc(cc2)CC3C(=O)NC(=O)S3)nc1.Cl",
        "formula": "C19H20N2O3S.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "392.9014",
        "optical_activity": "( + / - )",
        "references": [
          "7813d830-3e64-4aae-b52c-e14430c48544",
          "4daab2df-88b5-41f7-9413-a4b29754ee1e"
        ],
        "stereo_centers": 1
      },
      "unii": "JQT35NPK6C"
    }
  ]
}