{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "18d225f0-7ed2-4d4b-9747-4fdaf8d145e3",
          "code": "280576-94-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=280576-94-5",
          "code_system": "CAS",
          "references": [
            "37fcd59c-0e61-4fa5-b206-2a7656dd6a0c",
            "be2cda76-37a1-484a-831f-44c45cfbb4e6"
          ]
        },
        {
          "uuid": "5434a3dd-2c89-4531-a87e-c0341272dfb9",
          "code": "71587685",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587685",
          "code_system": "PUBCHEM",
          "references": [
            "37fcd59c-0e61-4fa5-b206-2a7656dd6a0c"
          ]
        },
        {
          "uuid": "94bc4ee2-7f60-af8f-c712-94c87307be68",
          "code": "DTXSID60182336",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60182336",
          "code_system": "EPA CompTox",
          "references": [
            "cf319ce3-18e8-0da5-42e0-0ffcebb6e5a5"
          ]
        },
        {
          "uuid": "1d915e2e-49e0-4e25-a8f6-9abfaf31bf26",
          "code": "JQA7VPQ358",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8b0f1999-e454-4ac5-814c-0f931ff6debe",
          "name": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, MONOPOTASSIUM SALT",
          "stdName": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, MONOPOTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f42e9896-23ad-49d0-8f04-627b654c02d0",
            "a48e4901-2537-4470-a7a8-5db070ca6072"
          ],
          "display_name": false
        },
        {
          "uuid": "210e928d-9076-4120-9980-0ee59125885f",
          "name": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, POTASSIUM SALT (1:1)",
          "stdName": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, POTASSIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f42e9896-23ad-49d0-8f04-627b654c02d0",
            "a48e4901-2537-4470-a7a8-5db070ca6072"
          ],
          "display_name": false
        },
        {
          "uuid": "817fcb1d-fa81-4003-87ea-9f8983f51f4f",
          "name": "POTASSIUM CAPRYLOYL GLUTAMATE",
          "stdName": "POTASSIUM CAPRYLOYL GLUTAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b7c7643-4523-497c-8db4-133accacaefa",
            "a48e4901-2537-4470-a7a8-5db070ca6072",
            "7763108c-03f2-4e3e-a530-3e2adc99bf0e",
            "b0337225-e730-43a2-a706-5bce4715f631"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8be20e9a-d2d7-48fd-83d4-268ca96f229b",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "7b7c7643-4523-497c-8db4-133accacaefa",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a48e4901-2537-4470-a7a8-5db070ca6072",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7763108c-03f2-4e3e-a530-3e2adc99bf0e",
          "citation": "pcpc-db",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f42e9896-23ad-49d0-8f04-627b654c02d0",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37fcd59c-0e61-4fa5-b206-2a7656dd6a0c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390920000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8df3ca66-ab3b-4d86-89c7-89fcff26037e",
          "citation": "SRS import [JQA7VPQ358]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JQA7VPQ358",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390920000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0337225-e730-43a2-a706-5bce4715f631",
          "citation": "POTASSIUM CAPRYLOYL GLUTAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cf319ce3-18e8-0da5-42e0-0ffcebb6e5a5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=280576-94-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "be2cda76-37a1-484a-831f-44c45cfbb4e6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "de8132b0-6828-43dd-87ff-7d55cf381da1",
          "id": "de8132b0-6828-43dd-87ff-7d55cf381da1",
          "molfile": "\n  Marvin  04262116132D          \n\n 19 18  0  0  1  0            999 V2000\n   10.2931   -8.2920    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.7170   -7.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7170   -7.2529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1327   -8.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5485   -7.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9683   -8.2503    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9683   -8.9265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4143   -9.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6649  -10.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1109  -10.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3617  -11.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8076  -12.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0583  -13.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5043  -13.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7591  -14.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6157   -9.3224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3965   -7.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3965   -7.2278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8373   -8.2503    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 17  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 16  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\nM  CHG  2   1  -1  19  -1\nM  END",
          "smiles": "CCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-]",
          "formula": "C13H21NO5",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "94eb1f85-d19f-4b1a-9738-886fb55e2f37"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "271.3101",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "52ed919a-f5d9-410e-80a5-8f9801f9ecd4",
          "id": "52ed919a-f5d9-410e-80a5-8f9801f9ecd4",
          "molfile": "\n  Marvin  04262116132D          \n\n  1  0  0  0  1  0            999 V2000\n   11.0109   -8.2920    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "86b7bf18-3884-4fa0-8fe7-3be9016f121d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a82a887e-dbcd-4357-bb19-8adf7382d97a",
          "id": "a82a887e-dbcd-4357-bb19-8adf7382d97a",
          "molfile": "\n  Marvin  04262116132D          \n\n  1  0  0  0  1  0            999 V2000\n   12.6698   -8.2944    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "64727a8e-7a87-431f-96b7-0849ace0bcbe"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d3f68a68-5539-47ee-9f1f-f3b231767dcb",
      "version": "4",
      "structure": {
        "id": "9c2babd7-35f8-4117-9a01-6a28bdfe9cda",
        "molfile": "\n  Marvin  01132108072D          \n\n 21 18  0  0  1  0            999 V2000\n   10.2931   -8.2920    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.7170   -7.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7170   -7.2529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1327   -8.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5485   -7.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9683   -8.2503    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9683   -8.9265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4143   -9.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6649  -10.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1109  -10.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3617  -11.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8076  -12.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0583  -13.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5043  -13.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7591  -14.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6157   -9.3224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3965   -7.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3965   -7.2278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8373   -8.2503    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.0109   -8.2920    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n   12.6698   -8.2944    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n  8 16  2  0  0  0  0\n  6 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\nM  CHG  4   1  -1  19  -1  20   1  21   1\nM  END",
        "smiles": "CCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[K+].[H+]",
        "formula": "C13H21NO5.K.H",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "311.4163",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8df3ca66-ab3b-4d86-89c7-89fcff26037e",
          "7763108c-03f2-4e3e-a530-3e2adc99bf0e"
        ],
        "stereo_centers": 1
      },
      "unii": "JQA7VPQ358"
    }
  ]
}