{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "24972ea8-25be-4ceb-b60d-f4f59d9fb215",
          "code": "JQ6BLH9FR7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b013a094-4f8a-4399-b154-6bdbcb3b2651",
          "code": "2237234-84-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2237234-84-1",
          "code_system": "CAS",
          "references": [
            "e08befed-e340-4410-6ff6-6176c41461e2"
          ]
        },
        {
          "uuid": "e9b06e60-eb2d-bfc1-2a7e-7b38d419adc2",
          "code": "235-428-9",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "435903dc-f69b-7432-6f7b-8e64b6af41d1"
          ]
        },
        {
          "uuid": "4d5bd90b-ac26-c5e7-2cc8-8848b0abbf19",
          "code": "1342-48-9",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1342-48-9",
          "code_system": "CAS",
          "references": [
            "435903dc-f69b-7432-6f7b-8e64b6af41d1",
            "3887030f-974c-4ec6-71e9-ae5347c20dee"
          ]
        },
        {
          "uuid": "06b19af0-7c97-2eab-8b7e-fc2107b22608",
          "code": "12227-69-9",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=12227-69-9",
          "code_system": "CAS",
          "references": [
            "bbf18d31-5d40-95b7-60ca-52893344e88e"
          ]
        },
        {
          "uuid": "9d4d9546-bbc1-2ff6-e24b-8def26193c70",
          "code": "12225-21-7",
          "type": "NO STRUCTURE GIVEN",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=12225-21-7",
          "code_system": "CAS",
          "references": [
            "7f7d5f4c-0e6f-76a3-4671-a879b99c979e",
            "a55ad23c-9bc2-6e17-993f-498954d14db5"
          ]
        },
        {
          "uuid": "307b7426-cfd0-2582-5d75-531277a248ce",
          "code": "DTXSID2025921",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2025921",
          "code_system": "EPA CompTox",
          "references": [
            "db563de5-69ce-16ef-a263-a06cf829914d"
          ]
        },
        {
          "uuid": "a718a1f6-b0f9-d22d-9241-a246992a2370",
          "code": "JQ6BLH9FR7",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=JQ6BLH9FR7",
          "code_system": "DAILYMED",
          "references": [
            "5d8c2c6c-4915-fe62-d843-11e95963bdf2"
          ]
        },
        {
          "uuid": "067b8f8f-aaba-6527-e0fe-c9fc187f507a",
          "code": "100000133933",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a0a4a1b8-5806-f180-fcaf-d18afbfcab31"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ae455238-9db6-42a2-b1cd-0414b64bd796",
          "amount": {
            "uuid": "1b319b3f-1751-42ea-b59d-2b1fe71fbf5b"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "e08befed-e340-4410-6ff6-6176c41461e2"
          ],
          "related_substance": {
            "uuid": "d8042126-e06f-4957-9157-1eaae7b2863c",
            "refuuid": "c24d5029-1403-4172-a681-29187ef51dbb",
            "name": "FD&C YELLOW NO. 5 FREE ACID",
            "unii": "6TP696149N",
            "linking_id": "6TP696149N",
            "ref_pname": "FD&C YELLOW NO. 5 FREE ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "837ee313-fc60-e5f6-415e-92c82eda0a2d",
          "name": "1H-PYRAZOLE-3-CARBOXYLIC ACID, 4,5-DIHYDRO-5-OXO-1-(4-SULFOPHENYL)-4-((4-SULFOPHENYL)AZO)-, ALUMINUM COMPLEX",
          "stdName": "1H-PYRAZOLE-3-CARBOXYLIC ACID, 4,5-DIHYDRO-5-OXO-1-(4-SULFOPHENYL)-4-((4-SULFOPHENYL)AZO)-, ALUMINUM COMPLEX",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3096543-6329-3379-025c-545119848d05",
            "e08befed-e340-4410-6ff6-6176c41461e2"
          ],
          "display_name": false
        },
        {
          "uuid": "467b7d82-649f-0880-0138-884fcb0813c2",
          "name": "ACID YELLOW 23 ALUMINUM LAKE",
          "stdName": "ACID YELLOW 23 ALUMINUM LAKE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "e3096543-6329-3379-025c-545119848d05",
            "6ff0f9a0-99ae-b9ee-f9c0-420f8c9fbc00",
            "0135cf31-ccbe-497d-fe7a-77c8411a152e"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "641eaeb4-6d80-6a50-cd17-22b17bcc5beb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "73cd287f-7ce9-4fef-89f5-0797261c2d66",
          "name": "ALUMINIUM 5-OXO-1-(4-SULFONATOPHENYL)-4-((E)-(4-SULFONATOPHENYL)DIAZENYL)-4,5-DIHYDRO-1H-PYRAZOLE-3-CARBOXYLATE",
          "stdName": "ALUMINIUM 5-OXO-1-(4-SULFONATOPHENYL)-4-((E)-(4-SULFONATOPHENYL)DIAZENYL)-4,5-DIHYDRO-1H-PYRAZOLE-3-CARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "556e16b5-facf-4a0b-b1b8-3075d28618d9"
          ],
          "display_name": false
        },
        {
          "uuid": "66183e04-f329-d8b5-1039-171d4fbed3a7",
          "name": "ALUMINUM, 4,5-DIHYDRO-5-OXO-1-(4-SULFOPHENYL)-4-((4-SULFOPHENYL)AZO)-1H-PYRAZOLE-3-CARBOXYLIC ACID COMPLEX",
          "stdName": "ALUMINUM, 4,5-DIHYDRO-5-OXO-1-(4-SULFOPHENYL)-4-((4-SULFOPHENYL)AZO)-1H-PYRAZOLE-3-CARBOXYLIC ACID COMPLEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3096543-6329-3379-025c-545119848d05",
            "6ff0f9a0-99ae-b9ee-f9c0-420f8c9fbc00"
          ],
          "display_name": false
        },
        {
          "uuid": "18a6b4b6-66ab-4014-866c-6f196da6c250",
          "name": "CI 19140:1",
          "stdName": "CI 19140:1",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3096543-6329-3379-025c-545119848d05",
            "6ff0f9a0-99ae-b9ee-f9c0-420f8c9fbc00"
          ],
          "display_name": false
        },
        {
          "uuid": "ed290401-cf68-e4fa-a945-9691403c7de9",
          "name": "D&C YELLOW NO. 5--ALUMINIUM LAKE",
          "stdName": "D&C YELLOW NO. 5--ALUMINIUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e919049-0b19-e6e9-2c9a-a3bd9c7a3310"
          ],
          "display_name": false
        },
        {
          "uuid": "43487572-48f3-bd0d-ab95-4d6d289e8e0e",
          "name": "D&C YELLOW NO. 5--ALUMINIUM LAKE (DELISTED)",
          "stdName": "D&C YELLOW NO. 5--ALUMINIUM LAKE (DELISTED)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e919049-0b19-e6e9-2c9a-a3bd9c7a3310"
          ],
          "display_name": false
        },
        {
          "uuid": "aba18ea7-2275-6184-c337-291e73653cb3",
          "name": "D&C YELLOW NO. 5-ALUMINUM LAKE",
          "stdName": "D&C YELLOW NO. 5-ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3bef1c1-74d0-c148-9e43-a4359842dfae"
          ],
          "display_name": false
        },
        {
          "uuid": "3b23d3f5-bf68-401c-ac20-832ca80c20c2",
          "name": "DYE FDC YELLOW NO. 5 ALUMINIUM LAKE",
          "stdName": "DYE FDC YELLOW NO. 5 ALUMINIUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20457bb6-e36a-48d3-b8a1-3e06c93331de"
          ],
          "display_name": false
        },
        {
          "uuid": "c35b1c7d-329b-4045-8d21-4e1010a3f56b",
          "name": "DYE YELLOW NO. 5 ALUMINIUM LAKE",
          "stdName": "DYE YELLOW NO. 5 ALUMINIUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20457bb6-e36a-48d3-b8a1-3e06c93331de"
          ],
          "display_name": false
        },
        {
          "uuid": "542e5beb-03f6-a9bf-edc4-9cf69d0cad1e",
          "name": "FD&C YELLOW NO. 5 ALUMINUM LAKE",
          "stdName": "FD&C YELLOW NO. 5 ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3bef1c1-74d0-c148-9e43-a4359842dfae"
          ],
          "display_name": true
        },
        {
          "uuid": "6bae809c-b23c-4c5a-8ec2-35876ab6692a",
          "name": "FD&C YELLOW NO. 5--ALUMINIUM LAKE",
          "stdName": "FD&C YELLOW NO. 5--ALUMINIUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7387a5a-08dd-494e-9b36-2b57b4155816"
          ],
          "display_name": false
        },
        {
          "uuid": "93344a10-eb92-49c9-9d85-6ab6c397a54b",
          "name": "FDC YELLOW NO. 5-ALUMINUM LAKE",
          "stdName": "FDC YELLOW NO. 5-ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f87dc0f-1afb-4b80-b6e3-607eca8d9145"
          ],
          "display_name": false
        },
        {
          "uuid": "8acf3a67-d12c-6d93-aee7-9fd829e6cbb2",
          "name": "FOOD YELLOW 4:1",
          "stdName": "FOOD YELLOW 4:1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3096543-6329-3379-025c-545119848d05",
            "6ff0f9a0-99ae-b9ee-f9c0-420f8c9fbc00"
          ],
          "display_name": false
        },
        {
          "uuid": "603b0367-ebc3-40f8-8458-a4c31cf0e300",
          "name": "FOOD YELLOW NO. 4 ALUMINUM LAKE",
          "stdName": "FOOD YELLOW NO. 4 ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "556e16b5-facf-4a0b-b1b8-3075d28618d9"
          ],
          "display_name": false
        },
        {
          "uuid": "c50922c6-bfcb-bd39-b583-b532171772d4",
          "name": "PIGMENT YELLOW 100",
          "stdName": "PIGMENT YELLOW 100",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3096543-6329-3379-025c-545119848d05",
            "6ff0f9a0-99ae-b9ee-f9c0-420f8c9fbc00"
          ],
          "display_name": false
        },
        {
          "uuid": "8035c9c9-1da4-b23b-b397-f6933bb2709a",
          "name": "TARTRAZINE ALUMINUM LAKE",
          "stdName": "TARTRAZINE ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3096543-6329-3379-025c-545119848d05",
            "6ff0f9a0-99ae-b9ee-f9c0-420f8c9fbc00"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cfa3f5de-d1d3-9327-af42-2d013e0da566",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "556e16b5-facf-4a0b-b1b8-3075d28618d9",
          "citation": "https://www.trc-canada.com/product-detail/?F754620",
          "url": "https://www.trc-canada.com/product-detail/?F754620",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6ff0f9a0-99ae-b9ee-f9c0-420f8c9fbc00",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e3096543-6329-3379-025c-545119848d05",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e08befed-e340-4410-6ff6-6176c41461e2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "435903dc-f69b-7432-6f7b-8e64b6af41d1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394604000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "170a0494-848d-3793-f57a-933bde537691",
          "citation": "SRS import [[ingredient] 0653383AA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=[ingredient] 0653383AA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394604000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0135cf31-ccbe-497d-fe7a-77c8411a152e",
          "citation": "ACID YELLOW 23 ALUMINUM LAKE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7b953689-9d8d-a3fd-8738-cbb174ecad09",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=12225-21-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bbf18d31-5d40-95b7-60ca-52893344e88e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3887030f-974c-4ec6-71e9-ae5347c20dee",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f5d91c31-04e8-c398-4769-49d38440eea8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "745af470-d3ad-48b5-9dff-5d75561cae99",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "77af1233-b4d0-2c91-2191-8c143fe17ab0",
          "citation": "21CFR82.705",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "298738ec-f563-293b-e085-fcb3a6bc82be",
          "citation": "CFR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6215374a-e9f8-bd5c-2ae9-98577b42ecd2",
          "citation": "CFR",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e919049-0b19-e6e9-2c9a-a3bd9c7a3310",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79e0e476-5d7f-05b0-8edd-9a73de3625e1",
          "citation": "SRS import [[ingredient] 0112505AA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=[ingredient] 0112505AA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394619000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab52627c-e2d3-72e2-a685-7a1eae09ca8c",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2684b366-49c4-ddd2-140a-d8814e971e33",
          "citation": "D&C YELLOW NO. 5--ALUMINUM LAKE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e3bef1c1-74d0-c148-9e43-a4359842dfae",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7f7d5f4c-0e6f-76a3-4671-a879b99c979e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394612000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec222d4a-4aa9-bbf5-527c-a82af8115164",
          "citation": "SRS import [[ingredient] 0520898AA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=[ingredient] 0520898AA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394612000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f597ab7f-1b0c-3899-2c63-5036a9307241",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0ac82b2-590d-93e3-75e9-ad41f492055e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68698-86-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a55ad23c-9bc2-6e17-993f-498954d14db5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7607579b-ba86-12e0-d0a2-53bd2b7fe0b1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "ac8b3920-889c-4a72-9291-048ea2160832",
          "citation": "FD&C YELLOW NO. 5--ALUMINUM LAKE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3bcf6bfd-5167-41a1-908c-ee81dea4d888",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb3c04a5-2408-48dc-915f-3779610d683d",
          "citation": "SRS import [[ingredient] 0054568AA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=[ingredient] 0054568AA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394628000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84498a71-3095-4f34-9d22-7d47e75a40a7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394628000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f87dc0f-1afb-4b80-b6e3-607eca8d9145",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20457bb6-e36a-48d3-b8a1-3e06c93331de",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7387a5a-08dd-494e-9b36-2b57b4155816",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96b619af-0b51-40ba-887b-55ece0536b0e",
          "citation": "21CFR74.1705",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c39d3b21-2746-40e4-be70-1de3d13a0418",
          "citation": "21CFR82.705",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d8c2c6c-4915-fe62-d843-11e95963bdf2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "db563de5-69ce-16ef-a263-a06cf829914d",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "a0a4a1b8-5806-f180-fcaf-d18afbfcab31",
          "citation": "EMA 2023",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5add2eda-fba8-4df0-80d7-1d2000b95772",
          "id": "5add2eda-fba8-4df0-80d7-1d2000b95772",
          "molfile": "\n  Marvin  11152109342D          \n\n 31 33  0  0  0  0            999 V2000\n    8.6207   -6.5103    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1840   -4.4410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2829   -5.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0956   -5.8455    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.1251   -7.1544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9560   -7.0018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1587   -5.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0408   -6.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5632   -4.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6770   -5.7757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7873   -4.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1866   -3.6029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8230   -3.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6454   -3.2176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7480   -2.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0490   -2.5192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4851   -1.9062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3417   -2.5192    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0263   -1.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5192   -2.5192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8716   -2.5192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3417   -3.3418    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   16.3417   -1.7043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1720   -2.5192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0263   -1.0034    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.9740   -4.0064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3047   -2.2553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1157   -1.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1157   -3.2176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2931   -1.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2725   -3.2176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  2  0  0  0  0\n 12  2  2  0  0  0  0\n  9  2  1  0  0  0  0\n  3  8  1  0  0  0  0\n  3  7  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 26 14  1  0  0  0  0\n 17 15  2  0  0  0  0\n 19 15  1  0  0  0  0\n 21 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 20  1  0  0  0  0\n 22 18  1  0  0  0  0\n 23 18  2  0  0  0  0\n 24 18  2  0  0  0  0\n 25 19  1  0  0  0  0\n 27 19  2  0  0  0  0\n 20 29  2  0  0  0  0\n 20 28  1  0  0  0  0\n 30 21  1  0  0  0  0\n 31 21  2  0  0  0  0\n 28 30  2  0  0  0  0\n 29 31  1  0  0  0  0\nM  CHG  3   4  -1  22  -1  25  -1\nM  END",
          "smiles": "c1cc(ccc1/N=N/c2c(C(=O)[O-])nn(-c3ccc(cc3)S(=O)(=O)[O-])c2O)S(=O)(=O)[O-]",
          "formula": "C16H9N4O9S2",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d223686a-f1f4-42cc-a657-30c17579419f"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "465.3969",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "4664e987-a993-4e4e-afe8-0848d6d6fd8a",
          "id": "4664e987-a993-4e4e-afe8-0848d6d6fd8a",
          "molfile": "\n  Marvin  11152109342D          \n\n  1  0  0  0  0  0            999 V2000\n   14.7998   -5.6498    0.0000 Al  0  1  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   3\nM  END",
          "smiles": "[Al+3]",
          "formula": "Al",
          "atropisomerism": "No",
          "charge": 3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6b522a0f-f8e6-4fdc-ada8-140a09dd70c9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "26.9815",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fcaed05c-958a-494e-b893-45d189a7cace",
      "version": "28",
      "structure": {
        "id": "e82e8ee9-188a-439f-bcc9-e31c4a6b4e7b",
        "molfile": "\n   JSDraw211152109342D\n\n 32 33  0  0  0  0              0 V2000\n   16.2654  -12.2836    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1018   -8.3793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5148  -11.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2747  -11.0293    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   17.2171  -13.4988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0112  -13.2109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2805   -9.7554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9448  -11.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9306   -9.3700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.1453  -10.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4665   -8.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1067   -6.7980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3074   -5.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8592   -6.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1659   -4.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6207   -4.7532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5568   -3.5965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   30.8334   -4.7532    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8043   -3.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2814   -4.7532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1727   -4.7532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.8334   -6.3052    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   30.8334   -3.2157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   32.4000   -4.7532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8043   -1.8932    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   24.4792   -7.5593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4427   -4.2553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5201   -3.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5201   -6.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.9681   -3.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.9291   -6.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9240  -10.6600    0.0000 Al  0  1  0  0  0  0  0  0  0  0  0  0\n 11  9  2  0  0  0  0\n  3  8  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  7  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8 10  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 20  1  0  0  0  0\n 12 13  1  0  0  0  0\n 19 15  1  0  0  0  0\n 20 29  2  0  0  0  0\n 21 16  1  0  0  0  0\n 22 18  1  0  0  0  0\n 23 18  2  0  0  0  0\n 24 18  2  0  0  0  0\n 25 19  1  0  0  0  0\n 26 14  1  0  0  0  0\n 27 19  2  0  0  0  0\n 28 30  2  0  0  0  0\n 29 31  1  0  0  0  0\n 30 21  1  0  0  0  0\n 31 21  2  0  0  0  0\n 16 17  1  0  0  0  0\n 20 28  1  0  0  0  0\n 12  2  2  0  0  0  0\n  9  2  1  0  0  0  0\n 10  9  1  0  0  0  0\nM  CHG  4   4  -1  22  -1  25  -1  32   3\nM  END",
        "smiles": "c1cc(ccc1/N=N/c2c(C(=O)[O-])nn(-c3ccc(cc3)S(=O)(=O)[O-])c2O)S(=O)(=O)[O-].[Al+3]",
        "formula": "C16H9N4O9S2.Al",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "492.3784",
        "optical_activity": "NONE",
        "references": [
          "556e16b5-facf-4a0b-b1b8-3075d28618d9",
          "e08befed-e340-4410-6ff6-6176c41461e2",
          "e3096543-6329-3379-025c-545119848d05"
        ],
        "stereo_centers": 0
      },
      "unii": "JQ6BLH9FR7"
    }
  ]
}