{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5612fe8a-d366-4032-b3b5-3863312406f2",
          "code": "162881-26-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=162881-26-7",
          "code_system": "CAS",
          "references": [
            "510a458c-770c-433f-85df-f13ebe235428",
            "332c3b29-e7e5-47b0-a596-df3f06fcc179"
          ]
        },
        {
          "uuid": "ff8a1d35-cd5b-469a-8eec-feca21ead1fe",
          "code": "164512",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/164512",
          "code_system": "PUBCHEM",
          "references": [
            "510a458c-770c-433f-85df-f13ebe235428"
          ]
        },
        {
          "uuid": "fae93414-4b42-43f0-c5ce-e9b4d54f138a",
          "code": "DTXSID8044597",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8044597",
          "code_system": "EPA CompTox",
          "references": [
            "15725693-de37-545e-c8a2-850c47ea0cae"
          ]
        },
        {
          "uuid": "f3411041-a9cf-4549-a774-e5dde64323ae",
          "code": "JOV61FMS35",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c72d5ab7-d85c-4098-9d01-cb10e55eb05c",
          "name": "(PHENYLPHOSPHORYL)BIS((2,4,6-TRIMETHYLPHENYL)METHANONE)",
          "stdName": "(PHENYLPHOSPHORYL)BIS((2,4,6-TRIMETHYLPHENYL)METHANONE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93879f55-7b7f-4e86-a24c-e775a6adc8da",
            "9bcc4fc5-705c-4afe-ae29-b1d5890310a2"
          ],
          "display_name": false
        },
        {
          "uuid": "7911083d-15ac-451b-86d9-62cc1ffcf10d",
          "name": "BIS(2,4,6-TRIMETHYLBENZOYL)PHENYLPHOSPHINE OXIDE",
          "stdName": "BIS(2,4,6-TRIMETHYLBENZOYL)PHENYLPHOSPHINE OXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f67428be-f782-4e27-a14e-476a7bf1118b",
            "9bcc4fc5-705c-4afe-ae29-b1d5890310a2"
          ],
          "display_name": false
        },
        {
          "uuid": "1c1d7f4f-defc-4201-b683-ec85516b658d",
          "name": "BIS-TRIMETHYLBENZOYL PHENYLPHOSPHINE OXIDE",
          "stdName": "BIS-TRIMETHYLBENZOYL PHENYLPHOSPHINE OXIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bcc4fc5-705c-4afe-ae29-b1d5890310a2",
            "4fee0ef3-4680-4b19-ac73-070f5650764c",
            "2d9252df-f049-41ff-8105-fdad25a72c58"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e1c9d068-362c-462b-a60e-9f0596ed5a40",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ea757b4c-e1b5-47ee-9ebc-ef36d73dff63",
          "name": "IRGACURE 801",
          "stdName": "IRGACURE 801",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f67428be-f782-4e27-a14e-476a7bf1118b",
            "9bcc4fc5-705c-4afe-ae29-b1d5890310a2"
          ],
          "display_name": false
        },
        {
          "uuid": "cbbe09de-5f96-4dd3-99fb-d221a9e89588",
          "name": "METHANONE, 1,1'-(PHENYLPHOSPHINYLIDENE)BIS(1-(2,4,6-TRIMETHYLPHENYL)-",
          "stdName": "METHANONE, 1,1'-(PHENYLPHOSPHINYLIDENE)BIS(1-(2,4,6-TRIMETHYLPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b030cb9-59ed-4ebe-8684-af977099f7d5",
            "9bcc4fc5-705c-4afe-ae29-b1d5890310a2"
          ],
          "display_name": false
        },
        {
          "uuid": "c30894ef-2cfe-4685-9eeb-d25fd1c40e2e",
          "name": "PHENYLBIS(2,4,6-TRIMETHYLBENZOYL)PHOSPHINE OXIDE",
          "stdName": "PHENYLBIS(2,4,6-TRIMETHYLBENZOYL)PHOSPHINE OXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f67428be-f782-4e27-a14e-476a7bf1118b",
            "9bcc4fc5-705c-4afe-ae29-b1d5890310a2"
          ],
          "display_name": false
        },
        {
          "uuid": "9599c565-afa7-45e9-a8f5-f893afd04112",
          "name": "PHOSPHINE OXIDE, PHENYLBIS(2,4,6-TRIMETHYLBENZOYL)-",
          "stdName": "PHOSPHINE OXIDE, PHENYLBIS(2,4,6-TRIMETHYLBENZOYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f67428be-f782-4e27-a14e-476a7bf1118b",
            "9bcc4fc5-705c-4afe-ae29-b1d5890310a2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f67428be-f782-4e27-a14e-476a7bf1118b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9bcc4fc5-705c-4afe-ae29-b1d5890310a2",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fee0ef3-4680-4b19-ac73-070f5650764c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b030cb9-59ed-4ebe-8684-af977099f7d5",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93879f55-7b7f-4e86-a24c-e775a6adc8da",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "510a458c-770c-433f-85df-f13ebe235428",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391290000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00d5e4e9-3357-48bf-8958-ea6757eb3951",
          "citation": "SRS import [JOV61FMS35]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JOV61FMS35",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391290000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c389120-fae8-47a4-9678-bc64770addf9",
          "citation": "CHEMID RECORD 162881-26-7",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d9252df-f049-41ff-8105-fdad25a72c58",
          "citation": "BIS-TRIMETHYLBENZOYL PHENYLPHOSPHINE OXIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15725693-de37-545e-c8a2-850c47ea0cae",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=162881-26-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "332c3b29-e7e5-47b0-a596-df3f06fcc179",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7cd9bab0-f8a8-4d30-ba15-2fa0d138173d",
          "id": "7cd9bab0-f8a8-4d30-ba15-2fa0d138173d",
          "molfile": "\n  Marvin  01132106292D          \n\n 30 32  0  0  0  0            999 V2000\n    2.4733   -3.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2995   -3.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7170   -2.9220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5388   -2.9220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9475   -2.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9475   -3.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0260   -3.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3729   -2.8868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5430   -4.2581    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2151   -4.7559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1298   -3.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8856   -2.8784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9115   -3.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3703   -3.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0319   -2.2771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1745   -3.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5086   -3.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3261   -3.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0123   -4.5530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1905   -4.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7029   -5.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6561   -5.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0189   -6.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5593   -6.9322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7389   -6.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3674   -6.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8357   -5.4522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5388   -4.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8562   -4.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7170   -4.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 30  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 28  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n  9 22  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 20  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  2  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 27  2  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(C)c(c(C)c1)C(=O)P(=O)(c2ccccc2)C(=O)c3c(C)cc(C)cc3C",
          "formula": "C26H27O3P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8f53f477-49e0-4062-aac9-426d5d4e9fce"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "418.4655",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e5dc15bd-3a50-4a39-bb4f-2b85b06bc886",
      "version": "6",
      "structure": {
        "id": "5ae1fcd2-7730-4810-bc31-e1027de3d269",
        "molfile": "\n  Marvin  01132104432D          \n\n 30 32  0  0  0  0            999 V2000\n    6.5430   -4.2581    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0260   -3.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9475   -3.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5388   -4.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7170   -4.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2995   -3.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7170   -2.9220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5388   -2.9220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3729   -2.8868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9475   -2.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4733   -3.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8562   -4.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1298   -3.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9115   -3.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1905   -4.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0123   -4.5530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5086   -3.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1745   -3.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3703   -3.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8856   -2.8784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0319   -2.2771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3261   -3.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7029   -5.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6561   -5.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0189   -6.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5593   -6.9322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7389   -6.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3674   -6.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8357   -5.4522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2151   -4.7559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  3  8  2  0  0  0  0\n  2  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n  4 12  1  0  0  0  0\n  1  2  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 14 19  2  0  0  0  0\n 13 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 17 22  1  0  0  0  0\n 15 23  1  0  0  0  0\n  1 13  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 24 29  2  0  0  0  0\n  1 24  1  0  0  0  0\n  1 30  2  0  0  0  0\nM  END",
        "smiles": "Cc1cc(C)c(c(C)c1)C(=O)P(=O)(c2ccccc2)C(=O)c3c(C)cc(C)cc3C",
        "formula": "C26H27O3P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "418.4655",
        "optical_activity": "NONE",
        "references": [
          "3c389120-fae8-47a4-9678-bc64770addf9",
          "00d5e4e9-3357-48bf-8958-ea6757eb3951"
        ],
        "stereo_centers": 0
      },
      "unii": "JOV61FMS35"
    }
  ]
}