{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d26cb4ed-5396-4e44-b776-d9ed3c5dac45", "code": "533926-00-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=533926-00-0", "code_system": "CAS", "references": [ "e563fd05-82fa-4295-b449-0801892698ed", "ae3afafd-74b3-4f77-9483-5734fc7db654" ] }, { "uuid": "97027629-0b2c-44f2-bd3f-a85b12ca1df6", "code": "71587761", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587761", "code_system": "PUBCHEM", "references": [ "e563fd05-82fa-4295-b449-0801892698ed" ] }, { "uuid": "821070b0-8ee7-4994-bbd2-8ede49b667db", "code": "JNU1I7ZKZ8", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "fe96a67c-edde-4c56-a7bf-44074f7a9c80", "name": "(±)-DITRIMETHYLOLPROPANE TRIETHYLHEXANOATE", "stdName": "(+/-)-DITRIMETHYLOLPROPANE TRIETHYLHEXANOATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "391bd436-df39-4e78-8288-9783bc84bfd9", "3d65867b-2428-431c-b365-62a03ec3d577" ], "display_name": false }, { "uuid": "6cbb41b0-96c1-494c-bec5-af149784d80d", "name": "DITRIMETHYLOLPROPANE TRIETHYLHEXANOATE", "stdName": "DITRIMETHYLOLPROPANE TRIETHYLHEXANOATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "62693e33-ca09-4a6d-b34c-cae550111df1", "391bd436-df39-4e78-8288-9783bc84bfd9", "ba7716f4-bbd2-40e4-8105-2c31541201d6" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "6b1d8db7-fb04-42cd-8d91-0c480ed7302d", "name_org": "INCI" } ] }, { "uuid": "bc0888af-45d4-40bb-818d-d4220cf43b00", "name": "DITRIMETHYLOLPROPANE TRIETHYLHEXANOATE, (±)-", "stdName": "DITRIMETHYLOLPROPANE TRIETHYLHEXANOATE, (+/-)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "391bd436-df39-4e78-8288-9783bc84bfd9", "3d65867b-2428-431c-b365-62a03ec3d577" ], "display_name": false }, { "uuid": "da046205-12a4-4970-817c-1d9c43b8863a", "name": "HEXANOIC ACID, 2-ETHYL-, 2-ETHYL-2-((2-(((2-ETHYL-1-OXOHEXYL)OXY)METHYL)-2-(HYDROXYMETHYL)BUTOXY)METHYL)-1,3-PROPANEDIYL ESTER", "stdName": "HEXANOIC ACID, 2-ETHYL-, 2-ETHYL-2-((2-(((2-ETHYL-1-OXOHEXYL)OXY)METHYL)-2-(HYDROXYMETHYL)BUTOXY)METHYL)-1,3-PROPANEDIYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e75aab6e-db0e-4296-b1cc-3e09d2858aaf", "391bd436-df39-4e78-8288-9783bc84bfd9" ], "display_name": false }, { "uuid": "871d57ed-6415-40e7-ba48-6723757b979c", "name": "SALACOS DT-38", "stdName": "SALACOS DT-38", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "391bd436-df39-4e78-8288-9783bc84bfd9", "ba7716f4-bbd2-40e4-8105-2c31541201d6" ], "display_name": false } ], "references": [ { "uuid": "ba7716f4-bbd2-40e4-8105-2c31541201d6", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "391bd436-df39-4e78-8288-9783bc84bfd9", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3d65867b-2428-431c-b365-62a03ec3d577", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e75aab6e-db0e-4296-b1cc-3e09d2858aaf", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e563fd05-82fa-4295-b449-0801892698ed", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391626000, "tags": [ "NOMEN" ] }, { "uuid": "2f24a055-74af-450f-a40f-4ee29fe2349d", "citation": "SRS import [JNU1I7ZKZ8]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JNU1I7ZKZ8", "doc_type": "SRS", "public_domain": true, "document_date": 1493391626000, "tags": [ "NOMEN" ] }, { "uuid": "62693e33-ca09-4a6d-b34c-cae550111df1", "citation": "DITRIMETHYLOLPROPANE TRIETHYLHEXANOATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ae3afafd-74b3-4f77-9483-5734fc7db654", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "8000475e-825a-420f-ae9b-24881f4a354b", "id": "8000475e-825a-420f-ae9b-24881f4a354b", "molfile": "\n Marvin 01132106392D \n\n 44 43 0 0 0 0 999 V2000\n 13.8761 -8.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1617 -8.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1617 -7.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4472 -7.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4472 -6.3606 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 13.1617 -5.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1617 -5.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7327 -5.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7327 -5.1231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0182 -6.3606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0182 -7.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3038 -7.5981 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 9.5893 -8.0106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5893 -8.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7163 -8.3126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5413 -8.3126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8913 -6.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0663 -6.8836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6538 -6.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8288 -6.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8288 -5.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5432 -4.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8288 -6.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1143 -7.4066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3998 -6.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3998 -6.1692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6854 -7.4067 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.6854 -8.2317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3998 -8.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9709 -6.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2565 -7.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5420 -6.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8275 -7.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0038 -6.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5913 -5.4547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0038 -4.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8288 -4.7402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5913 -4.0257 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.7663 -4.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3538 -4.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0037 -3.3113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5913 -2.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0037 -1.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5913 -1.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 8 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 15 1 0 0 0 0\n 17 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 23 1 0 0 0 0\n 20 34 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 2 0 0 0 0\n 27 25 1 0 0 0 0\n 27 28 1 0 0 0 0\n 30 27 1 0 0 0 0\n 28 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 35 1 0 0 0 0\n 36 37 2 0 0 0 0\n 38 36 1 0 0 0 0\n 38 39 1 0 0 0 0\n 41 38 1 0 0 0 0\n 39 40 1 0 0 0 0\n 42 41 1 0 0 0 0\n 43 42 1 0 0 0 0\n 44 43 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)C(=O)OCC(CC)(CO)COCC(CC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC", "formula": "C36H68O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "140c369f-3dd8-449e-907f-8657bed00484" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "628.9217", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "bb78c879-4752-4130-a910-0f88239c3293", "version": "3", "structure": { "id": "06b5bf7d-a0ba-4410-a39e-c3d875b0936c", "molfile": "\n Marvin 01132100382D \n\n 44 43 0 0 0 0 999 V2000\n 9.0663 -6.8836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8913 -6.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3038 -7.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7163 -8.3126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5413 -8.3126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0182 -7.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0182 -6.3606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7327 -5.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4472 -6.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4472 -7.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1617 -7.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1617 -8.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8761 -8.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1617 -5.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1617 -5.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7327 -5.1231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5893 -8.0106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5893 -8.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6538 -6.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8288 -6.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8288 -6.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1143 -7.4066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3998 -6.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6854 -7.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9709 -6.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2565 -7.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5420 -6.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8275 -7.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6854 -8.2317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3998 -8.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3998 -6.1692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0038 -6.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5913 -5.4547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0038 -4.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5913 -4.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0037 -3.3113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5913 -2.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0037 -1.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5913 -1.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7663 -4.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3538 -4.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8288 -4.7402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8288 -5.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5432 -4.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 9 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 8 16 2 0 0 0 0\n 3 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 1 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 24 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 23 31 2 0 0 0 0\n 20 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 35 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 34 42 2 0 0 0 0\n 20 43 1 0 0 0 0\n 43 44 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)C(=O)OCC(CC)(CO)COCC(CC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC", "formula": "C36H68O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "628.9217", "optical_activity": "UNSPECIFIED", "references": [ "e75aab6e-db0e-4296-b1cc-3e09d2858aaf", "2f24a055-74af-450f-a40f-4ee29fe2349d" ], "stereo_centers": 4 }, "unii": "JNU1I7ZKZ8" } ] }