{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ee8996d1-3ae4-47da-8b88-27288e86bbcd",
          "code": "2797-51-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2797-51-5",
          "code_system": "CAS",
          "references": [
            "34a792a9-aa37-4a71-8368-f47ab32ccb35",
            "21e45f28-c980-4cae-a3ee-00be70b4f5fc"
          ]
        },
        {
          "uuid": "119399c1-b089-4cac-84f8-a1e01268accf",
          "code": "C433215",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67433215",
          "code_system": "MESH",
          "references": [
            "34a792a9-aa37-4a71-8368-f47ab32ccb35"
          ]
        },
        {
          "uuid": "1e2d0705-44b5-40af-b84b-de276bec1c61",
          "code": "m9454",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9454?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "34a792a9-aa37-4a71-8368-f47ab32ccb35"
          ]
        },
        {
          "uuid": "2be9db76-d034-44be-afb6-5f727d6cf101",
          "code": "220-529-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.663",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "34a792a9-aa37-4a71-8368-f47ab32ccb35"
          ]
        },
        {
          "uuid": "1de33d8d-3a39-4dc7-a6fd-373ac6a24b8a",
          "code": "17748",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17748",
          "code_system": "PUBCHEM",
          "references": [
            "34a792a9-aa37-4a71-8368-f47ab32ccb35"
          ]
        },
        {
          "uuid": "0b40cb73-59bf-fc97-34b9-d2a9c7f0576d",
          "code": "DTXSID1041390",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1041390",
          "code_system": "EPA CompTox",
          "references": [
            "3987e58e-f890-7c1e-dfac-0a473c4323df"
          ]
        },
        {
          "uuid": "e2bf6440-0309-471e-a9a1-55567934f06b",
          "code": "JN6NK7K14F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "030f8ab2-3ffb-f6bf-6b6a-bf7eb47a1c13",
          "code": "3910",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3910",
          "code_system": "NSC",
          "references": [
            "f3f2d2b3-11ff-c58b-9b1a-79f200e4b55f"
          ]
        },
        {
          "uuid": "52de8940-d7ab-2658-1d27-1ca019d17b15",
          "code": "quinoclamine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/quinoclamine.html",
          "code_system": "ALANWOOD",
          "references": [
            "74920cd8-fc50-9879-b217-a5f103d4f744"
          ]
        },
        {
          "uuid": "9ddc2eac-9dec-0f05-0df0-6155004af59a",
          "code": "642009",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=642009",
          "code_system": "NSC",
          "references": [
            "f3f2d2b3-11ff-c58b-9b1a-79f200e4b55f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4ed2728d-26c7-46f8-a2fb-8af3173d528a",
          "name": "2-AMINO-3-CHLORO-1,4-NAPHTHALENEDIONE",
          "stdName": "2-AMINO-3-CHLORO-1,4-NAPHTHALENEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "440c847b-80b5-4d76-bf86-12a4b72f3a34",
            "70703cdc-318d-4509-9dd9-bcf9dcea8ad4"
          ],
          "display_name": false
        },
        {
          "uuid": "38dd70d7-fc93-4a11-9f6c-96c0fffd7d90",
          "name": "2-AMINO-3-CHLORO-1,4-NAPHTHOQUINONE",
          "stdName": "2-AMINO-3-CHLORO-1,4-NAPHTHOQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "440c847b-80b5-4d76-bf86-12a4b72f3a34",
            "70703cdc-318d-4509-9dd9-bcf9dcea8ad4"
          ],
          "display_name": false
        },
        {
          "uuid": "1b6cae41-c45a-4ffb-850d-179f274be2ea",
          "name": "NSC-3910",
          "stdName": "NSC-3910",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "440c847b-80b5-4d76-bf86-12a4b72f3a34",
            "b2fbf708-a84a-44ec-98f8-2f2fff41128d"
          ],
          "display_name": false
        },
        {
          "uuid": "d7945549-2292-4104-92e1-c55722810dcc",
          "name": "NSC-642009",
          "stdName": "NSC-642009",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "440c847b-80b5-4d76-bf86-12a4b72f3a34",
            "b2fbf708-a84a-44ec-98f8-2f2fff41128d"
          ],
          "display_name": false
        },
        {
          "uuid": "f702d1e4-eaaa-4e6e-a2dc-b262d977b82b",
          "name": "QUINOCLAMINE",
          "stdName": "QUINOCLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "440c847b-80b5-4d76-bf86-12a4b72f3a34",
            "4d529088-7d27-4f8a-9fa2-b949af862f84",
            "1a8ae938-a9e4-4bdb-bad2-edc19f45bc9d",
            "5c7e9cb7-068c-4549-8405-ad31c1bbb01f",
            "b083cbbb-75ab-488d-8204-5cdcf2839af2",
            "f33fa607-301e-420e-8622-79d52ec0b1da"
          ],
          "display_name": true
        },
        {
          "uuid": "5d244481-0e24-4a1b-ab17-6f464869e160",
          "name": "QUINOCLAMINE [ISO]",
          "stdName": "QUINOCLAMINE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "440c847b-80b5-4d76-bf86-12a4b72f3a34",
            "b083cbbb-75ab-488d-8204-5cdcf2839af2"
          ],
          "display_name": false
        },
        {
          "uuid": "af77bc8e-5c59-462d-94ec-f91e08f76c09",
          "name": "QUINOCLAMINE [MI]",
          "stdName": "QUINOCLAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "440c847b-80b5-4d76-bf86-12a4b72f3a34",
            "1a8ae938-a9e4-4bdb-bad2-edc19f45bc9d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5c7e9cb7-068c-4549-8405-ad31c1bbb01f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "70703cdc-318d-4509-9dd9-bcf9dcea8ad4",
          "citation": "http://www.alanwood.net/pesticides/index_cn_frame.html",
          "url": "http://www.alanwood.net/pesticides/index_cn_frame.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "440c847b-80b5-4d76-bf86-12a4b72f3a34",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b083cbbb-75ab-488d-8204-5cdcf2839af2",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a8ae938-a9e4-4bdb-bad2-edc19f45bc9d",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2fbf708-a84a-44ec-98f8-2f2fff41128d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34a792a9-aa37-4a71-8368-f47ab32ccb35",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a94283d8-1edd-43e5-a1b3-a8c2bff646b9",
          "citation": "SRS import [JN6NK7K14F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JN6NK7K14F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dbcd39c-2895-4197-97ba-2ffa5db12901",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d529088-7d27-4f8a-9fa2-b949af862f84",
          "citation": "QUINOCLAMINE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f33fa607-301e-420e-8622-79d52ec0b1da",
          "citation": "QUINOCLAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3987e58e-f890-7c1e-dfac-0a473c4323df",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2797-51-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "74920cd8-fc50-9879-b217-a5f103d4f744",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "21e45f28-c980-4cae-a3ee-00be70b4f5fc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f3f2d2b3-11ff-c58b-9b1a-79f200e4b55f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "db936ebf-0195-483e-b8a5-3558a75387e8",
          "id": "db936ebf-0195-483e-b8a5-3558a75387e8",
          "molfile": "\n  Marvin  01132111232D          \n\n 14 15  0  0  0  0            999 V2000\n    8.4835   -4.3256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7656   -4.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7656   -5.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5105   -6.0230    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.0644   -6.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0644   -6.8388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3489   -5.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6357   -6.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9300   -5.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9300   -4.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6357   -4.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3489   -4.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0644   -4.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0644   -3.5197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n 13  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(=O)C(=C(C2=O)N)Cl",
          "formula": "C10H6ClNO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "539f63e4-f0e8-40b0-9837-9641423227a4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "207.6135",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d253f9f5-14cf-45f7-9f4e-9ec7748f33c5",
      "version": "6",
      "structure": {
        "id": "c6b2e716-1988-480f-80b5-8cb9b3875ae9",
        "molfile": "\n  Marvin  01132110162D          \n\n 14 15  0  0  0  0            999 V2000\n    6.3489   -4.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3489   -5.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0644   -6.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7656   -5.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5105   -6.0230    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.7656   -4.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0644   -4.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0644   -3.5197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4835   -4.3256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0644   -6.8388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6357   -6.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9300   -5.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9300   -4.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6357   -4.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  6  9  1  0  0  0  0\n  3 10  2  0  0  0  0\n  2 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n  1 14  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(=O)C(=C(C2=O)N)Cl",
        "formula": "C10H6ClNO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "207.6135",
        "optical_activity": "NONE",
        "references": [
          "3dbcd39c-2895-4197-97ba-2ffa5db12901",
          "a94283d8-1edd-43e5-a1b3-a8c2bff646b9"
        ],
        "stereo_centers": 0
      },
      "unii": "JN6NK7K14F"
    }
  ]
}