{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8e261704-caa3-4ae2-807b-631f137d01ff",
          "code": "74222-97-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=74222-97-2",
          "code_system": "CAS",
          "references": [
            "630935ec-4053-4c06-853e-daaf0fede9be",
            "322eda8a-dae5-456c-8378-40ac4fd66dda"
          ]
        },
        {
          "uuid": "6083eb0f-c8de-48aa-9328-2a27b4245f82",
          "code": "277-780-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.688",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "630935ec-4053-4c06-853e-daaf0fede9be"
          ]
        },
        {
          "uuid": "6b463539-2ea7-4334-b62b-68793793cc79",
          "code": "m10357",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10357?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "630935ec-4053-4c06-853e-daaf0fede9be"
          ]
        },
        {
          "uuid": "00d0e7b4-da39-4429-9397-6dc8fbe92b8d",
          "code": "52997",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/52997",
          "code_system": "PUBCHEM",
          "references": [
            "630935ec-4053-4c06-853e-daaf0fede9be"
          ]
        },
        {
          "uuid": "54fdfefb-13e6-8dc8-d52c-97f8e0535063",
          "code": "7732",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7732",
          "code_system": "HSDB",
          "references": [
            "550b82e4-6398-1cc4-93ea-c525a47d7353"
          ]
        },
        {
          "uuid": "07f2671a-94ac-45ed-29af-1ff5c250f298",
          "code": "DTXSID0034936",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0034936",
          "code_system": "EPA CompTox",
          "references": [
            "9e5b4e21-c3b1-1c25-e680-832fe6f25deb"
          ]
        },
        {
          "uuid": "d1f92e38-6be5-f04f-bde2-11510e424769",
          "code": "9348",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9348",
          "code_system": "CHEBI",
          "references": [
            "bdcf6e05-2953-4990-a31a-3ead3e3bf0c2"
          ]
        },
        {
          "uuid": "5df9ae2b-f77f-3cb0-f679-74cad71d7c41",
          "code": "Sulfometuron methyl",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sulfometuron_methyl",
          "code_system": "WIKIPEDIA",
          "references": [
            "c97c75a9-3b01-1154-8c76-5985fd24a96a"
          ]
        },
        {
          "uuid": "71626a94-7980-4e15-a5d2-016a208c7bd9",
          "code": "JLY5D60J1A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2ac4850d-4995-c08e-db31-5163824a0988",
          "code": "sulfometuron-methyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/sulfometuron-methyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "158d1d7b-4ecc-e592-1c9a-c12f35088f75"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d9ad9c46-9454-46ce-9c40-87f4f46506b5",
          "name": "2-(3-(4,6-DIMETHYLPYRIMIDIN-2-YL)UREIDOSULFONYL)BENZOIC ACID METHYL ESTER",
          "stdName": "2-(3-(4,6-DIMETHYLPYRIMIDIN-2-YL)UREIDOSULFONYL)BENZOIC ACID METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "514961fc-13d2-423f-97a9-27204027ef60",
            "d8249ec9-1bea-4a6f-b42c-a3d62fba6c8b"
          ],
          "display_name": false
        },
        {
          "uuid": "e34a13c0-e7ed-4cda-a27a-6199fc2191ee",
          "name": "DPX-5648",
          "stdName": "DPX-5648",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "514961fc-13d2-423f-97a9-27204027ef60",
            "d8249ec9-1bea-4a6f-b42c-a3d62fba6c8b"
          ],
          "display_name": false
        },
        {
          "uuid": "6849d41a-3050-459c-8951-2054d5b12eed",
          "name": "OUST",
          "stdName": "OUST",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "514961fc-13d2-423f-97a9-27204027ef60",
            "d8249ec9-1bea-4a6f-b42c-a3d62fba6c8b"
          ],
          "display_name": false
        },
        {
          "uuid": "693c8373-8b19-4f71-8815-bdbf023431a0",
          "name": "SULFOMETURON METHYL ESTER",
          "stdName": "SULFOMETURON METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b426f1fc-7179-480f-8925-612fad8c0481",
            "d8249ec9-1bea-4a6f-b42c-a3d62fba6c8b"
          ],
          "display_name": false
        },
        {
          "uuid": "da47e5d9-b83f-42cf-a4c9-bb4456ef3be7",
          "name": "SULFOMETURON-METHYL",
          "stdName": "SULFOMETURON-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2fee303-9b7a-416e-86c7-bac8df7d6ef6",
            "5447a2ea-8fc3-4b20-a959-4ba26498f455",
            "d8249ec9-1bea-4a6f-b42c-a3d62fba6c8b",
            "5cf2d5f3-b241-4fb1-bf10-de8d0fac01e2",
            "9dc9d51e-3f20-462c-a652-1ed839e21a7f",
            "78ba2212-45bf-42b1-9ed8-90d4ae2eb643",
            "78bb309f-93f6-4e90-a478-829c31612d7f",
            "ff29f167-b22b-4cf3-a2ea-71dc80a40fa5"
          ],
          "display_name": true
        },
        {
          "uuid": "e04672f6-8f69-4dc0-a908-397499467fed",
          "name": "SULFOMETURON-METHYL [HSDB]",
          "stdName": "SULFOMETURON-METHYL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8249ec9-1bea-4a6f-b42c-a3d62fba6c8b",
            "9dc9d51e-3f20-462c-a652-1ed839e21a7f"
          ],
          "display_name": false
        },
        {
          "uuid": "e69ce1ba-9b73-4d3a-9435-34d6d4ffc5d0",
          "name": "SULFOMETURON-METHYL [ISO]",
          "stdName": "SULFOMETURON-METHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8249ec9-1bea-4a6f-b42c-a3d62fba6c8b",
            "78bb309f-93f6-4e90-a478-829c31612d7f"
          ],
          "display_name": false
        },
        {
          "uuid": "e942d76c-92b8-41e3-bf1d-b1ff9e3d77ab",
          "name": "SULFOMETURON-METHYL [MI]",
          "stdName": "SULFOMETURON-METHYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8249ec9-1bea-4a6f-b42c-a3d62fba6c8b",
            "5cf2d5f3-b241-4fb1-bf10-de8d0fac01e2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5447a2ea-8fc3-4b20-a959-4ba26498f455",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5cf2d5f3-b241-4fb1-bf10-de8d0fac01e2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8249ec9-1bea-4a6f-b42c-a3d62fba6c8b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "514961fc-13d2-423f-97a9-27204027ef60",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dc9d51e-3f20-462c-a652-1ed839e21a7f",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b426f1fc-7179-480f-8925-612fad8c0481",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78bb309f-93f6-4e90-a478-829c31612d7f",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "630935ec-4053-4c06-853e-daaf0fede9be",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391776000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fdb93e4-d947-4ef5-a9ae-83626d4cfd84",
          "citation": "SRS import [JLY5D60J1A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JLY5D60J1A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391776000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9690f6a1-6e7e-4d2e-a843-b41255e3f50d",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78ba2212-45bf-42b1-9ed8-90d4ae2eb643",
          "citation": "SULFOMETURON-METHYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e2fee303-9b7a-416e-86c7-bac8df7d6ef6",
          "citation": "SULFOMETURON-METHYL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ff29f167-b22b-4cf3-a2ea-71dc80a40fa5",
          "citation": "SULFOMETURON-METHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "550b82e4-6398-1cc4-93ea-c525a47d7353",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+74222-97-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9e5b4e21-c3b1-1c25-e680-832fe6f25deb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=74222-97-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c97c75a9-3b01-1154-8c76-5985fd24a96a",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "158d1d7b-4ecc-e592-1c9a-c12f35088f75",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "322eda8a-dae5-456c-8378-40ac4fd66dda",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bdcf6e05-2953-4990-a31a-3ead3e3bf0c2",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cfe2ceae-d2a1-4cbe-ba9f-ac2ba11d35bb",
          "id": "cfe2ceae-d2a1-4cbe-ba9f-ac2ba11d35bb",
          "molfile": "\n  Marvin  01132110452D          \n\n 25 26  0  0  0  0            999 V2000\n    6.8735   -4.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1643   -4.4215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4501   -4.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4501   -3.1598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7156   -4.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0026   -4.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2953   -4.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2953   -5.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0026   -5.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7156   -5.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4338   -5.6731    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0102   -6.3852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8597   -4.9627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1474   -6.0829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8735   -5.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8735   -4.8212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6047   -6.0829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3401   -5.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0543   -6.0598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7617   -5.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4978   -6.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7617   -4.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0543   -4.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0543   -3.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3401   -4.8212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 25  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 23 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 23  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(C)nc(n1)NC(=O)NS(=O)(=O)c2ccccc2C(=O)OC",
          "formula": "C15H16N4O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "de5465c5-4660-4e02-b21c-0a635c5dd0a3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "364.378",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "59cf7a16-dd6e-4753-8dab-9e293691c8db",
      "version": "7",
      "structure": {
        "id": "d7b50c04-442f-44df-a5f9-6c336f04f80b",
        "molfile": "\n  Marvin  01132111112D          \n\n 25 26  0  0  0  0            999 V2000\n    4.7156   -5.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7156   -4.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0026   -4.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2953   -4.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2953   -5.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0026   -5.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4501   -4.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1643   -4.4215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8735   -4.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4501   -3.1598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4338   -5.6731    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1474   -6.0829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8735   -5.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6047   -6.0829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3401   -5.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3401   -4.8212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0543   -4.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7617   -4.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7617   -5.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0543   -6.0598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4978   -6.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0543   -3.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8735   -4.8212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0102   -6.3852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8597   -4.9627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  7 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 15 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 17 22  1  0  0  0  0\n 13 23  2  0  0  0  0\n 11 24  2  0  0  0  0\n 11 25  2  0  0  0  0\nM  END",
        "smiles": "Cc1cc(C)nc(n1)NC(=O)NS(=O)(=O)c2ccccc2C(=O)OC",
        "formula": "C15H16N4O5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "364.378",
        "optical_activity": "NONE",
        "references": [
          "9690f6a1-6e7e-4d2e-a843-b41255e3f50d",
          "1fdb93e4-d947-4ef5-a9ae-83626d4cfd84"
        ],
        "stereo_centers": 0
      },
      "unii": "JLY5D60J1A"
    }
  ]
}