{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "972d3695-56dd-468a-85a4-a2e93edb72b4",
          "code": "719-96-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=719-96-0",
          "code_system": "CAS",
          "references": [
            "77c43a88-6dbb-4be6-9716-b4f1b52cde80",
            "a598233d-1bfa-43fe-8c65-c82548bd076a"
          ]
        },
        {
          "uuid": "e59415a0-0041-43f9-8b53-4f0d74d02229",
          "code": "309300",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:305",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "77c43a88-6dbb-4be6-9716-b4f1b52cde80"
          ]
        },
        {
          "uuid": "52eacdce-4a91-426a-9c0a-5e9d8601519c",
          "code": "211-952-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.867",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "77c43a88-6dbb-4be6-9716-b4f1b52cde80"
          ]
        },
        {
          "uuid": "cf0cf1c8-f622-4ae9-9540-e7c9564422d1",
          "code": "69755",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69755",
          "code_system": "PUBCHEM",
          "references": [
            "77c43a88-6dbb-4be6-9716-b4f1b52cde80"
          ]
        },
        {
          "uuid": "97856601-91e4-46f9-fa3c-4b5d6814e362",
          "code": "DTXSID5041982",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5041982",
          "code_system": "EPA CompTox",
          "references": [
            "5a391deb-9f4d-453d-893b-d627b8e04233"
          ]
        },
        {
          "uuid": "e7e90434-252b-45e0-ba46-1cfe3c8e4f39",
          "code": "JLQ9WCA0M7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "900e5195-77c1-48e5-9d3e-cde451b6ae11",
          "name": "((DICHLOROFLUOROMETHYL)THIO)PHTHALIMIDE",
          "stdName": "((DICHLOROFLUOROMETHYL)THIO)PHTHALIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18bbee5-a3a0-47d8-836e-e69071e3683a",
            "91d4e4fc-2fc8-48cc-a3ae-863585b7db39"
          ],
          "display_name": false
        },
        {
          "uuid": "410c3ca6-0830-470a-b308-b25997d31423",
          "name": "1H-ISOINDOLE-1,3(2H)-DIONE, 2-((DICHLOROFLUOROMETHYL)THIO)-",
          "stdName": "1H-ISOINDOLE-1,3(2H)-DIONE, 2-((DICHLOROFLUOROMETHYL)THIO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18bbee5-a3a0-47d8-836e-e69071e3683a",
            "91d4e4fc-2fc8-48cc-a3ae-863585b7db39"
          ],
          "display_name": false
        },
        {
          "uuid": "a7e08d62-e9af-4fde-b0be-c34922bd30e8",
          "name": "COATCIDE CS",
          "stdName": "COATCIDE CS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18bbee5-a3a0-47d8-836e-e69071e3683a",
            "91d4e4fc-2fc8-48cc-a3ae-863585b7db39"
          ],
          "display_name": false
        },
        {
          "uuid": "b43ea340-40a7-4fcc-b2f0-474d8d6a8612",
          "name": "FLUOROFOLPET",
          "stdName": "FLUOROFOLPET",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6276e57-9efb-4e22-86b7-133b72b95579",
            "a18bbee5-a3a0-47d8-836e-e69071e3683a",
            "6bca3978-d503-4023-972b-9aa226fd5a26",
            "a5e5df75-5c7e-4d16-a2fa-8d07a229d909"
          ],
          "display_name": true
        },
        {
          "uuid": "7eea4765-c0a3-44b3-8659-a21d9df9b8b2",
          "name": "FLUOROFOLPET [ISO]",
          "stdName": "FLUOROFOLPET [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6276e57-9efb-4e22-86b7-133b72b95579",
            "a18bbee5-a3a0-47d8-836e-e69071e3683a"
          ],
          "display_name": false
        },
        {
          "uuid": "2168cc13-b80f-4b21-adce-0b73a4e479e1",
          "name": "N-((DICHLOROFLUOROMETHYL)THIO)PHTHALIMIDE",
          "stdName": "N-((DICHLOROFLUOROMETHYL)THIO)PHTHALIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18bbee5-a3a0-47d8-836e-e69071e3683a",
            "91d4e4fc-2fc8-48cc-a3ae-863585b7db39"
          ],
          "display_name": false
        },
        {
          "uuid": "a7523c90-5cdf-4d66-a040-6007034fda29",
          "name": "N-((FLUORODICHLOROMETHYL)THIO)PHTHALIMIDE",
          "stdName": "N-((FLUORODICHLOROMETHYL)THIO)PHTHALIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18bbee5-a3a0-47d8-836e-e69071e3683a",
            "91d4e4fc-2fc8-48cc-a3ae-863585b7db39"
          ],
          "display_name": false
        },
        {
          "uuid": "05582b2a-aa04-45ae-9a7c-af1e908ac377",
          "name": "PHTHALIMIDE, N-((DICHLOROFLUOROMETHYL)THIO)-",
          "stdName": "PHTHALIMIDE, N-((DICHLOROFLUOROMETHYL)THIO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18bbee5-a3a0-47d8-836e-e69071e3683a",
            "91d4e4fc-2fc8-48cc-a3ae-863585b7db39"
          ],
          "display_name": false
        },
        {
          "uuid": "a3aa5b2f-0407-4a26-bcff-ca9f75786d7e",
          "name": "SANAIZOL 300",
          "stdName": "SANAIZOL 300",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18bbee5-a3a0-47d8-836e-e69071e3683a",
            "91d4e4fc-2fc8-48cc-a3ae-863585b7db39"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6bca3978-d503-4023-972b-9aa226fd5a26",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "91d4e4fc-2fc8-48cc-a3ae-863585b7db39",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a18bbee5-a3a0-47d8-836e-e69071e3683a",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6276e57-9efb-4e22-86b7-133b72b95579",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77c43a88-6dbb-4be6-9716-b4f1b52cde80",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18ab22ce-a4cf-4e6a-bcab-62b909b8b211",
          "citation": "SRS import [JLQ9WCA0M7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JLQ9WCA0M7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cb70cb6-4824-4af1-9c4a-65f8db326411",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5e5df75-5c7e-4d16-a2fa-8d07a229d909",
          "citation": "FLUOROFOLPET [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a391deb-9f4d-453d-893b-d627b8e04233",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=719-96-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a598233d-1bfa-43fe-8c65-c82548bd076a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0c22d5b1-5d23-40ad-8149-5ca94ac38d51",
          "id": "0c22d5b1-5d23-40ad-8149-5ca94ac38d51",
          "molfile": "\n  Marvin  01132100532D          \n\n 16 17  0  0  0  0            999 V2000\n    9.3473   -6.2646    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3473   -5.3855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3473   -4.4996    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.2240   -5.3855    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.4689   -5.3855    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5853   -5.3677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8410   -5.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8410   -4.2411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1390   -5.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4220   -5.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7052   -5.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7052   -6.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4259   -6.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1390   -6.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5853   -6.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3649   -6.6574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n 15  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 14  2  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(=O)N(C2=O)SC(Cl)(Cl)F",
          "formula": "C9H4Cl2FNO2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f15c6168-bf4d-4eb6-8212-6e6c790da3f4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "280.1043",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3b14ef1f-0f36-4d55-a0d2-2c0d5ced091f",
      "version": "3",
      "structure": {
        "id": "ae647680-7da1-4ddf-b655-23ea0e5121d6",
        "molfile": "\n  Marvin  01132109032D          \n\n 16 17  0  0  0  0            999 V2000\n    7.5853   -5.3677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5853   -6.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1390   -6.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4259   -6.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7052   -6.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7052   -5.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4220   -5.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1390   -5.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8410   -5.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8410   -4.2411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3649   -6.6574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4689   -5.3855    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3473   -5.3855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3473   -4.4996    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.2240   -5.3855    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.3473   -6.2646    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  2  0  0  0  0\n  8  3  2  0  0  0  0\n 11  2  2  0  0  0  0\n 12  1  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 13  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(=O)N(C2=O)SC(Cl)(Cl)F",
        "formula": "C9H4Cl2FNO2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "280.1043",
        "optical_activity": "NONE",
        "references": [
          "18ab22ce-a4cf-4e6a-bcab-62b909b8b211",
          "5cb70cb6-4824-4af1-9c4a-65f8db326411"
        ],
        "stereo_centers": 0
      },
      "unii": "JLQ9WCA0M7"
    }
  ]
}