{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9b4e2bde-d7ff-4533-b30e-d5718c03e80e",
          "code": "50471-44-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50471-44-8",
          "code_system": "CAS",
          "references": [
            "af14ffd3-fa59-4037-82cf-c6ac639026c1",
            "d6ddac67-bdd4-4f62-8a05-1b5598ba079e"
          ]
        },
        {
          "uuid": "99a50df3-1a1e-457c-b394-be140eab5a10",
          "code": "C025643",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67025643",
          "code_system": "MESH",
          "references": [
            "af14ffd3-fa59-4037-82cf-c6ac639026c1"
          ]
        },
        {
          "uuid": "5c13e1e5-100c-4a90-9a52-90213d46aa0c",
          "code": "VINCLOZOLIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Vinclozolin",
          "code_system": "WIKIPEDIA",
          "references": [
            "af14ffd3-fa59-4037-82cf-c6ac639026c1"
          ]
        },
        {
          "uuid": "c12b1361-a642-4163-b976-aaad91232c09",
          "code": "113201",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4400",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "af14ffd3-fa59-4037-82cf-c6ac639026c1"
          ]
        },
        {
          "uuid": "1a2a4851-c898-4211-a4ea-af169a1061b2",
          "code": "256-599-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.051.437",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "af14ffd3-fa59-4037-82cf-c6ac639026c1"
          ]
        },
        {
          "uuid": "fdf0a3ef-a0b0-4a84-a25a-cae0ce2a9507",
          "code": "m11451",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11451?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "af14ffd3-fa59-4037-82cf-c6ac639026c1"
          ]
        },
        {
          "uuid": "758794b5-8973-4abf-80af-5d1808915d57",
          "code": "39676",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/39676",
          "code_system": "PUBCHEM",
          "references": [
            "af14ffd3-fa59-4037-82cf-c6ac639026c1"
          ]
        },
        {
          "uuid": "ef42f896-1285-b0c8-ab45-db560bc2af01",
          "code": "6747",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6747",
          "code_system": "HSDB",
          "references": [
            "74a6745d-9e06-97e6-b03a-bd7f54246731"
          ]
        },
        {
          "uuid": "3869f0ba-48cc-a40c-b2cc-9868a58c937c",
          "code": "DTXSID4022361",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4022361",
          "code_system": "EPA CompTox",
          "references": [
            "3505e257-a4ec-2bf5-7da4-be9d7456ccee"
          ]
        },
        {
          "uuid": "cad03bc6-120e-428c-a9a2-ca3fe128bdf5",
          "code": "JJ258EZN1I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bc532e1f-49b8-2e87-26f4-4dd66e7974c8",
          "code": "9986",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9986",
          "code_system": "CHEBI",
          "references": [
            "e78d382d-b10f-7723-49b9-1be4136625d4"
          ]
        },
        {
          "uuid": "53ac5d77-1ed2-7edc-9901-a82976cebaca",
          "code": "83732",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83732",
          "code_system": "CHEBI",
          "references": [
            "e78d382d-b10f-7723-49b9-1be4136625d4"
          ]
        },
        {
          "uuid": "4c728d5d-deb4-dd5d-4754-7bc4782da2e1",
          "code": "vinclozolin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/vinclozolin.html",
          "code_system": "ALANWOOD",
          "references": [
            "2b30df22-5aa2-c6cc-dc19-ee671d66b1ff"
          ]
        },
        {
          "uuid": "fa8857ea-c060-879a-251d-cf773c204e3b",
          "code": "300000053633",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2bc9a53f-9db2-68bd-a249-d01b88c7e50d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "671add3a-c183-4781-90d8-2e766201ae23",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "29f30001-d9c9-4f39-ace3-7312a7a0d09e",
            "refuuid": "3070f7ae-5aed-4a75-b0e7-0fdc3010ee81",
            "name": "VINCLOZOLIN",
            "unii": "JJ258EZN1I",
            "linking_id": "JJ258EZN1I",
            "ref_pname": "VINCLOZOLIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e1adfde1-3d85-45fc-bcc9-0fc7e7588928",
          "name": "(±)-3-(3,5-DICHLOROPHENYL)-5-ETHENYL-5-METHYL-2,4-OXAZOLIDINEDIONE",
          "stdName": "(+/-)-3-(3,5-DICHLOROPHENYL)-5-ETHENYL-5-METHYL-2,4-OXAZOLIDINEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad69a779-be84-49dd-84f8-2da78de6bff2",
            "98ee2430-6a22-4869-b889-7cade5f99f88"
          ],
          "display_name": false
        },
        {
          "uuid": "780aac18-f9ec-4913-9808-ac3bfc5d5b55",
          "name": "3-(3,5-DICHLOROPHENYL)-5-ETHENYL-5-METHYL-2,4-OXAZOLIDINEDIONE",
          "stdName": "3-(3,5-DICHLOROPHENYL)-5-ETHENYL-5-METHYL-2,4-OXAZOLIDINEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98ee2430-6a22-4869-b889-7cade5f99f88",
            "d7590710-0efb-4447-bb72-cecc6ba9a90c"
          ],
          "display_name": false
        },
        {
          "uuid": "649322aa-aea7-4f86-90bc-6806f330801c",
          "name": "RONILAN",
          "stdName": "RONILAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98ee2430-6a22-4869-b889-7cade5f99f88",
            "d7590710-0efb-4447-bb72-cecc6ba9a90c"
          ],
          "display_name": false
        },
        {
          "uuid": "6406878f-8ef7-4609-81e7-c2d503bc019b",
          "name": "VINCLOZOLIN",
          "stdName": "VINCLOZOLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8dd51f7-d807-4ac9-9b05-eb247180cbdd",
            "c14562dd-7e4c-4bd8-96a1-986a1018543c",
            "98ee2430-6a22-4869-b889-7cade5f99f88",
            "fabb786e-7746-46c9-907a-137de543b893",
            "d7590710-0efb-4447-bb72-cecc6ba9a90c",
            "37d0cc27-ed12-4252-99b9-5241c97a6bf2",
            "6c705ce2-466b-4af5-bfbd-e7a7afbf9364"
          ],
          "display_name": true
        },
        {
          "uuid": "fe396c04-0df3-4531-9c7c-12b799ca78c0",
          "name": "VINCLOZOLIN [HSDB]",
          "stdName": "VINCLOZOLIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98ee2430-6a22-4869-b889-7cade5f99f88",
            "37d0cc27-ed12-4252-99b9-5241c97a6bf2"
          ],
          "display_name": false
        },
        {
          "uuid": "3024e779-3ceb-487f-b8d4-19fdcf7cba3a",
          "name": "VINCLOZOLIN [ISO]",
          "stdName": "VINCLOZOLIN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c14562dd-7e4c-4bd8-96a1-986a1018543c",
            "98ee2430-6a22-4869-b889-7cade5f99f88"
          ],
          "display_name": false
        },
        {
          "uuid": "f744fb11-10f1-4c42-bf8f-acdebaf07c02",
          "name": "VINCLOZOLIN [MI]",
          "stdName": "VINCLOZOLIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98ee2430-6a22-4869-b889-7cade5f99f88",
            "d7590710-0efb-4447-bb72-cecc6ba9a90c"
          ],
          "display_name": false
        },
        {
          "uuid": "005f7b91-18ea-4c9a-8038-9ad5511420ec",
          "name": "VINCLOZOLIN, (±)-",
          "stdName": "VINCLOZOLIN, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad69a779-be84-49dd-84f8-2da78de6bff2",
            "98ee2430-6a22-4869-b889-7cade5f99f88"
          ],
          "display_name": false
        },
        {
          "uuid": "9ddfc92e-8301-4913-9c41-16ea6dbc7bcf",
          "name": "VORLAN",
          "stdName": "VORLAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98ee2430-6a22-4869-b889-7cade5f99f88",
            "d7590710-0efb-4447-bb72-cecc6ba9a90c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d7590710-0efb-4447-bb72-cecc6ba9a90c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "98ee2430-6a22-4869-b889-7cade5f99f88",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad69a779-be84-49dd-84f8-2da78de6bff2",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37d0cc27-ed12-4252-99b9-5241c97a6bf2",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c14562dd-7e4c-4bd8-96a1-986a1018543c",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af14ffd3-fa59-4037-82cf-c6ac639026c1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391403000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb9192aa-6ce7-4844-a724-0df8c0095911",
          "citation": "SRS import [JJ258EZN1I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JJ258EZN1I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391403000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c705ce2-466b-4af5-bfbd-e7a7afbf9364",
          "citation": "VINCLOZOLIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d8dd51f7-d807-4ac9-9b05-eb247180cbdd",
          "citation": "VINCLOZOLIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fabb786e-7746-46c9-907a-137de543b893",
          "citation": "VINCLOZOLIN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74a6745d-9e06-97e6-b03a-bd7f54246731",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+50471-44-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3505e257-a4ec-2bf5-7da4-be9d7456ccee",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=50471-44-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2b30df22-5aa2-c6cc-dc19-ee671d66b1ff",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "d6ddac67-bdd4-4f62-8a05-1b5598ba079e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e78d382d-b10f-7723-49b9-1be4136625d4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2bc9a53f-9db2-68bd-a249-d01b88c7e50d",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c382e1a6-1f8b-418f-81cb-3c237a81e178",
          "id": "c382e1a6-1f8b-418f-81cb-3c237a81e178",
          "molfile": "\n  Marvin  01132110062D          \n\n 18 19  0  0  0  0            999 V2000\n    0.5142   -2.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2226   -2.6342    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.9692   -1.8249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6349   -1.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6349   -0.6583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2977   -1.8249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0442   -2.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7527   -3.1381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0184   -1.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0184   -0.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7330   -0.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7330    0.4656    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4478   -0.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4478   -1.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0555   -1.8249    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7330   -1.8677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2105   -3.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7799   -3.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  2 17  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 16  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 18  2  0  0  0  0\nM  END",
          "smiles": "C=CC1(C)C(=O)N(c2cc(cc(c2)Cl)Cl)C(=O)O1",
          "formula": "C12H9Cl2NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e2044d49-5283-4e65-a1e8-4a0cc0e825b0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "286.1111",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3070f7ae-5aed-4a75-b0e7-0fdc3010ee81",
      "version": "9",
      "structure": {
        "id": "5eeef932-902a-41cf-9e61-8b8ea75336ea",
        "molfile": "\n  Marvin  01132104552D          \n\n 18 19  0  0  0  0            999 V2000\n    0.5142   -2.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2226   -2.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0442   -2.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7527   -3.1381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2977   -1.8249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0184   -1.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0184   -0.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7330   -0.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7330    0.4656    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4478   -0.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4478   -1.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0555   -1.8249    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7330   -1.8677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6349   -1.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6349   -0.6583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9692   -1.8249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2105   -3.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7799   -3.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n  6 13  2  0  0  0  0\n  5 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n  2 16  1  0  0  0  0\n  2 17  1  0  0  0  0\n 17 18  2  0  0  0  0\nM  END",
        "smiles": "C=CC1(C)C(=O)N(c2cc(cc(c2)Cl)Cl)C(=O)O1",
        "formula": "C12H9Cl2NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "286.1111",
        "optical_activity": "( + / - )",
        "references": [
          "d7590710-0efb-4447-bb72-cecc6ba9a90c",
          "fb9192aa-6ce7-4844-a724-0df8c0095911"
        ],
        "stereo_centers": 1
      },
      "unii": "JJ258EZN1I"
    }
  ]
}