{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8e0e4e67-f463-470b-9326-69dac5d830d1",
          "code": "195251-91-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=195251-91-3",
          "code_system": "CAS",
          "references": [
            "9e9c1da7-db83-4369-84fc-2e267baf2990",
            "85b3ddb4-8e4c-44c1-a1a1-c4118b1c5ef8"
          ]
        },
        {
          "uuid": "9582e7cd-8a48-4ad0-b6f8-6d7c8905259e",
          "code": "16723825",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16723825",
          "code_system": "PUBCHEM",
          "references": [
            "9e9c1da7-db83-4369-84fc-2e267baf2990"
          ]
        },
        {
          "uuid": "e679a329-fcfd-c998-74c7-e178fac78145",
          "code": "DTXSID6051356",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6051356",
          "code_system": "EPA CompTox",
          "references": [
            "2dae0a72-b48a-4b47-1168-d953c0aff411"
          ]
        },
        {
          "uuid": "2c1e60e3-9fdc-4aed-95f7-de57643b2530",
          "code": "JI094VG3JB",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "addf3194-ab15-98f9-12ed-36a26f3a1c45"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5543270b-40e3-4124-8a97-1e3c6dfa2667",
          "name": "2H-1,5-BENZODIOXEPIN-3(4H)-ONE, 7-(1,1-DIMETHYLETHYL)-",
          "stdName": "2H-1,5-BENZODIOXEPIN-3(4H)-ONE, 7-(1,1-DIMETHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c655c91d-e51e-4271-9361-41c1d89abcbf"
          ],
          "display_name": false
        },
        {
          "uuid": "403abe5f-67b0-4c43-48da-422c1e2f1323",
          "name": "7-(1,1-DIMETHYLETHYL)-2H-1,5-BENZODIOXEPIN-3(4H)-ONE",
          "stdName": "7-(1,1-DIMETHYLETHYL)-2H-1,5-BENZODIOXEPIN-3(4H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "addf3194-ab15-98f9-12ed-36a26f3a1c45"
          ],
          "display_name": false
        },
        {
          "uuid": "14d39682-c1ed-400f-a0e7-ab97d76fc3f7",
          "name": "7-(TERT-BUTYL)-2H-BENZO(B)(1,4)DIOXEPIN-3(4H)-ONE",
          "stdName": "7-(TERT-BUTYL)-2H-BENZO(B)(1,4)DIOXEPIN-3(4H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "addf3194-ab15-98f9-12ed-36a26f3a1c45"
          ],
          "display_name": false
        },
        {
          "uuid": "ec03304b-9eec-4517-a50b-c937057719f5",
          "name": "7-TERT-BUTYL-1,5-BENZODIOXEPIN-3(4H)-ONE",
          "stdName": "7-TERT-BUTYL-1,5-BENZODIOXEPIN-3(4H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "addf3194-ab15-98f9-12ed-36a26f3a1c45"
          ],
          "display_name": false
        },
        {
          "uuid": "3d9424af-a0ac-42df-b02d-0e960a330a92",
          "name": "7-TERT-BUTYL-1,5-BENZODIOXEPIN-3-ONE",
          "stdName": "7-TERT-BUTYL-1,5-BENZODIOXEPIN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "addf3194-ab15-98f9-12ed-36a26f3a1c45",
            "7346d3c7-48f3-4ea6-a830-ab4b3f36feb0"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "c655c91d-e51e-4271-9361-41c1d89abcbf",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e9c1da7-db83-4369-84fc-2e267baf2990",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391987000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2dae0a72-b48a-4b47-1168-d953c0aff411",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=195251-91-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "addf3194-ab15-98f9-12ed-36a26f3a1c45",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "85b3ddb4-8e4c-44c1-a1a1-c4118b1c5ef8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7346d3c7-48f3-4ea6-a830-ab4b3f36feb0",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6153f722-3336-46f3-ad87-44b4053464fc",
          "id": "6153f722-3336-46f3-ad87-44b4053464fc",
          "molfile": "\n  Marvin  01132105022D          \n\n 16 17  0  0  0  0            999 V2000\n    4.3565   -2.4464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7560   -1.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4730   -2.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1665   -1.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0500   -1.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0500   -0.5145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3330   -0.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6270   -0.5145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0086    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1822   -0.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8264   -0.9140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.9140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1822   -1.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0086   -1.8170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6270   -1.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3330   -1.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n 16  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 15  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc2c(c1)OCC(=O)CO2",
          "formula": "C13H16O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "84f6a638-6243-41d7-8b05-96fc234bdfe6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "220.2648",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2faf63ff-75c1-4c9b-9a80-7ff2adc4e85c",
      "version": "6",
      "structure": {
        "id": "99440d57-a929-41fd-9126-ce0d3b68693f",
        "molfile": "\n  Marvin  01132107582D          \n\n 16 17  0  0  0  0            999 V2000\n   14.5351   -4.6639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7087   -4.5052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3529   -3.7610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7087   -3.0166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5351   -2.8469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1535   -3.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1535   -4.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8595   -4.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5765   -4.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5765   -3.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8595   -2.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5265   -3.7610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2825   -4.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8830   -5.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9995   -4.9650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6930   -3.8485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 12  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6 11  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 11  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc2c(c1)OCC(=O)CO2",
        "formula": "C13H16O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "220.2648",
        "optical_activity": "NONE",
        "references": [
          "c655c91d-e51e-4271-9361-41c1d89abcbf",
          "addf3194-ab15-98f9-12ed-36a26f3a1c45"
        ],
        "stereo_centers": 0
      },
      "unii": "JI094VG3JB"
    }
  ]
}