{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b1e25065-ced6-4059-8c82-6bff4620ef01",
          "code": "N05CD10",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|HYPNOTICS AND SEDATIVES|Benzodiazepine derivatives|quazepam",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05CD10&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "04771f01-75ac-4c6b-af23-c93d38312fc0",
          "code": "N0000175694",
          "comments": "Established Pharmacologic Class [EPC]|Benzodiazepine [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175694",
          "code_system": "NDF-RT",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "6e1c0d58-dcfb-4eeb-8e7e-11742c5a395e",
          "code": "N0000007542",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, 2-Ring [Chemical/Ingredient]|Benzazepines [Chemical/Ingredient]|Benzodiazepines [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007542",
          "code_system": "NDF-RT",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "8b030207-0788-47c2-bc5d-73ad85cb1d6e",
          "code": "QN05CD10",
          "comments": "VATC|PSYCHOLEPTICS|HYPNOTICS AND SEDATIVES|Benzodiazepine derivatives|quazepam",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05CD10&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "c9d1c41a-aaf2-445d-8e35-4ad76bf14319",
          "code": "36735-22-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=36735-22-5",
          "code_system": "CAS",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90",
            "79042ccd-cee3-49f9-afb4-3734fbe2f4db"
          ]
        },
        {
          "uuid": "38e48590-a2b3-4cd2-b43f-cf2b0125e413",
          "code": "C47699",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47699",
          "code_system": "NCI_THESAURUS",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "68206b4d-1325-4363-907f-5cd4f6bdd944",
          "code": "NBK548297",
          "comments": "LiverTox|CNS|Sedative/Hypnotic|Benzodiazepine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548297/",
          "code_system": "LIVERTOX",
          "references": [
            "65318190-ee9c-00fc-eab0-93be3ff6b6cd"
          ]
        },
        {
          "uuid": "cb43403a-23d4-41e1-b633-1a173550f068",
          "code": "QUAZEPAM",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Quazepam",
          "code_system": "WIKIPEDIA",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "a276c6a8-f44c-44bb-bfa3-95ea5a4380e6",
          "code": "C025130",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67025130",
          "code_system": "MESH",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "25fb62aa-9e40-4fe4-b385-26e504e6c0b0",
          "code": "SUB10188MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "2c368426-934e-49b5-9cf1-d38b18412a80",
          "code": "4018",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4018",
          "code_system": "INN",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "80c19156-40f4-476d-bf38-936eca7b9d52",
          "code": "2881",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Depressants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "1fedad2c-f721-4f80-8d9a-33245698b8c5",
          "code": "7288",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7288",
          "code_system": "IUPHAR",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "92d6b026-111e-4c3f-9e31-01b45c88d035",
          "code": "35185",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/35185/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "85f8e226-2e2c-4a9c-a166-d4ee415548c1",
          "code": "m9415",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9415?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "7c25ccf7-54f0-41ef-b653-190fa3823be5",
          "code": "DB01589",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01589",
          "code_system": "DRUG BANK",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "11020406-93cd-4331-9d4b-41c0bbb1e13c",
          "code": "CHEMBL1200472",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200472",
          "code_system": "ChEMBL",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "d71608b2-9445-4a47-b5f2-87ace5b72c94",
          "code": "253-179-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.048.329",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "337a207d-a646-444a-8e5f-30383ccd01ea",
          "code": "4999",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4999",
          "code_system": "PUBCHEM",
          "references": [
            "94e46469-b717-4cef-9da9-d0e5d7a13b90"
          ]
        },
        {
          "uuid": "d6887c8f-eb48-faa6-0660-d71d8a155455",
          "code": "DTXSID60190193",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60190193",
          "code_system": "EPA CompTox",
          "references": [
            "b751e618-b4bc-2c79-dec1-cf9a76da295a"
          ]
        },
        {
          "uuid": "af638e50-7af1-6a96-0d1f-3812e0f8de9d",
          "code": "C1012",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent[C28197]|Benzodiazepine",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1012",
          "code_system": "NCI_THESAURUS",
          "references": [
            "65318190-ee9c-00fc-eab0-93be3ff6b6cd"
          ]
        },
        {
          "uuid": "6cb2bb07-4d67-4c37-bb60-223459befd39",
          "code": "JF8V0828ZI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "641f05ec-e375-c1c3-176c-414c043f8057",
          "code": "Quazepam",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM383/",
          "code_system": "LACTMED",
          "references": [
            "65318190-ee9c-00fc-eab0-93be3ff6b6cd"
          ]
        },
        {
          "uuid": "1f9330de-3bd2-cb82-b273-a30608404bfd",
          "code": "2336",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2336",
          "code_system": "DRUG CENTRAL",
          "references": [
            "65318190-ee9c-00fc-eab0-93be3ff6b6cd"
          ]
        },
        {
          "uuid": "4a2dde64-0ce3-6ef8-9749-4f119691db2f",
          "code": "1592205",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1592205",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "65318190-ee9c-00fc-eab0-93be3ff6b6cd"
          ]
        },
        {
          "uuid": "d0f94eb2-f96f-8dae-ccc6-1f791ee84c0d",
          "code": "28934",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28934",
          "code_system": "CHEBI",
          "references": [
            "65318190-ee9c-00fc-eab0-93be3ff6b6cd"
          ]
        },
        {
          "uuid": "7be9c740-587c-a7fb-2ffc-8a05186eb6b0",
          "code": "JF8V0828ZI",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=JF8V0828ZI",
          "code_system": "DAILYMED",
          "references": [
            "805c0241-2500-d233-d2d2-d8df7f899b33"
          ]
        },
        {
          "uuid": "dd2e32b1-7c8b-b80c-d662-531f3b571b2e",
          "code": "100000081100",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a1242ec4-5956-3c32-1f11-997621371cc5"
          ]
        },
        {
          "uuid": "6a4c8cb2-9f1d-8a4b-9d8d-68ce579711d3",
          "code": "309702",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=309702",
          "code_system": "NSC",
          "references": [
            "406ac230-d913-581a-fd25-06ebba4e3f42"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "edf14ddf-20c9-4051-abd2-ef5b0a380472",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2b8ddf16-4910-49ac-b256-bc4674d8d0f9",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6c0a6df-1375-419a-a794-1d33d1b06791",
          "citation": "INN Proposed List 36",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL36.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e28cc7d4-ffc6-407d-b447-eacdfbf9aa18",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60e2400a-dedf-4f18-b81a-0b9078bef6ba",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e20d3c6-48ee-4118-bee2-92ef54ad66cb",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "122daa21-f579-4034-b585-99443e712e84",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f21c9811-be2e-4517-aaef-f14935cb9b14",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50851f79-7f47-4d70-9e09-abc87e7564b6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e545f55-ce8b-45e5-a61a-953bc2733c87",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38419bcc-6346-4899-b683-2421c66d70e8",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a827f916-0770-4838-888d-46dd5ffe5463",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a9899da-f556-4fdc-89d3-206fc0aa42fb",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94e46469-b717-4cef-9da9-d0e5d7a13b90",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389749000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a184196-6855-4bc3-96a8-71af4c4c7748",
          "citation": "DMD, JANUARY 1985 VOL. 13 NO. 1 25-29",
          "url": "http://dmd.aspetjournals.org/content/13/1/25.full.pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8ebe6af-8fbd-465c-9848-92774264b28c",
          "citation": "SRS import [JF8V0828ZI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JF8V0828ZI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389749000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00c2b7b0-ac99-455a-96ba-9d9174fdd161",
          "citation": "QUAZEPAM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d16fb67-887f-4295-8aed-0debf9fd84d9",
          "citation": "QUAZEPAM [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "84103bff-62b8-4207-9401-48b810df1ffd",
          "citation": "QUAZEPAM [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0476dd19-4835-477c-bc99-8d8685bf0770",
          "citation": "QUAZEPAM [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c054f9df-b1dc-4b99-99c5-dfe1afdc7ec3",
          "citation": "QUAZEPAM [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bc505d8f-9e13-4de6-ba8f-9a3068b62097",
          "citation": "QUAZEPAM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "61501103-3c4b-4ea5-9b42-5b9f9ae1dd52",
          "citation": "QUAZEPAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f1f25d7c-92ec-47c4-9ded-321152032b85",
          "citation": "QUAZEPAM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "12bebde6-9678-4d02-b57d-ca7f7ab652aa",
          "citation": "QUAZEPAM [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "012a8a4e-71de-4a3e-940c-eb78131eabe9",
          "citation": "QUAZEPAM CIV [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b751e618-b4bc-2c79-dec1-cf9a76da295a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=36735-22-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b73a36e7-5c4e-dd4f-592d-a86eba1f1d42",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+36735-22-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2d95ab22-8203-f6a8-ee97-b6f4ddcc9cd4",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/1537?sec=monphar",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "65318190-ee9c-00fc-eab0-93be3ff6b6cd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "79042ccd-cee3-49f9-afb4-3734fbe2f4db",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0e404c08-7189-4894-8324-d5f7db2797e0",
          "citation": "Nuerosci Lett 1983;38(1):73",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fa406a3a-79a1-0e10-9ee5-8acf82fafa6d",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "406ac230-d913-581a-fd25-06ebba4e3f42",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "805c0241-2500-d233-d2d2-d8df7f899b33",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4b651b6f-edce-f934-b73e-01ec6cc4e79b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a1242ec4-5956-3c32-1f11-997621371cc5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b4424017-ae9c-4aa7-8ec6-0f015a8864a3",
          "id": "b4424017-ae9c-4aa7-8ec6-0f015a8864a3",
          "molfile": "\n  Marvin  01132109202D          \n\n 25 27  0  0  0  0            999 V2000\n    4.2348   -4.5849    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5191   -4.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5191   -5.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8007   -6.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0876   -5.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0798   -5.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7489   -4.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7489   -3.7343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6098   -3.5787    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9625   -2.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6124   -2.1109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2504   -1.5560    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7956   -1.9242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3573   -1.2136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9045   -0.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6762    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7447   -0.1738    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6643   -1.0840    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1706   -2.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4574   -2.0383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7313   -2.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7313   -3.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.6513    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4574   -3.6591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1706   -3.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 25  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 19 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 15  1  0  0  0  0\n 20 19  1  0  0  0  0\n 25 19  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  2  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(c(c1)C2=NCC(=S)N(CC(F)(F)F)c3ccc(cc32)Cl)F",
          "formula": "C17H11ClF4N2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ed7d2d25-e29f-4041-817e-386aae5773fc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "386.7959",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "93211e82-10ec-485d-90eb-e5ad3550d20b",
      "version": "29",
      "structure": {
        "id": "a15c9eab-8e9c-4501-b7c9-28577165f2a5",
        "molfile": "\n  Marvin  01132108232D          \n\n 25 27  0  0  0  0            999 V2000\n    2.7956   -1.9242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7489   -3.7343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1706   -3.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1706   -2.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6098   -3.5787    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6124   -2.1109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7489   -4.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9045   -0.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3573   -1.2136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9625   -2.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4574   -2.0383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4574   -3.6591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2504   -1.5560    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5191   -4.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6762    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7447   -0.1738    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6643   -1.0840    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7313   -3.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7313   -2.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2348   -4.5849    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.6513    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.0798   -5.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5191   -5.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0876   -5.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8007   -6.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  6  2  0  0  0  0\n 14  7  2  0  0  0  0\n 15  8  1  0  0  0  0\n 16  8  1  0  0  0  0\n 17  8  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 11  2  0  0  0  0\n 20 14  1  0  0  0  0\n 21 18  1  0  0  0  0\n 22  7  1  0  0  0  0\n 23 14  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n  2  5  2  0  0  0  0\n 12 18  2  0  0  0  0\n 23 25  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(c(c1)C2=NCC(=S)N(CC(F)(F)F)c3ccc(cc32)Cl)F",
        "formula": "C17H11ClF4N2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "386.7959",
        "optical_activity": "NONE",
        "references": [
          "edf14ddf-20c9-4051-abd2-ef5b0a380472",
          "f8ebe6af-8fbd-465c-9848-92774264b28c",
          "b6c0a6df-1375-419a-a794-1d33d1b06791"
        ],
        "stereo_centers": 0
      },
      "unii": "JF8V0828ZI",
      "relationships": [
        {
          "uuid": "b6629466-2a5d-46ff-9fd1-d8a3cd435dd2",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3a0b1e1e-68fd-4f2b-9d5b-7ebec6f26926",
            "refuuid": "93211e82-10ec-485d-90eb-e5ad3550d20b",
            "name": "QUAZEPAM",
            "unii": "JF8V0828ZI",
            "linking_id": "JF8V0828ZI",
            "ref_pname": "QUAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8df51de4-4cd3-4659-b0a3-13e9bca2009d",
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE ACTIVE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "0e404c08-7189-4894-8324-d5f7db2797e0"
          ],
          "related_substance": {
            "uuid": "082095bd-12ad-4e25-bb31-f082120d9d13",
            "refuuid": "02bc1842-62df-41e0-81db-2bde4e429483",
            "name": "2-OXOQUAZEPAM",
            "unii": "8T62S796K7",
            "linking_id": "8T62S796K7",
            "ref_pname": "2-OXOQUAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0cbcb863-7c36-40fb-b376-f7b4ec22a435",
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "eac90ef9-76c3-4b22-800e-1d0a204aeede",
            "refuuid": "8a1ea15b-9de3-4765-9f02-87adaa16bff9",
            "name": "3-HYDROXY-2-OXOQUAZEPAM",
            "unii": "RT2K8QL6A5",
            "linking_id": "RT2K8QL6A5",
            "ref_pname": "3-HYDROXY-2-OXOQUAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c0759fb7-60bc-41a0-a7ed-01fdb8c4ff70",
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "8a184196-6855-4bc3-96a8-71af4c4c7748"
          ],
          "related_substance": {
            "uuid": "dc63b4fc-3fbe-4e72-99e1-cab56aafe649",
            "refuuid": "81d6f045-f502-42b8-a3be-b795eb7a483b",
            "name": "3-HYDROXY-2-OXOQUAZEPAM GLUCURONIDE",
            "unii": "81A95YQJ6A",
            "linking_id": "81A95YQJ6A",
            "ref_pname": "3-HYDROXY-2-OXOQUAZEPAM GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "05986ec7-ce07-44ec-a319-fe9b69b8b7ff",
          "amount": {
            "uuid": "8d92520f-930b-4b32-aa70-f985b1f2d8bd"
          },
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE ACTIVE->PARENT",
          "interaction_type": "MAJOR",
          "related_substance": {
            "uuid": "5517bb57-fbad-43ef-80cc-2d4753ab59f2",
            "refuuid": "1afa2a7c-4db2-49f7-98c3-9c4bfe7ab39f",
            "name": "NORFLURAZEPAM",
            "unii": "X9U41NXR6M",
            "linking_id": "X9U41NXR6M",
            "ref_pname": "NORFLURAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "71b6d7ef-bcd1-4d34-bca7-41929ce49b0b",
          "comments": "Large amount in urine",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "references": [
            "8a184196-6855-4bc3-96a8-71af4c4c7748"
          ],
          "related_substance": {
            "uuid": "a3eb5440-a718-4a37-aaa9-435bce098542",
            "refuuid": "c509d796-66e8-40fa-af58-5fd60ce625e8",
            "name": "3-HYDROXY-N-DESALKYL-2-OXOQUAZEPAM GLUCURONIDE",
            "unii": "TQV45T629X",
            "linking_id": "TQV45T629X",
            "ref_pname": "3-HYDROXY-N-DESALKYL-2-OXOQUAZEPAM GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4d403b8d-22a5-4693-ad88-bb71c3f0fa80",
          "amount": {
            "uuid": "7987ded9-b512-4908-a671-c627510ecb37",
            "average": 95,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "2d95ab22-8203-f6a8-ee97-b6f4ddcc9cd4"
          ],
          "related_substance": {
            "uuid": "7c2f92af-8b72-4f68-a21f-43b5c7fb63b6",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "4acfc129-4efa-422c-92dc-88fab7be4eb0",
          "name": "2H-1,4-BENZODIAZEPINE-2-THIONE, 7-CHLORO-5-(2-FLUOROPHENYL)-1,3-DIHYDRO-1-(2,2,2-TRIFLUOROETHYL)-",
          "stdName": "2H-1,4-BENZODIAZEPINE-2-THIONE, 7-CHLORO-5-(2-FLUOROPHENYL)-1,3-DIHYDRO-1-(2,2,2-TRIFLUOROETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b8ddf16-4910-49ac-b256-bc4674d8d0f9"
          ],
          "display_name": false
        },
        {
          "uuid": "3974b530-368f-4913-b6d6-bf8daa0dbdcb",
          "name": "7-Chloro-5-(O-fluorophenyl)-1,3-dihydro-1-(2,2,2-trifluoroethyl)-2H-1,4-benzodiazepine-2-thione",
          "stdName": "7-CHLORO-5-(O-FLUOROPHENYL)-1,3-DIHYDRO-1-(2,2,2-TRIFLUOROETHYL)-2H-1,4-BENZODIAZEPINE-2-THIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b8ddf16-4910-49ac-b256-bc4674d8d0f9"
          ],
          "display_name": false
        },
        {
          "uuid": "8b29bb8e-cc09-471d-adc7-ea76f6995c15",
          "name": "DORAL",
          "stdName": "DORAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b8ddf16-4910-49ac-b256-bc4674d8d0f9"
          ],
          "display_name": false
        },
        {
          "uuid": "d3d7cf27-7c1f-4fde-9e17-2fd1983f062a",
          "name": "NSC-309702",
          "stdName": "NSC-309702",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a9899da-f556-4fdc-89d3-206fc0aa42fb"
          ],
          "display_name": false
        },
        {
          "uuid": "15eb4ad9-7465-4324-a1a3-81c4486fb6e8",
          "name": "QUAZEPAM",
          "stdName": "QUAZEPAM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6c0a6df-1375-419a-a794-1d33d1b06791",
            "f21c9811-be2e-4517-aaef-f14935cb9b14",
            "38419bcc-6346-4899-b683-2421c66d70e8",
            "edf14ddf-20c9-4051-abd2-ef5b0a380472",
            "84103bff-62b8-4207-9401-48b810df1ffd",
            "9d16fb67-887f-4295-8aed-0debf9fd84d9",
            "12bebde6-9678-4d02-b57d-ca7f7ab652aa",
            "e28cc7d4-ffc6-407d-b447-eacdfbf9aa18",
            "bc505d8f-9e13-4de6-ba8f-9a3068b62097",
            "0476dd19-4835-477c-bc99-8d8685bf0770",
            "122daa21-f579-4034-b585-99443e712e84",
            "9e545f55-ce8b-45e5-a61a-953bc2733c87",
            "00c2b7b0-ac99-455a-96ba-9d9174fdd161",
            "f1f25d7c-92ec-47c4-9ded-321152032b85",
            "1e20d3c6-48ee-4118-bee2-92ef54ad66cb",
            "50851f79-7f47-4d70-9e09-abc87e7564b6",
            "c054f9df-b1dc-4b99-99c5-dfe1afdc7ec3",
            "60e2400a-dedf-4f18-b81a-0b9078bef6ba",
            "61501103-3c4b-4ea5-9b42-5b9f9ae1dd52"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "5a6ce663-92e5-47e7-854d-3bec8c1902d7",
              "name_org": "USAN"
            },
            {
              "uuid": "fe3de8cb-72a6-453b-b10f-c153c30c9294",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "518b798a-a931-44e0-bf79-ac55c9e026d8",
          "name": "QUAZEPAM CIV",
          "stdName": "QUAZEPAM CIV",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "012a8a4e-71de-4a3e-940c-eb78131eabe9",
            "a827f916-0770-4838-888d-46dd5ffe5463"
          ],
          "display_name": false
        },
        {
          "uuid": "16d84151-4098-4215-a71a-071fd8afb34f",
          "name": "QUAZEPAM CIV [USP-RS]",
          "stdName": "QUAZEPAM CIV [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a827f916-0770-4838-888d-46dd5ffe5463"
          ],
          "display_name": false
        },
        {
          "uuid": "dd925fe9-6cdf-439e-b216-4f847dd9a820",
          "name": "QUAZEPAM [JAN]",
          "stdName": "QUAZEPAM [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e20d3c6-48ee-4118-bee2-92ef54ad66cb"
          ],
          "display_name": false
        },
        {
          "uuid": "62b0a3bb-d818-4729-87b2-c22374f1afd9",
          "name": "QUAZEPAM [MART.]",
          "stdName": "QUAZEPAM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f21c9811-be2e-4517-aaef-f14935cb9b14"
          ],
          "display_name": false
        },
        {
          "uuid": "df512f0b-fc13-4bcb-8db5-d6750f17403b",
          "name": "QUAZEPAM [MI]",
          "stdName": "QUAZEPAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50851f79-7f47-4d70-9e09-abc87e7564b6"
          ],
          "display_name": false
        },
        {
          "uuid": "f1306afc-9f61-4817-94d2-13a68f69cf1a",
          "name": "QUAZEPAM [ORANGE BOOK]",
          "stdName": "QUAZEPAM [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "122daa21-f579-4034-b585-99443e712e84"
          ],
          "display_name": false
        },
        {
          "uuid": "8c63116e-8283-47e2-bc2b-820cf6388ed5",
          "name": "QUAZEPAM [USAN]",
          "stdName": "QUAZEPAM [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e28cc7d4-ffc6-407d-b447-eacdfbf9aa18"
          ],
          "display_name": false
        },
        {
          "uuid": "0b1ea524-3b92-c01f-110f-99ffc51a7fae",
          "name": "QUAZEPAM [USP MONOGRAPH]",
          "stdName": "QUAZEPAM [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa406a3a-79a1-0e10-9ee5-8acf82fafa6d"
          ],
          "display_name": false
        },
        {
          "uuid": "ff871fa8-1e64-4a68-a704-df26b478d8fd",
          "name": "QUAZEPAM [VANDF]",
          "stdName": "QUAZEPAM [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38419bcc-6346-4899-b683-2421c66d70e8"
          ],
          "display_name": false
        },
        {
          "uuid": "557c7d81-22a0-1cbf-d309-25a67671268c",
          "name": "Quazepam [WHO-DD]",
          "stdName": "QUAZEPAM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b651b6f-edce-f934-b73e-01ec6cc4e79b"
          ],
          "display_name": false
        },
        {
          "uuid": "bcd302f0-620c-4c80-b5af-82e1676752e5",
          "name": "SCH 16134",
          "stdName": "SCH 16134",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b8ddf16-4910-49ac-b256-bc4674d8d0f9"
          ],
          "display_name": false
        },
        {
          "uuid": "4ba19a1a-f22d-484f-8d25-fe884c18e489",
          "name": "SCH-16134",
          "stdName": "SCH-16134",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b8ddf16-4910-49ac-b256-bc4674d8d0f9"
          ],
          "display_name": false
        },
        {
          "uuid": "4ef931bb-102d-45ac-8995-7d368fac19e2",
          "name": "quazepam [INN]",
          "stdName": "QUAZEPAM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6c0a6df-1375-419a-a794-1d33d1b06791"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "9e9c91d1-a44e-4bcd-9a3b-1819b9088e63",
          "name": "Biological Half-life",
          "value": {
            "uuid": "6a5e0437-5c67-40bb-a7b9-61dd7e5ae17e",
            "average": 39,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "2d95ab22-8203-f6a8-ee97-b6f4ddcc9cd4"
          ]
        }
      ]
    }
  ]
}