{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "436b03f3-4d01-4daf-90f1-f34e5d4d2fa9",
          "code": "902-83-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=902-83-0",
          "code_system": "CAS",
          "references": [
            "86d41b66-75ce-429e-b0d6-6bc8f87e5a39",
            "5a410092-4419-490c-9fe3-01f777fddeda"
          ]
        },
        {
          "uuid": "bff9f916-ee6d-4b19-aa73-17a65ba9eac0",
          "code": "212-989-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.809",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "86d41b66-75ce-429e-b0d6-6bc8f87e5a39"
          ]
        },
        {
          "uuid": "02198050-1a96-0715-d198-b11c839f3217",
          "code": "13482",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13482",
          "code_system": "PUBCHEM",
          "references": [
            "ff417196-c405-976f-4e3e-93ac7fe63405"
          ]
        },
        {
          "uuid": "add30e2a-772b-4a82-9ffb-113ac03185b5",
          "code": "JEX5ZST2EZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "5a410092-4419-490c-9fe3-01f777fddeda"
          ]
        },
        {
          "uuid": "07ca8662-e245-7114-810e-c3427bab8229",
          "code": "16338",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=16338",
          "code_system": "NSC",
          "references": [
            "9c609c40-8bad-b10c-cdf2-05ef2b3df24d"
          ]
        },
        {
          "uuid": "695f5502-dc03-64fe-404e-7a0f031c8892",
          "code": "DTXSID601009245",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601009245",
          "code_system": "EPA CompTox",
          "references": [
            "9015c089-04ab-4257-d619-ac6d2195b9de"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1c42af98-6fc0-4a74-8c43-933b5d5908cc",
          "amount": {
            "uuid": "b8720708-c9f4-4d25-82fb-11c28310c069"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "7811b8c1-035b-4582-8db3-a9118647c3da"
          ],
          "related_substance": {
            "uuid": "9eda2359-c263-4304-b9af-6022f205cb85",
            "refuuid": "2658fcb5-627b-4774-9796-62c1cec1be48",
            "name": "2-(Diethylamino)ethyl 2-chloro-2,2-diphenylacetate",
            "unii": "8L6ED83WXU",
            "linking_id": "8L6ED83WXU",
            "ref_pname": "2-(Diethylamino)ethyl 2-chloro-2,2-diphenylacetate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3ca05fb0-1823-43a4-bd50-209907d361a5",
          "name": "Acetic acid, chlorodiphenyl-, 2-(diethylamino)ethyl ester, hydrochloride",
          "stdName": "ACETIC ACID, CHLORODIPHENYL-, 2-(DIETHYLAMINO)ETHYL ESTER, HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a410092-4419-490c-9fe3-01f777fddeda"
          ],
          "display_name": false
        },
        {
          "uuid": "1c5ff419-f1bd-4989-8566-a7c45b6cd354",
          "name": "Benzeneacetic acid, α-chloro-α-phenyl-, 2-(diethylamino)ethyl ester, hydrochloride (1:1)",
          "stdName": "BENZENEACETIC ACID, .ALPHA.-CHLORO-.ALPHA.-PHENYL-, 2-(DIETHYLAMINO)ETHYL ESTER, HYDROCHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a410092-4419-490c-9fe3-01f777fddeda"
          ],
          "display_name": false
        },
        {
          "uuid": "0a965f2d-8095-49ad-a7ee-afb256b0cc97",
          "name": "Diafen",
          "stdName": "DIAFEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d6f3e16-0c58-4895-abe2-c476c94a1f8c",
            "8965c234-3e24-44dc-bbd1-aa1a6bdefc48",
            "5a410092-4419-490c-9fe3-01f777fddeda"
          ],
          "display_name": true
        },
        {
          "uuid": "2aaabefd-3d45-43c2-9f9a-833e9ccfdd4d",
          "name": "Diaminophen",
          "stdName": "DIAMINOPHEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a410092-4419-490c-9fe3-01f777fddeda"
          ],
          "display_name": false
        },
        {
          "uuid": "22e72a79-28fb-474d-ba71-c7f44de145f6",
          "name": "Diamiphen",
          "stdName": "DIAMIPHEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a410092-4419-490c-9fe3-01f777fddeda"
          ],
          "display_name": false
        },
        {
          "uuid": "b3fc00ea-acff-4e73-b40c-55a5e8f1b0d3",
          "name": "Diamiphene",
          "stdName": "DIAMIPHENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a410092-4419-490c-9fe3-01f777fddeda"
          ],
          "display_name": false
        },
        {
          "uuid": "e1849713-a878-4c88-a4da-5c53c542963c",
          "name": "Diaphen",
          "stdName": "DIAPHEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a410092-4419-490c-9fe3-01f777fddeda"
          ],
          "display_name": false
        },
        {
          "uuid": "0e98970b-8c6b-430e-96a0-7175696c166d",
          "name": "NSC-16338",
          "stdName": "NSC-16338",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d6f3e16-0c58-4895-abe2-c476c94a1f8c",
            "8965c234-3e24-44dc-bbd1-aa1a6bdefc48"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5d6f3e16-0c58-4895-abe2-c476c94a1f8c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8965c234-3e24-44dc-bbd1-aa1a6bdefc48",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86d41b66-75ce-429e-b0d6-6bc8f87e5a39",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394153000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff417196-c405-976f-4e3e-93ac7fe63405",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "5a410092-4419-490c-9fe3-01f777fddeda",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7811b8c1-035b-4582-8db3-a9118647c3da",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9c609c40-8bad-b10c-cdf2-05ef2b3df24d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9015c089-04ab-4257-d619-ac6d2195b9de",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "46058933-2deb-4bef-b8d0-aca80ca56165",
          "id": "46058933-2deb-4bef-b8d0-aca80ca56165",
          "molfile": "\n  Marvin  06182316432D          \n\n  1  0  0  0  0  0            999 V2000\n   17.7100   -2.7925    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3561a68a-34ee-457e-8cf4-a03d2ea75fc3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "18b3377b-bdcc-49c2-8ef5-ef14df2192de",
          "id": "18b3377b-bdcc-49c2-8ef5-ef14df2192de",
          "molfile": "\n  Marvin  06182316432D          \n\n 24 25  0  0  0  0            999 V2000\n   11.9488   -3.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7738   -3.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9488   -4.7035    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   13.1863   -4.5930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1863   -3.1641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0113   -4.5930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4238   -5.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2488   -5.3076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6613   -4.5930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6613   -6.0220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4863   -4.5930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2488   -6.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1238   -3.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7113   -4.5930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7113   -3.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8863   -4.5930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8863   -3.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4738   -3.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9488   -3.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6632   -2.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2343   -2.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6632   -1.8160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2343   -1.8160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9488   -1.4035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1 13  1  0  0  0  0\n  1 19  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 16 18  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 22 24  2  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)CCOC(=O)C(c1ccccc1)(c2ccccc2)Cl",
          "formula": "C20H24ClNO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b75d4801-b50c-4e23-9524-8a5b83cc290a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "345.8637",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f9ff9086-df6d-4154-9328-a5a105f510a4",
      "version": "12",
      "structure": {
        "id": "7acc4fe9-14bb-48dd-b5cf-394d88eef17c",
        "molfile": "2-(Diethylamino)ethyl ?-chloro-?-phenylbenzeneacetate\n   JSDraw206182316432D\n\n 25 25  0  0  0  0              0 V2000\n   22.5940   -7.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1540   -7.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5940   -8.8939    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   24.9340   -8.6850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.9340   -5.9830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4940   -8.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2740  -10.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8340  -10.0361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   29.6140   -8.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.6140  -11.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.1740   -8.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8340  -12.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.0340   -7.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2540   -8.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2540   -5.9830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6940   -8.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6940   -5.9830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9140   -7.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5940   -5.7739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9449   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2431   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9449   -3.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2431   -3.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5940   -2.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.4880   -5.2804    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1 13  1  0  0  0  0\n  1 19  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 16 18  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 22 24  2  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
        "smiles": "CCN(CC)CCOC(=O)C(c1ccccc1)(c2ccccc2)Cl.Cl",
        "formula": "C20H24ClNO2.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "382.3246",
        "optical_activity": "NONE",
        "references": [
          "5d6f3e16-0c58-4895-abe2-c476c94a1f8c",
          "5a410092-4419-490c-9fe3-01f777fddeda"
        ],
        "stereo_centers": 0
      },
      "unii": "JEX5ZST2EZ"
    }
  ]
}