{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "162fe7c8-c957-40e2-8e91-f8d0cb38aab2",
          "code": "72490-01-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=72490-01-8",
          "code_system": "CAS",
          "references": [
            "472f859d-4021-45e8-a334-19058785a2be",
            "1574c0b8-17b9-4fb6-b6c0-5556eb77a1a4"
          ]
        },
        {
          "uuid": "1730f3bc-44a2-413a-a5b4-bf8d1dbe6dd0",
          "code": "C052034",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67052034",
          "code_system": "MESH",
          "references": [
            "472f859d-4021-45e8-a334-19058785a2be"
          ]
        },
        {
          "uuid": "09da9200-d470-44d6-86ce-0c54154a874d",
          "code": "FENOXYCARB",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fenoxycarb",
          "code_system": "WIKIPEDIA",
          "references": [
            "472f859d-4021-45e8-a334-19058785a2be"
          ]
        },
        {
          "uuid": "6f24d391-593a-41e6-a641-b4d6f16bdce4",
          "code": "125301",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2358",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "472f859d-4021-45e8-a334-19058785a2be"
          ]
        },
        {
          "uuid": "f7ba31a9-dbf1-4aa3-ba24-7cd653ac0f22",
          "code": "m5287",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5287?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "472f859d-4021-45e8-a334-19058785a2be"
          ]
        },
        {
          "uuid": "519e8e1f-299f-496d-a69c-f995f83e2ab2",
          "code": "276-696-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.069.702",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "472f859d-4021-45e8-a334-19058785a2be"
          ]
        },
        {
          "uuid": "fe7b790b-a38b-448e-b37d-9d15fe0834c4",
          "code": "51605",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/51605",
          "code_system": "PUBCHEM",
          "references": [
            "472f859d-4021-45e8-a334-19058785a2be"
          ]
        },
        {
          "uuid": "27554d96-7133-5967-79f5-53a6fc6c23db",
          "code": "6635",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6635",
          "code_system": "HSDB",
          "references": [
            "e8de343c-8734-032c-02b3-185c2234d91d"
          ]
        },
        {
          "uuid": "dadb9585-339a-af14-a7d1-abd502ca0986",
          "code": "DTXSID7032393",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7032393",
          "code_system": "EPA CompTox",
          "references": [
            "f10e4e69-ec78-91a7-4679-77632f6bca8a"
          ]
        },
        {
          "uuid": "48cd60de-f441-4774-9814-4eae5fbeaffe",
          "code": "JEN0LSV1G9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f88b9ae4-39c3-e562-545a-01ff61dc777e",
          "code": "5009",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5009",
          "code_system": "CHEBI",
          "references": [
            "be33d849-1155-341d-8f5f-a5b54e3d81e8"
          ]
        },
        {
          "uuid": "aa195828-a2e1-47fc-475e-46892829631e",
          "code": "300000020472",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "61a0537b-cb21-4369-6064-9ae898f2436f"
          ]
        },
        {
          "uuid": "0dcef753-a65f-8aa4-31d2-bd815a93dada",
          "code": "fenoxycarb",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenoxycarb.html",
          "code_system": "ALANWOOD",
          "references": [
            "0f353ec1-0bb8-69fb-049e-24bf87efbe23"
          ]
        },
        {
          "uuid": "f0f0b2c3-96b4-6e25-d59a-bc080342365d",
          "code": "C163658",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C163658",
          "code_system": "NCI_THESAURUS",
          "references": [
            "272acf5b-5718-e304-839c-f7eb87888dc7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ab04ac85-b661-451c-b749-051b3db68744",
          "name": "ABG 6215",
          "stdName": "ABG 6215",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "6ea36691-62ea-41b1-9803-e4faacde4897"
          ],
          "display_name": false
        },
        {
          "uuid": "cb8df3bf-bc0a-4201-8ba3-2dffbcc29a2a",
          "name": "ABG-6215",
          "stdName": "ABG-6215",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "6ea36691-62ea-41b1-9803-e4faacde4897"
          ],
          "display_name": false
        },
        {
          "uuid": "cbdc34c0-490f-4bcb-bba6-2baf2636a437",
          "name": "CARBAMIC ACID, N-(2-(4-PHENOXYPHENOXY)ETHYL)-, ETHYL ESTER",
          "stdName": "CARBAMIC ACID, N-(2-(4-PHENOXYPHENOXY)ETHYL)-, ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "6ea36691-62ea-41b1-9803-e4faacde4897"
          ],
          "display_name": false
        },
        {
          "uuid": "40a51f18-718e-41b8-963f-1ff4d089c04f",
          "name": "ECLIPSE",
          "stdName": "ECLIPSE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "6ea36691-62ea-41b1-9803-e4faacde4897"
          ],
          "display_name": false
        },
        {
          "uuid": "280e0fb0-1ee0-4387-aa56-019e23e3a411",
          "name": "ETHYL (2-(4-PHENOXYPHENOXY)ETHYL)CARBAMATE",
          "stdName": "ETHYL (2-(4-PHENOXYPHENOXY)ETHYL)CARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "6ea36691-62ea-41b1-9803-e4faacde4897"
          ],
          "display_name": false
        },
        {
          "uuid": "b3f7eb6e-4342-4d33-89b9-7c9d9bb3ac23",
          "name": "FENOXYCARB",
          "stdName": "FENOXYCARB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9402dc0b-cdc7-492b-bf37-ec77d64c47f8",
            "284cd84c-4c2a-44df-b28f-d8c46e80f69f",
            "47cfa7b0-71a5-4dd2-9373-48bc422756e8",
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "a9b571a6-dbe7-4af1-9d4c-17945305bbe8",
            "92a98a1f-79cc-4d03-a32b-cfdd2c6f3902",
            "a6fc02c5-3891-46b0-b0d1-18c0d951812f",
            "a42e2005-fbb0-427a-8a00-d8752603bff4"
          ],
          "display_name": true
        },
        {
          "uuid": "7666070b-b056-4959-9c6e-186343c5a982",
          "name": "FENOXYCARB [HSDB]",
          "stdName": "FENOXYCARB [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "a6fc02c5-3891-46b0-b0d1-18c0d951812f"
          ],
          "display_name": false
        },
        {
          "uuid": "b45fd7b9-b9b0-4700-9604-6799945b8de3",
          "name": "FENOXYCARB [ISO]",
          "stdName": "FENOXYCARB [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "a42e2005-fbb0-427a-8a00-d8752603bff4"
          ],
          "display_name": false
        },
        {
          "uuid": "1afee0e1-918b-47ba-a2a5-0774d837359b",
          "name": "FENOXYCARB [MI]",
          "stdName": "FENOXYCARB [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "92a98a1f-79cc-4d03-a32b-cfdd2c6f3902"
          ],
          "display_name": false
        },
        {
          "uuid": "ae335ff7-7004-4385-ac6b-eb85aea15873",
          "name": "INSEGAR",
          "stdName": "INSEGAR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "aec9b389-09f2-4de9-b9c8-4952edba2832"
          ],
          "display_name": false
        },
        {
          "uuid": "21acc942-78fd-43be-8bbf-03f949ddc6fe",
          "name": "LOGIC",
          "stdName": "LOGIC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "aec9b389-09f2-4de9-b9c8-4952edba2832"
          ],
          "display_name": false
        },
        {
          "uuid": "b37011ad-c186-4217-8d17-c7ac662a5c23",
          "name": "PHENOXYCARB",
          "stdName": "PHENOXYCARB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "6ea36691-62ea-41b1-9803-e4faacde4897"
          ],
          "display_name": false
        },
        {
          "uuid": "2bb9ab85-2703-418f-b80c-71cfbd9075d9",
          "name": "VARIKILL",
          "stdName": "VARIKILL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
            "aec9b389-09f2-4de9-b9c8-4952edba2832"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "284cd84c-4c2a-44df-b28f-d8c46e80f69f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6ea36691-62ea-41b1-9803-e4faacde4897",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e64e91a-0fc3-4faf-9c98-f32ae485ae22",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aec9b389-09f2-4de9-b9c8-4952edba2832",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92a98a1f-79cc-4d03-a32b-cfdd2c6f3902",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6fc02c5-3891-46b0-b0d1-18c0d951812f",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a42e2005-fbb0-427a-8a00-d8752603bff4",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "472f859d-4021-45e8-a334-19058785a2be",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "271f82ea-a2c8-4ff5-83bf-bcceb35f54c0",
          "citation": "SRS import [JEN0LSV1G9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JEN0LSV1G9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8c2f867-162c-4d54-beda-b86d5864ea34",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47cfa7b0-71a5-4dd2-9373-48bc422756e8",
          "citation": "FENOXYCARB [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9402dc0b-cdc7-492b-bf37-ec77d64c47f8",
          "citation": "FENOXYCARB [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a9b571a6-dbe7-4af1-9d4c-17945305bbe8",
          "citation": "FENOXYCARB [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8de343c-8734-032c-02b3-185c2234d91d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+72490-01-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f10e4e69-ec78-91a7-4679-77632f6bca8a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=72490-01-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0f353ec1-0bb8-69fb-049e-24bf87efbe23",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "272acf5b-5718-e304-839c-f7eb87888dc7",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "1574c0b8-17b9-4fb6-b6c0-5556eb77a1a4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "be33d849-1155-341d-8f5f-a5b54e3d81e8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "61a0537b-cb21-4369-6064-9ae898f2436f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b9001718-50c2-4934-9ab9-f0bc30cfb29f",
          "id": "b9001718-50c2-4934-9ab9-f0bc30cfb29f",
          "molfile": "\n  Marvin  01132109342D          \n\n 22 23  0  0  0  0            999 V2000\n   12.0508   -4.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3387   -4.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6265   -4.7841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8961   -4.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8961   -3.5294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1878   -4.7841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4496   -4.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7405   -4.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0215   -4.3727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3017   -4.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3017   -5.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5858   -6.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8775   -5.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1394   -6.0686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4118   -5.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6813   -6.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9761   -5.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9761   -4.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6583   -4.4180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4118   -4.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8775   -4.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5858   -4.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 22 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 21  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)NCCOc1ccc(cc1)Oc2ccccc2",
          "formula": "C17H19NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6e5908d0-713d-47ee-86f8-7c5742d28e9b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "301.3377",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "84cc19f1-6e20-4807-bc1c-e719aaf96ac9",
      "version": "9",
      "structure": {
        "id": "8ca8f84f-0291-42e0-9399-f013a0e9e58c",
        "molfile": "\n  Marvin  01132107182D          \n\n 22 23  0  0  0  0            999 V2000\n    4.8775   -5.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1394   -6.0686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4118   -5.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6813   -6.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9761   -5.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9761   -4.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6583   -4.4180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4118   -4.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5858   -6.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3017   -5.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3017   -4.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0215   -4.3727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7405   -4.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4496   -4.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1878   -4.7841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8961   -4.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6265   -4.7841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3387   -4.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0508   -4.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8961   -3.5294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5858   -4.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8775   -4.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 16 20  2  0  0  0  0\n 21 11  2  0  0  0  0\n 22 21  1  0  0  0  0\n  1 22  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)NCCOc1ccc(cc1)Oc2ccccc2",
        "formula": "C17H19NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "301.3377",
        "optical_activity": "NONE",
        "references": [
          "e8c2f867-162c-4d54-beda-b86d5864ea34",
          "271f82ea-a2c8-4ff5-83bf-bcceb35f54c0"
        ],
        "stereo_centers": 0
      },
      "unii": "JEN0LSV1G9"
    }
  ]
}