{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5a747a48-6dc4-497b-aebd-55683c9dd8b4",
          "code": "2921-88-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2921-88-2",
          "code_system": "CAS",
          "references": [
            "a4c62e72-7e34-487c-8c59-a8ac48e59b41",
            "27d7cd73-0959-4166-93a8-da471172a844"
          ]
        },
        {
          "uuid": "37641161-997e-4bb2-b6af-8c32e921a44e",
          "code": "D004390",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68004390",
          "code_system": "MESH",
          "references": [
            "a4c62e72-7e34-487c-8c59-a8ac48e59b41"
          ]
        },
        {
          "uuid": "c2a8e0d0-e6b6-4504-8efa-043313245eea",
          "code": "CHLORPYRIFOS",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Chlorpyrifos",
          "code_system": "WIKIPEDIA",
          "references": [
            "a4c62e72-7e34-487c-8c59-a8ac48e59b41"
          ]
        },
        {
          "uuid": "ddaee348-11ec-4048-aee4-2dce969e1cb8",
          "code": "59101",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1822",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "a4c62e72-7e34-487c-8c59-a8ac48e59b41"
          ]
        },
        {
          "uuid": "7814e076-1275-47b6-9987-bbe61fcd4710",
          "code": "m3465",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3465?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a4c62e72-7e34-487c-8c59-a8ac48e59b41"
          ]
        },
        {
          "uuid": "ab36ebdb-94f0-482a-9432-c533cdd5c5ac",
          "code": "SUB33137",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a4c62e72-7e34-487c-8c59-a8ac48e59b41"
          ]
        },
        {
          "uuid": "dbaf59ae-0d74-413c-9600-08854f36c979",
          "code": "CHEMBL463210",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL463210",
          "code_system": "ChEMBL",
          "references": [
            "a4c62e72-7e34-487c-8c59-a8ac48e59b41"
          ]
        },
        {
          "uuid": "851ca430-9e94-4a1a-ae17-38d098430a55",
          "code": "220-864-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.969",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a4c62e72-7e34-487c-8c59-a8ac48e59b41"
          ]
        },
        {
          "uuid": "a26ea8c5-0ac5-4a9b-b82c-90f551873b91",
          "code": "2730",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2730",
          "code_system": "PUBCHEM",
          "references": [
            "a4c62e72-7e34-487c-8c59-a8ac48e59b41"
          ]
        },
        {
          "uuid": "55c1fb38-5260-e33f-0305-cd0baf7a8eea",
          "code": "389",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/389",
          "code_system": "HSDB",
          "references": [
            "560e8ef3-bb4b-5705-c135-5200ee7e0e59"
          ]
        },
        {
          "uuid": "d6824094-a577-de28-de6e-6e423b2d08dd",
          "code": "DTXSID4020458",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4020458",
          "code_system": "EPA CompTox",
          "references": [
            "2e26968b-3d7e-e131-badb-eef332cd4efd"
          ]
        },
        {
          "uuid": "99ccea30-35b7-43d8-9da1-4c48a7f39849",
          "code": "JCS58I644W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bd177a69-80e3-709d-e586-3c0744321afc",
          "code": "34631",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34631",
          "code_system": "CHEBI",
          "references": [
            "72cb78db-4500-0cb6-e5dd-6d9d0b6036d5"
          ]
        },
        {
          "uuid": "cd1436b4-2cdc-2e24-312b-9e28361ba285",
          "code": "100000125916",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "25a9c274-54a4-6e49-42a7-0a483c1df0dc"
          ]
        },
        {
          "uuid": "3d8f5e3a-55b5-3c39-4637-70450b0a87aa",
          "code": "chlorpyrifos",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/chlorpyrifos.html",
          "code_system": "ALANWOOD",
          "references": [
            "0ef9117c-1cb0-cace-9bff-761470643327"
          ]
        },
        {
          "uuid": "d57b6173-73f9-0083-4938-c94155a8549f",
          "code": "C163641",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C163641",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e2ffbb8f-4645-917b-abc3-5f7854d7a81a"
          ]
        },
        {
          "uuid": "9d440303-9205-2e5e-14bd-a14ceaea9430",
          "code": "755891",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=755891",
          "code_system": "NSC",
          "references": [
            "93c0b0e3-a5a7-1a07-b1e4-a9f5aca33f16"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a4b4c51c-867b-4453-aaf8-2283c4364c2c",
          "amount": {
            "uuid": "fae21f50-dbb9-4826-b860-b2a4f2add2ae"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8d3c1e92-fbb6-428c-b398-5a62cb6a459c",
            "refuuid": "e7764c43-b54e-458f-b860-77c6b4ecab13",
            "name": "CHLORPYRIFOS",
            "unii": "JCS58I644W",
            "linking_id": "JCS58I644W",
            "ref_pname": "CHLORPYRIFOS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8a403a0e-78a1-4cc0-806f-159011ccbb7d",
          "amount": {
            "uuid": "2c4d9592-2a8d-4f1f-bbde-071f22f01c56"
          },
          "type": "PARENT->METABOLITE",
          "related_substance": {
            "uuid": "19e8d405-3874-4373-907e-fb70fa9782f9",
            "refuuid": "0d1cf3c0-ccaf-4406-b0ff-8464c82545cc",
            "name": "CHLORPYRIFOS OXON",
            "unii": "7RC6H1MPX6",
            "linking_id": "7RC6H1MPX6",
            "ref_pname": "CHLORPYRIFOS OXON"
          }
        },
        {
          "uuid": "bb063a79-7a89-4c77-a77c-a5767cb89fc9",
          "amount": {
            "uuid": "1c08d722-92c4-4bd0-9e43-7ab372dcdfa2"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "04fc8834-7914-4343-a4f4-cb98e4282dcb"
          ],
          "related_substance": {
            "uuid": "18608f0c-6494-46a2-afb8-783f084e9002",
            "refuuid": "aeceb5cc-3e49-45d7-aeaf-7e6b71622f1c",
            "name": "3,5,6-TRICHLORO-2-PYRIDINONE",
            "unii": "JS52YZJ84A",
            "linking_id": "JS52YZJ84A",
            "ref_pname": "3,5,6-TRICHLORO-2-PYRIDINONE"
          }
        },
        {
          "uuid": "7f5baaf3-7bd0-4369-8421-2da0cf97ffab",
          "amount": {
            "uuid": "84b82ad7-0550-40ed-9c20-a0a3556f7ee8"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "46b1aefa-ec21-4b11-a14c-e41cb49d132c"
          ],
          "related_substance": {
            "uuid": "66535f86-b3d7-4e33-9221-8084f1532500",
            "refuuid": "d1355093-3173-459b-b6d5-690458e92717",
            "name": "DIETHYL PHOSPHATE",
            "unii": "W0QQU4CAB7",
            "linking_id": "W0QQU4CAB7",
            "ref_pname": "DIETHYL PHOSPHATE"
          }
        },
        {
          "uuid": "3e61662f-9816-43fe-828a-55c1718a7aa4",
          "amount": {
            "uuid": "732c0686-5611-4fbc-a7f1-0485d80beeb7"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "da565d6f-64e2-40a4-959f-a044f0e604f2"
          ],
          "related_substance": {
            "uuid": "c73de381-4c7b-4d31-a28b-0084369afc65",
            "refuuid": "260fe47d-9d0e-4034-a1b5-a0cb68d3eea3",
            "name": "O,O-DIETHYL PHOSPHOROTHIOATE",
            "unii": "FND2ADQ374",
            "linking_id": "FND2ADQ374",
            "ref_pname": "O,O-DIETHYL PHOSPHOROTHIOATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "10f8f947-faa5-4676-91d0-5d515d25a8d3",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "98c34577-c565-3ef5-ab27-30e49e65c278"
          ],
          "related_substance": {
            "uuid": "fe8c9898-5a87-4227-96bb-5c42d87827d8",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "876b7ce7-c22a-45f3-b4a7-d9f525f08a26",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "98c34577-c565-3ef5-ab27-30e49e65c278"
          ],
          "related_substance": {
            "uuid": "665a7477-d5d9-4c1e-8afc-f8bc52d87d2e",
            "refuuid": "83e3f07e-be5b-48ac-be08-0c68c20e8bf0",
            "name": "CYTOCHROME P450 2B6",
            "unii": "0UY97CSG1T",
            "linking_id": "0UY97CSG1T",
            "ref_pname": "CYTOCHROME P450 2B6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cea74ac5-7211-4cd4-943c-d1c767f0437b",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "98c34577-c565-3ef5-ab27-30e49e65c278"
          ],
          "related_substance": {
            "uuid": "252513e1-cd73-4930-8b36-f6cfeb958aca",
            "refuuid": "4f746c19-0e0a-447a-beda-d28b91d6f23e",
            "name": "CYTOCHROME P450 2C19",
            "unii": "081I12ZA58",
            "linking_id": "081I12ZA58",
            "ref_pname": "CYTOCHROME P450 2C19",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7274b061-73e7-407c-b021-e533735c8d06",
          "comments": "Screening of potential CYP2B6 inhibitions illustrates that CYP2B6 activity was extensively inhibited by all tested organophosphate pesticides. Inhibition percentages were 100% with chlorpyrifos.",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "3807029c-dfc2-9c2f-d5b9-7acf825d12cb"
          ],
          "related_substance": {
            "uuid": "80b397fc-f1da-47d1-af1e-2df8bb025a80",
            "refuuid": "83e3f07e-be5b-48ac-be08-0c68c20e8bf0",
            "name": "CYTOCHROME P450 2B6",
            "unii": "0UY97CSG1T",
            "linking_id": "0UY97CSG1T",
            "ref_pname": "CYTOCHROME P450 2B6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0df7dff1-0e90-4254-a1e7-05000ea421f1",
          "amount": {
            "uuid": "b98b24eb-9c03-428d-b174-512dd5b5c63d"
          },
          "comments": "Chlorpyrifos inhibited CYP1A1/2 activities more than 90%.",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "81b5c223-634d-43b5-82f9-be1df2649009"
          ],
          "related_substance": {
            "uuid": "eed55a13-25a0-47a0-9028-89cfea29825e",
            "refuuid": "af140fab-1943-47e6-b0eb-bc830d08e98a",
            "name": "CYTOCHROME P450 1A1",
            "unii": "9DX651UO0D",
            "linking_id": "9DX651UO0D",
            "ref_pname": "CYTOCHROME P450 1A1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9d851932-8a86-4b5a-964c-722960f001f2",
          "comments": "Chlorpyrifos inhibited CYP1A1/2 activities more than 90%.",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "3807029c-dfc2-9c2f-d5b9-7acf825d12cb"
          ],
          "related_substance": {
            "uuid": "8367eedc-e5bc-4f3e-967a-bd82b0b06808",
            "refuuid": "2964cc53-40a9-4b2b-b19c-d61342fadb5a",
            "name": "CYTOCHROME P450 1A2",
            "unii": "VK4SQL11C0",
            "linking_id": "VK4SQL11C0",
            "ref_pname": "CYTOCHROME P450 1A2",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "75149dad-fbbe-4827-aac1-5dda8b294a35",
          "name": "CHLOROPYRIFOS",
          "stdName": "CHLOROPYRIFOS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "928d6b5b-4071-403e-97f5-dd0ceb14b93d",
            "f95bdd96-265e-40c8-a984-8c3df3c2836b"
          ],
          "display_name": false
        },
        {
          "uuid": "dce3335a-494a-47bd-8616-d04d9b78e86a",
          "name": "CHLORPYRIFOS",
          "stdName": "CHLORPYRIFOS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a03e561-1dd9-4c94-a23a-664e2d7ef0a8",
            "70742919-709d-4817-b010-e8f42ceec5ac",
            "928d6b5b-4071-403e-97f5-dd0ceb14b93d",
            "23ec0a9b-8dbe-49c4-8768-c5cf33211f05",
            "a9e80ad7-c558-4938-b0b2-18b688bab731",
            "1ef3c822-4978-4960-ab8a-73d2e5a87c25",
            "1602de5a-ce60-4fcc-a1b2-5fafbb641992",
            "c4f19bc5-28f8-4196-a131-44c3ebdd572c",
            "2f5817f3-6406-4e08-9f31-39e903d162f7",
            "cc92d30b-0762-4f90-a2da-7f05fa2488dc"
          ],
          "display_name": true
        },
        {
          "uuid": "70d88001-c452-42c9-aa64-2edb830d2221",
          "name": "CHLORPYRIFOS [HSDB]",
          "stdName": "CHLORPYRIFOS [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4f19bc5-28f8-4196-a131-44c3ebdd572c",
            "928d6b5b-4071-403e-97f5-dd0ceb14b93d"
          ],
          "display_name": false
        },
        {
          "uuid": "9c403b31-b678-4b90-b04e-c296525448e2",
          "name": "CHLORPYRIFOS [ISO]",
          "stdName": "CHLORPYRIFOS [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "928d6b5b-4071-403e-97f5-dd0ceb14b93d",
            "23ec0a9b-8dbe-49c4-8768-c5cf33211f05"
          ],
          "display_name": false
        },
        {
          "uuid": "31ddadb1-a2db-4f15-ba83-96f3eacf3906",
          "name": "CHLORPYRIFOS [MART.]",
          "stdName": "CHLORPYRIFOS [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9e80ad7-c558-4938-b0b2-18b688bab731"
          ],
          "display_name": false
        },
        {
          "uuid": "20f20e44-acce-44d5-97e1-d16131f3e633",
          "name": "CHLORPYRIFOS [MI]",
          "stdName": "CHLORPYRIFOS [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc92d30b-0762-4f90-a2da-7f05fa2488dc",
            "928d6b5b-4071-403e-97f5-dd0ceb14b93d"
          ],
          "display_name": false
        },
        {
          "uuid": "fda12905-29d0-489d-a219-984834fe29b2",
          "name": "DURSBAN",
          "stdName": "DURSBAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "344b8a81-9bca-4531-940a-4e4a46ff233c"
          ],
          "display_name": false
        },
        {
          "uuid": "d6c83018-4a85-4ab1-b7b2-3d8c02191594",
          "name": "ENT-27311",
          "stdName": "ENT-27311",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f5817f3-6406-4e08-9f31-39e903d162f7",
            "928d6b5b-4071-403e-97f5-dd0ceb14b93d"
          ],
          "display_name": false
        },
        {
          "uuid": "8ef3f94d-04cc-90fe-458d-ca50be902a07",
          "name": "NSC-755891",
          "stdName": "NSC-755891",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93c0b0e3-a5a7-1a07-b1e4-a9f5aca33f16"
          ],
          "display_name": false
        },
        {
          "uuid": "96b7bd3e-66a5-4ced-af8d-20d0d1181e91",
          "name": "O,O-DIETHYL O-(3,5,6-TRICHLORO-2-PYRIDINYL) PHOSPHOROTHIOATE",
          "stdName": "O,O-DIETHYL O-(3,5,6-TRICHLORO-2-PYRIDINYL) PHOSPHOROTHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ecae67b-eec3-47fb-9a44-675f3b313d89",
            "ca6a31f5-a516-4b03-b118-67d66490cd76"
          ],
          "display_name": false
        },
        {
          "uuid": "c003fb57-fa0b-4333-89ea-2d92838588e1",
          "name": "O,O-DIETHYL O-3,5,6-TRICHLORO-2-PYRIDYL PHOSPHOROTHIOATE",
          "stdName": "O,O-DIETHYL O-3,5,6-TRICHLORO-2-PYRIDYL PHOSPHOROTHIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84ca6e8f-c884-4674-82ac-a118e5035a94"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "344b8a81-9bca-4531-940a-4e4a46ff233c",
          "citation": "WEB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2f5817f3-6406-4e08-9f31-39e903d162f7",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84ca6e8f-c884-4674-82ac-a118e5035a94",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "928d6b5b-4071-403e-97f5-dd0ceb14b93d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ecae67b-eec3-47fb-9a44-675f3b313d89",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca6a31f5-a516-4b03-b118-67d66490cd76",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9e80ad7-c558-4938-b0b2-18b688bab731",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc92d30b-0762-4f90-a2da-7f05fa2488dc",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4f19bc5-28f8-4196-a131-44c3ebdd572c",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23ec0a9b-8dbe-49c4-8768-c5cf33211f05",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f95bdd96-265e-40c8-a984-8c3df3c2836b",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4c62e72-7e34-487c-8c59-a8ac48e59b41",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b39edd4-bdcc-45f4-9108-daf5bf3a35b7",
          "citation": "SRS import [JCS58I644W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JCS58I644W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a03e561-1dd9-4c94-a23a-664e2d7ef0a8",
          "citation": "CHLORPYRIFOS [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "70742919-709d-4817-b010-e8f42ceec5ac",
          "citation": "CHLORPYRIFOS [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1602de5a-ce60-4fcc-a1b2-5fafbb641992",
          "citation": "CHLORPYRIFOS [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1ef3c822-4978-4960-ab8a-73d2e5a87c25",
          "citation": "CHLORPYRIFOS [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "560e8ef3-bb4b-5705-c135-5200ee7e0e59",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+2921-88-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2e26968b-3d7e-e131-badb-eef332cd4efd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2921-88-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "27d7cd73-0959-4166-93a8-da471172a844",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "da565d6f-64e2-40a4-959f-a044f0e604f2",
          "citation": "Smith, Jordan Ned, et al. \"In vitro age-dependent enzymatic metabolism of chlorpyrifos and chlorpyrifos-oxon in human hepatic microsomes and chlorpyrifos-oxon in plasma.\" Drug metabolism and disposition 39.8 (2011): 1353-1362.",
          "url": "http://dmd.aspetjournals.org/content/dmd/39/8/1353.full.pdf",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "98c34577-c565-3ef5-ab27-30e49e65c278",
          "citation": "Foxenberg, Robert J., et al. \"Human hepatic cytochrome p450-specific metabolism of parathion and chlorpyrifos.\" Drug metabolism and disposition 35.2 (2007): 189-193.",
          "url": "https://dmd.aspetjournals.org/content/dmd/35/2/189.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "46b1aefa-ec21-4b11-a14c-e41cb49d132c",
          "citation": "Smith, Jordan Ned, et al. \"In vitro age-dependent enzymatic metabolism of chlorpyrifos and chlorpyrifos-oxon in human hepatic microsomes and chlorpyrifos-oxon in plasma.\" Drug metabolism and disposition 39.8 (2011): 1353-1362.",
          "url": "http://dmd.aspetjournals.org/content/dmd/39/8/1353.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "34c796b9-e80f-4ca4-99e6-20cb631b4532",
          "citation": "Smith, Jordan Ned, et al. \"In vitro age-dependent enzymatic metabolism of chlorpyrifos and chlorpyrifos-oxon in human hepatic microsomes and chlorpyrifos-oxon in plasma.\" Drug metabolism and disposition 39.8 (2011): 1353-1362.",
          "url": "http://dmd.aspetjournals.org/content/dmd/39/8/1353.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "04fc8834-7914-4343-a4f4-cb98e4282dcb",
          "citation": "Smith, Jordan Ned, et al. \"In vitro age-dependent enzymatic metabolism of chlorpyrifos and chlorpyrifos-oxon in human hepatic microsomes and chlorpyrifos-oxon in plasma.\" Drug metabolism and disposition 39.8 (2011): 1353-1362.",
          "url": "http://dmd.aspetjournals.org/content/dmd/39/8/1353.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0ef9117c-1cb0-cace-9bff-761470643327",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "e2ffbb8f-4645-917b-abc3-5f7854d7a81a",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "3807029c-dfc2-9c2f-d5b9-7acf825d12cb",
          "citation": "Abass, Khaled, Miia Turpeinen, and Olavi Pelkonen. \"An evaluation of the cytochrome P450 inhibition potential of selected pesticides in human hepatic microsomes.\" Journal of Environmental Science and Health, Part B 44.6 (2009): 553-563.",
          "url": "https://www.tandfonline.com/doi/pdf/10.1080/03601230902997766?needAccess=true",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "93c0b0e3-a5a7-1a07-b1e4-a9f5aca33f16",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "72cb78db-4500-0cb6-e5dd-6d9d0b6036d5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "81b5c223-634d-43b5-82f9-be1df2649009",
          "citation": "Abass, Khaled, Miia Turpeinen, and Olavi Pelkonen. \"An evaluation of the cytochrome P450 inhibition potential of selected pesticides in human hepatic microsomes.\" Journal of Environmental Science and Health, Part B 44.6 (2009): 553-563.",
          "url": "https://www.tandfonline.com/doi/pdf/10.1080/03601230902997766?needAccess=true",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "25a9c274-54a4-6e49-42a7-0a483c1df0dc",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "277d37e1-4c88-4aa6-94b4-5c307935837d",
          "id": "277d37e1-4c88-4aa6-94b4-5c307935837d",
          "molfile": "\n  Marvin  01132102102D          \n\n 18 18  0  0  0  0            999 V2000\n   -2.5577   -5.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7445   -5.3520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3895   -4.6084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5789   -4.5363    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5789   -5.3597    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2419   -4.6058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5918   -5.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4023   -5.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5763   -3.7233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2788   -3.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9967   -3.7233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7146   -3.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4196   -3.7233    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7146   -2.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4196   -2.0791    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9967   -2.0791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2788   -2.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5763   -2.0791    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  4  9  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 17 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "CCOP(=S)(OCC)Oc1c(cc(c(Cl)n1)Cl)Cl",
          "formula": "C9H11Cl3NO3PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d529fea5-7d99-4d10-ac95-e0320a75fb15"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "350.5875",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e7764c43-b54e-458f-b860-77c6b4ecab13",
      "version": "20",
      "structure": {
        "id": "65437794-088f-41e2-9f8b-96e7da4940d9",
        "molfile": "\n  Marvin  01132105162D          \n\n 18 18  0  0  0  0            999 V2000\n   -1.2788   -3.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9967   -3.7233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5789   -4.5363    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5763   -3.7233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7146   -3.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2788   -2.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9967   -2.0791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7146   -2.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5789   -5.3597    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3895   -4.6084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2419   -4.6058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4196   -3.7233    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5763   -2.0791    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4196   -2.0791    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7445   -5.3520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5918   -5.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5577   -5.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4023   -5.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  3  2  0  0  0  0\n 10  3  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  5  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15 10  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 16  1  0  0  0  0\n  8  5  1  0  0  0  0\nM  END",
        "smiles": "CCOP(=S)(OCC)Oc1c(cc(c(Cl)n1)Cl)Cl",
        "formula": "C9H11Cl3NO3PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "350.5875",
        "optical_activity": "NONE",
        "references": [
          "2f5817f3-6406-4e08-9f31-39e903d162f7",
          "2b39edd4-bdcc-45f4-9108-daf5bf3a35b7"
        ],
        "stereo_centers": 0
      },
      "unii": "JCS58I644W"
    }
  ]
}