{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b0efdc71-1130-43b0-8d84-06794d0e7cc3",
          "code": "4196-89-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4196-89-8",
          "code_system": "CAS",
          "references": [
            "eef311de-8b95-4769-a0f8-426439ade4a5",
            "6f0d8287-4b0e-4c2e-a950-839fbecc7ea3"
          ]
        },
        {
          "uuid": "ac41aac9-38e9-4b4e-8bc1-e728ac01fa69",
          "code": "224-081-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.893",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "eef311de-8b95-4769-a0f8-426439ade4a5"
          ]
        },
        {
          "uuid": "260268b8-6741-4ae1-ab47-67f14e5ae713",
          "code": "20169",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20169",
          "code_system": "PUBCHEM",
          "references": [
            "eef311de-8b95-4769-a0f8-426439ade4a5"
          ]
        },
        {
          "uuid": "ae7235f6-66f9-2af4-a661-57252157ccbe",
          "code": "DTXSID1038822",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1038822",
          "code_system": "EPA CompTox",
          "references": [
            "6f99e613-9869-58b0-e41d-e48fe5ac9fb6"
          ]
        },
        {
          "uuid": "51d54785-d266-4a8b-aab5-58b1a965fcb5",
          "code": "JBP9MR90CQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b2cf7f18-cb11-ea80-9f77-f884db2ff813",
          "code": "166504",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=166504",
          "code_system": "NSC",
          "references": [
            "b54a3b42-0819-bb19-e825-f604a79c2c75"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e19f04fc-a3a6-4e2e-8549-4dc0c817a303",
          "name": "1,3-PROPANEDIOL, 2,2-DIMETHYL-, 1,3-DIBENZOATE",
          "stdName": "1,3-PROPANEDIOL, 2,2-DIMETHYL-, 1,3-DIBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d369ecbe-28b7-4381-8d58-e4e803fe9ca5",
            "81701f89-ba02-490e-bbc0-919bdd5e2fe2"
          ],
          "display_name": false
        },
        {
          "uuid": "2a9df4b0-d7fa-4285-a57d-963dd3cdb5b1",
          "name": "NEOPENTYL GLYCOL DIBENZOATE",
          "stdName": "NEOPENTYL GLYCOL DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e420229-f281-4d71-a67b-422c2aaa7456"
          ],
          "display_name": true
        },
        {
          "uuid": "c703abbf-096c-4f9c-a442-ef7aaab2f298",
          "name": "NSC-166504",
          "stdName": "NSC-166504",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d369ecbe-28b7-4381-8d58-e4e803fe9ca5",
            "81701f89-ba02-490e-bbc0-919bdd5e2fe2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7e420229-f281-4d71-a67b-422c2aaa7456",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d369ecbe-28b7-4381-8d58-e4e803fe9ca5",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81701f89-ba02-490e-bbc0-919bdd5e2fe2",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eef311de-8b95-4769-a0f8-426439ade4a5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391047000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65045a7c-ef05-4ba0-a14f-fbd52e8ffc34",
          "citation": "SRS import [JBP9MR90CQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JBP9MR90CQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391047000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57c07926-2bd6-4a6f-bf27-84c1041fa3bd",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f99e613-9869-58b0-e41d-e48fe5ac9fb6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4196-89-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6f0d8287-4b0e-4c2e-a950-839fbecc7ea3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b54a3b42-0819-bb19-e825-f604a79c2c75",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "22c209c2-e4a1-4214-b542-75e91bef44a3",
          "id": "22c209c2-e4a1-4214-b542-75e91bef44a3",
          "molfile": "\n  Marvin  01132101572D          \n\n 23 24  0  0  0  0            999 V2000\n    7.1373   -5.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1373   -4.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1373   -3.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0058   -4.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3693   -4.9611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1952   -4.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6086   -4.2647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5909   -5.6899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1664   -6.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5669   -7.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4031   -7.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8165   -6.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4364   -5.6899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3049   -4.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9063   -4.9307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0712   -4.9307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6632   -4.2093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6596   -5.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0564   -6.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6392   -7.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8179   -7.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4174   -6.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8419   -5.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n 14  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 23  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(COC(=O)c1ccccc1)COC(=O)c2ccccc2",
          "formula": "C19H20O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c9cefda9-104a-4a80-b46a-1d6d04cdf66f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "312.3604",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "902c07b2-1d4b-4a59-880c-31a49978ef3b",
      "version": "5",
      "structure": {
        "id": "49e92d5e-ba9c-4eec-9406-8123fcd8cdbb",
        "molfile": "\n  Marvin  01132103522D          \n\n 23 24  0  0  0  0            999 V2000\n    4.6596   -5.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0712   -4.9307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9063   -4.9307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3049   -4.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1373   -4.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0058   -4.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3693   -4.9611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1952   -4.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5909   -5.6899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1664   -6.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5669   -7.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4031   -7.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8165   -6.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4364   -5.6899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6086   -4.2647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1373   -5.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1373   -3.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6632   -4.2093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0564   -6.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6392   -7.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8179   -7.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4174   -6.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8419   -5.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n  9 14  2  0  0  0  0\n  8 15  2  0  0  0  0\n  5 16  1  0  0  0  0\n  5 17  1  0  0  0  0\n  2 18  2  0  0  0  0\n  1 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n  1 23  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(COC(=O)c1ccccc1)COC(=O)c2ccccc2",
        "formula": "C19H20O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "312.3604",
        "optical_activity": "NONE",
        "references": [
          "57c07926-2bd6-4a6f-bf27-84c1041fa3bd",
          "65045a7c-ef05-4ba0-a14f-fbd52e8ffc34"
        ],
        "stereo_centers": 0
      },
      "unii": "JBP9MR90CQ"
    }
  ]
}