{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b808e84a-1c5a-4046-b519-63eaa05567ed", "code": "115724-27-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=115724-27-1", "code_system": "CAS", "references": [ "12f08921-ea1b-47e2-85f2-0487d6aa25bb", "31e8fe4a-efc9-41e0-bed3-6f2aefc5377c" ] }, { "uuid": "ed812a30-8a3a-46fd-b597-bce8b5578b9e", "code": "16206258", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16206258", "code_system": "PUBCHEM", "references": [ "12f08921-ea1b-47e2-85f2-0487d6aa25bb" ] }, { "uuid": "91553c16-59f0-43fb-8bd9-fd28db47acea", "code": "JAZ26EQ8IU", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8f14c5b4-7091-8f62-8335-9893a3e734a1", "code": "DTXSID60888881", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60888881", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "ca401441-bb1d-4d27-aa50-d885097bc456", "name": "2-TERT-BUTYL-4-METHYLCYCLOHEXYL ACETATE", "stdName": "2-TERT-BUTYL-4-METHYLCYCLOHEXYL ACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "230c5c5f-dbdc-46bf-ac3a-f589ffd56173", "cc66a844-6659-4761-8920-828767a7b4ed" ], "display_name": true }, { "uuid": "9861cc55-34b4-44fc-9dd1-2106ce18fecb", "name": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-4-METHYL-, 1-ACETATE", "stdName": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-4-METHYL-, 1-ACETATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "af7931f8-af3b-49cf-bc0f-8c5800bd5034", "cc66a844-6659-4761-8920-828767a7b4ed" ], "display_name": false } ], "references": [ { "uuid": "230c5c5f-dbdc-46bf-ac3a-f589ffd56173", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "cc66a844-6659-4761-8920-828767a7b4ed", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "af7931f8-af3b-49cf-bc0f-8c5800bd5034", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "12f08921-ea1b-47e2-85f2-0487d6aa25bb", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392007000, "tags": [ "NOMEN" ] }, { "uuid": "29bf02d8-939c-4cdb-a6bb-49f334fba95f", "citation": "SRS import [JAZ26EQ8IU]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JAZ26EQ8IU", "doc_type": "SRS", "public_domain": true, "document_date": 1493392007000, "tags": [ "NOMEN" ] }, { "uuid": "31e8fe4a-efc9-41e0-bed3-6f2aefc5377c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "13d97013-2ee9-43f7-8fa0-54e6fabf8c71", "id": "13d97013-2ee9-43f7-8fa0-54e6fabf8c71", "molfile": "\n Marvin 01132101142D \n\n 15 15 0 0 0 0 999 V2000\n 8.1181 -3.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1181 -4.3318 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.4036 -4.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4036 -5.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1181 -5.9818 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.1181 -6.8068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4036 -7.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6891 -6.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4036 -8.0443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8325 -5.5693 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.8325 -4.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5470 -5.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5470 -6.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2615 -6.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2615 -5.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 11 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 12 15 1 0 0 0 0\nM END", "smiles": "CC1CCC(C(C1)C(C)(C)C)OC(=O)C", "formula": "C13H24O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "593f0f83-1cdd-4b81-a7c9-f35579d06299" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "212.329", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "e8126322-d4d2-4477-b966-82b70225f755", "version": "3", "structure": { "id": "5630aca6-81bb-4e11-b54b-526c4bf18325", "molfile": "\n Marvin 01132104292D \n\n 15 15 0 0 0 0 999 V2000\n 7.4036 -4.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1181 -4.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1181 -3.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8325 -4.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8325 -5.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5470 -5.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5470 -6.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2615 -6.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2615 -5.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1181 -5.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1181 -6.8068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4036 -7.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6891 -6.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4036 -8.0443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4036 -5.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 10 5 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 15 10 1 0 0 0 0\n 1 15 1 0 0 0 0\nM END", "smiles": "CC1CCC(C(C1)C(C)(C)C)OC(=O)C", "formula": "C13H24O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "212.329", "optical_activity": "UNSPECIFIED", "references": [ "29bf02d8-939c-4cdb-a6bb-49f334fba95f", "af7931f8-af3b-49cf-bc0f-8c5800bd5034" ], "stereo_centers": 3 }, "unii": "JAZ26EQ8IU" } ] }