{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9689d725-b0af-4d9a-9d1f-7fec0218d10e",
          "code": "134-09-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=134-09-8",
          "code_system": "CAS",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c",
            "7e739cc3-6262-4bc2-8924-45dcb55e28f1"
          ]
        },
        {
          "uuid": "fc5a3e75-e824-41f8-b2a6-932c81803e26",
          "code": "C87223",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87223",
          "code_system": "NCI_THESAURUS",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "3a6512b9-715f-412c-b0bc-17cfa338a382",
          "code": "21 CFR 352.10",
          "comments": "PART 352 -- SUNSCREEN DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE [STAYED INDEFINITELY]|Subpart B--Active Ingredients|Sec. 352.10 Sunscreen active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=352.10",
          "code_system": "CFR",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "82124527-f360-4461-9361-8395352c8de6",
          "code": "21 CFR 352.20",
          "comments": "PART 352 -- SUNSCREEN DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE [STAYED INDEFINITELY]|Subpart B--Active Ingredients|Sec. 352.20 Permitted combinations of active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=352.20",
          "code_system": "CFR",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "d4e18668-0f0d-4efd-9ba3-753f28ccebf8",
          "code": "MENTHYL ANTHRANILATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Menthyl_anthranilate",
          "code_system": "WIKIPEDIA",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "571bc3f1-10df-4026-aff2-0cbd1755597a",
          "code": "7981",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7981",
          "code_system": "INN",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "a82c8f4c-54ff-4f3c-b385-f5a42bac9af9",
          "code": "91324",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/91324/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "ce7886bb-a5fc-42ad-9d58-556e85224986",
          "code": "m7178",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7178?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "8406e96c-f382-4c9b-9c46-699ca18dcb79",
          "code": "CHEMBL1597075",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1597075",
          "code_system": "ChEMBL",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "7bc7d941-96b4-4730-ba30-c2a22a06ff0c",
          "code": "SUB89716",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "3dd18cd6-a227-4180-a449-83b3ea1b2fdd",
          "code": "205-129-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.664",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "dcdb59cd-d2a1-4f86-9bd0-e616d04fdf9e",
          "code": "8633",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8633",
          "code_system": "PUBCHEM",
          "references": [
            "42faa655-e62e-429c-8c2d-5dd80df8656c"
          ]
        },
        {
          "uuid": "a07feaea-fb19-6384-94b8-bf716d0df366",
          "code": "DTXSID3047895",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3047895",
          "code_system": "EPA CompTox",
          "references": [
            "7b955a67-e1f9-b53e-c7e6-286309302174"
          ]
        },
        {
          "uuid": "1ef5fddb-e14a-5f3d-fbd9-59b92a3bd45a",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0eb6d79a-59b1-1a0d-ce40-2d4fc62be8fc"
          ]
        },
        {
          "uuid": "d5c12fba-a292-44b3-9746-114742d8bf2f",
          "code": "J9QGD60OUZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "71ce3e84-9bbc-4c9f-cc81-186cb69d7776",
          "code": "DB11096",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11096",
          "code_system": "DRUG BANK",
          "references": [
            "0eb6d79a-59b1-1a0d-ce40-2d4fc62be8fc"
          ]
        },
        {
          "uuid": "2d3bf9e4-7e7c-aaf5-9309-b6bec1915173",
          "code": "4444",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4444",
          "code_system": "DRUG CENTRAL",
          "references": [
            "0eb6d79a-59b1-1a0d-ce40-2d4fc62be8fc"
          ]
        },
        {
          "uuid": "7896f1bb-d355-bcd7-04d1-3635acb692ab",
          "code": "1381742",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1381742",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "0eb6d79a-59b1-1a0d-ce40-2d4fc62be8fc"
          ]
        },
        {
          "uuid": "48cb4d9d-81ec-8832-004a-fb8030db0426",
          "code": "LL-22",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/LL-22/relevant/1/",
          "code_system": "USAN",
          "references": [
            "b7236186-9130-7365-d49c-38e61fd154d6"
          ]
        },
        {
          "uuid": "60d87742-3e24-9ffc-3a92-d88f07f64174",
          "code": "J9QGD60OUZ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=J9QGD60OUZ",
          "code_system": "DAILYMED",
          "references": [
            "98d0db72-fbd8-47b4-ba8f-6ab6ab3a73b9"
          ]
        },
        {
          "uuid": "c3a2ba73-9b3c-d423-7cd3-1e1049f503f7",
          "code": "300000027749",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "73005b06-55b7-013b-6657-0f6cbc76d0d7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "687e93ed-bc2f-4ec4-8575-a850bcf41f61",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7c5f27f6-3aa1-447f-a4db-4b07f7a8ced7",
            "refuuid": "bb143eb1-2089-47cb-9e7e-b449f9548474",
            "name": "MERADIMATE",
            "unii": "J9QGD60OUZ",
            "linking_id": "J9QGD60OUZ",
            "ref_pname": "MERADIMATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8008756f-e887-41ae-b082-ba21dc18f241",
          "name": "ANTHRANILIC ACID, P-MENTH-3-YL ESTER",
          "stdName": "ANTHRANILIC ACID, P-MENTH-3-YL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef781498-9420-4dde-b2d0-47190a6f49cd"
          ],
          "display_name": false
        },
        {
          "uuid": "0384a4a9-5f55-49d5-8869-36a272b55948",
          "name": "CYCLOHEXANOL, 5-METHYL-2-(1-METHYLETHYL)-, 2-AMINOBENZOATE",
          "stdName": "CYCLOHEXANOL, 5-METHYL-2-(1-METHYLETHYL)-, 2-AMINOBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef781498-9420-4dde-b2d0-47190a6f49cd"
          ],
          "display_name": false
        },
        {
          "uuid": "76b0370d-709d-425b-8159-d5b5b4e27e7f",
          "name": "MENTHYL ANTHRANILATE",
          "stdName": "MENTHYL ANTHRANILATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "67767791-5f95-4688-92cd-35a58bb2b714",
            "03471155-cb28-4349-8264-111ca50fae5f",
            "a6c9bbfa-62c0-4a84-bb48-748917d5c21f",
            "87cef64b-bd90-49dc-b963-f537a2d16d15",
            "ef781498-9420-4dde-b2d0-47190a6f49cd"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4681945c-ffda-48d4-ad81-c07a42c7e77a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4602b624-1735-43b7-994c-525c787acda9",
          "name": "MENTHYL ANTHRANILATE [MI]",
          "stdName": "MENTHYL ANTHRANILATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87cef64b-bd90-49dc-b963-f537a2d16d15"
          ],
          "display_name": false
        },
        {
          "uuid": "be4f08d3-a788-4b4d-80bc-a4769d30fe1f",
          "name": "MERADIMATE",
          "stdName": "MERADIMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "969867db-b79c-4ff9-9dad-886df0dca203",
            "9977a63a-7002-4300-9f5f-60d81050726e",
            "ce1f3e4e-880c-4035-b6b9-2d841b390441",
            "e803a9bd-e37c-4d6a-a4fd-9fd163506290",
            "1ccf42cf-e364-4021-b176-ece2cce1c3aa",
            "0e46e2c5-d52b-4cf1-9dc2-d27bf3b621d9",
            "4b67fc27-8a86-4d6b-b901-c321e27c7cb6",
            "c26fa88e-0c29-4940-9446-0328a126c5e6",
            "1dfde9d9-b8c4-4d14-82de-ca27d4a84e03",
            "09d51cd7-06fa-4e35-8085-482705466372",
            "ef781498-9420-4dde-b2d0-47190a6f49cd",
            "8add5473-12ae-4386-97f3-b622a1c90496",
            "b2e8e995-8bfd-4e03-ba06-231f5c81f644"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "437e357f-82c8-46ca-8a24-909486de1b80",
              "name_org": "USAN"
            },
            {
              "uuid": "cfb09d2b-b100-4e19-bd0f-6b1e512d42e7",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "4817aab0-dc68-43f9-9f47-78362f759052",
          "name": "MERADIMATE [MART.]",
          "stdName": "MERADIMATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9977a63a-7002-4300-9f5f-60d81050726e"
          ],
          "display_name": false
        },
        {
          "uuid": "12dee6c6-de3b-4b9c-b4b0-d5e1e12854a2",
          "name": "MERADIMATE [USAN]",
          "stdName": "MERADIMATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ccf42cf-e364-4021-b176-ece2cce1c3aa"
          ],
          "display_name": false
        },
        {
          "uuid": "7a45a7b0-61f3-0b42-19db-1463c3d57acd",
          "name": "MERADIMATE [USP MONOGRAPH]",
          "stdName": "MERADIMATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7314d43f-286e-d9a5-afc4-4c3d00b02677"
          ],
          "display_name": false
        },
        {
          "uuid": "d6c92e83-5855-46cb-9193-332d498d86ef",
          "name": "MERADIMATE [USP-RS]",
          "stdName": "MERADIMATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2e8e995-8bfd-4e03-ba06-231f5c81f644"
          ],
          "display_name": false
        },
        {
          "uuid": "a85d9c9b-435e-1143-22de-09482d7aebd7",
          "name": "Meradimate [WHO-DD]",
          "stdName": "MERADIMATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d09d7061-64d3-4d82-91fd-35aadd5871d2"
          ],
          "display_name": false
        },
        {
          "uuid": "4d3d20ea-cd9b-413d-8943-14d9e6703c95",
          "name": "meradimate [INN]",
          "stdName": "MERADIMATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8add5473-12ae-4386-97f3-b622a1c90496"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a0217e92-4828-eb16-1b8b-5bab5809c27f",
          "citation": "USP42-NF37 - 2749, Meradimate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7e739cc3-6262-4bc2-8924-45dcb55e28f1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ef781498-9420-4dde-b2d0-47190a6f49cd",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1ccf42cf-e364-4021-b176-ece2cce1c3aa",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8add5473-12ae-4386-97f3-b622a1c90496",
          "citation": "INN Proposed List 83",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL83.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c26fa88e-0c29-4940-9446-0328a126c5e6",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9977a63a-7002-4300-9f5f-60d81050726e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87cef64b-bd90-49dc-b963-f537a2d16d15",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67767791-5f95-4688-92cd-35a58bb2b714",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2e8e995-8bfd-4e03-ba06-231f5c81f644",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1dfde9d9-b8c4-4d14-82de-ca27d4a84e03",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42faa655-e62e-429c-8c2d-5dd80df8656c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389716000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "232770a3-7a09-490f-baa1-2153378d6c25",
          "citation": "SRS import [J9QGD60OUZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J9QGD60OUZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389716000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "969867db-b79c-4ff9-9dad-886df0dca203",
          "citation": "MERADIMATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e803a9bd-e37c-4d6a-a4fd-9fd163506290",
          "citation": "MERADIMATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0e46e2c5-d52b-4cf1-9dc2-d27bf3b621d9",
          "citation": "MERADIMATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ce1f3e4e-880c-4035-b6b9-2d841b390441",
          "citation": "MERADIMATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a6c9bbfa-62c0-4a84-bb48-748917d5c21f",
          "citation": "MENTHYL ANTHRANILATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "03471155-cb28-4349-8264-111ca50fae5f",
          "citation": "MENTHYL ANTHRANILATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4b67fc27-8a86-4d6b-b901-c321e27c7cb6",
          "citation": "MERADIMATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09d51cd7-06fa-4e35-8085-482705466372",
          "citation": "MERADIMATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7b955a67-e1f9-b53e-c7e6-286309302174",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=134-09-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0eb6d79a-59b1-1a0d-ce40-2d4fc62be8fc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b7236186-9130-7365-d49c-38e61fd154d6",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "7314d43f-286e-d9a5-afc4-4c3d00b02677",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "98d0db72-fbd8-47b4-ba8f-6ab6ab3a73b9",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d09d7061-64d3-4d82-91fd-35aadd5871d2",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "73005b06-55b7-013b-6657-0f6cbc76d0d7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "65a08c3b-faa0-4ab1-a80b-944223621cbc",
          "id": "65a08c3b-faa0-4ab1-a80b-944223621cbc",
          "molfile": "\n  Marvin  01132105172D          \n\n 20 21  0  0  0  0            999 V2000\n    6.5250   -1.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2375   -2.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9500   -1.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2458   -2.8375    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.9583   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9583   -4.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2416   -4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.2375   -5.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5333   -4.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5375   -3.2459    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.8250   -2.8334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1125   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1083   -4.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4000   -2.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6833   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9708   -2.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9708   -2.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6833   -1.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4000   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1125   -1.5959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 10  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C1CCC(C)CC1OC(=O)c2ccccc2N",
          "formula": "C17H25NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e4ceda34-ce70-4a22-a240-9853834cee01"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "275.3865",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bb143eb1-2089-47cb-9e7e-b449f9548474",
      "version": "23",
      "structure": {
        "id": "ce01259f-345c-405c-a4b5-db9a45ffb879",
        "molfile": "\n  Marvin  01132110382D          \n\n 20 21  0  0  0  0            999 V2000\n    5.1125   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4000   -2.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5375   -3.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8250   -2.8334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2458   -2.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9583   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4000   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1083   -4.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5333   -4.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2375   -2.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1125   -1.5959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9583   -4.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2416   -4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6833   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6833   -1.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5250   -1.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9500   -1.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2375   -5.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9708   -2.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9708   -2.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  1  2  0  0  0  0\n  9  3  1  0  0  0  0\n  5 10  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14  2  2  0  0  0  0\n 15  7  2  0  0  0  0\n 16 10  1  0  0  0  0\n 17 10  1  0  0  0  0\n 13 18  1  0  0  0  0\n 19 14  1  0  0  0  0\n 20 15  1  0  0  0  0\n 19 20  2  0  0  0  0\n 12 13  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C1CCC(C)CC1OC(=O)c2ccccc2N",
        "formula": "C17H25NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "UNKNOWN",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "275.3865",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "232770a3-7a09-490f-baa1-2153378d6c25",
          "ef781498-9420-4dde-b2d0-47190a6f49cd",
          "8add5473-12ae-4386-97f3-b622a1c90496"
        ],
        "stereo_centers": 3
      },
      "unii": "J9QGD60OUZ"
    }
  ]
}