{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "33c5850f-9246-4ce8-b7e4-96c75fb43f92",
          "code": "40372-72-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=40372-72-3",
          "code_system": "CAS",
          "references": [
            "bdf099df-6bd9-4f7c-9328-5e1ea190b288",
            "55bb8848-0a84-494a-b6eb-d3ddf4594d4b"
          ]
        },
        {
          "uuid": "0d4c26ca-0c90-415a-892e-9c82841c50c9",
          "code": "254-896-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.049.888",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bdf099df-6bd9-4f7c-9328-5e1ea190b288"
          ]
        },
        {
          "uuid": "ef203a2b-a056-43a9-9c72-0c950f33a1f6",
          "code": "162012",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/162012",
          "code_system": "PUBCHEM",
          "references": [
            "bdf099df-6bd9-4f7c-9328-5e1ea190b288"
          ]
        },
        {
          "uuid": "a20741a1-4815-3724-5723-677bf653fe91",
          "code": "DTXSID3029362",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3029362",
          "code_system": "EPA CompTox",
          "references": [
            "78d50d7c-d663-b0a6-0e56-d07f954e9cbb"
          ]
        },
        {
          "uuid": "28bdca53-622a-8ce4-5e4a-67368504712c",
          "code": "Bis(triethoxysilylpropyl)tetrasulfide",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bis(triethoxysilylpropyl)tetrasulfide",
          "code_system": "WIKIPEDIA",
          "references": [
            "f313a637-84c0-f4c4-dfac-da3fab9f8229"
          ]
        },
        {
          "uuid": "761cbcd4-9b59-4d93-b90a-4da87640a565",
          "code": "J98V193ZRY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "637aae86-72d6-4ab0-8973-cd5694e8c31c",
          "name": "3,16-DIOXA-8,9,10,11-TETRATHIA-4,15-DISILAOCTADECANE, 4,4,15,15-",
          "stdName": "3,16-DIOXA-8,9,10,11-TETRATHIA-4,15-DISILAOCTADECANE, 4,4,15,15-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78344a71-9995-4ca4-b355-a43d36f15b8b",
            "81151bfa-3655-473d-adba-f5e8d9886565"
          ],
          "display_name": false
        },
        {
          "uuid": "8dfe6ee9-f5a6-4303-9bab-76b2dd26b748",
          "name": "3,16-DIOXA-8,9,10,11-TETRATHIA-4,15-DISILAOCTADECANE, 4,4,15,15-TETRAETHOXY-",
          "stdName": "3,16-DIOXA-8,9,10,11-TETRATHIA-4,15-DISILAOCTADECANE, 4,4,15,15-TETRAETHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78344a71-9995-4ca4-b355-a43d36f15b8b",
            "81151bfa-3655-473d-adba-f5e8d9886565"
          ],
          "display_name": false
        },
        {
          "uuid": "6ba8a3ea-763d-4d81-a813-9b22d413cf9f",
          "name": "3,3'-BIS(TRIETHOXYSILYLPROPYL) TETRASULFIDE",
          "stdName": "3,3'-BIS(TRIETHOXYSILYLPROPYL) TETRASULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78344a71-9995-4ca4-b355-a43d36f15b8b",
            "5e75a657-1234-4ffb-a922-2c699faad3d2"
          ],
          "display_name": false
        },
        {
          "uuid": "dce416c6-2b22-4ba8-b83e-e90c8898fac2",
          "name": "4,4,15,15-TETRAETHOXY-3,16-DIOXA-8,9,10,11-TETRATHIA-4,15-DISILAOCTADECANE",
          "stdName": "4,4,15,15-TETRAETHOXY-3,16-DIOXA-8,9,10,11-TETRATHIA-4,15-DISILAOCTADECANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78344a71-9995-4ca4-b355-a43d36f15b8b",
            "5e75a657-1234-4ffb-a922-2c699faad3d2"
          ],
          "display_name": true
        },
        {
          "uuid": "caf16548-113a-414f-8ab1-d4dff5d35391",
          "name": "BIS(.GAMMA.-(TRIETHOXYSILYL)PROPYL) TETRASULFIDE",
          "stdName": "BIS(.GAMMA.-(TRIETHOXYSILYL)PROPYL) TETRASULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78344a71-9995-4ca4-b355-a43d36f15b8b",
            "5e75a657-1234-4ffb-a922-2c699faad3d2"
          ],
          "display_name": false
        },
        {
          "uuid": "1e0ba9fe-8eee-4302-87c1-77f9070f4152",
          "name": "BIS(3-(TRIETHOXYSILYL)PROPYL) TETRASULFIDE",
          "stdName": "BIS(3-(TRIETHOXYSILYL)PROPYL) TETRASULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78344a71-9995-4ca4-b355-a43d36f15b8b",
            "5e75a657-1234-4ffb-a922-2c699faad3d2"
          ],
          "display_name": false
        },
        {
          "uuid": "45d2e9a6-f2a7-4e38-a1ab-e1f2ed8b3b16",
          "name": "BIS(3-TRIETHOXYSILYLPROPYL)TETRASULFANE",
          "stdName": "BIS(3-TRIETHOXYSILYLPROPYL)TETRASULFANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78344a71-9995-4ca4-b355-a43d36f15b8b",
            "5e75a657-1234-4ffb-a922-2c699faad3d2"
          ],
          "display_name": false
        },
        {
          "uuid": "da863c2d-a1d3-48e0-b917-53dacbf5ee28",
          "name": "BIS(TRIETHOXYSILYLPROPYL) TETRASULFIDE",
          "stdName": "BIS(TRIETHOXYSILYLPROPYL) TETRASULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78344a71-9995-4ca4-b355-a43d36f15b8b",
            "5e75a657-1234-4ffb-a922-2c699faad3d2"
          ],
          "display_name": false
        },
        {
          "uuid": "6b46862b-ded3-437e-8555-d635d3fa8846",
          "name": "BIS-(TRIETHOXYSILYLPROPYL)TETRASULFANE",
          "stdName": "BIS-(TRIETHOXYSILYLPROPYL)TETRASULFANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78344a71-9995-4ca4-b355-a43d36f15b8b",
            "5e75a657-1234-4ffb-a922-2c699faad3d2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "81151bfa-3655-473d-adba-f5e8d9886565",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "78344a71-9995-4ca4-b355-a43d36f15b8b",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e75a657-1234-4ffb-a922-2c699faad3d2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdf099df-6bd9-4f7c-9328-5e1ea190b288",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be0001a8-08a5-4b81-8234-d90813f25c10",
          "citation": "SRS import [J98V193ZRY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J98V193ZRY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d15d5a6c-8d86-4e6d-b4c8-444e817492f7",
          "citation": "CHEMID RECORD 40372-72-3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78d50d7c-d663-b0a6-0e56-d07f954e9cbb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=40372-72-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f313a637-84c0-f4c4-dfac-da3fab9f8229",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "55bb8848-0a84-494a-b6eb-d3ddf4594d4b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cd606ff1-dca8-4f84-b4ce-ab1e4588d614",
          "id": "cd606ff1-dca8-4f84-b4ce-ab1e4588d614",
          "molfile": "\n  Marvin  01132110362D          \n\n 30 29  0  0  0  0            999 V2000\n    4.5788    0.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5788   -0.2615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2932   -0.6740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2932   -1.4990    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4682   -1.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0557   -2.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2307   -2.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8182   -2.9280    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9932   -2.9280    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5807   -3.6424    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7557   -3.6424    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3432   -2.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4818   -2.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8943   -2.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7193   -2.2135    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7193   -3.0385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0048   -3.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0048   -4.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5443   -2.2135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9568   -2.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5443   -3.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7193   -1.3885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4337   -0.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1482   -1.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1182   -1.4990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5307   -0.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1182   -0.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2932   -2.3240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5788   -2.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5788   -3.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 25  1  0  0  0  0\n  4 28  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 19  1  0  0  0  0\n 15 22  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\nM  END",
          "smiles": "CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC",
          "formula": "C18H42O6S4Si2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "919c8429-5eb6-47df-87bd-d7cc8e0adc7e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "538.9583",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9619aeab-edff-4ae5-b3b9-354c5c0d291c",
      "version": "4",
      "structure": {
        "id": "be7c6e9f-db21-4b42-b1d6-47fc9e0ec00a",
        "molfile": "\n  Marvin  01132109512D          \n\n 30 29  0  0  0  0            999 V2000\n    4.5788    0.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5788   -0.2615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2932   -0.6740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2932   -1.4990    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4682   -1.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0557   -2.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2307   -2.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8182   -2.9280    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9932   -2.9280    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5807   -3.6424    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7557   -3.6424    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3432   -2.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4818   -2.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8943   -2.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7193   -2.2135    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7193   -3.0385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0048   -3.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0048   -4.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5443   -2.2135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9568   -2.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5443   -3.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7193   -1.3885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4337   -0.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1482   -1.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1182   -1.4990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5307   -0.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1182   -0.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2932   -2.3240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5788   -2.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5788   -3.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 19 20  1  0  0  0  0\n 15 19  1  0  0  0  0\n 23 24  1  0  0  0  0\n 22 23  1  0  0  0  0\n 15 22  1  0  0  0  0\n 26 27  1  0  0  0  0\n 25 26  1  0  0  0  0\n  4 25  1  0  0  0  0\n 29 30  1  0  0  0  0\n 28 29  1  0  0  0  0\n  4 28  1  0  0  0  0\nM  END",
        "smiles": "CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC",
        "formula": "C18H42O6S4Si2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "538.9583",
        "optical_activity": "NONE",
        "references": [
          "be0001a8-08a5-4b81-8234-d90813f25c10",
          "d15d5a6c-8d86-4e6d-b4c8-444e817492f7"
        ],
        "stereo_centers": 0
      },
      "unii": "J98V193ZRY"
    }
  ]
}