{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "af1d507b-d499-4fd7-b452-0cd82b454935",
          "code": "7491-02-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7491-02-3",
          "code_system": "CAS",
          "references": [
            "964f2ffc-6bf3-4476-ac1c-eab9cb493f47",
            "be27caf7-a04c-4db4-9b94-10dd07812866"
          ]
        },
        {
          "uuid": "3833982e-f571-42f8-9c41-fa0b0bcbf5b3",
          "code": "C050859",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67050859",
          "code_system": "MESH",
          "references": [
            "964f2ffc-6bf3-4476-ac1c-eab9cb493f47"
          ]
        },
        {
          "uuid": "f5527e3c-abcf-4380-9f7c-5135c97ea431",
          "code": "231-306-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.461",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "964f2ffc-6bf3-4476-ac1c-eab9cb493f47"
          ]
        },
        {
          "uuid": "7574f31b-cdc0-4ad5-8a7f-4801d3827739",
          "code": "1363601",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363601/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "964f2ffc-6bf3-4476-ac1c-eab9cb493f47"
          ]
        },
        {
          "uuid": "bdb629df-5785-4c38-bcf6-cd28b2d20c1c",
          "code": "SUB39447",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "964f2ffc-6bf3-4476-ac1c-eab9cb493f47"
          ]
        },
        {
          "uuid": "717b68a8-f487-4fcb-8c27-b80c955b5abb",
          "code": "24096",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24096",
          "code_system": "PUBCHEM",
          "references": [
            "964f2ffc-6bf3-4476-ac1c-eab9cb493f47"
          ]
        },
        {
          "uuid": "e6cb483b-b89a-91a8-610e-9048c70fd652",
          "code": "DTXSID3064720",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3064720",
          "code_system": "EPA CompTox",
          "references": [
            "583294fe-0869-3f55-12d9-d5505cf03d00"
          ]
        },
        {
          "uuid": "de002935-3ab5-4fe6-a7fc-04e1a86522fe",
          "code": "J8T3X564IH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4f840e95-8ef3-78f4-3b35-1c2fc42bf7aa",
          "code": "100000129559",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4d951c03-27fa-912b-da7b-8fc4695a1abe"
          ]
        },
        {
          "uuid": "95e3ade5-ef5e-0c38-69ae-87a37f104183",
          "code": "J8T3X564IH",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=J8T3X564IH",
          "code_system": "DAILYMED",
          "references": [
            "4526e24b-3faf-0f9f-46b8-c043a6f4444c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ef8c6028-e921-45d9-b8b2-1a0dab4fa9d5",
          "name": "BIS(1-METHYLETHYL)DECANEDIOATE",
          "stdName": "BIS(1-METHYLETHYL)DECANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c06ac087-b186-47a8-96d9-cb08b94a892f",
            "7e3e7352-6fde-48c3-aaf9-307992be0df8"
          ],
          "display_name": false
        },
        {
          "uuid": "248525b0-90a3-4d02-9bb9-65ddce85b81a",
          "name": "DECANEDIOIC ACID, BIS(1-METHYLETHYL) ESTER",
          "stdName": "DECANEDIOIC ACID, BIS(1-METHYLETHYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c06ac087-b186-47a8-96d9-cb08b94a892f",
            "7e3e7352-6fde-48c3-aaf9-307992be0df8"
          ],
          "display_name": false
        },
        {
          "uuid": "bc3bcd2a-2090-4645-85c6-3dbcbd056644",
          "name": "DERMOL DIPS",
          "stdName": "DERMOL DIPS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c06ac087-b186-47a8-96d9-cb08b94a892f",
            "7e3e7352-6fde-48c3-aaf9-307992be0df8"
          ],
          "display_name": false
        },
        {
          "uuid": "25cfbafc-407d-43aa-96ab-1eb86f0f3f45",
          "name": "DI-ISOPROPYL SEBACATE",
          "stdName": "DI-ISOPROPYL SEBACATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a56ce21b-5238-4748-90a8-d2132e1d6010",
            "7e3e7352-6fde-48c3-aaf9-307992be0df8",
            "b7af9b12-1d3f-436f-8cd3-1698926bbf9a"
          ],
          "display_name": false
        },
        {
          "uuid": "2ef704bc-842d-494a-912f-a06cc656ed11",
          "name": "DI-ISOPROPYL SEBACATE [VANDF]",
          "stdName": "DI-ISOPROPYL SEBACATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a56ce21b-5238-4748-90a8-d2132e1d6010",
            "7e3e7352-6fde-48c3-aaf9-307992be0df8"
          ],
          "display_name": false
        },
        {
          "uuid": "b7242ed9-0a6e-4a67-b241-b56884bdad32",
          "name": "DIISOPROPYL SEBACATE",
          "stdName": "DIISOPROPYL SEBACATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08f3f63c-4f60-4a75-9460-c9dbd50f581c",
            "c06ac087-b186-47a8-96d9-cb08b94a892f",
            "08a57bd1-d1cb-4b37-8c09-68ab8cab2118",
            "7c61d886-f74b-4880-b5b1-3e1bccadbfec",
            "b9a9ddab-1ff9-4dc5-9e7a-390e19fcaf25",
            "7e3e7352-6fde-48c3-aaf9-307992be0df8"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "dfe4531c-a6c7-4924-854b-e8dcf35bb8f9",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c0c0ebca-07f3-72e4-ed65-8bf34a0ccbd9",
          "name": "Diisopropyl sebacate [WHO-DD]",
          "stdName": "DIISOPROPYL SEBACATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d93885f3-fb6f-84cd-ec65-32e6a3dc6c50"
          ],
          "display_name": false
        },
        {
          "uuid": "b1b988cc-43b7-4f5e-aa63-797d0ccc8d94",
          "name": "IPSE",
          "stdName": "IPSE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c06ac087-b186-47a8-96d9-cb08b94a892f",
            "7e3e7352-6fde-48c3-aaf9-307992be0df8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c06ac087-b186-47a8-96d9-cb08b94a892f",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7e3e7352-6fde-48c3-aaf9-307992be0df8",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a56ce21b-5238-4748-90a8-d2132e1d6010",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08f3f63c-4f60-4a75-9460-c9dbd50f581c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9a9ddab-1ff9-4dc5-9e7a-390e19fcaf25",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "964f2ffc-6bf3-4476-ac1c-eab9cb493f47",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390815000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "274f4d3a-24ce-4fbe-82a1-c496ca38fcc9",
          "citation": "SRS import [J8T3X564IH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J8T3X564IH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390815000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c61d886-f74b-4880-b5b1-3e1bccadbfec",
          "citation": "DIISOPROPYL SEBACATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "08a57bd1-d1cb-4b37-8c09-68ab8cab2118",
          "citation": "DIISOPROPYL SEBACATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7af9b12-1d3f-436f-8cd3-1698926bbf9a",
          "citation": "DI-ISOPROPYL SEBACATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2bf13376-a16e-6f11-88a8-3b5284fc91e9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7491-02-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "be27caf7-a04c-4db4-9b94-10dd07812866",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4526e24b-3faf-0f9f-46b8-c043a6f4444c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d93885f3-fb6f-84cd-ec65-32e6a3dc6c50",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "583294fe-0869-3f55-12d9-d5505cf03d00",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "4d951c03-27fa-912b-da7b-8fc4695a1abe",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c85aa4bc-63d0-4a9f-997f-d4e8ba932076",
          "id": "c85aa4bc-63d0-4a9f-997f-d4e8ba932076",
          "molfile": "\n  Marvin  01132110212D          \n\n 20 19  0  0  0  0            999 V2000\n    9.1625   -7.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1607   -6.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8704   -6.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4462   -6.4130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7317   -6.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7288   -7.6474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0172   -6.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3027   -6.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5882   -6.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8737   -6.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1563   -6.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4418   -6.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7273   -6.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0128   -6.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2983   -6.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2954   -5.6027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5838   -6.8371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1285   -6.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8430   -6.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1292   -5.6051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
          "smiles": "CC(C)OC(=O)CCCCCCCCC(=O)OC(C)C",
          "formula": "C16H30O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c1bc4257-a510-404c-a961-6afb3508862b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "286.4076",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "15fc3728-abc6-457f-bb86-ac146631764b",
      "version": "11",
      "structure": {
        "id": "b26044d3-26bf-4d11-b9bd-3bf087bce150",
        "molfile": "\n  Marvin  01132109142D          \n\n 20 19  0  0  0  0            999 V2000\n    1.2983   -6.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7317   -6.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2954   -5.6027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7288   -7.6474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5838   -6.8371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4462   -6.4130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0128   -6.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0172   -6.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3027   -6.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7273   -6.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8737   -6.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5882   -6.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4418   -6.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1563   -6.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1607   -6.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1625   -7.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8704   -6.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1285   -6.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8430   -6.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1292   -5.6051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  7  1  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 10  1  0  0  0  0\n 14 13  1  0  0  0  0\n  6 15  1  0  0  0  0\n  2  8  1  0  0  0  0\n 15 16  1  0  0  0  0\n  3  1  2  0  0  0  0\n 15 17  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5 18  1  0  0  0  0\n  5  1  1  0  0  0  0\n 18 19  1  0  0  0  0\n  6  2  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
        "smiles": "CC(C)OC(=O)CCCCCCCCC(=O)OC(C)C",
        "formula": "C16H30O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "286.4076",
        "optical_activity": "NONE",
        "references": [
          "c06ac087-b186-47a8-96d9-cb08b94a892f",
          "274f4d3a-24ce-4fbe-82a1-c496ca38fcc9"
        ],
        "stereo_centers": 0
      },
      "unii": "J8T3X564IH"
    }
  ]
}