{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c29a49ae-ce98-44c9-a130-91bb8233e631",
          "code": "31335-74-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=31335-74-7",
          "code_system": "CAS",
          "references": [
            "af73491e-4d97-426e-a0e6-60fac86d2ae9",
            "3c93f97c-3794-4fec-9603-cf68ba88327d"
          ]
        },
        {
          "uuid": "342f6efd-e83c-47dc-a402-7930aa91930b",
          "code": "250-575-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.045.963",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "af73491e-4d97-426e-a0e6-60fac86d2ae9"
          ]
        },
        {
          "uuid": "5e355b36-4698-4c4c-b0a7-50c6f87e0a9b",
          "code": "160200",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/160200",
          "code_system": "PUBCHEM",
          "references": [
            "af73491e-4d97-426e-a0e6-60fac86d2ae9"
          ]
        },
        {
          "uuid": "41aee441-7cf1-431f-830a-ea2bbb0bbe5b",
          "code": "J888K71638",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "53deada9-5bf8-a233-ad50-29687bc01d3c",
          "code": "DTXSID80865593",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80865593",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7678729c-814b-4430-8ef4-378d43e5d133",
          "name": "NEOPENTYL GLYCOL DICAPRYLATE",
          "stdName": "NEOPENTYL GLYCOL DICAPRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d091be6-a2bd-4237-923e-61f5504dc85b",
            "b9e7491b-a33b-4e80-b086-8e2bf9749c05"
          ],
          "display_name": true
        },
        {
          "uuid": "a8399ff4-247d-404c-80e7-9877bdd810d1",
          "name": "NEOPENTYLGLYCOL DIOCTANOATE",
          "stdName": "NEOPENTYLGLYCOL DIOCTANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85d11e7a-1953-44d7-9fcc-9bc3f2cc1f81",
            "b9e7491b-a33b-4e80-b086-8e2bf9749c05"
          ],
          "display_name": false
        },
        {
          "uuid": "c29d5387-d2e4-4d22-aa11-9a5c42823388",
          "name": "OCTANOIC ACID, 1,1'-(2,2-DIMETHYL-1,3-PROPANEDIYL) ESTER",
          "stdName": "OCTANOIC ACID, 1,1'-(2,2-DIMETHYL-1,3-PROPANEDIYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85d11e7a-1953-44d7-9fcc-9bc3f2cc1f81",
            "b9e7491b-a33b-4e80-b086-8e2bf9749c05"
          ],
          "display_name": false
        },
        {
          "uuid": "6c47a066-2321-48bb-b761-438c7e9d25f3",
          "name": "OCTANOIC ACID, 2,2-DIMETHYL-1,3-PROPANEDIYL ESTER",
          "stdName": "OCTANOIC ACID, 2,2-DIMETHYL-1,3-PROPANEDIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85d11e7a-1953-44d7-9fcc-9bc3f2cc1f81",
            "b9e7491b-a33b-4e80-b086-8e2bf9749c05"
          ],
          "display_name": false
        },
        {
          "uuid": "1f0c90c6-88f4-4808-805b-2ec46bbc5b4b",
          "name": "OCTANOIC ACID, 2,2-DIMETHYLTRIMETHYLENE ESTER",
          "stdName": "OCTANOIC ACID, 2,2-DIMETHYLTRIMETHYLENE ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85d11e7a-1953-44d7-9fcc-9bc3f2cc1f81",
            "b9e7491b-a33b-4e80-b086-8e2bf9749c05"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "85d11e7a-1953-44d7-9fcc-9bc3f2cc1f81",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b9e7491b-a33b-4e80-b086-8e2bf9749c05",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d091be6-a2bd-4237-923e-61f5504dc85b",
          "citation": "http://chembase.com/cbid_160200.htm",
          "url": "http://chembase.com/cbid_160200.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af73491e-4d97-426e-a0e6-60fac86d2ae9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391530000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb75e732-3bd3-4188-bae1-cf5cedac45f3",
          "citation": "SRS import [J888K71638]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J888K71638",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391530000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8de451ef-803a-47f7-aabd-89f150d14eb8",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c93f97c-3794-4fec-9603-cf68ba88327d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1387812a-c0c7-458b-9b46-2500308b1ab0",
          "id": "1387812a-c0c7-458b-9b46-2500308b1ab0",
          "molfile": "\n  Marvin  01132101132D          \n\n 25 24  0  0  0  0            999 V2000\n    2.1327   -5.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8748   -5.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5757   -5.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2997   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0281   -5.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7383   -5.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4530   -5.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1815   -5.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1815   -4.5522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8871   -5.7925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6155   -5.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2980   -5.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8369   -6.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9250   -6.3136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8697   -5.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6997   -5.4514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2807   -4.8565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0732   -4.0633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0738   -5.0963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6825   -4.5199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4616   -4.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0566   -4.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8682   -4.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4399   -3.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2376   -3.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCCC",
          "formula": "C21H40O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "691ec14f-8e6e-4955-a879-af6f392003b5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "356.5407",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c4be2088-3be2-4b31-8a87-5ae17be1f61e",
      "version": "3",
      "structure": {
        "id": "21a890ac-4f23-463b-825b-6492257f8fb5",
        "molfile": "\n  Marvin  01132101542D          \n\n 25 24  0  0  0  0            999 V2000\n    2.1327   -5.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8748   -5.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5757   -5.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2997   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0281   -5.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7383   -5.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4530   -5.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1815   -5.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1815   -4.5522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8871   -5.7925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6155   -5.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2980   -5.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8369   -6.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9250   -6.3136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8697   -5.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6997   -5.4514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2807   -4.8565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0738   -5.0963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6825   -4.5199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4616   -4.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0566   -4.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8682   -4.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4399   -3.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2376   -3.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0732   -4.0633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 17  2  0  0  0  0\nM  END",
        "smiles": "CCCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCCC",
        "formula": "C21H40O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "356.5407",
        "optical_activity": "NONE",
        "references": [
          "eb75e732-3bd3-4188-bae1-cf5cedac45f3",
          "8de451ef-803a-47f7-aabd-89f150d14eb8"
        ],
        "stereo_centers": 0
      },
      "unii": "J888K71638"
    }
  ]
}