{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d88977f8-379c-4828-9f67-a9df0cc390a0",
          "code": "120-36-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=120-36-5",
          "code_system": "CAS",
          "references": [
            "fc7e7a1a-91b9-4ce7-93d0-bb689956367a",
            "115b2455-da2b-47c6-8268-8f68336745a1"
          ]
        },
        {
          "uuid": "5038dc27-676a-445a-9751-16bc5cf3b7a9",
          "code": "C010571",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67010571",
          "code_system": "MESH",
          "references": [
            "fc7e7a1a-91b9-4ce7-93d0-bb689956367a"
          ]
        },
        {
          "uuid": "01e07335-9095-4956-bac2-4e454767a90d",
          "code": "DICHLORPROP",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dichlorprop",
          "code_system": "WIKIPEDIA",
          "references": [
            "fc7e7a1a-91b9-4ce7-93d0-bb689956367a"
          ]
        },
        {
          "uuid": "42893b27-0c25-4865-8e1e-c50f42ae5ef9",
          "code": "31401",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2105",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "fc7e7a1a-91b9-4ce7-93d0-bb689956367a"
          ]
        },
        {
          "uuid": "94ae8b9a-f4c0-41f0-b06f-14364336b241",
          "code": "204-390-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.991",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fc7e7a1a-91b9-4ce7-93d0-bb689956367a"
          ]
        },
        {
          "uuid": "8c4b539f-dd6f-4281-abec-71476da4362d",
          "code": "m4358",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4358?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "fc7e7a1a-91b9-4ce7-93d0-bb689956367a"
          ]
        },
        {
          "uuid": "1b79aa4d-0923-4135-9bbc-de43f06b3929",
          "code": "8427",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8427",
          "code_system": "PUBCHEM",
          "references": [
            "fc7e7a1a-91b9-4ce7-93d0-bb689956367a"
          ]
        },
        {
          "uuid": "f85e3916-1e25-9252-3e67-8747a48b7f25",
          "code": "1575",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1575",
          "code_system": "HSDB",
          "references": [
            "8ff95b81-e29a-4e43-77ba-935f94781732"
          ]
        },
        {
          "uuid": "73aa9b3a-ae48-2708-1b16-9757a7bafad6",
          "code": "DTXSID0020440",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0020440",
          "code_system": "EPA CompTox",
          "references": [
            "3a4d6515-927d-b3a2-325e-155bb552cffa"
          ]
        },
        {
          "uuid": "af6cb9e3-e156-4dca-b3c0-9e106b35a6be",
          "code": "J7YV2RKO6Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7a3bae2c-519f-cdf8-da50-827eb8c5241e",
          "code": "75370",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:75370",
          "code_system": "CHEBI",
          "references": [
            "abaad8f2-e392-8bbf-4900-a49178e444c3"
          ]
        },
        {
          "uuid": "07a02667-40ab-686c-2a3d-061781e81bbb",
          "code": "75375",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:75375",
          "code_system": "CHEBI",
          "references": [
            "abaad8f2-e392-8bbf-4900-a49178e444c3"
          ]
        },
        {
          "uuid": "d56430ce-c469-2542-8719-8ae1b62015cf",
          "code": "39624",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=39624",
          "code_system": "NSC",
          "references": [
            "a48be8cc-c195-fce5-3dbc-9a09064f66d6"
          ]
        },
        {
          "uuid": "2f7618c4-84e6-93a1-0f21-8f1a23267706",
          "code": "dichlorprop",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/dichlorprop.html",
          "code_system": "ALANWOOD",
          "references": [
            "1c476597-bcf2-bca2-f2e8-e5c141530f8f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7600fb14-7c6b-4698-aeb5-0e4232f04581",
          "name": "(±)-2,4-DP",
          "stdName": "(+/-)-2,4-DP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "71c111ce-b18e-4ebd-97d1-90d3310fa100",
          "name": "(±)-2-(2,4-DICHLOROPHENOXY)PROPANOIC ACID",
          "stdName": "(+/-)-2-(2,4-DICHLOROPHENOXY)PROPANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "56dd363c-197b-4792-91da-57f89f8aac47",
          "name": "(±)-2-(2,4-DICHLOROPHENOXY)PROPIONIC ACID",
          "stdName": "(+/-)-2-(2,4-DICHLOROPHENOXY)PROPIONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "5cfced48-4b67-4aaa-b377-95bcbf5bb5d0",
          "name": "(±)-DICHLORPROP",
          "stdName": "(+/-)-DICHLORPROP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "7a8829ec-ae96-4ec9-82fc-00fbb4ac8bfb",
          "name": ".ALPHA.-(2,4-DICHLOROPHENOXY)PROPIONIC ACID",
          "stdName": ".ALPHA.-(2,4-DICHLOROPHENOXY)PROPIONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "03e1dc0c-f308-4616-a927-adb724344d59",
          "name": "2,4-DCPPA",
          "stdName": "2,4-DCPPA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "8e5c2561-96f8-4de9-abf4-7463cb0731e0",
          "name": "2,4-DP",
          "stdName": "2,4-DP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "533eb85d-f3f3-418e-b522-4eaac89c35a2",
          "name": "2-(2,4-DICHLOROPHENOXY)PROPANOIC ACID",
          "stdName": "2-(2,4-DICHLOROPHENOXY)PROPANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "6518cf4f-4ace-433e-bddf-bec9f6e1ecb7",
          "name": "2-(2,4-DICHLOROPHENOXY)PROPIONIC ACID",
          "stdName": "2-(2,4-DICHLOROPHENOXY)PROPIONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "d70228a2-fc26-4e1e-ba5a-fb07a0de35da",
          "name": "DICHLOROPROP",
          "stdName": "DICHLOROPROP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "c5817c13-2d0e-4bb9-941d-a9b3070db77d",
          "name": "DICHLORPROP",
          "stdName": "DICHLORPROP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5513a8d-40a8-41d5-804e-d3b78661695b",
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887",
            "b355acc7-4463-4cb4-9580-62d1b1699f61",
            "c6b481d6-fbef-4484-a742-5382d3d24f2c",
            "90806335-75e2-4e45-b4c9-1aa7d55088bd"
          ],
          "display_name": true
        },
        {
          "uuid": "fafb619d-87cc-47cc-8799-c37a15e46dab",
          "name": "DICHLORPROP ACID",
          "stdName": "DICHLORPROP ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "36f399c3-72ce-4bd3-b46e-5c7544be49df",
          "name": "DICHLORPROP [ISO]",
          "stdName": "DICHLORPROP [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5513a8d-40a8-41d5-804e-d3b78661695b",
            "ee385e4e-0a37-4ee8-be5b-1509032ee938"
          ],
          "display_name": false
        },
        {
          "uuid": "5492d5de-f95a-4e6b-8848-cbd36712125c",
          "name": "DICHLORPROP [MI]",
          "stdName": "DICHLORPROP [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "b355acc7-4463-4cb4-9580-62d1b1699f61"
          ],
          "display_name": false
        },
        {
          "uuid": "42434f5e-6bde-4edd-b300-d7afbef3fe37",
          "name": "DICHLORPROP, (±)-",
          "stdName": "DICHLORPROP, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "2124c152-53c2-4e16-86ef-815ae554069a"
          ],
          "display_name": false
        },
        {
          "uuid": "319ad898-51f6-4557-a9ee-aa228238b46e",
          "name": "DICOPUR DP",
          "stdName": "DICOPUR DP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "b355acc7-4463-4cb4-9580-62d1b1699f61"
          ],
          "display_name": false
        },
        {
          "uuid": "bce05bf5-5bf9-4aae-b41e-2dda7cc5f5ca",
          "name": "NSC-39624",
          "stdName": "NSC-39624",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        },
        {
          "uuid": "510bd92d-0ba8-4b11-abae-169a42ecdf0e",
          "name": "PROPIONIC ACID, 2-(2,4-DICHLOROPHENOXY)-",
          "stdName": "PROPIONIC ACID, 2-(2,4-DICHLOROPHENOXY)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee385e4e-0a37-4ee8-be5b-1509032ee938",
            "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2124c152-53c2-4e16-86ef-815ae554069a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ee385e4e-0a37-4ee8-be5b-1509032ee938",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b355acc7-4463-4cb4-9580-62d1b1699f61",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5513a8d-40a8-41d5-804e-d3b78661695b",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc7e7a1a-91b9-4ce7-93d0-bb689956367a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391637000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a47cf4ec-a955-456d-9360-550b12dc1d32",
          "citation": "SRS import [J7YV2RKO6Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J7YV2RKO6Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391637000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6b481d6-fbef-4484-a742-5382d3d24f2c",
          "citation": "DICHLORPROP [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "90806335-75e2-4e45-b4c9-1aa7d55088bd",
          "citation": "DICHLORPROP [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8ff95b81-e29a-4e43-77ba-935f94781732",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+120-36-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3a4d6515-927d-b3a2-325e-155bb552cffa",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=120-36-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1c476597-bcf2-bca2-f2e8-e5c141530f8f",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "abaad8f2-e392-8bbf-4900-a49178e444c3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "115b2455-da2b-47c6-8268-8f68336745a1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a48be8cc-c195-fce5-3dbc-9a09064f66d6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "719bd52a-72d5-4ce0-a82e-7a4f1d6bf662",
          "id": "719bd52a-72d5-4ce0-a82e-7a4f1d6bf662",
          "molfile": "\n  Marvin  01132105532D          \n\n 14 14  0  0  0  0            999 V2000\n   10.0974   -7.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0974   -6.8682    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.3837   -6.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6650   -6.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6650   -7.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9506   -8.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2381   -7.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5227   -8.1048    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.2381   -6.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9506   -6.4555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9506   -5.6302    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.8106   -6.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5289   -6.8700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8106   -5.6312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 12  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n 10  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
          "smiles": "CC(C(=O)O)Oc1ccc(cc1Cl)Cl",
          "formula": "C9H8Cl2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "53aaf10f-f8fe-4371-ba97-df6965a8f583"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "235.0642",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5e8ebff6-ac04-408f-aa3a-7fc183cd157f",
      "version": "8",
      "structure": {
        "id": "0bf8b8f7-1646-458f-a25f-e4221d2674c5",
        "molfile": "\n  Marvin  01132100522D          \n\n 14 14  0  0  0  0            999 V2000\n    8.6650   -7.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9506   -8.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2381   -7.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5227   -8.1048    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.2381   -6.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9506   -6.4555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9506   -5.6302    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.6650   -6.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3837   -6.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0974   -6.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0974   -7.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8106   -6.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5289   -6.8700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8106   -5.6312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  1  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
        "smiles": "CC(C(=O)O)Oc1ccc(cc1Cl)Cl",
        "formula": "C9H8Cl2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "235.0642",
        "optical_activity": "( + / - )",
        "references": [
          "a47cf4ec-a955-456d-9360-550b12dc1d32",
          "4a8ab7a8-9847-4ab4-9b3f-ab5bbcf98887"
        ],
        "stereo_centers": 1
      },
      "unii": "J7YV2RKO6Q"
    }
  ]
}