{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d0c931bc-5be2-4bc2-9aff-58fd7c6f34d1",
          "code": "24480-45-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=24480-45-3",
          "code_system": "CAS",
          "references": [
            "7f98d5d6-8773-449f-9147-1b766f6cfc8e",
            "82c305a9-f776-4817-8582-6e85db2b3800"
          ]
        },
        {
          "uuid": "0330d60b-9d56-4e17-9102-b6a7d0fa4068",
          "code": "159970",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/159970",
          "code_system": "PUBCHEM",
          "references": [
            "7f98d5d6-8773-449f-9147-1b766f6cfc8e"
          ]
        },
        {
          "uuid": "a20b49c5-6ac4-4255-b205-600d9b042b9c",
          "code": "J7YR6A878I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "145ea20c-ea03-c386-b6ca-f1c1c481f468",
          "code": "DTXSID301021375",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301021375",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "92806af5-af57-4de6-8f9d-d028015d7f4b",
          "name": "(2S-(2.ALPHA.,4A.ALPHA.,6A.ALPHA.,8A.BETA.,10.ALPHA.,12A.ALPHA.,14A.BETA.,14B.ALPHA.))-1,2,3,4,4A,5,6,6A,7,8,8A,9,10,11,12,12A,13,14,14A,14B-EICOSAHYDRO-10-HYDROXY-2,4A,6A,9,9,12A,14A-HEPTAMETHYL-2-PICENECARBOXYLIC ACID",
          "stdName": "(2S-(2.ALPHA.,4A.ALPHA.,6A.ALPHA.,8A.BETA.,10.ALPHA.,12A.ALPHA.,14A.BETA.,14B.ALPHA.))-1,2,3,4,4A,5,6,6A,7,8,8A,9,10,11,12,12A,13,14,14A,14B-EICOSAHYDRO-10-HYDROXY-2,4A,6A,9,9,12A,14A-HEPTAMETHYL-2-PICENECARBOXYLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8112eb8d-2ae8-4841-8bd8-db3ab4b315b8",
            "a49da645-e332-4c92-8bbc-9ff579aada12"
          ],
          "display_name": false
        },
        {
          "uuid": "61088041-e965-47f7-b370-ac856f52d0a9",
          "name": "2-PICENECARBOXYLIC ACID, 1,2,3,4,4A,5,6,6A,7,8,8A,9,10,11,12,12A,13,14,14A,14B-EICOSAHYDRO-10-HYDROXY-2,4A,6A,9,9,12A,14A-HEPTAMETHYL-, (2S,4AS,6AS,8AR,10S,12AS,14AS,14BR)-",
          "stdName": "2-PICENECARBOXYLIC ACID, 1,2,3,4,4A,5,6,6A,7,8,8A,9,10,11,12,12A,13,14,14A,14B-EICOSAHYDRO-10-HYDROXY-2,4A,6A,9,9,12A,14A-HEPTAMETHYL-, (2S,4AS,6AS,8AR,10S,12AS,14AS,14BR)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8112eb8d-2ae8-4841-8bd8-db3ab4b315b8",
            "a49da645-e332-4c92-8bbc-9ff579aada12"
          ],
          "display_name": false
        },
        {
          "uuid": "e2043845-d663-40e8-903b-4511e979aa22",
          "name": "26-NOROLEAN-8-EN-29-OIC ACID, 3-HYDROXY-13-METHYL-, (3.BETA.,13.ALPHA.,14.BETA.,20.BETA.)-",
          "stdName": "26-NOROLEAN-8-EN-29-OIC ACID, 3-HYDROXY-13-METHYL-, (3.BETA.,13.ALPHA.,14.BETA.,20.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8112eb8d-2ae8-4841-8bd8-db3ab4b315b8",
            "a49da645-e332-4c92-8bbc-9ff579aada12"
          ],
          "display_name": false
        },
        {
          "uuid": "12bd11ea-46bb-4c08-aa3e-1f12b3d4e632",
          "name": "BIO-ACTIVE BA",
          "stdName": "BIO-ACTIVE BA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe168b71-38ab-458a-a2f5-31f3556e533c",
            "a49da645-e332-4c92-8bbc-9ff579aada12"
          ],
          "display_name": false
        },
        {
          "uuid": "196f990e-6885-4d04-8ee1-429515e2ac48",
          "name": "BRYONOLIC ACID",
          "stdName": "BRYONOLIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0633f2b-daeb-44bc-86c7-19f747a35ff8",
            "fe168b71-38ab-458a-a2f5-31f3556e533c",
            "a49da645-e332-4c92-8bbc-9ff579aada12",
            "e6314c3b-b085-4cbf-b19b-dca263a41691"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "79c04650-53d3-478a-b699-ee26f42740bf",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "48d926fd-e0dd-41bf-920e-9a346832b9da",
          "name": "D:C-FRIEDOOLEAN-8-EN-29-OIC ACID, 3-HYDROXY-, (3.BETA.,20.BETA.)-",
          "stdName": "D:C-FRIEDOOLEAN-8-EN-29-OIC ACID, 3-HYDROXY-, (3.BETA.,20.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8112eb8d-2ae8-4841-8bd8-db3ab4b315b8",
            "a49da645-e332-4c92-8bbc-9ff579aada12"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c0633f2b-daeb-44bc-86c7-19f747a35ff8",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8112eb8d-2ae8-4841-8bd8-db3ab4b315b8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a49da645-e332-4c92-8bbc-9ff579aada12",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe168b71-38ab-458a-a2f5-31f3556e533c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f98d5d6-8773-449f-9147-1b766f6cfc8e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390995000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b725ca2e-d90f-4d03-8620-027826dbcfda",
          "citation": "SRS import [J7YR6A878I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J7YR6A878I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390995000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6509c3cb-4e67-4fc6-b602-f9b9d60d3a80",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6314c3b-b085-4cbf-b19b-dca263a41691",
          "citation": "BRYONOLIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82c305a9-f776-4817-8582-6e85db2b3800",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2a44145d-776e-4f46-96f7-3545fdb68e3f",
          "id": "2a44145d-776e-4f46-96f7-3545fdb68e3f",
          "molfile": "\n  Marvin  01132102182D          \n\n 33 37  0  0  1  0            999 V2000\n    4.9213   -8.4318    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.2094   -8.8382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9213   -7.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6548   -7.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3337   -7.6421    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.3337   -6.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0576   -7.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7631   -7.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7631   -8.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0398   -8.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3337   -8.4553    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.6222   -8.8551    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.1131   -9.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7111   -9.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4771   -7.2461    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.4771   -8.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1890   -7.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9043   -7.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9043   -6.4257    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.8466   -6.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6217   -6.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6217   -5.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9043   -4.7683    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.6443   -4.3351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1871   -5.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1871   -6.0140    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.4771   -6.4257    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.4771   -5.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7739   -6.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0576   -6.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9043   -3.9027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1397   -3.4694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6390   -3.4694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 12  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n 11  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n 30  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 15  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 15 17  1  0  0  0  0\n 27 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 21  1  0  0  0  0\n 26 19  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  6  0  0  0\n 25 23  1  0  0  0  0\n 23 31  1  0  0  0  0\n 26 25  1  6  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  6  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  2  0  0  0  0\nM  END",
          "smiles": "CC1(C)[C@@H]2CCC3=C(CC[C@@]4(C)[C@@H]5C[C@](C)(CC[C@]5(C)CC[C@]34C)C(=O)O)[C@@]2(C)CC[C@@H]1O",
          "formula": "C30H48O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a651d4c9-b8d2-4edf-9be5-cae5f5f2225d"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "456.7014",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "42a10fe7-1843-48a7-ba25-7fb8439f22a8",
      "version": "4",
      "structure": {
        "id": "81bec11e-ce20-4105-aec8-f7924e9a7b32",
        "molfile": "\n  Marvin  01132106442D          \n\n 35 39  0  0  1  0            999 V2000\n    9.1871   -5.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1871   -6.0140    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.4771   -6.4257    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.4771   -7.2461    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.1890   -7.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9043   -7.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9043   -6.4257    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.8466   -6.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6217   -6.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6217   -5.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9043   -4.7683    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.6443   -4.3351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9043   -3.9027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1397   -3.4694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6390   -3.4694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4771   -8.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7631   -7.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0576   -7.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0576   -6.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7739   -6.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3337   -7.6421    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3337   -8.4553    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0398   -8.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7631   -8.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6222   -8.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9213   -8.4318    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.9213   -7.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6548   -7.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2094   -8.8382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1131   -9.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7111   -9.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5426   -9.2395    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3337   -6.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4771   -5.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1871   -6.8798    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  2  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  6  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n  4 16  1  1  0  0  0\n  4 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n  3 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 17 24  1  0  0  0  0\n 22 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 21 28  1  0  0  0  0\n 26 29  1  1  0  0  0\n 25 30  1  0  0  0  0\n 25 31  1  0  0  0  0\n 22 32  1  6  0  0  0\n 21 33  1  1  0  0  0\n  3 34  1  6  0  0  0\n  2 35  1  1  0  0  0\nM  END",
        "smiles": "CC1(C)[C@]2([H])CCC3=C(CC[C@@]4(C)[C@]5([H])C[C@](C)(CC[C@]5(C)CC[C@]34C)C(=O)O)[C@@]2(C)CC[C@@H]1O",
        "formula": "C30H48O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "456.7014",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b725ca2e-d90f-4d03-8620-027826dbcfda",
          "6509c3cb-4e67-4fc6-b602-f9b9d60d3a80"
        ],
        "stereo_centers": 8
      },
      "unii": "J7YR6A878I"
    }
  ]
}