{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "59723a51-790a-4489-a35a-264607ea702c",
          "code": "3457-61-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3457-61-2",
          "code_system": "CAS",
          "references": [
            "6d637724-8282-497d-a813-c7c630db5e68",
            "b058705f-ad73-4234-ad96-024e8150a769"
          ]
        },
        {
          "uuid": "ef4abb17-48a7-4acd-bb86-4908484002fd",
          "code": "222-389-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.355",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6d637724-8282-497d-a813-c7c630db5e68"
          ]
        },
        {
          "uuid": "a6a0e0e3-973f-4f15-8274-69f43a45a5ec",
          "code": "76997",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76997",
          "code_system": "PUBCHEM",
          "references": [
            "6d637724-8282-497d-a813-c7c630db5e68"
          ]
        },
        {
          "uuid": "a0df568a-aebf-e801-3a8f-20e96ac2e564",
          "code": "DTXSID9063039",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9063039",
          "code_system": "EPA CompTox",
          "references": [
            "13c4091c-de86-e4df-be35-d97c2c9a4d76"
          ]
        },
        {
          "uuid": "52e07430-bd79-49d0-ace0-640012468e97",
          "code": "J78XB9M8IR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9c26b6d7-db32-4da6-a6ac-6310f987a197",
          "name": "CUMYL TERT-BUTYL PEROXIDE",
          "stdName": "CUMYL TERT-BUTYL PEROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65e0b683-f764-4a43-9a21-a570c460ae3b",
            "e2deff9f-f1f9-4760-89ca-008dc6e965d0"
          ],
          "display_name": false
        },
        {
          "uuid": "2a42bff2-1078-4d0c-b479-8b9595ed6b4d",
          "name": "KAYABUTYL C",
          "stdName": "KAYABUTYL C",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65e0b683-f764-4a43-9a21-a570c460ae3b",
            "e2deff9f-f1f9-4760-89ca-008dc6e965d0"
          ],
          "display_name": false
        },
        {
          "uuid": "5d772f33-e1d7-433b-b057-408a5a26c1ee",
          "name": "LUPERCO 801-XL",
          "stdName": "LUPERCO 801-XL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65e0b683-f764-4a43-9a21-a570c460ae3b",
            "e2deff9f-f1f9-4760-89ca-008dc6e965d0"
          ],
          "display_name": false
        },
        {
          "uuid": "04105ef3-f0fe-499e-8bd3-533249cc1355",
          "name": "LUPEROX 801",
          "stdName": "LUPEROX 801",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ed221fe-9d09-4743-ab6b-cab952897f98",
            "e2deff9f-f1f9-4760-89ca-008dc6e965d0"
          ],
          "display_name": false
        },
        {
          "uuid": "973b1209-2926-47fa-8355-5248d3ed7417",
          "name": "TERT-BUTYL CUMYL PEROXIDE",
          "stdName": "TERT-BUTYL CUMYL PEROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65e0b683-f764-4a43-9a21-a570c460ae3b",
            "e2deff9f-f1f9-4760-89ca-008dc6e965d0"
          ],
          "display_name": true
        },
        {
          "uuid": "a8b1c882-148c-41db-a273-73d722825910",
          "name": "TERT-BUTYL-CUMYL PEROXIDE",
          "stdName": "TERT-BUTYL-CUMYL PEROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d22c75-b4c2-40aa-bbe7-263ac3e773e7",
            "e2deff9f-f1f9-4760-89ca-008dc6e965d0"
          ],
          "display_name": false
        },
        {
          "uuid": "cf14741b-da9e-43e5-b0d0-c625f91e140e",
          "name": "TERT-BUTYLCUMENEPEROXIDE",
          "stdName": "TERT-BUTYLCUMENEPEROXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65e0b683-f764-4a43-9a21-a570c460ae3b",
            "e2deff9f-f1f9-4760-89ca-008dc6e965d0"
          ],
          "display_name": false
        },
        {
          "uuid": "22610c8f-c089-41b2-bde3-c027034817bf",
          "name": "TRIGONOX T",
          "stdName": "TRIGONOX T",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65e0b683-f764-4a43-9a21-a570c460ae3b",
            "e2deff9f-f1f9-4760-89ca-008dc6e965d0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "65e0b683-f764-4a43-9a21-a570c460ae3b",
          "citation": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB0205821.htm",
          "url": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB0205821.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e2deff9f-f1f9-4760-89ca-008dc6e965d0",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61d22c75-b4c2-40aa-bbe7-263ac3e773e7",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ed221fe-9d09-4743-ab6b-cab952897f98",
          "citation": "http://www.arkema.com/en/products/product-finder/product-viewer/Luperox-801/",
          "url": "http://www.arkema.com/en/products/product-finder/product-viewer/Luperox-801/",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d637724-8282-497d-a813-c7c630db5e68",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391972000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61c2ea00-4550-4ae0-9a86-824788c69235",
          "citation": "SRS import [J78XB9M8IR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J78XB9M8IR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391972000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13c4091c-de86-e4df-be35-d97c2c9a4d76",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3457-61-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b058705f-ad73-4234-ad96-024e8150a769",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1929819b-a2da-4b01-97bf-d55e626d20b4",
          "id": "1929819b-a2da-4b01-97bf-d55e626d20b4",
          "molfile": "\n  Marvin  01132101292D          \n\n 15 15  0  0  0  0            999 V2000\n   -2.5006   -0.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7862   -0.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5006    0.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7862    0.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0717   -0.4678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3572   -0.0553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3572   -0.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7697   -1.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0553   -1.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717   -0.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717    0.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7862    1.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5006    0.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5006   -0.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7862   -0.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)OOC(C)(C)c1ccccc1",
          "formula": "C13H20O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a353ca2b-e8a6-49bd-b02c-2f53b1d3d12f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "208.2972",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fb6738a2-25f3-4bcf-ad27-e565863a9604",
      "version": "3",
      "structure": {
        "id": "ce254068-e4b6-4872-9b61-9fd903620e17",
        "molfile": "\n  Marvin  01132110392D          \n\n 15 15  0  0  0  0            999 V2000\n   -0.3572   -0.0553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0717   -0.4678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3572   -0.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7697   -1.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0553   -1.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717   -0.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717    0.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7862    1.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5006    0.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5006   -0.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7862   -0.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7862   -0.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5006   -0.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5006    0.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7862    0.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n  6 11  2  0  0  0  0\n  1  3  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 15  1  0  0  0  0\n 12 14  1  0  0  0  0\n  2 12  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)OOC(C)(C)c1ccccc1",
        "formula": "C13H20O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "208.2972",
        "optical_activity": "NONE",
        "references": [
          "65e0b683-f764-4a43-9a21-a570c460ae3b",
          "61c2ea00-4550-4ae0-9a86-824788c69235"
        ],
        "stereo_centers": 0
      },
      "unii": "J78XB9M8IR"
    }
  ]
}