{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "25a34754-eb79-435c-8763-7f156f17ead1",
          "code": "QP53BC02",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR SYSTEMIC USE|Chitin synthesis inhibitors|diflubenzuron",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53BC02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "31795267-c4cf-4525-b260-8c322c9a6d9b"
          ]
        },
        {
          "uuid": "82d384c0-ff90-4b1f-b6df-91ec4621c3ee",
          "code": "35367-38-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=35367-38-5",
          "code_system": "CAS",
          "references": [
            "31795267-c4cf-4525-b260-8c322c9a6d9b",
            "a06e4d12-c3ef-4560-aa40-caa4d5db5a68"
          ]
        },
        {
          "uuid": "11cc44fb-c7cc-4859-8ee2-ddcabf91e28f",
          "code": "D004132",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68004132",
          "code_system": "MESH",
          "references": [
            "31795267-c4cf-4525-b260-8c322c9a6d9b"
          ]
        },
        {
          "uuid": "3c250132-1b46-469b-b443-ce6752781adc",
          "code": "DIFLUBENZURON",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diflubenzuron",
          "code_system": "WIKIPEDIA",
          "references": [
            "31795267-c4cf-4525-b260-8c322c9a6d9b"
          ]
        },
        {
          "uuid": "fe9c15ee-c211-41c4-b623-c40970d57754",
          "code": "108201",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2139",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "31795267-c4cf-4525-b260-8c322c9a6d9b"
          ]
        },
        {
          "uuid": "aef06ced-5789-4657-9fc9-d0626eead1ab",
          "code": "1665336",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1665336/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "31795267-c4cf-4525-b260-8c322c9a6d9b"
          ]
        },
        {
          "uuid": "bad371c9-2f86-4dd0-b7bf-630f45fb06d9",
          "code": "m4431",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4431?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "31795267-c4cf-4525-b260-8c322c9a6d9b"
          ]
        },
        {
          "uuid": "f26a7af5-e0bb-42bc-ab24-477042c30839",
          "code": "SUB90869",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "31795267-c4cf-4525-b260-8c322c9a6d9b"
          ]
        },
        {
          "uuid": "f5df3615-b31e-45d3-9c9f-08e8542faa79",
          "code": "252-529-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.047.740",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "31795267-c4cf-4525-b260-8c322c9a6d9b"
          ]
        },
        {
          "uuid": "57b430fd-acbb-456e-8135-0ecb3ba5238a",
          "code": "37123",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/37123",
          "code_system": "PUBCHEM",
          "references": [
            "31795267-c4cf-4525-b260-8c322c9a6d9b"
          ]
        },
        {
          "uuid": "c2703373-f079-2817-5984-c1f82a898042",
          "code": "6611",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6611",
          "code_system": "HSDB",
          "references": [
            "fc0645b0-81cb-926e-2e0b-53d84744d2b7"
          ]
        },
        {
          "uuid": "732c58e6-10c3-361f-7bef-0f2f07579414",
          "code": "DTXSID1024049",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1024049",
          "code_system": "EPA CompTox",
          "references": [
            "6ea42c7b-e922-1191-0bec-01de03e7c646"
          ]
        },
        {
          "uuid": "7f78e416-d561-4803-9ff2-9b68c706a2a5",
          "code": "J76U6ZSI8D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "75311032-7ad6-1834-835b-6a7532665a65",
          "code": "34703",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34703",
          "code_system": "CHEBI",
          "references": [
            "678f1adc-c2bf-2798-ce29-6535cceef4bc"
          ]
        },
        {
          "uuid": "1fa529a0-ed97-1179-61cf-abdb32ca9d8d",
          "code": "100000141123",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "596093e9-f899-5fd7-6fef-8946ac1a4ce6"
          ]
        },
        {
          "uuid": "3698c1f2-3b00-c9ea-cbd7-2d0a65ff6d76",
          "code": "J76U6ZSI8D",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=J76U6ZSI8D",
          "code_system": "DAILYMED",
          "references": [
            "bf2f3057-0549-bd85-b861-3648ee3fb72d"
          ]
        },
        {
          "uuid": "948d9654-96e1-c219-c9b1-52059ca78533",
          "code": "diflubenzuron",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/diflubenzuron.html",
          "code_system": "ALANWOOD",
          "references": [
            "5f6b39fc-7786-6a77-bbb6-17481f8e640f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4dcd4d3d-d6c1-47a0-8ece-77787515eb18",
          "name": "1-(4-CHLOROPHENYL)-3-(2,6-DIFLUOROBENZOYL)UREA",
          "stdName": "1-(4-CHLOROPHENYL)-3-(2,6-DIFLUOROBENZOYL)UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd2b325c-ca28-4d42-8155-f943ceaa36a1",
            "6db26e2e-f17c-4931-b4e0-9c1844c62206"
          ],
          "display_name": false
        },
        {
          "uuid": "0e26e67d-cb3f-4f46-9ba6-685b09eb4345",
          "name": "DIFLUBENZURON",
          "stdName": "DIFLUBENZURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd2b325c-ca28-4d42-8155-f943ceaa36a1",
            "70ffe392-3342-49a6-806f-33fae4e0bfee",
            "496bd1e9-0c15-4eb8-bfba-e241bfdab3c1",
            "05bc1d02-592f-4e19-a2ae-9a0f1001065d",
            "5f4a146c-add7-403f-b889-99a83a9a2129",
            "984153c3-9149-406e-84c0-8d38df33ff37",
            "40da5338-7998-4739-8e54-4ab21455aae3",
            "65c38335-1dc4-4d3e-a548-a1d505e80f9d",
            "b60fb459-26df-4539-a6f4-925dadb7fc6d",
            "d9d17635-aadb-476d-ae0c-d6f52a84b8fd"
          ],
          "display_name": true
        },
        {
          "uuid": "5c0949c9-b65b-4059-9058-234a127bc150",
          "name": "DIFLUBENZURON [HSDB]",
          "stdName": "DIFLUBENZURON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd2b325c-ca28-4d42-8155-f943ceaa36a1",
            "496bd1e9-0c15-4eb8-bfba-e241bfdab3c1"
          ],
          "display_name": false
        },
        {
          "uuid": "6b30599b-e9e6-479d-9ebb-a5e408ebdadd",
          "name": "DIFLUBENZURON [ISO]",
          "stdName": "DIFLUBENZURON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd2b325c-ca28-4d42-8155-f943ceaa36a1",
            "d9d17635-aadb-476d-ae0c-d6f52a84b8fd"
          ],
          "display_name": false
        },
        {
          "uuid": "92e69788-2608-4465-bc09-1738a688176d",
          "name": "DIFLUBENZURON [JAN]",
          "stdName": "DIFLUBENZURON [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed5142d0-5387-2eca-09c7-aa40e8ea78a1"
          ],
          "display_name": false
        },
        {
          "uuid": "11a19c64-1f98-4897-a843-1cc149ae851d",
          "name": "DIFLUBENZURON [MART.]",
          "stdName": "DIFLUBENZURON [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05bc1d02-592f-4e19-a2ae-9a0f1001065d"
          ],
          "display_name": false
        },
        {
          "uuid": "fe0465d0-1f0b-4d28-a579-4da75854bcfc",
          "name": "DIFLUBENZURON [MI]",
          "stdName": "DIFLUBENZURON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd2b325c-ca28-4d42-8155-f943ceaa36a1",
            "b60fb459-26df-4539-a6f4-925dadb7fc6d"
          ],
          "display_name": false
        },
        {
          "uuid": "f8054c04-e2e8-49a9-9296-29386416eb07",
          "name": "N-(((4-CHLOROPHENYL)AMINO)CARBONYL)-2,6-DIFLUOROBENZAMIDE",
          "stdName": "N-(((4-CHLOROPHENYL)AMINO)CARBONYL)-2,6-DIFLUOROBENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6df013e9-c632-4750-a138-f6fb13415d68",
            "d2467bb4-6eba-4db4-ae10-86a06936d619"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "984153c3-9149-406e-84c0-8d38df33ff37",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6db26e2e-f17c-4931-b4e0-9c1844c62206",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd2b325c-ca28-4d42-8155-f943ceaa36a1",
          "citation": "MARTINDALE",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2467bb4-6eba-4db4-ae10-86a06936d619",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6df013e9-c632-4750-a138-f6fb13415d68",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05bc1d02-592f-4e19-a2ae-9a0f1001065d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b60fb459-26df-4539-a6f4-925dadb7fc6d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "496bd1e9-0c15-4eb8-bfba-e241bfdab3c1",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9d17635-aadb-476d-ae0c-d6f52a84b8fd",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31795267-c4cf-4525-b260-8c322c9a6d9b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b9a7ded-4c02-4c18-9b20-10a30fad1d1f",
          "citation": "SRS import [J76U6ZSI8D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J76U6ZSI8D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bc183ea-af23-440c-ae0c-e7b12c1e95ba",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f4a146c-add7-403f-b889-99a83a9a2129",
          "citation": "DIFLUBENZURON [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "70ffe392-3342-49a6-806f-33fae4e0bfee",
          "citation": "DIFLUBENZURON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40da5338-7998-4739-8e54-4ab21455aae3",
          "citation": "DIFLUBENZURON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "65c38335-1dc4-4d3e-a548-a1d505e80f9d",
          "citation": "DIFLUBENZURON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fc0645b0-81cb-926e-2e0b-53d84744d2b7",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+35367-38-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ed5142d0-5387-2eca-09c7-aa40e8ea78a1",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6ea42c7b-e922-1191-0bec-01de03e7c646",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=35367-38-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5f6b39fc-7786-6a77-bbb6-17481f8e640f",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "678f1adc-c2bf-2798-ce29-6535cceef4bc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a06e4d12-c3ef-4560-aa40-caa4d5db5a68",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bf2f3057-0549-bd85-b861-3648ee3fb72d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "596093e9-f899-5fd7-6fef-8946ac1a4ce6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ea26e506-da72-4772-9b40-9b187bd8916e",
          "id": "ea26e506-da72-4772-9b40-9b187bd8916e",
          "molfile": "\n  Marvin  01132112072D          \n\n 21 22  0  0  0  0            999 V2000\n    5.3133   -6.7671    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5989   -6.3546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8843   -6.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1699   -6.3546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1699   -5.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8843   -5.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8843   -4.2922    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5989   -5.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3133   -5.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3133   -4.2922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0278   -5.5296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7423   -5.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7423   -4.2922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4568   -5.5296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1712   -5.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8857   -5.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6002   -5.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6002   -4.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3146   -3.8797    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.8857   -3.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1712   -4.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 21  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(c(c1)F)C(=O)NC(=O)Nc2ccc(cc2)Cl)F",
          "formula": "C14H9ClF2N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ec55a593-2142-44f5-b105-5de121e22699"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "310.6837",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2bf8c096-61a8-41a9-b080-975df0e70ff4",
      "version": "9",
      "structure": {
        "id": "0cb3ff4c-0835-4943-9db3-a1a72397f5b1",
        "molfile": "\n  Marvin  01132100542D          \n\n 21 22  0  0  0  0            999 V2000\n    4.5989   -5.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3133   -5.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0278   -5.5296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7423   -5.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4568   -5.5296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1712   -5.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8857   -5.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6002   -5.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6002   -4.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3146   -3.8797    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.8857   -3.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1712   -4.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7423   -4.2922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3133   -4.2922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8843   -5.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1699   -5.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1699   -6.3546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8843   -6.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5989   -6.3546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3133   -6.7671    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8843   -4.2922    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n  4 13  2  0  0  0  0\n  2 14  2  0  0  0  0\n  1 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n  1 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 15 21  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(c(c1)F)C(=O)NC(=O)Nc2ccc(cc2)Cl)F",
        "formula": "C14H9ClF2N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "310.6837",
        "optical_activity": "NONE",
        "references": [
          "0bc183ea-af23-440c-ae0c-e7b12c1e95ba",
          "0b9a7ded-4c02-4c18-9b20-10a30fad1d1f"
        ],
        "stereo_centers": 0
      },
      "unii": "J76U6ZSI8D"
    }
  ]
}