{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "faf3295e-bf37-412e-9dde-2d2630ad2dd9", "code": "56507-37-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=56507-37-0", "code_system": "CAS", "references": [ "abc0cc08-0fc9-4e55-9414-24a4ad6d08e9", "38c80041-4e76-4660-b19a-c30c0c64b811" ] }, { "uuid": "dc0f9aaa-8682-43e7-ba62-fb01320440ef", "code": "41909", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/41909", "code_system": "PUBCHEM", "references": [ "abc0cc08-0fc9-4e55-9414-24a4ad6d08e9" ] }, { "uuid": "471f4099-758c-752d-e4ac-d484a9bb29e9", "code": "DTXSID9037616", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9037616", "code_system": "EPA CompTox", "references": [ "52e48ae4-42ae-1650-ef3f-d103ed4af1ae" ] }, { "uuid": "41a9b487-f20d-4487-8fb3-af59eec9d6e9", "code": "J720PX0KGE", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "2f7610b2-db02-c487-4025-c6b68ee76f7d", "name": "1,2,4-TRIAZINE-3,5(2H,4H)-DIONE, 4-AMINO-6-(1,1-DIMETHYLETHYL)-", "stdName": "1,2,4-TRIAZINE-3,5(2H,4H)-DIONE, 4-AMINO-6-(1,1-DIMETHYLETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "24583321-2976-4c4c-1996-5736a4409e42" ], "display_name": false }, { "uuid": "5d72f954-ea0e-b1e3-4b34-0f4ed6100fef", "name": "4-AMINO-6-TERT-BUTYL-3-HYDROXY-1,2,4-TRIAZIN-5-ONE", "stdName": "4-AMINO-6-TERT-BUTYL-3-HYDROXY-1,2,4-TRIAZIN-5-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "24583321-2976-4c4c-1996-5736a4409e42" ], "display_name": false }, { "uuid": "34301548-344d-6be6-4c62-cd8fefc47504", "name": "DIKETOMETRIBUZIN", "stdName": "DIKETOMETRIBUZIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "24583321-2976-4c4c-1996-5736a4409e42" ], "display_name": true }, { "uuid": "c59330e5-eab6-178a-ab43-2684f41b6bd5", "name": "METRIBUZIN DK", "stdName": "METRIBUZIN DK", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "24583321-2976-4c4c-1996-5736a4409e42" ], "display_name": false } ], "references": [ { "uuid": "abc0cc08-0fc9-4e55-9414-24a4ad6d08e9", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391022000, "tags": [ "NOMEN" ] }, { "uuid": "2ae7cd9a-8d5c-45f3-9666-9f8868ab7f75", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "52e48ae4-42ae-1650-ef3f-d103ed4af1ae", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=56507-37-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "24583321-2976-4c4c-1996-5736a4409e42", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "38c80041-4e76-4660-b19a-c30c0c64b811", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "22d883a2-f09d-4ab2-a815-a45dfdb2cabe", "id": "22d883a2-f09d-4ab2-a815-a45dfdb2cabe", "molfile": "\n Marvin 01132101572D \n\n 13 13 0 0 0 0 999 V2000\n 6.5535 -3.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1286 -4.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4196 -3.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7046 -4.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8362 -4.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5513 -4.2620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2551 -4.6778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2551 -5.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9688 -5.9176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5513 -5.8979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5513 -6.7219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8362 -5.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1098 -5.8979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 5 2 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 12 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 10 1 0 0 0 0\n 12 13 2 0 0 0 0\nM END", "smiles": "CC(C)(C)c1c(=O)n(c(=O)[nH]n1)N", "formula": "C7H12N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1d6aa836-72f9-43f9-9061-c1ea01acdf25" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "184.1961", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "83bf020d-b12e-44d7-9d32-5a1df7a368a5", "version": "5", "structure": { "id": "c8090b8c-1b4d-4864-8100-5301d925431a", "molfile": "\n Marvin 01132110202D \n\n 13 13 0 0 0 0 999 V2000\n 14.8860 -3.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8860 -4.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6011 -4.8433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3049 -4.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0186 -4.8630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3049 -3.6232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6011 -3.2074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6011 -5.6673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1596 -4.8433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1784 -3.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6033 -2.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4694 -2.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7544 -3.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 1 7 2 0 0 0 0\n 3 8 1 0 0 0 0\n 2 9 2 0 0 0 0\n 1 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 13 1 0 0 0 0\nM END", "smiles": "CC(C)(C)c1c(=O)n(c(=O)[nH]n1)N", "formula": "C7H12N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "184.1961", "optical_activity": "NONE", "references": [ "2ae7cd9a-8d5c-45f3-9666-9f8868ab7f75" ], "stereo_centers": 0 }, "unii": "J720PX0KGE" } ] }