{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "3e0fc95a-8eb5-4653-988f-b48c80e16eef", "code": "N0000180182", "comments": "Established Pharmacologic Class [EPC]|Typical Antipsychotic [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000180182", "code_system": "NDF-RT", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "80fc9fdc-4595-4d0f-9bff-7acae9cd978b", "code": "N05AD01", "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANTIPSYCHOTICS|Butyrophenone derivatives|haloperidol", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N05AD01&showdescription=yes", "code_system": "WHO-ATC", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "d0860218-eda3-42c4-a58f-331858504615", "code": "QN05AD01", "comments": "VATC|PSYCHOLEPTICS|ANTIPSYCHOTICS|Butyrophenone derivatives|haloperidol", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05AD01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "4e6786f3-6e1e-446d-b7f3-8f837bdc04ef", "code": "52-86-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=52-86-8", "code_system": "CAS", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2", "fc4ca23d-7d33-4913-9800-60625d81b868" ] }, { "uuid": "a6e78e3a-d541-42ec-933e-6196897db0a8", "code": "C537", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C537", "code_system": "NCI_THESAURUS", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "30c80f1b-872a-471b-9a64-facfbf93f561", "code": "NBK548393", "comments": "LiverTox|CNS|Antipsychotic|Miscellaneous", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548393/", "code_system": "LIVERTOX", "references": [ "d85fd0d7-cea8-8b3f-a514-f012ab3b4f26" ] }, { "uuid": "60788f92-4d3d-4176-98e8-5e8c18cc78a9", "code": "D006220", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68006220", "code_system": "MESH", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "3bfd9f4c-4ff6-4053-9962-743678d6a779", "code": "HALOPERIDOL", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Haloperidol", "code_system": "WIKIPEDIA", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "aa48b8e7-15d4-4a8d-8d9d-8853f98f2079", "code": "24.1", "comments": "WHO ESSENTIAL MEDICINES LIST|Medicines for mental and behavioural disorders|Medicines used in psychotic disorders", "type": "PRIMARY", "url": "http://prais.paho.org/medicine/332/?section=149#type712", "code_system": "WHO-ESSENTIAL MEDICINES LIST", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "e0030c43-cdd1-406c-b655-c9187254f99b", "code": "SUB08005MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "e3ed5497-1730-43a6-838a-5a3d7ba2a21b", "code": "918", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=918", "code_system": "INN", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "9447d83a-ef3b-406c-808a-a189386ec64f", "code": "200-155-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.142", "code_system": "ECHA (EC/EINECS)", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "0599ee19-c994-4b2c-bc1c-13d86fdef135", "code": "86", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=86", "code_system": "IUPHAR", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "0066b288-dbb8-4787-8591-70dab2afd1e5", "code": "HALOPERIDOL", "comments": "Description: A white to faintly yellowish, amorphous or microcrystalline powder; odourless. Solubility: Practically insoluble in water; soluble in 50 parts of ethanol (~750 g/l) TS and in 200 parts of ether R. Category: Neuroleptic. Storage: Haloperidol should be kept in a well-closed container, protected from light. Definition: Haloperidol contains not less than 98.0% and not more than 101.0% of C21H23ClFNO2, calculated with reference to the dried substance.", "type": "PRIMARY", "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.198.pdf", "code_system": "WHO INTERNATIONAL PHARMACOPEIA", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "4e39a89f-e33f-4623-913a-309b9aa8d76f", "code": "5093", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/5093/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "95b32f59-b2a0-4c2e-88dc-efb12dbb7d79", "code": "m5904", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m5904?q=authorize", "code_system": "MERCK INDEX", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "155331ad-3170-4d2a-959f-9e4729c1ac8e", "code": "DB00502", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00502", "code_system": "DRUG BANK", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "5621917d-d9cd-46a4-8eba-3f17ef975245", "code": "CHEMBL54", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL54", "code_system": "ChEMBL", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "4fe2de61-85d9-465f-9a06-72f9daf8152f", "code": "3559", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3559", "code_system": "PUBCHEM", "references": [ "340d3735-fcaf-455e-8b26-9c111df375d2" ] }, { "uuid": "28918537-b328-b90a-632e-583dc2a74eb3", "code": "3093", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3093", "code_system": "HSDB", "references": [ "02988422-677a-d116-6cd9-d155cba76155" ] }, { "uuid": "d16ac68e-2745-1db3-799c-4080d7e31779", "code": "DTXSID4034150", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4034150", "code_system": "EPA CompTox", "references": [ "a0c2501e-773b-2864-6a32-c335c447f8de" ] }, { "uuid": "e8560f0d-e218-3931-8585-83ffbf713b29", "code": "C66883", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Dopamine Antagonist", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66883", "code_system": "NCI_THESAURUS", "references": [ "d85fd0d7-cea8-8b3f-a514-f012ab3b4f26" ] }, { "uuid": "dfd3d20d-18fe-c2d8-9bb3-ac755102811e", "code": "C323", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antiemetic Agent[C267]|Butyrophenone", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C323", "code_system": "NCI_THESAURUS", "references": [ "d85fd0d7-cea8-8b3f-a514-f012ab3b4f26" ] }, { "uuid": "4a6c5910-824f-4c0e-a462-387816f67a03", "code": "J6292F8L3D", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "28bf8d95-9c86-d362-b467-924909aea4c6", "code": "Haloperidol", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM132/", "code_system": "LACTMED", "references": [ "d85fd0d7-cea8-8b3f-a514-f012ab3b4f26" ] }, { "uuid": "f4bf293f-ee3d-0e76-aa52-e359360a1f43", "code": "1353", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/1353", "code_system": "DRUG CENTRAL", "references": [ "d85fd0d7-cea8-8b3f-a514-f012ab3b4f26" ] }, { "uuid": "0ab40c5f-a440-8bb3-08d3-2e1256d813b5", "code": "1303002", "type": "PRIMARY", "url": "https://store.usp.org/product/1303002", "code_system": "RS_ITEM_NUM", "references": [ "d85fd0d7-cea8-8b3f-a514-f012ab3b4f26" ] }, { "uuid": "15012dc3-7cc9-304c-8101-9d2f5d1fe6b6", "code": "5613", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5613", "code_system": "CHEBI", "references": [ "d85fd0d7-cea8-8b3f-a514-f012ab3b4f26" ] }, { "uuid": "d940f066-d648-c33e-6f80-da5422b39350", "code": "100000092645", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "93329438-0cf5-7cb7-26fe-9cc6ebd07ee2" ] }, { "uuid": "1889547b-b290-089b-31a4-9d065bf76f41", "code": "J6292F8L3D", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=J6292F8L3D", "code_system": "DAILYMED", "references": [ "294184c3-f9c7-74dc-c84e-9f5e583fcaae" ] }, { "uuid": "9dc417f8-4535-98ea-0fff-53b0075b2f56", "code": "615296", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=615296", "code_system": "NSC", "references": [ "1902307c-6ee3-d071-e83f-eec1f9430dbf" ] }, { "uuid": "efbea0c0-98e8-7c08-15a8-4b466690a0a7", "code": "170973", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=170973", "code_system": "NSC", "references": [ "1902307c-6ee3-d071-e83f-eec1f9430dbf" ] } ], "substance_class": "chemical", "references": [ { "uuid": "5d87b460-b97c-463c-a31d-357f2584e001", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "70606cfc-1a9b-4df4-b0aa-be4681f79fca", "citation": "INN Proposed List 10", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL10.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c3e17570-dff7-4c7b-be85-43d687f9c5c8", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5650c503-a2fd-43e0-9fc7-8ceeb38ad392", "citation": "EP 7.2", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "371db65d-1033-496b-8506-137f2f04d760", "citation": "USP 33", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "02996a14-ddc9-4c74-b60a-a428e6fef868", "citation": "ORANGE BOOK 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "36b85618-fbbe-48e7-9e0e-73a4691541c4", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e170b228-866a-4d89-9d94-e7035e0bbfd6", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5c6449af-a1a6-4eb1-973c-504667d8a815", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b7079194-ee1c-4e5c-8ae2-8624055d9769", "citation": "D00136", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "349960d8-aa15-4477-a54d-045cd50f4237", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "51afe9e0-d9ce-43be-999b-ff6972e3a2ef", "citation": "USP/NF", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "51e34dd5-8e40-4726-b531-e03302cf6b5c", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "048f42d7-2fa3-4c69-a01a-b5231810cfbe", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6cf65332-f75d-4b56-8c82-7a1231596f46", "citation": "EP", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "53a0fc58-b580-490f-8aae-b1841864a150", "citation": "WHO-IP", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f3a8a8bf-c6f7-4c08-8372-1558acf2c0cc", "citation": "CHEMBL", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1113a546-fe98-4a0f-aa5a-f69eedfb7bfc", "citation": "USP DICTIONARY", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "340d3735-fcaf-455e-8b26-9c111df375d2", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390691000, "tags": [ "NOMEN" ] }, { "uuid": "248ccc01-71b8-4dc8-90d0-685e5923c578", "citation": "DMD 12:1638?1643, 2001", "url": "http://dmd.aspetjournals.org/content/29/12/1638.full.pdf", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f68e654e-da14-4bb8-b0c8-b221e31c9a2c", "citation": "EP 7.8 HALOPERIDOL MONOGRAPH", "doc_type": "EUROPEAN PHARMACOPEIA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "332150a3-fb48-458c-bd81-610d0291a205", "citation": "USP 36 HALOPERIDOL MONOGRAPH", "doc_type": "USP", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "919521ff-5f12-411f-8c24-642b5ac32610", "citation": "SRS import [J6292F8L3D]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J6292F8L3D", "doc_type": "SRS", "public_domain": true, "document_date": 1493390691000, "tags": [ "NOMEN" ] }, { "uuid": "01134ac6-8e4a-4f43-8187-d416b71169ff", "citation": "HALOPERIDOL [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3adaf9af-2fb4-4637-96be-a733ee9d0dc5", "citation": "HALOPERIDOL [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c7c7086e-d905-4715-b888-9559f1065f81", "citation": "HALOPERIDOL [EP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "960b0620-b6f6-4a32-bcb2-f51c82d6e783", "citation": "HALOPERIDOL [USP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e9851fb9-5232-41f3-b2d9-54735847d288", "citation": "HALOPERIDOL [ORANGE BOOK]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "97a0cef4-466c-4217-a3bc-d89feaf1f85c", "citation": "HALOPERIDOL [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e345f7e2-5221-4d14-890e-0e95c97a7e6d", "citation": "HALOPERIDOL [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "df0f1191-d667-4691-88b4-6c04a4b6406e", "citation": "HALOPERIDOL [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "62369e3f-e6a3-4694-abc4-0b379c1cc911", "citation": "HALOPERIDOL [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "4bbc884d-d04f-4c09-b548-61a6debf0ea3", "citation": "HALOPERIDOL [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2eee1a32-f008-4838-a5e3-c9580cf29b5c", "citation": "HALOPERIDOL [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d0fcc338-ad83-4db7-9e01-a36dcf279b7c", "citation": "HALOPERIDOL [WHO-IP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "02988422-677a-d116-6cd9-d155cba76155", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+52-86-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a0c2501e-773b-2864-6a32-c335c447f8de", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=52-86-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "614a0eb5-f67b-45be-0d2f-93b74c79a197", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+52-86-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d85fd0d7-cea8-8b3f-a514-f012ab3b4f26", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "fc4ca23d-7d33-4913-9800-60625d81b868", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "56ef011c-cbd2-0889-f561-be98c2e5ee75", "citation": "USP42-NF37 - 2140, Haloperidol Monograph", "doc_type": "USPNF", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1a6c7ec5-1855-bd60-ec8d-446e86f329b0", "citation": "European Pharmacopoeia Online 9.8, Haloperidol Monograph", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b3579abe-de81-1644-d7bc-964630e4f862", "citation": "JAN", "doc_type": "JAN", "public_domain": true }, { "uuid": "241dd5fa-2381-4162-cc71-7e69dbd831ed", "citation": "USP 10/2020", "doc_type": "USPNF", "public_domain": true }, { "uuid": "fdd8bad5-a01d-466b-9c15-b71ac7b666eb", "citation": "Life Sci 1996;59(10):815-20", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "42877326-8cb0-909a-c65a-f21da07cc4e7", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true }, { "uuid": "dfbbacdd-7bfe-1f05-6dce-a8ccf10351ed", "citation": "EP 10.6", "doc_type": "EP", "public_domain": true }, { "uuid": "1902307c-6ee3-d071-e83f-eec1f9430dbf", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "10d69bf9-f458-bb3c-4431-cf6b07b3cb72", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "98c27f55-5ed1-473f-8ad7-08ac032ad412", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "294184c3-f9c7-74dc-c84e-9f5e583fcaae", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "93329438-0cf5-7cb7-26fe-9cc6ebd07ee2", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "c8c6de31-9163-4a04-9dd7-88708cedb320", "citation": "Kudo, Shoji, and Takashi Ishizaki. \"Pharmacokinetics of haloperidol: an update.\" Clinical pharmacokinetics 37 (1999): 435-456.", "url": "https://link.springer.com/article/10.2165/00003088-199937060-00001#preview", "doc_type": "JA", "public_domain": true }, { "uuid": "db324c71-54e2-4f5b-8653-a6bfa4d0f10a", "citation": "https://www.eurofinsdiscovery.com/catalogmanagement/viewItem/1322", "url": "https://www.eurofinsdiscovery.com/catalogmanagement/viewItem/1322", "doc_type": "ASSAY REFERENCE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "913d2c55-b74f-464d-bdc4-372d09e16633", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "599483d7-ecb1-41b9-a163-4e7cf5280907", "citation": "Bourne, James A. \"SCH 23390: the first selective dopamine D1‐like receptor antagonist.\" CNS drug reviews 7.4 (2001): 399-414.", "url": "https://onlinelibrary.wiley.com/doi/abs/10.1111/j.1527-3458.2001.tb00207.x?sid=nlm%3Apubmed", "doc_type": "JA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2fd9fead-ff05-4ff7-b204-fb486f6f383e", "id": "2fd9fead-ff05-4ff7-b204-fb486f6f383e", "molfile": "\n Marvin 01132102342D \n\n 26 28 0 0 0 0 999 V2000\n 6.3630 -0.9995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6108 -1.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6211 -2.3443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9101 -2.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1836 -2.3520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4803 -2.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7590 -2.3597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0583 -2.7745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3447 -2.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3370 -1.5405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6286 -2.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6286 -3.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0696 -4.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7857 -3.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4967 -4.0187 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7934 -2.7771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0824 -2.3726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1887 -1.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8998 -1.1129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3218 -1.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3321 -2.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0354 -3.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7515 -2.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4651 -3.1454 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7515 -1.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0354 -1.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 19 2 1 0 0 0 0\n 20 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 18 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 9 1 0 0 0 0\n 12 11 1 0 0 0 0\n 17 11 2 0 0 0 0\n 13 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 26 20 2 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 23 25 2 0 0 0 0\n 25 26 1 0 0 0 0\nM END", "smiles": "C(CC(=O)c1ccc(cc1)F)CN2CCC(CC2)(c3ccc(cc3)Cl)O", "formula": "C21H23ClFNO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "65f55835-6cc7-413c-b368-5b9a4e2e109b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "375.8649", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "cb034a38-8a43-4112-9760-cae598710d66", "version": "73", "structure": { "id": "7f14ca7c-6d7a-4ca1-be20-7306f5fe97fc", "molfile": "\n Marvin 01132106362D \n\n 26 28 0 0 0 0 999 V2000\n 17.2822 -3.0483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8550 -3.8831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2925 -3.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5711 -2.6439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9932 -3.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0160 -3.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2999 -4.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0083 -3.0715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5814 -4.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8600 -3.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0035 -4.2798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7068 -3.0483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2999 -5.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5888 -3.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0344 -2.5305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4229 -4.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8855 -5.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7068 -4.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6016 -5.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4229 -3.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8778 -4.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1745 -5.5498 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 20.1365 -4.6765 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1516 -4.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4303 -3.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7296 -4.3056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 10 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 26 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 6 2 0 0 0 0\n 9 3 1 0 0 0 0\n 10 4 1 0 0 0 0\n 11 5 2 0 0 0 0\n 12 5 1 0 0 0 0\n 13 7 1 0 0 0 0\n 14 7 2 0 0 0 0\n 15 1 1 0 0 0 0\n 16 20 1 0 0 0 0\n 17 21 2 0 0 0 0\n 18 11 1 0 0 0 0\n 19 13 2 0 0 0 0\n 20 12 2 0 0 0 0\n 21 14 1 0 0 0 0\n 22 17 1 0 0 0 0\n 23 16 1 0 0 0 0\n 24 2 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 9 2 1 0 0 0 0\n 16 18 2 0 0 0 0\n 19 17 1 0 0 0 0\nM END", "smiles": "C(CC(=O)c1ccc(cc1)F)CN2CCC(CC2)(c3ccc(cc3)Cl)O", "formula": "C21H23ClFNO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "375.8649", "optical_activity": "NONE", "references": [ "919521ff-5f12-411f-8c24-642b5ac32610", "5d87b460-b97c-463c-a31d-357f2584e001", "70606cfc-1a9b-4df4-b0aa-be4681f79fca" ], "stereo_centers": 0 }, "unii": "J6292F8L3D", "relationships": [ { "uuid": "cd4e4383-45b1-41d6-a53e-e27666012bb0", "amount": { "uuid": "1d5ca68a-c7f6-4cfa-b1c5-a71f858c43a1" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "bf550e5f-726f-4add-b022-529213e2aded", "refuuid": "cb034a38-8a43-4112-9760-cae598710d66", "name": "HALOPERIDOL", "unii": "J6292F8L3D", "linking_id": "J6292F8L3D", "ref_pname": "HALOPERIDOL", "substance_class": "reference" } }, { "uuid": "9b6d9e91-8604-48b2-a743-f270e55581d9", "amount": { "uuid": "602e5db2-19cd-4fb9-a9d8-223d7c20c29e" }, "type": "METABOLITE INACTIVE->PARENT", "mediator_substance": { "uuid": "b97db86e-a7d7-496c-b67b-c6c0c38b6c6a", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "248ccc01-71b8-4dc8-90d0-685e5923c578" ], "related_substance": { "uuid": "64c15968-2484-4a4d-925b-64b2899e3739", "refuuid": "d8786e3c-190e-4fad-ada5-27179ce57594", "name": "4-(4-CHLOROPHENYL)-4-PIPERIDINOL", "unii": "UND92FKS0W", "linking_id": "UND92FKS0W", "ref_pname": "4-(4-CHLOROPHENYL)-4-PIPERIDINOL", "substance_class": "reference" } }, { "uuid": "e6d1e977-81af-4f36-9384-f1dd9dc36900", "amount": { "uuid": "bb86b19a-6b76-4f1b-99a1-7a2505acad09", "type": "RELATIONSHIP_AMOUNT", "units": "WEIGHT PERCENT", "high_limit": 101, "low_limit": 99 }, "qualification": "EP", "type": "BASIS OF STRENGTH->SUBSTANCE", "interaction_type": "ASSAY (TITRATION)", "references": [ "f68e654e-da14-4bb8-b0c8-b221e31c9a2c" ], "related_substance": { "uuid": "87583c6d-52fe-408a-9f64-b3aba6dc1874", "refuuid": "cb034a38-8a43-4112-9760-cae598710d66", "name": "HALOPERIDOL", "unii": "J6292F8L3D", "linking_id": "J6292F8L3D", "ref_pname": "HALOPERIDOL", "substance_class": "reference" } }, { "uuid": "334d3462-cf4d-4392-8f80-d47dc81866c6", "amount": { "uuid": "491efd50-a46f-45f6-82a8-c2a2c1657540", "type": "RELATIONSHIP_AMOUNT", "units": "WEIGHT PERCENT", "high_limit": 102, "low_limit": 98 }, "qualification": "USP", "type": "BASIS OF STRENGTH->SUBSTANCE", "interaction_type": "ASSAY (TITRATION)", "references": [ "332150a3-fb48-458c-bd81-610d0291a205" ], "related_substance": { "uuid": "fff92a71-920c-4c84-a841-34ec40b2d2bc", "refuuid": "cb034a38-8a43-4112-9760-cae598710d66", "name": "HALOPERIDOL", "unii": "J6292F8L3D", "linking_id": "J6292F8L3D", "ref_pname": "HALOPERIDOL", "substance_class": "reference" } }, { "uuid": "bef8f077-6f14-4db7-b2c3-b32ae86a38dd", "amount": { "uuid": "ec6f91da-78ce-4a36-8365-ce73f6c12ab3", "units": "PERCENT PEAK AREA", "high_limit": 0.5 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "f68e654e-da14-4bb8-b0c8-b221e31c9a2c", "1a6c7ec5-1855-bd60-ec8d-446e86f329b0" ], "related_substance": { "uuid": "9da48e50-d5dd-400d-990f-809076ed3cd4", "refuuid": "f0898568-e698-4192-b73d-e46fc83dfb15", "name": "4-(4-(4-CHLOROPHENYL)-4-HYDROXYPIPERIDIN-1-YL)-1-(4-(4-(4-CHLOROPHENYL)-4-HYDROXYPIPERIDIN-1-YL)PHENYL)BUTAN-1-ONE", "unii": "PC902FN76R", "linking_id": "PC902FN76R", "ref_pname": "4-(4-(4-CHLOROPHENYL)-4-HYDROXYPIPERIDIN-1-YL)-1-(4-(4-(4-CHLOROPHENYL)-4-HYDROXYPIPERIDIN-1-YL)PHENYL)BUTAN-1-ONE", "substance_class": "reference" } }, { "uuid": "0ce7a3c2-d58c-4bd3-ade1-132a211307ed", "amount": { "uuid": "506bb25a-fa41-4dfb-8932-d65b0c140aaa" }, "type": "METABOLITE TOXIC->PARENT", "mediator_substance": { "uuid": "7961a465-2178-464d-a458-352720a0243c", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "248ccc01-71b8-4dc8-90d0-685e5923c578" ], "related_substance": { "uuid": "f9f9a99a-855d-4dc4-a4e7-449050e0c170", "refuuid": "546d093f-5c42-4d65-83c4-0cf42982cbaa", "name": "HALOPERIDOL PYRIDINIUM", "unii": "47Z7A2W953", "linking_id": "47Z7A2W953", "ref_pname": "HALOPERIDOL PYRIDINIUM", "substance_class": "reference" } }, { "uuid": "16a50192-9d76-42b8-9f7c-2a9b569c699d", "amount": { "uuid": "0f95e36b-2b68-4346-adb3-5833f14f5d00" }, "type": "METABOLITE->PARENT", "mediator_substance": { "uuid": "8ef62c54-7d76-4b9d-9067-d30dc7ecc621", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "fdd8bad5-a01d-466b-9c15-b71ac7b666eb" ], "related_substance": { "uuid": "04939ca3-126a-4ae6-a189-b7bc8f155646", "refuuid": "7072e1ef-ef7d-4cd4-81db-918675abd342", "name": "4-(4-(P-CHLOROPHENYL)-2,5,6-TRIHYDROPYRIDINO)-4'-FLUOROBUTYROPHENONE", "unii": "59IR9L62QF", "linking_id": "59IR9L62QF", "ref_pname": "4-(4-(P-CHLOROPHENYL)-2,5,6-TRIHYDROPYRIDINO)-4'-FLUOROBUTYROPHENONE", "substance_class": "reference" } }, { "uuid": "1bf0fdde-923d-4599-b1b9-76dcf383cc37", "amount": { "uuid": "bf16c8f9-d060-4334-9965-01253523a74b" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "e059f497-b707-49ff-a453-c39ed7fcdc98", "refuuid": "dd7819bc-02b5-49ca-aa02-4fd9b0de61ee", "name": "HALOPERIDOL HYDROCHLORIDE", "unii": "UM06W2ADRY", "linking_id": "UM06W2ADRY", "ref_pname": "HALOPERIDOL HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "5b8706c2-f8ab-4446-bf77-6a87a2f05379", "amount": { "uuid": "65b1057c-486b-4881-b8e9-a9bbc94b576c" }, "type": "METABOLITE->PARENT", "mediator_substance": { "uuid": "6ecd256f-e522-4abd-8b73-667de0da9fe8", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "related_substance": { "uuid": "c8f035ce-ae5a-4eba-b406-10e1f257c167", "refuuid": "e32d2a94-51d4-4456-a284-83084983e7c5", "name": "3-(4-FLUOROBENZOYL)PROPANOIC ACID", "unii": "V2Z6N6JC9Z", "linking_id": "V2Z6N6JC9Z", "ref_pname": "3-(4-FLUOROBENZOYL)PROPANOIC ACID" } }, { "uuid": "07422b31-2eb7-4e34-ad8c-e9bf67cd0b89", "amount": { "uuid": "5094cc8d-dd71-4183-ad6d-6c2bc7a232fd", "units": "PERCENT PEAK AREA", "high_limit": 0.3 }, "qualification": "USP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "56ef011c-cbd2-0889-f561-be98c2e5ee75" ], "related_substance": { "uuid": "b43cf217-1293-4c53-967a-1ed60a9fe120", "refuuid": "5629454e-263d-463e-9657-6b0c4acebad3", "name": "4-(4-(4-CHLOROPHENYL)-4-HYDROXYPIPERIDIN-1-YL)-1-(2-FLUOROPHENYL)BUTAN-1-ONE", "unii": "6ZQO8KXL92", "linking_id": "6ZQO8KXL92", "ref_pname": "4-(4-(4-CHLOROPHENYL)-4-HYDROXYPIPERIDIN-1-YL)-1-(2-FLUOROPHENYL)BUTAN-1-ONE", "substance_class": "reference" } }, { "uuid": "f2e5746e-8aa7-43da-84ee-a9beb7f29111", "amount": { "uuid": "6196ec7c-2b7a-4963-a1aa-e7bc39374cc0", "units": "PERCENT PEAK AREA", "high_limit": 0.2 }, "qualification": "USP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "56ef011c-cbd2-0889-f561-be98c2e5ee75" ], "related_substance": { "uuid": "3047108a-cea3-4b25-85cc-9a8c57cb7707", "refuuid": "f0898568-e698-4192-b73d-e46fc83dfb15", "name": "4-(4-(4-CHLOROPHENYL)-4-HYDROXYPIPERIDIN-1-YL)-1-(4-(4-(4-CHLOROPHENYL)-4-HYDROXYPIPERIDIN-1-YL)PHENYL)BUTAN-1-ONE", "unii": "PC902FN76R", "linking_id": "PC902FN76R", "ref_pname": "4-(4-(4-CHLOROPHENYL)-4-HYDROXYPIPERIDIN-1-YL)-1-(4-(4-(4-CHLOROPHENYL)-4-HYDROXYPIPERIDIN-1-YL)PHENYL)BUTAN-1-ONE", "substance_class": "reference" } }, { "uuid": "abca317c-8759-4cb4-8e30-b43e90234107", "amount": { "uuid": "6f85b33a-b00b-4a26-a5bb-5be5e8a50169" }, "type": "PRODRUG->METABOLITE ACTIVE", "references": [ "98c27f55-5ed1-473f-8ad7-08ac032ad412" ], "related_substance": { "uuid": "2effb388-f4a7-4610-8845-8617b6c19f16", "refuuid": "9c9e781c-14de-496b-8579-7eba698b3252", "name": "HALOPERIDOL DECANOATE", "unii": "AC20PJ4101", "linking_id": "AC20PJ4101", "ref_pname": "HALOPERIDOL DECANOATE", "substance_class": "reference" } }, { "uuid": "0916b2df-c130-4823-9f3a-bdafc3e2c36f", "amount": { "uuid": "23a064a3-5f17-450b-bb16-a8bf83691277", "average": 0.3, "units": "NANOMOLAR" }, "qualification": "Ki", "type": "TARGET->INVERSE AGONIST", "interaction_type": "BINDING", "related_substance": { "uuid": "835f62b4-4b89-46c2-a179-7faebbb10b65", "refuuid": "8a5e8a47-f550-4902-8d11-e0aa6920db0b", "name": "D(2) DOPAMINE RECEPTOR", "unii": "19GBD6T9L7", "linking_id": "19GBD6T9L7", "ref_pname": "D(2) DOPAMINE RECEPTOR", "substance_class": "reference" } }, { "uuid": "9a667ece-754d-4353-9d83-f759ce116bd6", "amount": { "uuid": "41586102-da3f-4c0c-a241-d9ab4abbc17d" }, "type": "PARENT->METABOLITE", "references": [ "c8c6de31-9163-4a04-9dd7-88708cedb320" ], "related_substance": { "uuid": "ab6f4532-b2ad-4eb6-b6f9-492923478ba7", "refuuid": "fc8eea66-4e84-407b-b418-61cf4598b5ab", "name": "HALOPERIDOL GLUCURONIDE", "unii": "4W53FP2YJV", "linking_id": "4W53FP2YJV", "ref_pname": "HALOPERIDOL GLUCURONIDE", "substance_class": "reference" } }, { "uuid": "de1e8e5e-c62e-4daa-b1fd-a4ab8d03084f", "amount": { "uuid": "df8b9cb4-7395-4a33-b915-26350a171c6c", "high": 92.5, "low": 89 }, "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "c8c6de31-9163-4a04-9dd7-88708cedb320" ], "related_substance": { "uuid": "16c54d83-5139-4ffa-9445-f7b93af620f9", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "ade72be1-9d4b-4b51-b51f-a75725fdcdc7", "amount": { "uuid": "4d4f8403-f4d6-43ae-a1f9-523ec241b8e2", "average": 2.6, "units": "NANOMOLAR" }, "qualification": "IC50", "type": "TARGET->INHIBITOR", "interaction_type": "BINDING", "references": [ "db324c71-54e2-4f5b-8653-a6bfa4d0f10a" ], "related_substance": { "uuid": "8aedcb74-3101-4148-8cbc-5a88f947528a", "refuuid": "8a5e8a47-f550-4902-8d11-e0aa6920db0b", "name": "D(2) DOPAMINE RECEPTOR", "unii": "19GBD6T9L7", "linking_id": "19GBD6T9L7", "ref_pname": "D(2) DOPAMINE RECEPTOR", "substance_class": "reference" } }, { "uuid": "5d5094e9-ee30-4b24-aef3-42619de8a682", "amount": { "uuid": "a211eb12-9dd0-4606-a78f-8ebdd0b3df6d" }, "type": "IMPURITY->PARENT", "references": [ "913d2c55-b74f-464d-bdc4-372d09e16633" ], "related_substance": { "uuid": "3438d7e1-ebe7-4709-8f3e-8e7cdedcca87", "refuuid": "b4d72f23-8573-4450-919e-328b8f41b3bd", "name": "N,C-Fluorophenylbutyryl Haloperidol", "unii": "SBH8N48FGM", "linking_id": "SBH8N48FGM", "ref_pname": "N,C-Fluorophenylbutyryl Haloperidol", "substance_class": "reference" } }, { "uuid": "46561c8d-5392-4dfb-88e0-6287e9f6ee81", "amount": { "uuid": "e3c0e993-f10d-4fb0-aa36-efb416767aae", "average": 100, "units": "NANOMOLAR" }, "qualification": "Ki", "type": "TARGET->WEAK INHIBITOR", "references": [ "599483d7-ecb1-41b9-a163-4e7cf5280907" ], "related_substance": { "uuid": "324705f4-1763-4111-b788-4cb8450a4d83", "refuuid": "7d15e9e6-b6eb-4b58-9bc0-a2bdb303b579", "name": "D(1B) DOPAMINE RECEPTOR", "unii": "EI9KB27FI6", "linking_id": "EI9KB27FI6", "ref_pname": "D(1B) DOPAMINE RECEPTOR", "substance_class": "reference" } }, { "uuid": "b816185e-fa5e-483f-8163-d09ab624acaf", "amount": { "uuid": "98e66f0a-b116-46e8-bf04-e321c6f75917", "average": 80, "units": "NANOMOLAR" }, "qualification": "Ki", "type": "TARGET->WEAK INHIBITOR", "references": [ "599483d7-ecb1-41b9-a163-4e7cf5280907" ], "related_substance": { "uuid": "f469ef28-f0b6-4381-8a44-fff2924a8e70", "refuuid": "84edf12e-87a3-43e0-8526-ad45513dcd09", "name": "D(1A) DOPAMINE RECEPTOR", "unii": "54202V7DRJ", "linking_id": "54202V7DRJ", "ref_pname": "D(1A) DOPAMINE RECEPTOR", "substance_class": "reference" } }, { "uuid": "71dba06e-98ca-4914-8bfc-3ed6bd47b72c", "amount": { "uuid": "3b496abb-512a-44ed-bd9d-804189864106", "average": 2.3, "units": "NANOMOLAR" }, "qualification": "Ki", "type": "TARGET->INHIBITOR", "references": [ "599483d7-ecb1-41b9-a163-4e7cf5280907" ], "related_substance": { "uuid": "3800d383-9c63-47b3-9adc-e93f617f9b6c", "refuuid": "ea992769-afc0-4ea1-a836-2b3c94ce32cd", "name": "D(4) DOPAMINE RECEPTOR", "unii": "RI471QC62V", "linking_id": "RI471QC62V", "ref_pname": "D(4) DOPAMINE RECEPTOR", "substance_class": "reference" } }, { "uuid": "a70acfc3-56cb-4e89-8ffc-63ba1cdc3d70", "amount": { "uuid": "3209e02b-ca77-4608-87cc-c69670104b3a", "average": 7, "units": "NANOMOLAR" }, "qualification": "Ki", "type": "TARGET->INHIBITOR", "references": [ "599483d7-ecb1-41b9-a163-4e7cf5280907" ], "related_substance": { "uuid": "72409eb9-ff44-4636-a7f3-5b6abe11393b", "refuuid": "a98f13f0-dc55-4a68-ad39-74c161d27375", "name": "D(3) DOPAMINE RECEPTOR", "unii": "G9XQ9S7T2F", "linking_id": "G9XQ9S7T2F", "ref_pname": "D(3) DOPAMINE RECEPTOR", "substance_class": "reference" } }, { "uuid": "b1954928-3664-466a-afed-aec9e0a9317d", "amount": { "uuid": "76e142f1-3cdf-43e2-98bb-ee892fc47a51", "average": 1.2, "units": "NANOMOLAR" }, "qualification": "Ki", "type": "TARGET->INHIBITOR", "references": [ "599483d7-ecb1-41b9-a163-4e7cf5280907" ], "related_substance": { "uuid": "775ce9ec-53e6-4f4d-8803-22e8bf46cd97", "refuuid": "8a5e8a47-f550-4902-8d11-e0aa6920db0b", "name": "D(2) DOPAMINE RECEPTOR", "unii": "19GBD6T9L7", "linking_id": "19GBD6T9L7", "ref_pname": "D(2) DOPAMINE RECEPTOR", "substance_class": "reference" } } ], "names": [ { "uuid": "a8d6b1ca-84ed-42ae-836e-0feb21464a48", "name": "1-BUTANONE, 4-(4-(4-CHLOROPHENYL)-4-HYDROXY-1-PIPERIDINYL)-1-(4-FLUOROPHENYL)-", "stdName": "1-BUTANONE, 4-(4-(4-CHLOROPHENYL)-4-HYDROXY-1-PIPERIDINYL)-1-(4-FLUOROPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5d87b460-b97c-463c-a31d-357f2584e001" ], "display_name": false }, { "uuid": "30369be7-646e-4780-a29e-83db345e1b78", "name": "ALOPERIDIN", "stdName": "ALOPERIDIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "a45714bc-b790-47ba-b785-629b3d384578", "name": "BIOPERIDOLO", "stdName": "BIOPERIDOLO", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "f936e354-1885-4884-968a-22a9f1c3d134", "name": "DOZIC", "stdName": "DOZIC", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "0802e1b9-3ff6-4abd-8ce1-550295c39a11", "name": "EUKYSTOL", "stdName": "EUKYSTOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "2ece8f02-d8e8-4a91-8393-69d5d58d8760", "name": "HALDOL", "stdName": "HALDOL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "b7079194-ee1c-4e5c-8ae2-8624055d9769", "5c6449af-a1a6-4eb1-973c-504667d8a815" ], "display_name": false }, { "uuid": "38effcf8-9bc2-46f1-945b-2c38ee7274cb", "name": "HALOPERIDOL", "stdName": "HALOPERIDOL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "3adaf9af-2fb4-4637-96be-a733ee9d0dc5", "5d87b460-b97c-463c-a31d-357f2584e001", "048f42d7-2fa3-4c69-a01a-b5231810cfbe", "c7c7086e-d905-4715-b888-9559f1065f81", "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "70606cfc-1a9b-4df4-b0aa-be4681f79fca", "349960d8-aa15-4477-a54d-045cd50f4237", "e9851fb9-5232-41f3-b2d9-54735847d288", "51afe9e0-d9ce-43be-999b-ff6972e3a2ef", "01134ac6-8e4a-4f43-8187-d416b71169ff", "2eee1a32-f008-4838-a5e3-c9580cf29b5c", "c3e17570-dff7-4c7b-be85-43d687f9c5c8", "62369e3f-e6a3-4694-abc4-0b379c1cc911", "53a0fc58-b580-490f-8aae-b1841864a150", "97a0cef4-466c-4217-a3bc-d89feaf1f85c", "51e34dd5-8e40-4726-b531-e03302cf6b5c", "36b85618-fbbe-48e7-9e0e-73a4691541c4", "960b0620-b6f6-4a32-bcb2-f51c82d6e783", "e170b228-866a-4d89-9d94-e7035e0bbfd6", "4bbc884d-d04f-4c09-b548-61a6debf0ea3", "d0fcc338-ad83-4db7-9e01-a36dcf279b7c", "5650c503-a2fd-43e0-9fc7-8ceeb38ad392", "df0f1191-d667-4691-88b4-6c04a4b6406e", "371db65d-1033-496b-8506-137f2f04d760", "e345f7e2-5221-4d14-890e-0e95c97a7e6d", "02996a14-ddc9-4c74-b60a-a428e6fef868" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "284074d3-39c5-45ca-b44d-a31507939c25", "name_org": "INN" }, { "uuid": "c4506da2-7573-4b8b-be54-a43e8ac9b459", "name_org": "USAN" } ] }, { "uuid": "097eed31-7a0d-d0ab-6c9b-6911e61d0a80", "name": "HALOPERIDOL DECANOATE IMPURITY G [EP IMPURITY]", "stdName": "HALOPERIDOL DECANOATE IMPURITY G [EP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dfbbacdd-7bfe-1f05-6dce-a8ccf10351ed" ], "display_name": false }, { "uuid": "c3ea5717-3d50-927f-8017-6066089fbd81", "name": "HALOPERIDOL DECANOATE IMPURITY, HALOPERIDOL- [USP IMPURITY]", "stdName": "HALOPERIDOL DECANOATE IMPURITY, HALOPERIDOL- [USP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "51afe9e0-d9ce-43be-999b-ff6972e3a2ef", "7b4211e3-31a8-446c-93a6-8e71c37b3e99" ], "display_name": false }, { "uuid": "484053a9-ab17-ff97-b8c2-dbf05a1c6709", "name": "HALOPERIDOL [EP MONOGRAPH]", "stdName": "HALOPERIDOL [EP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "42877326-8cb0-909a-c65a-f21da07cc4e7" ], "display_name": false }, { "uuid": "10a4a263-53a4-47a2-881a-560e516b202b", "name": "HALOPERIDOL [HSDB]", "stdName": "HALOPERIDOL [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "349960d8-aa15-4477-a54d-045cd50f4237" ], "display_name": false }, { "uuid": "4f514255-4c2f-fc63-e917-ad2903b482bd", "name": "HALOPERIDOL [JAN]", "stdName": "HALOPERIDOL [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b3579abe-de81-1644-d7bc-964630e4f862" ], "display_name": false }, { "uuid": "cdafe1c6-f800-4ffb-92e7-374b412567d6", "name": "HALOPERIDOL [MART.]", "stdName": "HALOPERIDOL [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "36b85618-fbbe-48e7-9e0e-73a4691541c4" ], "display_name": false }, { "uuid": "b2e58b3e-0f2c-4420-8008-67e34103a649", "name": "HALOPERIDOL [MI]", "stdName": "HALOPERIDOL [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e170b228-866a-4d89-9d94-e7035e0bbfd6", "7b4211e3-31a8-446c-93a6-8e71c37b3e99" ], "display_name": false }, { "uuid": "dabed38c-4d68-4d62-8e65-4468d37972af", "name": "HALOPERIDOL [ORANGE BOOK]", "stdName": "HALOPERIDOL [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "02996a14-ddc9-4c74-b60a-a428e6fef868" ], "display_name": false }, { "uuid": "e35303c8-546f-48fd-8ced-d44f86264279", "name": "HALOPERIDOL [USAN]", "stdName": "HALOPERIDOL [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c3e17570-dff7-4c7b-be85-43d687f9c5c8" ], "display_name": false }, { "uuid": "e25ef866-ffde-e7e1-aeab-75aeafb00cab", "name": "HALOPERIDOL [USP IMPURITY]", "stdName": "HALOPERIDOL [USP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "371db65d-1033-496b-8506-137f2f04d760" ], "display_name": false }, { "uuid": "c2c8672b-5910-176a-1338-f56882b2caa1", "name": "HALOPERIDOL [USP MONOGRAPH]", "stdName": "HALOPERIDOL [USP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "241dd5fa-2381-4162-cc71-7e69dbd831ed" ], "display_name": false }, { "uuid": "f9b934c4-2136-400d-9fe5-34198f4bd518", "name": "HALOPERIDOL [USP-RS]", "stdName": "HALOPERIDOL [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "51afe9e0-d9ce-43be-999b-ff6972e3a2ef", "7b4211e3-31a8-446c-93a6-8e71c37b3e99" ], "display_name": false }, { "uuid": "f430203e-ff8c-4ee5-aee8-3471245303d0", "name": "HALOPERIDOL [VANDF]", "stdName": "HALOPERIDOL [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "048f42d7-2fa3-4c69-a01a-b5231810cfbe", "7b4211e3-31a8-446c-93a6-8e71c37b3e99" ], "display_name": false }, { "uuid": "10e961db-82dd-47c7-9d24-c519c8ef0b56", "name": "HALOPERIDOL [WHO-IP]", "stdName": "HALOPERIDOL [WHO-IP]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "53a0fc58-b580-490f-8aae-b1841864a150", "7b4211e3-31a8-446c-93a6-8e71c37b3e99" ], "display_name": false }, { "uuid": "7e14c90e-d2af-410b-b918-e0be5b03b813", "name": "HALOPERIDOLUM [WHO-IP LATIN]", "stdName": "HALOPERIDOLUM [WHO-IP LATIN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "53a0fc58-b580-490f-8aae-b1841864a150", "7b4211e3-31a8-446c-93a6-8e71c37b3e99" ], "display_name": false }, { "uuid": "41689f08-8f58-f452-2408-b7d9cfffb30e", "name": "Haloperidol [WHO-DD]", "stdName": "HALOPERIDOL [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "10d69bf9-f458-bb3c-4431-cf6b07b3cb72" ], "display_name": false }, { "uuid": "2f79dc1a-0daf-47fc-a908-60a05abdf161", "name": "KESELAN", "stdName": "KESELAN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "d6ea9ac9-b5b7-4a5e-8271-5d9b8dbdc32f", "name": "LINTON", "stdName": "LINTON", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "d421c6ab-176e-4af7-a504-a230e02e606f", "name": "NEURODOL", "stdName": "NEURODOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "36b642bf-bc35-4a17-aba6-7fbd4bd93252", "name": "NSC-170973", "stdName": "NSC-170973", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "705a441f-6a9a-4037-97f7-9c2a48b2fb0f", "name": "NSC-615296", "stdName": "NSC-615296", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "60acdbd0-1812-4939-9a35-d269c26a4c9c", "name": "R-1625", "stdName": "R-1625", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f3a8a8bf-c6f7-4c08-8372-1558acf2c0cc", "7b4211e3-31a8-446c-93a6-8e71c37b3e99" ], "display_name": false }, { "uuid": "ba39c355-30a5-4d56-b0b8-91cad6bfe828", "name": "SERENACE", "stdName": "SERENACE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "a016a70d-ab9c-448d-842f-e28c950b7e16", "name": "SERENASE", "stdName": "SERENASE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "9d213f28-e3f8-41c6-98d2-38416c9d67f4", "name": "SERENELFI", "stdName": "SERENELFI", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "1307a270-7d78-4e29-bb3d-1cea60329eab", "name": "SIGAPERIDOL", "stdName": "SIGAPERIDOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b4211e3-31a8-446c-93a6-8e71c37b3e99", "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "0d6a73e4-b0dd-4bf7-a8f8-219795c77194", "name": "VESALIUM COMPONENT HALOPERIDOL", "stdName": "VESALIUM COMPONENT HALOPERIDOL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "c7e8b3ff-3e35-4185-b13c-cd19b12bbca9" ], "display_name": false }, { "uuid": "eaa960d2-7a1b-4075-a6f8-86cdecdb62c4", "name": "haloperidol [INN]", "stdName": "HALOPERIDOL [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "70606cfc-1a9b-4df4-b0aa-be4681f79fca" ], "display_name": false } ], "modifications": { "uuid": "06cb658c-a288-4bf3-9863-6085fe46f832" } } ] }