{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "dfd6e0aa-9118-4ece-965a-871f9f7d7eda", "code": "EME (psychedelic)", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/EME_(psychedelic)", "code_system": "WIKIPEDIA" }, { "uuid": "331a2088-750d-42cf-a8d9-6df06c01bfca", "code": "PiHKAL", "comments": "Wikipedia|PiHKAL|Phenethylamines", "type": "CONCEPT", "url": "https://en.wikipedia.org/wiki/PiHKAL", "code_system": "WIKIPEDIA" }, { "uuid": "2f18f54c-d482-4a8b-b045-9d03de12b113", "code": "44719562", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44719562", "code_system": "PUBCHEM" }, { "uuid": "85478739-3d95-4bbe-9eea-9f33990fe253", "code": "23693-34-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=23693-34-7", "code_system": "CAS", "references": [ "bcb47cd9-4fd5-45cd-b908-af89cd4dc31f", "c80b052e-c7c9-4981-b7c7-8d566d44ea0d" ] }, { "uuid": "74ea8a0c-f016-96b9-7f72-b7e47aa4e6fb", "code": "DTXSID80660363", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80660363", "code_system": "EPA CompTox" }, { "uuid": "cb602115-cea6-4884-832f-880656d2f07e", "code": "J5Z2GQ2QK7", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "13eab571-5ce7-46bc-97b8-b02e98ae8222", "amount": { "uuid": "ff96a528-1e88-4a29-b9fb-336c4b6a64a9" }, "type": "ACTIVE MOIETY", "references": [ "bcb47cd9-4fd5-45cd-b908-af89cd4dc31f" ], "related_substance": { "uuid": "8a333ddc-50b6-447d-9b14-03524f02ea15", "refuuid": "0a534e06-5a94-4d0e-85bc-69e2b11f76fe", "name": "EME", "unii": "J5Z2GQ2QK7", "linking_id": "J5Z2GQ2QK7", "ref_pname": "EME", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "67de79d9-0ac2-47c7-a106-861b145b056d", "name": "2,5-DIETHOXY-4-METHOXY-.ALPHA.-METHYLBENZENEETHANAMINE", "stdName": "2,5-DIETHOXY-4-METHOXY-.ALPHA.-METHYLBENZENEETHANAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c80b052e-c7c9-4981-b7c7-8d566d44ea0d" ], "display_name": false }, { "uuid": "2d94d3c1-43be-44f7-980c-22dc25be7148", "name": "2,5-DIETHOXY-4-METHOXYAMPHETAMINE", "stdName": "2,5-DIETHOXY-4-METHOXYAMPHETAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bcb47cd9-4fd5-45cd-b908-af89cd4dc31f" ], "display_name": false }, { "uuid": "6afa9320-f488-43d1-a6e7-96bbbd1e0fcf", "name": "EME", "stdName": "EME", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bcb47cd9-4fd5-45cd-b908-af89cd4dc31f" ], "display_name": true }, { "uuid": "d8844ab2-e5db-4e44-9adc-cc53265bddbb", "name": "EME (PSYCHEDELIC)", "stdName": "EME (PSYCHEDELIC)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bcb47cd9-4fd5-45cd-b908-af89cd4dc31f" ], "display_name": false }, { "uuid": "ab423e72-c6cd-4d97-818a-73c7f71aea45", "name": "PHENETHYLAMINE, 2,5-DIETHOXY-4-METHOXY-.ALPHA.-METHYL-", "stdName": "PHENETHYLAMINE, 2,5-DIETHOXY-4-METHOXY-.ALPHA.-METHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c80b052e-c7c9-4981-b7c7-8d566d44ea0d" ], "display_name": false } ], "references": [ { "uuid": "bcb47cd9-4fd5-45cd-b908-af89cd4dc31f", "citation": "https://en.wikipedia.org/wiki/EME_(psychedelic)", "doc_type": "WIKI", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c80b052e-c7c9-4981-b7c7-8d566d44ea0d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3b1eda43-4937-4d7c-bbd9-005f0a29d0c3", "id": "3b1eda43-4937-4d7c-bbd9-005f0a29d0c3", "molfile": "\n Marvin 01132103082D \n\n 18 18 0 0 0 0 999 V2000\n 0.1191 -0.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8335 -0.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8335 0.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1191 0.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5954 0.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5954 -0.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3099 -0.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0243 -0.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0243 0.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7388 -0.8021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1191 1.6729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8335 2.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8335 2.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5480 0.8479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2625 0.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1191 -1.6271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8335 -2.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8335 -2.8646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 6 1 0 0 0 0\n 1 16 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 14 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 11 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "CCOc1cc(c(cc1CC(C)N)OCC)OC", "formula": "C14H23NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "adae7ea8-84e7-42e5-a90e-8ff63b32d629" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "253.3379", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "0a534e06-5a94-4d0e-85bc-69e2b11f76fe", "version": "11", "structure": { "id": "2ce7e4a4-77e7-48b5-abab-983623e1f31f", "molfile": "\n Marvin 01132102252D \n\n 18 18 0 0 0 0 999 V2000\n 13.6672 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3817 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3817 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6672 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9528 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9528 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2382 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5239 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5239 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8094 -4.8950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6672 -2.4200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3817 -2.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3817 -1.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0961 -3.2450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8106 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6672 -5.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3817 -6.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3817 -6.9575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 1 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 4 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 3 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 1 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "CCOc1cc(c(cc1CC(C)N)OCC)OC", "formula": "C14H23NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "253.3379", "optical_activity": "( + / - )", "references": [ "bcb47cd9-4fd5-45cd-b908-af89cd4dc31f", "c80b052e-c7c9-4981-b7c7-8d566d44ea0d" ], "stereo_centers": 1 }, "unii": "J5Z2GQ2QK7" } ] }