{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8d9b55bd-c672-4f2c-b954-e1fea39f5dc5",
          "code": "C012209",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67012209",
          "code_system": "MESH",
          "references": [
            "ae5bcaf7-6215-4ad7-89ea-e98209b3f127"
          ]
        },
        {
          "uuid": "573a038e-2ab9-4fac-b5df-71eec3056c26",
          "code": "41889-45-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41889-45-6",
          "code_system": "CAS",
          "references": [
            "ae5bcaf7-6215-4ad7-89ea-e98209b3f127",
            "1f59f1d8-83cf-4271-8ac9-e51d25e919e5"
          ]
        },
        {
          "uuid": "16c8dc44-d636-4e78-95bb-a17c4fb34d71",
          "code": "114718",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/114718",
          "code_system": "PUBCHEM",
          "references": [
            "ae5bcaf7-6215-4ad7-89ea-e98209b3f127"
          ]
        },
        {
          "uuid": "f184f710-a22e-4238-b4c5-0d7849cf0c78",
          "code": "J518R38LAU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c49a347c-b292-87a5-829c-d8390b530f27",
          "code": "DTXSID20962035",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20962035",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "0c26544c-6b7c-414a-bff3-b899a8be25b7",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3fb32a83-1d08-4991-9d31-31f28910627e",
            "refuuid": "53f41621-3471-4ca7-938c-280ebe288b06",
            "name": "BENZOYLNORECGONINE",
            "unii": "J518R38LAU",
            "linking_id": "J518R38LAU",
            "ref_pname": "BENZOYLNORECGONINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "edbd3611-b98d-4001-b180-3ef75fccc3e1",
          "name": "(-)-BENZOYLNORECGONINE",
          "stdName": "(-)-BENZOYLNORECGONINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4aeb2eba-16ae-454e-8388-c309598f2bb6",
            "57a7d830-6b36-4d69-95b6-d03b53817635"
          ],
          "display_name": false
        },
        {
          "uuid": "c61c7779-ac69-4832-957c-9f55331fe622",
          "name": "8-AZABICYCLO(3.2.1)OCTANE-2-CARBOXYLIC ACID, 3-(BENZOYLOXY)-, (1R,2R,3S,5S)-",
          "stdName": "8-AZABICYCLO(3.2.1)OCTANE-2-CARBOXYLIC ACID, 3-(BENZOYLOXY)-, (1R,2R,3S,5S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4aeb2eba-16ae-454e-8388-c309598f2bb6",
            "57a7d830-6b36-4d69-95b6-d03b53817635"
          ],
          "display_name": false
        },
        {
          "uuid": "c8472e37-df38-49b7-99a4-bf57194e7729",
          "name": "BENZOYLNORECGONINE",
          "stdName": "BENZOYLNORECGONINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57a7d830-6b36-4d69-95b6-d03b53817635"
          ],
          "display_name": true
        },
        {
          "uuid": "a1301617-43ec-40dd-ac4a-4631f7b79ba9",
          "name": "N-DEMETHYLBENZOYLECGONINE",
          "stdName": "N-DEMETHYLBENZOYLECGONINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57a7d830-6b36-4d69-95b6-d03b53817635"
          ],
          "display_name": false
        },
        {
          "uuid": "686ccb97-0180-47a9-a926-d0f34c7189f9",
          "name": "NORBENZOYLECGONINE",
          "stdName": "NORBENZOYLECGONINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57a7d830-6b36-4d69-95b6-d03b53817635"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "57a7d830-6b36-4d69-95b6-d03b53817635",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4aeb2eba-16ae-454e-8388-c309598f2bb6",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae5bcaf7-6215-4ad7-89ea-e98209b3f127",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ba0bae9-28cc-4eb0-a515-715c49cd3379",
          "citation": "SRS import [J518R38LAU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J518R38LAU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f59f1d8-83cf-4271-8ac9-e51d25e919e5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "965da193-589c-4ce9-bbdb-0e4ee3a060c0",
          "id": "965da193-589c-4ce9-bbdb-0e4ee3a060c0",
          "molfile": "\n  Marvin  01132107482D          \n\n 20 22  0  0  1  0            999 V2000\n    3.7000   -4.9298    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.0444   -4.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0444   -3.5830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6955   -3.0612    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.1951   -4.0111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5028   -3.2395    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.9175   -2.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7515   -2.5082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4938   -1.7857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8639   -3.9887    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.5117   -4.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5685   -3.9887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1796   -3.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1796   -2.9184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7905   -3.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3927   -3.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0170   -3.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0170   -4.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4061   -5.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7905   -4.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  1  0  0  0\n  1 11  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  1  0  0  0\n  6 10  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  1  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(=O)O[C@H]2C[C@@H]3CC[C@H]([C@H]2C(=O)O)N3",
          "formula": "C15H17NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cecf0ff2-ccc3-40a2-b185-71c47457b6c6"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "275.3004",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "53f41621-3471-4ca7-938c-280ebe288b06",
      "version": "4",
      "structure": {
        "id": "34e6751d-f9d6-4ad9-acbb-c4bbd5c1f91a",
        "molfile": "\n  Marvin  01132102492D          \n\n 20 22  0  0  1  0            999 V2000\n    4.5028   -3.2395    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.6955   -3.0612    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1951   -4.0111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7000   -4.9298    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.5117   -4.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8639   -3.9887    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5685   -3.9887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1796   -3.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1796   -2.9184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7905   -3.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3927   -3.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0170   -3.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0170   -4.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4061   -5.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7905   -4.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0444   -4.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0444   -3.5830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9175   -2.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7515   -2.5082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4938   -1.7857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  1  0  0  0\n  4  3  1  1  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 10  1  0  0  0  0\n  4 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17  2  1  0  0  0  0\n  1 18  1  1  0  0  0\n 19 18  2  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(=O)O[C@H]2C[C@@H]3CC[C@H]([C@H]2C(=O)O)N3",
        "formula": "C15H17NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "275.3004",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6ba0bae9-28cc-4eb0-a515-715c49cd3379",
          "57a7d830-6b36-4d69-95b6-d03b53817635"
        ],
        "stereo_centers": 4
      },
      "unii": "J518R38LAU"
    }
  ]
}