{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f58eced1-48e5-48c9-ad4e-949a429531b9",
          "code": "548-62-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=548-62-9",
          "code_system": "CAS",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044",
            "17c8dc8c-fdcc-4e02-aa71-e848df84c80d"
          ]
        },
        {
          "uuid": "caa7825c-20d3-45d5-929e-30937202b4a0",
          "code": "C61776",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61776",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "ad1b0811-9d0f-47d0-b866-8a003a58d645",
          "code": "C548657",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67548657",
          "code_system": "MESH",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "0c5c5c72-d8e2-40d1-b3ab-f063669a72c1",
          "code": "D005840",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005840",
          "code_system": "MESH",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "e263a959-d070-47fc-8f2e-988cf3e55675",
          "code": "21 CFR 589.1000",
          "comments": "PART 589 -- SUBSTANCES PROHIBITED FROM USE IN ANIMAL FOOD OR FEED|Subpart B--Listing of Specific Substances Prohibited From Use in Animal Food or Feed|Sec. 589.1000 Gentian violet.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=589.1000",
          "code_system": "CFR",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "b91f6733-2241-4e6c-b022-7b59b62b8f78",
          "code": "CRYSTAL VIOLET",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Crystal_violet",
          "code_system": "WIKIPEDIA",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "a2c0d6b3-0e6f-497b-aa7e-50102fe87c53",
          "code": "SUB08875MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "4f1268e3-fbeb-4856-ac57-0679773af55a",
          "code": "39502",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2832",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "89e0e98e-71a7-4bd2-a4a3-f32169f57f1d",
          "code": "113",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=113",
          "code_system": "INN",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "40c817dc-9fac-4a9d-a9af-d4b549b5a1fd",
          "code": "208-953-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.140",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "412a03a8-9433-41a4-bc1e-f7cb6a909810",
          "code": "GENTIAN VIOLET",
          "comments": "Other names: Crystal violet, gentian violet. Description: A dark green powder or greenish, glistening pieces having a metallic lustre; odourless or almost odourless. Solubility: Sparingly soluble in water; soluble in ethanol (~750 g/l) TS and glycerol R; practically insoluble in ether R. Category: Anti-infective drug. Storage: Methylrosanilinium chloride should be kept in a tightly closed container, protected from light. Requirements: Methylrosanilinium chloride contains not less than 96.0% and not more than the equivalent of 101.0% of C25H30ClN3, calculated with reference to the anhydrous substance.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.267.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "c7ba5392-6330-496a-825d-b778c6da37dc",
          "code": "4778",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4778/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "76ce99ab-6d20-4f22-bd12-08f52973c429",
          "code": "m5700",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5700?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "9c171c99-e672-4c13-9123-2aa75d356148",
          "code": "CHEMBL459265",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL459265",
          "code_system": "ChEMBL",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "124e611e-c8e7-4386-b75f-4059ab44e877",
          "code": "11057",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11057",
          "code_system": "PUBCHEM",
          "references": [
            "c093b068-1cc8-4c47-9e82-7479bb7d4044"
          ]
        },
        {
          "uuid": "3aec2b36-1a2b-d83b-a8dd-4502f80a8c67",
          "code": "4366",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4366",
          "code_system": "HSDB",
          "references": [
            "37144111-7bce-8ffb-9667-1d3774d5cc2a"
          ]
        },
        {
          "uuid": "546efe59-e237-d9d3-3ef1-00822bb01ef3",
          "code": "DTXSID5020653",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5020653",
          "code_system": "EPA CompTox",
          "references": [
            "8d759772-2d02-ba0f-894a-64f0a5535632"
          ]
        },
        {
          "uuid": "3aaef340-dfab-0c11-08d9-ade47a43afc1",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c316bde8-8742-be07-299f-0304c82acc29"
          ]
        },
        {
          "uuid": "ec9f33be-1e1e-4c9c-b6db-d45a865063f6",
          "code": "J4Z741D6O5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a4615843-ee6f-f8ea-ddc9-d2af7bdc9c6c",
          "code": "Gentian Violet",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM951/",
          "code_system": "LACTMED",
          "references": [
            "c316bde8-8742-be07-299f-0304c82acc29"
          ]
        },
        {
          "uuid": "5f6ef31d-4f7b-bdba-a00a-f7efdece310b",
          "code": "4138",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4138",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c316bde8-8742-be07-299f-0304c82acc29"
          ]
        },
        {
          "uuid": "c478645e-db6f-2289-970e-04a4f62d0700",
          "code": "DBSALT000604",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT000604",
          "code_system": "DRUG BANK",
          "references": [
            "c316bde8-8742-be07-299f-0304c82acc29"
          ]
        },
        {
          "uuid": "dcc33517-2974-7d96-6085-81a752e5ec6c",
          "code": "1290002",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1290002",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "c316bde8-8742-be07-299f-0304c82acc29"
          ]
        },
        {
          "uuid": "a7909150-4847-babb-5c1b-e0a078510820",
          "code": "41688",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:41688",
          "code_system": "CHEBI",
          "references": [
            "c316bde8-8742-be07-299f-0304c82acc29"
          ]
        },
        {
          "uuid": "1b9fb2b1-74db-b8da-2ee1-695ccb677193",
          "code": "100000080908",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3e5e80ed-6a75-2c3e-50eb-a0c06d753c1e"
          ]
        },
        {
          "uuid": "d1884f16-fd38-7d9e-2c55-9f981414170d",
          "code": "3090",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3090",
          "code_system": "NSC",
          "references": [
            "588120fd-88d5-80f8-6d8f-24560c60a7a6"
          ]
        },
        {
          "uuid": "edef6475-a88c-bf43-08e0-826643082106",
          "code": "J4Z741D6O5",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=J4Z741D6O5",
          "code_system": "DAILYMED",
          "references": [
            "2fb773a4-ad51-2825-4487-bbd942dd9c22"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "91a7eeb3-aebf-48bf-aa0d-2fbced772500",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "1c80c51e-357b-4592-94cc-43a01dad5849",
            "refuuid": "9eb45377-e236-4b4b-8710-998aa2e9ad92",
            "name": "GENTIAN VIOLET CATION",
            "unii": "3GVJ31T6YY",
            "linking_id": "3GVJ31T6YY",
            "ref_pname": "GENTIAN VIOLET CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a901d201-a562-439c-8a41-2c9b481bfd3b",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "e3d287e7-d296-49e4-96b1-59dde1cf9dcb",
            "refuuid": "9eb45377-e236-4b4b-8710-998aa2e9ad92",
            "name": "GENTIAN VIOLET CATION",
            "unii": "3GVJ31T6YY",
            "linking_id": "3GVJ31T6YY",
            "ref_pname": "GENTIAN VIOLET CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "516723d6-2f20-497e-a236-4a56e682088d",
          "name": "(4-(BIS(P-(DIMETHYLAMINO)PHENYL)METHYLENE)-2,5-CYCLOHEXADIEN-1-YLIDENE)DIMETHYLAMMONIUM CHLORIDE",
          "stdName": "(4-(BIS(P-(DIMETHYLAMINO)PHENYL)METHYLENE)-2,5-CYCLOHEXADIEN-1-YLIDENE)DIMETHYLAMMONIUM CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82b52b10-b781-41ad-b5f6-00940cfd166c",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "2b00d1b6-9ffd-4351-9f63-5311b613d1b9",
          "name": "C.I. Basic violet 3",
          "stdName": "C.I. BASIC VIOLET 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82b52b10-b781-41ad-b5f6-00940cfd166c",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "d2b40244-025b-4886-bf00-7ce24a0d95d6",
          "name": "CRYSTAL VIOLET",
          "stdName": "CRYSTAL VIOLET",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81813799-1c61-41ed-b3fc-35a49daf3262",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "a2c27d9f-df8d-477e-bab0-edf90864e17d",
          "name": "GENAPAX",
          "stdName": "GENAPAX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d92828d8-2849-4b07-a4e1-860a3eaa91bd",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "aa4fac18-82fb-49a0-9121-e4e6f89bb69a",
          "name": "GENTIAN VIOLET",
          "stdName": "GENTIAN VIOLET",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9757dc20-86df-49ea-8f46-3f4a85d7ebdf",
            "57eb09b1-5199-4ce5-99de-112da158d1cf",
            "2a16f0c9-9134-440d-8d27-e34d93c01b43",
            "52a26567-bbce-4544-ac49-d49bdd8170c4",
            "c8c2ad24-7863-435a-b9f4-3bcdb27fcbe9",
            "de5e255b-cf44-40f4-8919-01c7e628838b",
            "9fd1af84-9947-4267-be43-d505f70f9821",
            "f118ae72-3b98-4dac-8509-3b8c0f2c9bf5",
            "4f7223b0-e100-4c71-b7ea-a56c2bab3b6b",
            "f0df8c30-1858-4149-9876-1fa0fd2e720d",
            "a8c42c21-1f2f-4e58-af1e-e5f9adec9645",
            "33b5b535-3ede-46fd-97df-a55f222e7382",
            "9728d8bc-035a-4dfc-b10a-ece40cee98d4",
            "e5bafd93-c07b-4d4f-a8ea-3e419651efd7",
            "62cb494b-1716-48f7-9b77-bce6005df5c9"
          ],
          "display_name": true
        },
        {
          "uuid": "93f9071c-71ff-4ef5-a475-09cdb9d5a448",
          "name": "GENTIAN VIOLET [HSDB]",
          "stdName": "GENTIAN VIOLET [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a16f0c9-9134-440d-8d27-e34d93c01b43",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "60eb9443-5750-4682-831c-56573dac0f9c",
          "name": "GENTIAN VIOLET [MI]",
          "stdName": "GENTIAN VIOLET [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f7223b0-e100-4c71-b7ea-a56c2bab3b6b",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "f1bedbd8-6fd4-48c5-888b-ec6a5c1f1b9e",
          "name": "GENTIAN VIOLET [ORANGE BOOK]",
          "stdName": "GENTIAN VIOLET [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f118ae72-3b98-4dac-8509-3b8c0f2c9bf5"
          ],
          "display_name": false
        },
        {
          "uuid": "d96d1e8b-6bcd-95af-2cfa-c9792f54d6fa",
          "name": "GENTIAN VIOLET [USP IMPURITY]",
          "stdName": "GENTIAN VIOLET [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8c42c21-1f2f-4e58-af1e-e5f9adec9645"
          ],
          "display_name": false
        },
        {
          "uuid": "2e0ef03e-5a4d-f3b6-d3c7-0a616a3c182e",
          "name": "GENTIAN VIOLET [USP MONOGRAPH]",
          "stdName": "GENTIAN VIOLET [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19bac411-36f1-473f-b53e-ae45ba1f6fd8"
          ],
          "display_name": false
        },
        {
          "uuid": "aac159f2-ece6-4cac-b461-4eb0becd7e6a",
          "name": "GENTIAN VIOLET [USP-RS]",
          "stdName": "GENTIAN VIOLET [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9757dc20-86df-49ea-8f46-3f4a85d7ebdf",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "28cb9938-17db-4021-a66a-1c2fb1140791",
          "name": "GENTIAN VIOLET [VANDF]",
          "stdName": "GENTIAN VIOLET [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57eb09b1-5199-4ce5-99de-112da158d1cf",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "7de3c97b-5555-4c5f-9989-9200965587b4",
          "name": "GVS",
          "stdName": "GVS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82b52b10-b781-41ad-b5f6-00940cfd166c",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "cc213e56-ac67-410b-a47d-5d7970c2ad1b",
          "name": "HEXAMETHYL PARAROSANILINE CHLORIDE",
          "stdName": "HEXAMETHYL PARAROSANILINE CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33b5b535-3ede-46fd-97df-a55f222e7382",
            "cdc87111-d7c1-47af-b2a8-8f61ff574d59"
          ],
          "display_name": false
        },
        {
          "uuid": "137a7fea-c071-497c-8583-b1f6591a30b4",
          "name": "METHANAMINIUM, N-(4-(BIS(4-(DIMETHYLAMINO)PHENYL)METHYLENE)-2,5-CYCLOHEXADIEN-1-YLIDENE)-N-METHYL-, CHLORIDE",
          "stdName": "METHANAMINIUM, N-(4-(BIS(4-(DIMETHYLAMINO)PHENYL)METHYLENE)-2,5-CYCLOHEXADIEN-1-YLIDENE)-N-METHYL-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82b52b10-b781-41ad-b5f6-00940cfd166c",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "869f1fa5-4853-4ea8-ae1e-6b681e799ce0",
          "name": "METHANAMINIUM, N-(4-(BIS(4-(DIMETHYLAMINO)PHENYL)METHYLENE)-2,5-CYCLOHEXADIEN-1-YLIDENE)-N-METHYL-, CHLORIDE (1:1)",
          "stdName": "METHANAMINIUM, N-(4-(BIS(4-(DIMETHYLAMINO)PHENYL)METHYLENE)-2,5-CYCLOHEXADIEN-1-YLIDENE)-N-METHYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd4e11f4-385a-4db5-ba8e-b92b5180ff13",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "b9ccda88-a09b-4492-82cd-b4c2f41b02b7",
          "name": "METHYL VIOLET 10B",
          "stdName": "METHYL VIOLET 10B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33b5b535-3ede-46fd-97df-a55f222e7382",
            "cdc87111-d7c1-47af-b2a8-8f61ff574d59"
          ],
          "display_name": false
        },
        {
          "uuid": "5f96d886-63ff-4755-8ec7-c9a8025072e3",
          "name": "METHYLROSANILINE CHLORIDE",
          "stdName": "METHYLROSANILINE CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82b52b10-b781-41ad-b5f6-00940cfd166c",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "73ed08e6-6b16-436e-bd93-c1bf5d3b5e5b",
          "name": "METHYLROSANILINII CHLORIDUM [WHO-IP LATIN]",
          "stdName": "METHYLROSANILINII CHLORIDUM [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "915bc763-194d-4c18-b136-65bbe5d9af9d",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "a751ce44-4114-482f-bc95-a723f9dc385d",
          "name": "METHYLROSANILINIUM CHLORIDE",
          "stdName": "METHYLROSANILINIUM CHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c101513c-a123-48eb-8ee3-410375e9eb99",
            "a23f16f6-18ec-4841-b0a6-fd48c8f2dca5",
            "7e51fef1-2036-43a7-a2a2-00bd2d4fedec",
            "3e340af4-bc33-4b73-bbc4-bf9ba500e67e",
            "09e1d50e-5654-4be6-880b-533cc1bf82f9",
            "90079a0c-cdd0-4da8-8e30-b2cf0800777b",
            "4bb39e49-071c-4f2d-a55b-17f0ab3676ef",
            "9491a50a-582e-4a89-a826-36a5becf8f52",
            "33b5b535-3ede-46fd-97df-a55f222e7382",
            "915bc763-194d-4c18-b136-65bbe5d9af9d",
            "61901dcd-6c24-48ed-a442-1250ececce13",
            "38487bc9-f97f-44d4-a91b-c00cd2edb595"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "be839b91-45ab-47d7-b00c-b9cec1afea88",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ec3b33b0-17f6-937a-b474-4db46cb38ae0",
          "name": "METHYLROSANILINIUM CHLORIDE [EP MONOGRAPH]",
          "stdName": "METHYLROSANILINIUM CHLORIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbc8eb89-8271-ad6f-7bd7-5e0f037e7d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "49358bdd-abfd-4997-b719-9981ab694520",
          "name": "METHYLROSANILINIUM CHLORIDE [JAN]",
          "stdName": "METHYLROSANILINIUM CHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1dd51a0-3bcd-b590-35d2-ae9067bf0643"
          ],
          "display_name": false
        },
        {
          "uuid": "0282b0d2-b06c-4fac-9469-66dc89610247",
          "name": "METHYLROSANILINIUM CHLORIDE [MART.]",
          "stdName": "METHYLROSANILINIUM CHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9491a50a-582e-4a89-a826-36a5becf8f52"
          ],
          "display_name": false
        },
        {
          "uuid": "a818cd34-5b68-41f1-a42c-75d02ce59095",
          "name": "METHYLROSANILINIUM CHLORIDE [WHO-IP]",
          "stdName": "METHYLROSANILINIUM CHLORIDE [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "915bc763-194d-4c18-b136-65bbe5d9af9d",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "ad577156-dba4-2e0e-1e40-d1c10e6360cb",
          "name": "Methylrosanilinium chloride [WHO-DD]",
          "stdName": "METHYLROSANILINIUM CHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6252cead-d437-f2c2-6c42-ffb9a20e3ac6"
          ],
          "display_name": false
        },
        {
          "uuid": "ef37454d-2861-4651-901b-eb182552638e",
          "name": "NSC-3090",
          "stdName": "NSC-3090",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81813799-1c61-41ed-b3fc-35a49daf3262",
            "33b5b535-3ede-46fd-97df-a55f222e7382"
          ],
          "display_name": false
        },
        {
          "uuid": "fe5937af-05e1-4b15-8df4-0142af14753b",
          "name": "methylrosanilinium chloride [INN]",
          "stdName": "METHYLROSANILINIUM CHLORIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e51fef1-2036-43a7-a2a2-00bd2d4fedec"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "81813799-1c61-41ed-b3fc-35a49daf3262",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "33b5b535-3ede-46fd-97df-a55f222e7382",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdc87111-d7c1-47af-b2a8-8f61ff574d59",
          "citation": "WIKEPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82b52b10-b781-41ad-b5f6-00940cfd166c",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5bafd93-c07b-4d4f-a8ea-3e419651efd7",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9fd1af84-9947-4267-be43-d505f70f9821",
          "citation": "OTC",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d92828d8-2849-4b07-a4e1-860a3eaa91bd",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61901dcd-6c24-48ed-a442-1250ececce13",
          "citation": "EMEA 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e51fef1-2036-43a7-a2a2-00bd2d4fedec",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4bb39e49-071c-4f2d-a55b-17f0ab3676ef",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8c42c21-1f2f-4e58-af1e-e5f9adec9645",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f118ae72-3b98-4dac-8509-3b8c0f2c9bf5",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9491a50a-582e-4a89-a826-36a5becf8f52",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f7223b0-e100-4c71-b7ea-a56c2bab3b6b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a16f0c9-9134-440d-8d27-e34d93c01b43",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48699b28-4686-492e-bf33-08349b874479",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9757dc20-86df-49ea-8f46-3f4a85d7ebdf",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e340af4-bc33-4b73-bbc4-bf9ba500e67e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57eb09b1-5199-4ce5-99de-112da158d1cf",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "338cf865-cbd5-487c-b11e-d76d2c393462",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "915bc763-194d-4c18-b136-65bbe5d9af9d",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd4e11f4-385a-4db5-ba8e-b92b5180ff13",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c093b068-1cc8-4c47-9e82-7479bb7d4044",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bd0c9e9-6843-43a2-8abf-6013ef4e05c3",
          "citation": "SRS import [J4Z741D6O5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J4Z741D6O5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a23f16f6-18ec-4841-b0a6-fd48c8f2dca5",
          "citation": "METHYLROSANILINIUM CHLORIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "90079a0c-cdd0-4da8-8e30-b2cf0800777b",
          "citation": "METHYLROSANILINIUM CHLORIDE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f0df8c30-1858-4149-9876-1fa0fd2e720d",
          "citation": "GENTIAN VIOLET [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62cb494b-1716-48f7-9b77-bce6005df5c9",
          "citation": "GENTIAN VIOLET [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c101513c-a123-48eb-8ee3-410375e9eb99",
          "citation": "METHYLROSANILINIUM CHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "52a26567-bbce-4544-ac49-d49bdd8170c4",
          "citation": "GENTIAN VIOLET [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9728d8bc-035a-4dfc-b10a-ece40cee98d4",
          "citation": "GENTIAN VIOLET [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d85af7f1-0162-4fc0-bda0-89d2265f8dfc",
          "citation": "BASIC VIOLET 3 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c8c2ad24-7863-435a-b9f4-3bcdb27fcbe9",
          "citation": "GENTIAN VIOLET [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38487bc9-f97f-44d4-a91b-c00cd2edb595",
          "citation": "METHYLROSANILINIUM CHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "de5e255b-cf44-40f4-8919-01c7e628838b",
          "citation": "GENTIAN VIOLET [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09e1d50e-5654-4be6-880b-533cc1bf82f9",
          "citation": "METHYLROSANILINIUM CHLORIDE [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37144111-7bce-8ffb-9667-1d3774d5cc2a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+548-62-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a1dd51a0-3bcd-b590-35d2-ae9067bf0643",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d759772-2d02-ba0f-894a-64f0a5535632",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=548-62-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ff06c752-8448-9a1b-5591-845acf0e624a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+548-62-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c316bde8-8742-be07-299f-0304c82acc29",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "17c8dc8c-fdcc-4e02-aa71-e848df84c80d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "19bac411-36f1-473f-b53e-ae45ba1f6fd8",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "cbc8eb89-8271-ad6f-7bd7-5e0f037e7d6d",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "588120fd-88d5-80f8-6d8f-24560c60a7a6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2fb773a4-ad51-2825-4487-bbd942dd9c22",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "6252cead-d437-f2c2-6c42-ffb9a20e3ac6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3e5e80ed-6a75-2c3e-50eb-a0c06d753c1e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "02e6a283-3076-4978-abcf-843e5196292e",
          "id": "02e6a283-3076-4978-abcf-843e5196292e",
          "molfile": "\n  Marvin  01132100282D          \n\n  1  0  0  0  0  0            999 V2000\n    3.5223   -2.0172    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7252e060-2c41-4886-9890-1dbf9505e4eb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "8264d9fb-7366-4f69-ab17-f72d79abce92",
          "id": "8264d9fb-7366-4f69-ab17-f72d79abce92",
          "molfile": "\n  Marvin  01132106462D          \n\n 28 30  0  0  0  0            999 V2000\n   -3.5895   -4.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8602   -4.6472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8602   -5.4645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1801   -4.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1801   -3.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4741   -2.9430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7681   -3.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7499   -4.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4327   -4.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0621   -2.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6362   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3526   -2.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1051   -3.2766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1129   -4.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3913   -4.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6362   -4.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8473   -4.4765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -5.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5378   -4.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0621   -2.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6362   -1.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6284   -0.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0983   -0.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7758   -0.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7758   -1.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0827    0.3388    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -0.8534    0.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6155    0.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7 10  1  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 20  2  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 17 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 21 20  1  0  0  0  0\n 25 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 26 23  2  0  0  0  0\n 24 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  1  0  0  0  0\nM  CHG  1  26   1\nM  END",
          "smiles": "CN(C)c1ccc(cc1)C(=C2C=CC(=[N+](C)C)C=C2)c3ccc(cc3)N(C)C",
          "formula": "C25H30N3",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "64a673f0-7c0d-451c-a4b5-51e295e7ee99"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "372.5267",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5b1f737a-c8b7-4d5e-83d9-8e84c5a63c61",
      "version": "28",
      "structure": {
        "id": "458ad46e-98c4-4b2a-9d74-2e5e60ac3fd9",
        "molfile": "\n  Marvin  01132103392D          \n\n 29 30  0  0  0  0            999 V2000\n   -0.0621   -2.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0827    0.3388    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -0.0621   -2.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0983   -0.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6362   -1.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7758   -1.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6284   -0.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7758   -0.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7681   -3.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6362   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1801   -4.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1129   -4.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8602   -4.6472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8473   -4.4765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6362   -4.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3526   -2.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7499   -4.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4741   -2.9430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1051   -3.2766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4327   -4.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3913   -4.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1801   -3.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8534    0.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6155    0.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5895   -4.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -5.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5378   -4.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8602   -5.4645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5223   -2.0172    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  2  4  2  0  0  0  0\n  3  1  2  0  0  0  0\n  4  8  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  6  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11 20  2  0  0  0  0\n 12 19  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 10  2  0  0  0  0\n 16 10  1  0  0  0  0\n 17  9  2  0  0  0  0\n 18  9  1  0  0  0  0\n 19 16  2  0  0  0  0\n 20 17  1  0  0  0  0\n 21 15  1  0  0  0  0\n 22 18  2  0  0  0  0\n 23  2  1  0  0  0  0\n 24  2  1  0  0  0  0\n 25 13  1  0  0  0  0\n 26 14  1  0  0  0  0\n 27 14  1  0  0  0  0\n 28 13  1  0  0  0  0\n  7  4  1  0  0  0  0\n 12 21  2  0  0  0  0\n 22 11  1  0  0  0  0\nM  CHG  2   2   1  29  -1\nM  END",
        "smiles": "C[N+](=C1C=CC(=C(c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C)C=C1)C.[Cl-]",
        "formula": "C25H30N3.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "407.9797",
        "optical_activity": "NONE",
        "references": [
          "e5bafd93-c07b-4d4f-a8ea-3e419651efd7",
          "0bd0c9e9-6843-43a2-8abf-6013ef4e05c3",
          "7e51fef1-2036-43a7-a2a2-00bd2d4fedec"
        ],
        "stereo_centers": 0
      },
      "unii": "J4Z741D6O5"
    }
  ]
}