{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a7eb14b8-e73f-4e45-88fc-659709d03ee0",
          "code": "492-61-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=492-61-5",
          "code_system": "CAS",
          "references": [
            "db748658-3337-46d6-b2c6-10577c7892a3",
            "ba6a1fb8-1ba3-49cf-84f1-f317d8a3b9d7"
          ]
        },
        {
          "uuid": "bd2adf4f-fe86-4cc2-9dc2-eec66c1954c1",
          "code": "C61650",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61650",
          "code_system": "NCI_THESAURUS",
          "references": [
            "db748658-3337-46d6-b2c6-10577c7892a3"
          ]
        },
        {
          "uuid": "ba8d2798-3e52-4afb-960b-72ebb76308e0",
          "code": "50986-29-3",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50986-29-3",
          "code_system": "CAS",
          "references": [
            "db748658-3337-46d6-b2c6-10577c7892a3",
            "9d3b46d9-d300-415b-af24-769d18143781"
          ]
        },
        {
          "uuid": "410a4418-4dc0-4a98-a692-524fe68510aa",
          "code": "207-756-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.052",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "db748658-3337-46d6-b2c6-10577c7892a3"
          ]
        },
        {
          "uuid": "64bd608b-f5f3-4f06-8683-185839279cf6",
          "code": "64689",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/64689",
          "code_system": "PUBCHEM",
          "references": [
            "db748658-3337-46d6-b2c6-10577c7892a3"
          ]
        },
        {
          "uuid": "efa22003-88fd-2c7a-b900-881f892f8a87",
          "code": "1442190",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1442190/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "cc42fd15-540e-495d-9d55-ed2046abbf27",
          "code": "J4R00M814D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5346c358-3c35-3289-a594-04b621d9159a",
          "code": "100000174200",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e4057607-7e88-df50-f652-8df01a321fb3"
          ]
        },
        {
          "uuid": "5bdf6421-2871-0012-a50c-27e6c91468c9",
          "code": "DTXSID70883403",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70883403",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "55aab5b7-ea91-5063-d1db-20c06d5fd00c",
          "code": "J4R00M814D",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=J4R00M814D",
          "code_system": "DAILYMED",
          "references": [
            "a3987c9f-a5a3-b8d1-73ba-061cd02b0baa"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5335a6ad-5473-46a7-949c-2dcea8d0348b",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "05ea1981-b137-4683-af69-a8c022ca3c09",
            "refuuid": "c8963d5a-4418-486b-b8a2-e2be95342312",
            "name": ".BETA.-D-GLUCOPYRANOSE, MONOHYDRATE",
            "unii": "6GV3WWI8WY",
            "linking_id": "6GV3WWI8WY",
            "ref_pname": ".BETA.-D-GLUCOPYRANOSE, MONOHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "05a6adcf-fd18-466c-b78a-41207b5486a4",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "b47e4d30-1e9c-43db-8626-4ed17d40a7aa"
          ],
          "related_substance": {
            "uuid": "97477d00-0014-4adb-b35a-733e888e6300",
            "refuuid": "c8963d5a-4418-486b-b8a2-e2be95342312",
            "name": ".BETA.-D-GLUCOPYRANOSE, MONOHYDRATE",
            "unii": "6GV3WWI8WY",
            "linking_id": "6GV3WWI8WY",
            "ref_pname": ".BETA.-D-GLUCOPYRANOSE, MONOHYDRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "861bbad5-26ee-4757-b430-7aec774e55ee",
          "name": ".BETA.-D-GLUCOPYRANOSE",
          "stdName": ".BETA.-D-GLUCOPYRANOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68cdc6ed-b43a-45ca-9a16-374ab14f38eb",
            "ed486360-d57b-4b34-8a63-eec839fdf314"
          ],
          "display_name": true
        },
        {
          "uuid": "e521b29e-15fd-4731-b699-d5bed5557af9",
          "name": ".BETA.-D-GLUCOSE",
          "stdName": ".BETA.-D-GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46b684f2-ea9d-4604-ab6a-9a1816cb71e2",
            "22f5dc6a-6f76-4af6-adfa-392ee9f7e394"
          ],
          "display_name": false
        },
        {
          "uuid": "8c437e11-adaa-4f4e-ba7b-28536ce58c0b",
          "name": ".BETA.-D-GLUCOSE ANHYDROUS",
          "stdName": ".BETA.-D-GLUCOSE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46b684f2-ea9d-4604-ab6a-9a1816cb71e2",
            "ff141857-df59-431d-a4f9-c96def799899"
          ],
          "display_name": false
        },
        {
          "uuid": "a7a60acd-17a6-47c9-8461-13abd55abc0e",
          "name": ".BETA.-D-GLUCOSE, ANHYDROUS",
          "stdName": ".BETA.-D-GLUCOSE, ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46b684f2-ea9d-4604-ab6a-9a1816cb71e2",
            "22f5dc6a-6f76-4af6-adfa-392ee9f7e394"
          ],
          "display_name": false
        },
        {
          "uuid": "09f3e22b-ba0d-4fd3-81fd-bca65e59edbd",
          "name": "GLUCOSE, .BETA.-D",
          "stdName": "GLUCOSE, .BETA.-D",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff141857-df59-431d-a4f9-c96def799899",
            "8e4bc7c8-4ffd-450e-9624-a5f136bd7d31"
          ],
          "display_name": false
        },
        {
          "uuid": "4b70bc2d-a04c-4f5f-a56f-8fc91fa08795",
          "name": "GLUCOSE, BETA-D-",
          "stdName": "GLUCOSE, BETA-D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff141857-df59-431d-a4f9-c96def799899",
            "d8d87193-fd23-4928-a412-22c24381d768"
          ],
          "display_name": false
        },
        {
          "uuid": "82f34083-0828-47cb-abd7-623d0ed49c1a",
          "name": "GLUCOSIDE",
          "stdName": "GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff141857-df59-431d-a4f9-c96def799899",
            "ab1ae4f8-40b1-4bf5-9542-89bfcdeaca7d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ed486360-d57b-4b34-8a63-eec839fdf314",
          "citation": "GOOGLE PATENTS 10-OCT-2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "68cdc6ed-b43a-45ca-9a16-374ab14f38eb",
          "citation": "MERCK 13 EDITION",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46b684f2-ea9d-4604-ab6a-9a1816cb71e2",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22f5dc6a-6f76-4af6-adfa-392ee9f7e394",
          "citation": "MERCK 13TH EDITION",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff141857-df59-431d-a4f9-c96def799899",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8d87193-fd23-4928-a412-22c24381d768",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab1ae4f8-40b1-4bf5-9542-89bfcdeaca7d",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e4bc7c8-4ffd-450e-9624-a5f136bd7d31",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db748658-3337-46d6-b2c6-10577c7892a3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390176000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ce2d5b4-cb73-45dc-b4db-e44ab9071356",
          "citation": "SRS import [J4R00M814D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J4R00M814D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390176000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b47e4d30-1e9c-43db-8626-4ed17d40a7aa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9d3b46d9-d300-415b-af24-769d18143781",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ba6a1fb8-1ba3-49cf-84f1-f317d8a3b9d7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a3987c9f-a5a3-b8d1-73ba-061cd02b0baa",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e4057607-7e88-df50-f652-8df01a321fb3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2fafa6b2-fdaa-4376-9c65-1005e043dced",
          "id": "2fafa6b2-fdaa-4376-9c65-1005e043dced",
          "molfile": "\n  Marvin  01132102332D          \n\n 12 12  0  0  1  0            999 V2000\n   -1.2810   -1.6819    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.4561   -1.6819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6964   -0.9644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5213   -0.9615    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -2.9396   -0.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7616   -0.2382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9280   -1.6819    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -3.7500   -1.6877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5156   -2.3936    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -2.9339   -3.1081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6906   -2.3935    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -1.2694   -3.1052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 11  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  7  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  6  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O)O1)O)O)O)O",
          "formula": "C6H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6eccd1a0-a241-45cc-a735-7c92851584d2"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "180.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4cf90035-16a7-4b50-b45c-fc1451b122d2",
      "version": "7",
      "structure": {
        "id": "4db445f6-0ef1-456e-9f12-a6039cbdbd42",
        "molfile": "\n  Marvin  01132104032D          \n\n 12 12  0  0  1  0            999 V2000\n   -1.6906   -2.3935    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.5156   -2.3936    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.6964   -0.9644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2810   -1.6819    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -2.9280   -1.6819    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -2.5213   -0.9615    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -1.2694   -3.1052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9339   -3.1081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7500   -1.6877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4561   -1.6819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9396   -0.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7616   -0.2382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  7  1  6  0  0  0\n  2  8  1  1  0  0  0\n  5  9  1  6  0  0  0\n  4 10  1  1  0  0  0\n  6 11  1  1  0  0  0\n  3  6  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O)O1)O)O)O)O",
        "formula": "C6H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "180.1561",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7ce2d5b4-cb73-45dc-b4db-e44ab9071356",
          "ed486360-d57b-4b34-8a63-eec839fdf314"
        ],
        "stereo_centers": 5
      },
      "unii": "J4R00M814D"
    }
  ]
}