{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3a6da08d-21a6-4927-ba4d-b0d50c8681a6",
          "code": "1916-59-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1916-59-2",
          "code_system": "CAS",
          "references": [
            "8f5f39da-c926-47ab-8a5f-e77af719cc80",
            "4f86643d-89c2-4972-9185-3a2b38bcffd1"
          ]
        },
        {
          "uuid": "4f1953ce-459d-425f-a28f-257493499121",
          "code": "72725",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72725",
          "code_system": "PUBCHEM",
          "references": [
            "8f5f39da-c926-47ab-8a5f-e77af719cc80"
          ]
        },
        {
          "uuid": "0da83d24-a982-06d4-58d9-e7d4676bcf34",
          "code": "DTXSID60172691",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60172691",
          "code_system": "EPA CompTox",
          "references": [
            "fbe8e3d6-d720-018e-0f43-733a20103e88"
          ]
        },
        {
          "uuid": "9b3e4e97-834f-cf84-896b-358ae45ca088",
          "code": "Questiomycin A",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Questiomycin_A",
          "code_system": "WIKIPEDIA",
          "references": [
            "c9caf953-dbca-4fd4-8ba5-18a941d9bdc0"
          ]
        },
        {
          "uuid": "26faca18-3b36-c1dc-97a5-060663ae9453",
          "code": "94945",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=94945",
          "code_system": "NSC",
          "references": [
            "ec231079-6744-57e9-6bc5-4aa76b432ecf"
          ]
        },
        {
          "uuid": "e6d8b678-41ff-498a-af14-11845e696b72",
          "code": "J4CM69VF7H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4fc67a31-523d-4029-9212-59df9b3d3539",
          "name": "2-Amino-3H-phenoxazin-3-one",
          "stdName": "2-AMINO-3H-PHENOXAZIN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f86643d-89c2-4972-9185-3a2b38bcffd1"
          ],
          "display_name": false
        },
        {
          "uuid": "6dbfd66e-f51f-450c-bda1-18a7ba59d2e4",
          "name": "2-Aminophenoxazon",
          "stdName": "2-AMINOPHENOXAZON",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f86643d-89c2-4972-9185-3a2b38bcffd1"
          ],
          "display_name": false
        },
        {
          "uuid": "24a71303-a503-48ff-b64c-609ac1cce008",
          "name": "3-AMINOPHENOXAZONE",
          "stdName": "3-AMINOPHENOXAZONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5cce44d-9fa5-4341-b7eb-e023ea852617",
            "6ca09e9c-8ded-4a90-870e-de7fd54574f8"
          ],
          "display_name": false
        },
        {
          "uuid": "2e61b606-7d03-4097-8fcf-13b09e91f1e2",
          "name": "3H-Phenoxazin-3-one, 2-amino-",
          "stdName": "3H-PHENOXAZIN-3-ONE, 2-AMINO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f86643d-89c2-4972-9185-3a2b38bcffd1"
          ],
          "display_name": false
        },
        {
          "uuid": "bdc591d8-1400-4dec-97ed-9a392f1d3799",
          "name": "AV Toxin C",
          "stdName": "AV TOXIN C",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f86643d-89c2-4972-9185-3a2b38bcffd1"
          ],
          "display_name": false
        },
        {
          "uuid": "9ad57d72-ca7b-423f-a325-250ed85ea100",
          "name": "Acrospermumviticola toxin C",
          "stdName": "ACROSPERMUMVITICOLA TOXIN C",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f86643d-89c2-4972-9185-3a2b38bcffd1"
          ],
          "display_name": false
        },
        {
          "uuid": "b7b55302-aa26-434f-99b4-584cc5b40331",
          "name": "Isophenoxazine",
          "stdName": "ISOPHENOXAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f86643d-89c2-4972-9185-3a2b38bcffd1"
          ],
          "display_name": false
        },
        {
          "uuid": "471f8c21-6c8a-438d-87e2-5eba9a86f04c",
          "name": "NSC-94945",
          "stdName": "NSC-94945",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5cce44d-9fa5-4341-b7eb-e023ea852617",
            "6ca09e9c-8ded-4a90-870e-de7fd54574f8"
          ],
          "display_name": false
        },
        {
          "uuid": "f70c3c98-c16c-4b23-8b55-97dd00622ecc",
          "name": "Questiomycin A",
          "stdName": "QUESTIOMYCIN A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9caf953-dbca-4fd4-8ba5-18a941d9bdc0",
            "4f86643d-89c2-4972-9185-3a2b38bcffd1"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "b5cce44d-9fa5-4341-b7eb-e023ea852617",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ca09e9c-8ded-4a90-870e-de7fd54574f8",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f5f39da-c926-47ab-8a5f-e77af719cc80",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394211000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fbe8e3d6-d720-018e-0f43-733a20103e88",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1916-59-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c9caf953-dbca-4fd4-8ba5-18a941d9bdc0",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "4f86643d-89c2-4972-9185-3a2b38bcffd1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ec231079-6744-57e9-6bc5-4aa76b432ecf",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "191fcd0c-1946-4584-9fb0-e10232a5afc4",
          "id": "191fcd0c-1946-4584-9fb0-e10232a5afc4",
          "molfile": "\n  Marvin  08172206012D          \n\n 16 18  0  0  0  0            999 V2000\n    5.0013    1.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8578    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8578    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    1.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5723    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5723    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1 10  1  0  0  0  0\n  2 12  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  6 10  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 13  2  0  0  0  0\n 10 12  1  0  0  0  0\n 11 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 16  2  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)nc-3cc(c(=O)cc3o2)N",
          "formula": "C12H8N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8c85f0e6-d5fe-4a62-930d-0ed5870b3212"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "212.2046",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "25973d47-4dd9-4126-8522-1cb89132fb97",
      "version": "8",
      "structure": {
        "id": "167e304d-3750-42d7-ba67-4b9e31136afb",
        "molfile": "2-Aminophenoxazin-3-one\n   JSDraw208172206012D\n\n 16 18  0  0  0  0              0 V2000\n   29.2725   -6.1360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2725   -9.2560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2195   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2195   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8684   -6.1360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5705   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8684   -9.2560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5705   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5175   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9215   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5175   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9215   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1665   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1665   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8155   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8155   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1 10  1  0  0  0  0\n  2 12  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  6 10  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 13  2  0  0  0  0\n 10 12  1  0  0  0  0\n 11 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 16  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)nc-3cc(c(=O)cc3o2)N",
        "formula": "C12H8N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "212.2046",
        "optical_activity": "NONE",
        "references": [
          "b5cce44d-9fa5-4341-b7eb-e023ea852617",
          "4f86643d-89c2-4972-9185-3a2b38bcffd1"
        ],
        "stereo_centers": 0
      },
      "unii": "J4CM69VF7H"
    }
  ]
}