{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "17a2e998-95d6-479f-a72a-e8f382a4e691",
          "code": "G03GB01",
          "comments": "ATC|GENITO URINARY SYSTEM AND SEX HORMONES|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|GONADOTROPINS AND OTHER OVULATION STIMULANTS|Ovulation stimulants, synthetic|cyclofenil",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=G03GB01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "fac9337e-1df7-4dca-af17-7c741cf46aaf",
          "code": "QG03GB01",
          "comments": "VATC|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|GONADOTROPINS AND OTHER OVULATION STIMULANTS|Ovulation stimulants, synthetic|cyclofenil",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QG03GB01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "5c2b4466-544d-49c8-a72b-ec501bac12a5",
          "code": "2624-43-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2624-43-3",
          "code_system": "CAS",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35",
            "70f01c78-fff3-493f-af1e-6f1c19f01abc"
          ]
        },
        {
          "uuid": "0c91e912-f65b-4cf5-a8c5-a5c3e8e841b9",
          "code": "C78030",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C78030",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "b8fc4b1c-3838-45a0-9e10-919f6c3f500e",
          "code": "D003506",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68003506",
          "code_system": "MESH",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "60164f8c-c68d-4dc9-ab8c-70b094f6472f",
          "code": "SUB06852MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "ca986d21-8724-4abc-bc34-f92dae3c2af3",
          "code": "2258",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2258",
          "code_system": "INN",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "528426a2-8dea-4a6b-8ad0-c55222868edf",
          "code": "2983",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2983/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "4caed32d-a85c-4885-bd6b-915a7a838354",
          "code": "m3983",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3983?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "87bf1469-f3ec-4174-9c65-3c34ced6e4e5",
          "code": "CHEMBL141305",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL141305",
          "code_system": "ChEMBL",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "1cc64698-426d-4cdf-994c-a2b51674d558",
          "code": "220-089-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.264",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "987405bc-d38f-4c7e-af9d-f1419b2a5b71",
          "code": "2898",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2898",
          "code_system": "PUBCHEM",
          "references": [
            "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35"
          ]
        },
        {
          "uuid": "846a024b-3d66-43ee-7259-6a2b6cbdaec9",
          "code": "DTXSID4022866",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4022866",
          "code_system": "EPA CompTox",
          "references": [
            "c8d76eee-3fd8-165b-b3f4-8b83539a89db"
          ]
        },
        {
          "uuid": "04422586-32a3-47a4-813a-1f5f260b02af",
          "code": "C481",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Hormonal/Endocrine Agent[C129818]|Antiestrogen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C481",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2c37b7a9-a5d0-fa68-9af2-72acff261535"
          ]
        },
        {
          "uuid": "8a41a7e2-e48c-4415-8f47-cea4fdaaa689",
          "code": "J468V64WZ1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "577e8933-b9d8-252f-4ac1-ecd7871eead0",
          "code": "753",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/753",
          "code_system": "DRUG CENTRAL",
          "references": [
            "2c37b7a9-a5d0-fa68-9af2-72acff261535"
          ]
        },
        {
          "uuid": "6b8dc75d-fb36-d266-8cd0-9ae6652c2973",
          "code": "DB13472",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13472",
          "code_system": "DRUG BANK",
          "references": [
            "2c37b7a9-a5d0-fa68-9af2-72acff261535"
          ]
        },
        {
          "uuid": "52f657af-6196-bc6e-ee2c-c55127c80d69",
          "code": "Cyclofenil",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cyclofenil",
          "code_system": "WIKIPEDIA",
          "references": [
            "9d70907b-8c76-625f-c108-0585999889d6"
          ]
        },
        {
          "uuid": "370f26e1-496e-1fa9-dd79-80bb4bd30067",
          "code": "86464",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=86464",
          "code_system": "NSC",
          "references": [
            "15253025-aabf-7fac-0354-0b818ee7b281"
          ]
        },
        {
          "uuid": "bcce4bc4-e1d1-a018-2559-148aeddf0b0e",
          "code": "100000083751",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "27de2457-ce7f-b574-95c1-4d92b3f0678b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "019954cb-12d3-47f3-a9db-1f20816e16f6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8cb86ce5-a3f6-4d40-9373-3278c9575379",
            "refuuid": "f6b1973d-6848-4960-97b2-ac9e2fd76769",
            "name": "CYCLOFENIL",
            "unii": "J468V64WZ1",
            "linking_id": "J468V64WZ1",
            "ref_pname": "CYCLOFENIL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f65099c6-e6b3-4846-a7e8-9f454f3fb8e1",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "references": [
            "67c43136-8889-4cf9-af28-7ced8eba1229"
          ],
          "related_substance": {
            "uuid": "9b18eec0-975a-4d4f-81f6-b766f4904bb9",
            "refuuid": "28fd3214-3728-430a-ac1d-c7bea6fa626a",
            "name": "CYCLOFENIL DIPHENOL",
            "unii": "00W4083OML",
            "linking_id": "00W4083OML",
            "ref_pname": "CYCLOFENIL DIPHENOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f3243b58-002f-4735-8d3b-9a0bb44304c2",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "references": [
            "5df0fe12-0a7f-490f-8b30-3d5d7df0935a"
          ],
          "related_substance": {
            "uuid": "c64e2463-2273-4596-9978-f9961137425c",
            "refuuid": "c815b1e7-3c70-4ba3-98ef-fdc6cbaf2c6f",
            "name": "4-HYDROXY CYCLOFENIL DIPHENOL",
            "unii": "5O0NV28X2K",
            "linking_id": "5O0NV28X2K",
            "ref_pname": "4-HYDROXY CYCLOFENIL DIPHENOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d0e95b55-71d4-41bb-a939-ec9cc66a2136",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "references": [
            "c6a3dfc4-0e0d-4dc7-8af0-2a60a79ed227"
          ],
          "related_substance": {
            "uuid": "65d9076d-512b-43eb-8188-a2da1b67c32a",
            "refuuid": "5566ebc1-3ee5-4f25-af68-8fd9b32a14f7",
            "name": "3-HYDROXY CYCLOFENIL DIPHENOL",
            "unii": "71400TA8CZ",
            "linking_id": "71400TA8CZ",
            "ref_pname": "3-HYDROXY CYCLOFENIL DIPHENOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e058a7ab-0bdf-4565-92ff-4b586eeaae5c",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "references": [
            "c6a3dfc4-0e0d-4dc7-8af0-2a60a79ed227"
          ],
          "related_substance": {
            "uuid": "5c918ede-0b6d-4d66-8390-29e4f9acf5c1",
            "refuuid": "3053c3e4-ae43-48f9-a141-7f831a40c008",
            "name": "2-HYDROXY CYCLOFENIL DIPHENOL",
            "unii": "R978SU80MV",
            "linking_id": "R978SU80MV",
            "ref_pname": "2-HYDROXY CYCLOFENIL DIPHENOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f1cd0f3c-a4df-4577-9d86-6c79041e8724",
          "name": "4,4'-(CYCLOHEXYLIDENEMETHYLENE)DIPHENOL DIACETATE ESTER",
          "stdName": "4,4'-(CYCLOHEXYLIDENEMETHYLENE)DIPHENOL DIACETATE ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19cd66b5-6ecc-4b15-8542-68afd662fb1a"
          ],
          "display_name": false
        },
        {
          "uuid": "3d231288-7b0c-4524-a44c-ffa75d1db075",
          "name": "CYCLOFENIL",
          "stdName": "CYCLOFENIL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1a4851b-b935-4968-bc57-284298e4fff4",
            "d4c5208c-2f20-47ba-875c-4145ac1cc3f2",
            "19cd66b5-6ecc-4b15-8542-68afd662fb1a",
            "5e042b06-1626-4502-8f22-1dda4fc9ea4e",
            "59c58142-7915-42fa-920c-05bacccbe70f",
            "e15c83c3-18e9-4553-adfd-dfe3a0c5e2cf",
            "e7a15fb5-ca94-4056-9f12-8f31a0c8edc9",
            "15aab8b3-7a60-41da-a5cf-2a80d6162541",
            "2d8c26e8-86ac-41b9-a57d-b34caf028b3c",
            "6bbd1f63-dc98-4bd6-9ab0-c35ea495aae2",
            "987d4d3f-0d4c-45aa-8bbb-61df4120c302"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "0727814d-7bfa-45e6-a4cc-92c9a56b943d",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "899c5fdf-bbb0-4a8a-a2a1-75edf33af0d8",
          "name": "CYCLOFENIL [JAN]",
          "stdName": "CYCLOFENIL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7a15fb5-ca94-4056-9f12-8f31a0c8edc9"
          ],
          "display_name": false
        },
        {
          "uuid": "76dfb087-64c6-45b0-bd1e-92a5e7f6414e",
          "name": "CYCLOFENIL [MART.]",
          "stdName": "CYCLOFENIL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "987d4d3f-0d4c-45aa-8bbb-61df4120c302"
          ],
          "display_name": false
        },
        {
          "uuid": "acf1a686-233c-49db-b866-50ff1140071f",
          "name": "CYCLOFENIL [MI]",
          "stdName": "CYCLOFENIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e042b06-1626-4502-8f22-1dda4fc9ea4e"
          ],
          "display_name": false
        },
        {
          "uuid": "1882487b-dae5-97a8-d6c4-a99780801dea",
          "name": "Cyclofenil [WHO-DD]",
          "stdName": "CYCLOFENIL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b91456a-4221-3cea-c81b-d00173117eb9"
          ],
          "display_name": false
        },
        {
          "uuid": "3bcf6716-621c-4f23-aa01-12485584814a",
          "name": "F 6066",
          "stdName": "F 6066",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19cd66b5-6ecc-4b15-8542-68afd662fb1a"
          ],
          "display_name": false
        },
        {
          "uuid": "4929b91d-d494-451c-8039-2e277beced63",
          "name": "F-6066",
          "stdName": "F-6066",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74ced6b5-8ea7-4745-9ff1-e311d0bbafb9"
          ],
          "display_name": false
        },
        {
          "uuid": "27509a29-a34c-4775-b5db-960d164144dc",
          "name": "ICI 48213",
          "stdName": "ICI 48213",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19cd66b5-6ecc-4b15-8542-68afd662fb1a"
          ],
          "display_name": false
        },
        {
          "uuid": "0a8b9e6c-7843-4715-a7fb-2f0390314632",
          "name": "ICI-48213",
          "stdName": "ICI-48213",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74ced6b5-8ea7-4745-9ff1-e311d0bbafb9"
          ],
          "display_name": false
        },
        {
          "uuid": "0bbade63-aad8-425d-9625-bd2c18c59053",
          "name": "NSC-86464",
          "stdName": "NSC-86464",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "390d5053-a5fb-4b31-9cd1-f0f7bac04f10"
          ],
          "display_name": false
        },
        {
          "uuid": "552a57dc-f49a-4416-a958-17f7533dd8a7",
          "name": "SEXOVID",
          "stdName": "SEXOVID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7a15fb5-ca94-4056-9f12-8f31a0c8edc9",
            "ef9d7435-6361-491d-b7d6-2caf8d324ef8"
          ],
          "display_name": false
        },
        {
          "uuid": "810f690e-40be-4055-b445-4cbb28ee5e9d",
          "name": "cyclofenil [INN]",
          "stdName": "CYCLOFENIL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e15c83c3-18e9-4553-adfd-dfe3a0c5e2cf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5df0fe12-0a7f-490f-8b30-3d5d7df0935a",
          "citation": "RAPID COMMUNICATIONS IN MASS SPECTROMETRY, 30 APRIL 2002, VOLUME 16, ISSUE 8, PAGES 743?820",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/rcm.636/full",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6a3dfc4-0e0d-4dc7-8af0-2a60a79ed227",
          "citation": "JOURNAL OF MASS SPECTROMETRY\\\\nVOLUME 43, ISSUE 7, ARTICLE FIRST PUBLISHED ONLINE: 24 JUN 2008",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/jms.1462/pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5081382-bb2e-4b51-b83d-0d167f762b65",
          "citation": "SRS import [J468V64WZ1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J468V64WZ1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bbd1f63-dc98-4bd6-9ab0-c35ea495aae2",
          "citation": "CYCLOFENIL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d4c5208c-2f20-47ba-875c-4145ac1cc3f2",
          "citation": "CYCLOFENIL [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15aab8b3-7a60-41da-a5cf-2a80d6162541",
          "citation": "CYCLOFENIL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c1a4851b-b935-4968-bc57-284298e4fff4",
          "citation": "CYCLOFENIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d8c26e8-86ac-41b9-a57d-b34caf028b3c",
          "citation": "CYCLOFENIL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "19cd66b5-6ecc-4b15-8542-68afd662fb1a",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e15c83c3-18e9-4553-adfd-dfe3a0c5e2cf",
          "citation": "INN Proposed List 17",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL17.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e7a15fb5-ca94-4056-9f12-8f31a0c8edc9",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "987d4d3f-0d4c-45aa-8bbb-61df4120c302",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e042b06-1626-4502-8f22-1dda4fc9ea4e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef9d7435-6361-491d-b7d6-2caf8d324ef8",
          "citation": "D01281",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59c58142-7915-42fa-920c-05bacccbe70f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "390d5053-a5fb-4b31-9cd1-f0f7bac04f10",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74ced6b5-8ea7-4745-9ff1-e311d0bbafb9",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9f99d9a-aabc-4f14-9f43-ecf7f7181d35",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67c43136-8889-4cf9-af28-7ced8eba1229",
          "citation": "RAPID COMMUNICATIONS IN MASS SPECTROMETRY, VOLUME 16, ISSUE 8\\\\n30 APRIL 2002\\\\nPAGES 761?767",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/rcm.636/full",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8d76eee-3fd8-165b-b3f4-8b83539a89db",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2624-43-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2c37b7a9-a5d0-fa68-9af2-72acff261535",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9d70907b-8c76-625f-c108-0585999889d6",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "70f01c78-fff3-493f-af1e-6f1c19f01abc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2b91456a-4221-3cea-c81b-d00173117eb9",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "15253025-aabf-7fac-0354-0b818ee7b281",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "27de2457-ce7f-b574-95c1-4d92b3f0678b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9201da70-793a-4963-b0c7-ddd61884654e",
          "id": "9201da70-793a-4963-b0c7-ddd61884654e",
          "molfile": "\n  Marvin  01132107342D          \n\n 27 29  0  0  0  0            999 V2000\n    8.8678   -5.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1699   -4.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1660   -3.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4719   -5.1376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7686   -4.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0597   -5.1358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3563   -4.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3613   -3.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0657   -3.5047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7696   -3.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6468   -3.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6468   -2.6721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8261   -2.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8261   -1.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6691   -0.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5083   -1.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5083   -2.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9268   -3.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2117   -3.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4968   -3.9056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4959   -4.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7759   -5.1415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0625   -4.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3490   -5.1415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0585   -3.9046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2159   -5.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9278   -4.7311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 11  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 18  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 27 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 26  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)Oc1ccc(cc1)C(=C2CCCCC2)c3ccc(cc3)OC(=O)C",
          "formula": "C23H24O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "31f6082c-112d-4b7c-81ec-05dea5eeb980"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "364.4351",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f6b1973d-6848-4960-97b2-ac9e2fd76769",
      "version": "16",
      "structure": {
        "id": "17e2aeaa-8e85-4bc4-9344-37d5ee6f8e31",
        "molfile": "\n  Marvin  01132101262D          \n\n 27 29  0  0  0  0            999 V2000\n    3.9268   -3.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2117   -3.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4968   -3.9056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4959   -4.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2159   -5.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9278   -4.7311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3613   -3.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3563   -4.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0597   -5.1358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7686   -4.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7696   -3.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0657   -3.5047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6468   -3.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6468   -2.6721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8261   -2.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5083   -2.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8261   -1.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5083   -1.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6691   -0.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4719   -5.1376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1699   -4.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8678   -5.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1660   -3.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7759   -5.1415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0625   -4.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3490   -5.1415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0585   -3.9046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  4  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  4  5  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 19  1  0  0  0  0\n 13  7  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 20  1  0  0  0  0\n  2  3  1  0  0  0  0\n 20 21  1  0  0  0  0\n 10 11  1  0  0  0  0\n 21 22  1  0  0  0  0\n  5  6  2  0  0  0  0\n 21 23  2  0  0  0  0\n 13  1  1  0  0  0  0\n 11 12  2  0  0  0  0\n  4 24  1  0  0  0  0\n 12  7  1  0  0  0  0\n 24 25  1  0  0  0  0\n  6  1  1  0  0  0  0\n 25 26  1  0  0  0  0\n  1  2  2  0  0  0  0\n 25 27  2  0  0  0  0\nM  END",
        "smiles": "CC(=O)Oc1ccc(cc1)C(=C2CCCCC2)c3ccc(cc3)OC(=O)C",
        "formula": "C23H24O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "364.4351",
        "optical_activity": "NONE",
        "references": [
          "19cd66b5-6ecc-4b15-8542-68afd662fb1a",
          "c5081382-bb2e-4b51-b83d-0d167f762b65",
          "e15c83c3-18e9-4553-adfd-dfe3a0c5e2cf"
        ],
        "stereo_centers": 0
      },
      "unii": "J468V64WZ1"
    }
  ]
}