{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cb15cbc7-f2f5-4833-a1f5-be08cd68fa67",
          "code": "6645-46-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6645-46-1",
          "code_system": "CAS",
          "references": [
            "31416f08-1bac-4b95-8838-545c6491c7ff",
            "e1d38bbf-ad70-43aa-a376-52d900a3d043"
          ]
        },
        {
          "uuid": "2227a3ec-0908-4e54-9bf0-6d6fe3759ba8",
          "code": "229-663-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.967",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "31416f08-1bac-4b95-8838-545c6491c7ff"
          ]
        },
        {
          "uuid": "207e6844-870d-4e71-82a5-ce27ad609ab6",
          "code": "1426681",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426681/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "31416f08-1bac-4b95-8838-545c6491c7ff"
          ]
        },
        {
          "uuid": "53893355-22a3-4f1e-bc0c-a540fa8722f4",
          "code": "m3119",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3119?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "31416f08-1bac-4b95-8838-545c6491c7ff"
          ]
        },
        {
          "uuid": "f8612320-063f-4e8f-94d4-91dc71595e69",
          "code": "SUB02906MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "31416f08-1bac-4b95-8838-545c6491c7ff"
          ]
        },
        {
          "uuid": "988a1eff-75c9-40c7-b279-2591c37de6d2",
          "code": "CHEMBL1149",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1149",
          "code_system": "ChEMBL",
          "references": [
            "31416f08-1bac-4b95-8838-545c6491c7ff"
          ]
        },
        {
          "uuid": "2da40114-407a-42dc-857c-de4cd2eec6b5",
          "code": "SUB01064MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "31416f08-1bac-4b95-8838-545c6491c7ff"
          ]
        },
        {
          "uuid": "198ed75d-b309-4d0e-89fe-1af3f63b5750",
          "code": "656657",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/656657",
          "code_system": "PUBCHEM",
          "references": [
            "e53913d0-a54f-7414-cf60-f9c44eb9fd90"
          ]
        },
        {
          "uuid": "40885c6d-95b3-1ffc-2036-93b551971973",
          "code": "DBSALT001037",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT001037",
          "code_system": "DRUG BANK",
          "references": [
            "eee2f2da-d690-9e4b-04cc-479b920e3c94"
          ]
        },
        {
          "uuid": "aa5752f8-5358-4b7b-8540-93d3a75125dc",
          "code": "J3Y5E6IKS3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0b38d9e7-4fb8-d133-f5f5-c4f47d1460a9",
          "code": "100000086667",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "57d5ad05-23c9-29de-f1d6-85f1b832763b"
          ]
        },
        {
          "uuid": "dd148f37-6142-b2b6-9080-2704e678038c",
          "code": "DTXSID701014449",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701014449",
          "code_system": "EPA CompTox",
          "references": [
            "eee2f2da-d690-9e4b-04cc-479b920e3c94"
          ]
        },
        {
          "uuid": "921b274b-6a0b-8f67-5d36-78766c1719eb",
          "code": "J3Y5E6IKS3",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=J3Y5E6IKS3",
          "code_system": "DAILYMED",
          "references": [
            "a3abd9f0-1e12-3cde-b1e5-f01def2360cc"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "893c4fdf-5c35-44e3-85c1-37ff80e07b74",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "294366b4-e0f2-4b4d-a889-6b4e12748172",
            "refuuid": "523e21ff-f2d9-4fbb-9842-1e91ad778ba6",
            "name": "LEVOCARNITINE",
            "unii": "0G389FZZ9M",
            "linking_id": "0G389FZZ9M",
            "ref_pname": "LEVOCARNITINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "16580521-c57e-4bf0-b705-26e2b0823ae3",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "286c1cb6-9ac0-4adf-abce-96a0b3ec5c41",
            "refuuid": "523e21ff-f2d9-4fbb-9842-1e91ad778ba6",
            "name": "LEVOCARNITINE",
            "unii": "0G389FZZ9M",
            "linking_id": "0G389FZZ9M",
            "ref_pname": "LEVOCARNITINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c5993498-a727-42d7-8db0-1e4b254f801f",
          "type": "SALT/SOLVATE->SALT/SOLVATE",
          "related_substance": {
            "uuid": "5ff3136c-f9ef-48af-bb7e-8d3453a254c0",
            "refuuid": "a03a8e7c-2b51-48fc-be24-488f16099369",
            "name": "ACETYLCARNITINE",
            "unii": "6DH1W9VH8Q",
            "linking_id": "6DH1W9VH8Q",
            "ref_pname": "ACETYLCARNITINE"
          }
        },
        {
          "uuid": "37913580-f443-4b59-b56d-e6c8f4fd9a24",
          "type": "IMPURITY->PARENT",
          "related_substance": {
            "uuid": "092ccb10-91de-42d3-9f57-a8b22468e775",
            "refuuid": "89a42684-8d7a-45db-963f-6b814825e467",
            "name": "CROTONOBETAINE HYDROCHLORIDE",
            "unii": "X7E9C9R1UY",
            "linking_id": "X7E9C9R1UY",
            "ref_pname": "CROTONOBETAINE HYDROCHLORIDE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "967a7ca5-f41c-4c08-beca-0e8b8a07b5c4",
          "name": "(2R)-3-CARBOXY-2-HYDROXY-N,N,N-TRIMETHYL-1-PROPANAMINIUM INNER SALT HYDROCHLORIDE",
          "stdName": "(2R)-3-CARBOXY-2-HYDROXY-N,N,N-TRIMETHYL-1-PROPANAMINIUM INNER SALT HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
            "aa69cb37-1798-40e4-86ea-2022edacc8af"
          ],
          "display_name": false
        },
        {
          "uuid": "8ec0e50a-ffa0-4c7f-bd7e-2fad13ca5657",
          "name": "CARNITINE HCL",
          "stdName": "CARNITINE HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
            "5d17c05a-5620-4d85-a7c6-4f1682086794",
            "6d3b3b4d-5e17-4e87-8061-eda6af5f08cb"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1912ceb6-0821-4389-9518-8fa3ec028c6f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "770b6643-da21-4ec4-b6ae-1696e1085d23",
          "name": "CARNITINE HYDROCHLORIDE [MI]",
          "stdName": "CARNITINE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
            "dc9486ea-73ff-492a-a579-a72b2aadb183"
          ],
          "display_name": false
        },
        {
          "uuid": "a11b4849-e949-4362-883d-dd7269dfe960",
          "name": "CARNITINE HYDROCHLORIDE, L-",
          "stdName": "CARNITINE HYDROCHLORIDE, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
            "4a2b2f1a-45aa-43fe-823a-44703bc09aff"
          ],
          "display_name": false
        },
        {
          "uuid": "5225bab0-ef00-438b-a06d-4df225084580",
          "name": "L-CARNITINE HYDROCHLORIDE",
          "stdName": "L-CARNITINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
            "aa69cb37-1798-40e4-86ea-2022edacc8af"
          ],
          "display_name": false
        },
        {
          "uuid": "8eb5c898-8246-43fc-a1b0-e5a6ef583020",
          "name": "LEVOCARNITINE CHLORIDE",
          "stdName": "LEVOCARNITINE CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc269804-1a12-4fbd-a302-f7685881bb5e",
            "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
            "d2518481-1469-4c60-8e0e-701529eb46ef"
          ],
          "display_name": false
        },
        {
          "uuid": "6921e70e-b44c-4aa1-8fd6-ef6893eba1c9",
          "name": "LEVOCARNITINE CHLORIDE [JAN]",
          "stdName": "LEVOCARNITINE CHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
            "d2518481-1469-4c60-8e0e-701529eb46ef"
          ],
          "display_name": false
        },
        {
          "uuid": "743723d4-35ef-49de-8468-95e9cc72d264",
          "name": "LEVOCARNITINE HCL",
          "stdName": "LEVOCARNITINE HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f4f06cb-2524-4f1e-b7d4-839a5450a375"
          ],
          "display_name": false
        },
        {
          "uuid": "217e859a-a3e2-4897-8d1d-96f1bf147011",
          "name": "LEVOCARNITINE HYDROCHLORIDE",
          "stdName": "LEVOCARNITINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddd12d88-75c3-4535-9aa1-5150d2a0d8e7",
            "95c57818-b6c2-43ef-a853-1c29c8bd9210",
            "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
            "aa69cb37-1798-40e4-86ea-2022edacc8af",
            "3c4c8e27-6da8-411c-a1f5-64db89b4d413",
            "87cafc98-ecaa-4241-996b-4e32e6aefef2",
            "b07d00d2-2f3c-4f50-a75c-4aee9434b07e"
          ],
          "display_name": true
        },
        {
          "uuid": "5b26974c-ff66-488d-b213-e3e3024dcac1",
          "name": "LEVOCARNITINE HYDROCHLORIDE [MART.]",
          "stdName": "LEVOCARNITINE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95c57818-b6c2-43ef-a853-1c29c8bd9210"
          ],
          "display_name": false
        },
        {
          "uuid": "b8483a6f-3dd5-6477-075f-3ac1776b7c3d",
          "name": "Levocarnitine hydrochloride [WHO-DD]",
          "stdName": "LEVOCARNITINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a25b30ae-beb1-e53e-f85e-a352a2b66ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "e5f4a4b8-c46a-4ec3-bf9f-bc5cd2cd058e",
          "name": "ORISTAR LCH",
          "stdName": "ORISTAR LCH",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
            "6d3b3b4d-5e17-4e87-8061-eda6af5f08cb"
          ],
          "display_name": false
        },
        {
          "uuid": "04a3e32c-ddc8-4a8f-97e6-f607fb1c52be",
          "name": "SELTZER CHEMICALS L-CARNITINE HCL",
          "stdName": "SELTZER CHEMICALS L-CARNITINE HCL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
            "6d3b3b4d-5e17-4e87-8061-eda6af5f08cb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "aa69cb37-1798-40e4-86ea-2022edacc8af",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b07d00d2-2f3c-4f50-a75c-4aee9434b07e",
          "citation": "USAN",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "385ecfaa-b1e7-4d32-8f27-0dc29f267cd0",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f4f06cb-2524-4f1e-b7d4-839a5450a375",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95c57818-b6c2-43ef-a853-1c29c8bd9210",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a2b2f1a-45aa-43fe-823a-44703bc09aff",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87cafc98-ecaa-4241-996b-4e32e6aefef2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2518481-1469-4c60-8e0e-701529eb46ef",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc9486ea-73ff-492a-a579-a72b2aadb183",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d3b3b4d-5e17-4e87-8061-eda6af5f08cb",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31416f08-1bac-4b95-8838-545c6491c7ff",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390844000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92f2758a-cd2b-42d4-9942-bfed2ee21235",
          "citation": "SRS import [J3Y5E6IKS3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J3Y5E6IKS3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390844000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c4c8e27-6da8-411c-a1f5-64db89b4d413",
          "citation": "LEVOCARNITINE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ddd12d88-75c3-4535-9aa1-5150d2a0d8e7",
          "citation": "LEVOCARNITINE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bc269804-1a12-4fbd-a302-f7685881bb5e",
          "citation": "LEVOCARNITINE CHLORIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5d17c05a-5620-4d85-a7c6-4f1682086794",
          "citation": "CARNITINE HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e53913d0-a54f-7414-cf60-f9c44eb9fd90",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "e1d38bbf-ad70-43aa-a376-52d900a3d043",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "eee2f2da-d690-9e4b-04cc-479b920e3c94",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a3abd9f0-1e12-3cde-b1e5-f01def2360cc",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a25b30ae-beb1-e53e-f85e-a352a2b66ff8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "57d5ad05-23c9-29de-f1d6-85f1b832763b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2c935db5-c4a5-496f-ae8f-d64fe57c72f1",
          "id": "2c935db5-c4a5-496f-ae8f-d64fe57c72f1",
          "molfile": "\n  Marvin  01132102242D          \n\n  1  0  0  0  1  0            999 V2000\n    7.1348   -6.3592    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "56c2052c-07fa-4b97-ad4f-7d14e14327ed"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "bf02a021-d3c2-4e86-b01d-0b964a42aa83",
          "id": "bf02a021-d3c2-4e86-b01d-0b964a42aa83",
          "molfile": "\n  Marvin  01132109522D          \n\n 11 10  0  0  1  0            999 V2000\n    7.6418   -4.8601    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.6418   -5.6193    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.9265   -4.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2222   -4.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5398   -4.4107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2113   -5.5864    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3599   -4.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2232   -4.9369    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n   10.1275   -4.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2286   -5.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2232   -4.1037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  8  1  0  0  0  0\nM  CHG  2   2  -1   8   1\nM  END",
          "smiles": "C[N+](C)(C)C[C@@H](CC(=O)O)[O-]",
          "formula": "C7H15NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ffba1aab-dc8e-491e-8e67-0283d8ac8f06"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "161.1992",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a277a409-87e3-4f0d-a6f4-8b922037e540",
      "version": "12",
      "structure": {
        "id": "a7929625-a903-45fe-b986-0df74186ec7b",
        "molfile": "\n  Marvin  01132108422D          \n\n 12 10  0  0  1  0            999 V2000\n    7.1348   -6.3592    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n    6.2222   -4.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9265   -4.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6418   -4.8601    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3599   -4.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2232   -4.9369    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.1275   -4.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2286   -5.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2232   -4.1037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6418   -5.6193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5398   -4.4107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2113   -5.5864    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  6  1  0  0  0  0\n  4 10  1  6  0  0  0\n 11  2  1  0  0  0  0\n 12  2  2  0  0  0  0\nM  CHG  2   1  -1   6   1\nM  END",
        "smiles": "C[N+](C)(C)C[C@@H](CC(=O)O)O.[Cl-]",
        "formula": "C7H16NO3.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "197.6601",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "aa69cb37-1798-40e4-86ea-2022edacc8af",
          "92f2758a-cd2b-42d4-9942-bfed2ee21235"
        ],
        "stereo_centers": 1
      },
      "unii": "J3Y5E6IKS3"
    }
  ]
}