{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bbbf6f7b-662c-4d46-8817-47b7a2836dc2", "code": "24748-23-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=24748-23-0", "code_system": "CAS", "references": [ "a8542c4a-9272-4748-a431-9e39e6ce50d1", "9a0c009c-deda-4849-8786-3c2c160ee397" ] }, { "uuid": "fd09d9c0-450b-4358-8223-a99df8eea663", "code": "FCN NO. 67", "comments": "FCN|RHEOLOGY MODIFIER|OLEFIN POLYMERS", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=67", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "a8542c4a-9272-4748-a431-9e39e6ce50d1" ] }, { "uuid": "f0826b1e-6762-4456-843d-b1d9b8262185", "code": "2734078", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2734078", "code_system": "PUBCHEM", "references": [ "a8542c4a-9272-4748-a431-9e39e6ce50d1" ] }, { "uuid": "704679d2-6a8f-6a56-f517-939987d085c2", "code": "DTXSID3051913", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3051913", "code_system": "EPA CompTox", "references": [ "4770616a-6402-91e5-91ae-c167fae6ceb1" ] }, { "uuid": "d8c40826-0f1d-4320-8edb-ae52e876ce05", "code": "J3MV6AZN38", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "98ce1c75-c121-4dbd-bc5f-a81df436e629", "name": "1,2,4,5,7,8-HEXOXONANE, 3,6,9-TRIETHYL-3,6,9-TRIMETHYL-", "stdName": "1,2,4,5,7,8-HEXOXONANE, 3,6,9-TRIETHYL-3,6,9-TRIMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c1d1c3c4-1281-4010-8796-9cdea19aa69c" ], "display_name": false }, { "uuid": "c3500e44-df49-496e-9500-0d7aba140d0e", "name": "3,6,9-TRIETHYL-3,6,9-TRIMETHYL-1,2,4,5,7,8-HEXOXONANE", "stdName": "3,6,9-TRIETHYL-3,6,9-TRIMETHYL-1,2,4,5,7,8-HEXOXONANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3b286e06-a4a4-420b-8212-3d7a3bbb0ad0" ], "display_name": true }, { "uuid": "72c45e41-f23f-469b-aa21-49e207f7fb68", "name": "TRIGONOX 301", "stdName": "TRIGONOX 301", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "4231a45b-583b-4b45-8370-4b12800710cb" ], "display_name": false } ], "references": [ { "uuid": "3b286e06-a4a4-420b-8212-3d7a3bbb0ad0", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "c1d1c3c4-1281-4010-8796-9cdea19aa69c", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4231a45b-583b-4b45-8370-4b12800710cb", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a8542c4a-9272-4748-a431-9e39e6ce50d1", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390315000, "tags": [ "NOMEN" ] }, { "uuid": "02061b5e-2bfd-4627-af5d-549d5d9e3996", "citation": "SRS import [J3MV6AZN38]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J3MV6AZN38", "doc_type": "SRS", "public_domain": true, "document_date": 1493390315000, "tags": [ "NOMEN" ] }, { "uuid": "4770616a-6402-91e5-91ae-c167fae6ceb1", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=24748-23-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9a0c009c-deda-4849-8786-3c2c160ee397", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "291294e3-22ee-4dca-ba21-05f2140d3c1d", "id": "291294e3-22ee-4dca-ba21-05f2140d3c1d", "molfile": "\n Marvin 01132102152D \n\n 18 18 0 0 0 0 999 V2000\n -2.0399 0.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3724 1.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6188 1.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7050 1.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8737 0.2715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4257 -0.3416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0132 -1.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9270 -1.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6807 -1.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4343 -1.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2062 -0.8846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6007 -1.0561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0132 -0.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6807 0.1433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7669 -0.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4343 -0.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4612 0.2715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2062 1.0561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 3 1 0 0 0 0\n 18 3 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 11 7 1 0 0 0 0\n 9 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 17 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 18 17 1 0 0 0 0\nM END", "smiles": "CCC1(C)OOC(C)(CC)OOC(C)(CC)OO1", "formula": "C12H24O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b27e3881-c5ab-4cfb-bd6d-6abaeeb3f1dd" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "264.3158", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "d5bbc8dd-9d04-485b-a5f7-ec127eff7c03", "version": "3", "structure": { "id": "4dfcee09-6ff9-49cd-b5ff-e22ed592a1c4", "molfile": "\n Marvin 01132104042D \n\n 18 18 0 0 0 0 999 V2000\n 0.2062 1.0561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4612 0.2715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0132 -0.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6007 -1.0561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2062 -0.8846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0132 -1.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4257 -0.3416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8737 0.2715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6188 1.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7050 1.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9270 -1.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6807 0.1433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3724 1.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0399 0.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6807 -1.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4343 -1.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7669 -0.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4343 -0.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 1 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 6 11 1 0 0 0 0\n 3 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 9 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 6 15 1 0 0 0 0\n 17 18 1 0 0 0 0\n 3 17 1 0 0 0 0\nM END", "smiles": "CCC1(C)OOC(C)(CC)OOC(C)(CC)OO1", "formula": "C12H24O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "264.3158", "optical_activity": "NONE", "references": [ "02061b5e-2bfd-4627-af5d-549d5d9e3996", "c1d1c3c4-1281-4010-8796-9cdea19aa69c" ], "stereo_centers": 0 }, "unii": "J3MV6AZN38" } ] }