{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5689125d-04d9-46cf-8f19-91f8d1a599e4",
          "code": "51657-91-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51657-91-1",
          "code_system": "CAS",
          "references": [
            "e994f0e8-1bab-44ab-b23e-cff6518b6640"
          ]
        },
        {
          "uuid": "2e35fb0b-efc1-8377-2616-cfd7ab961986",
          "code": "21196452",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21196452",
          "code_system": "PUBCHEM",
          "references": [
            "22d299b2-4f38-4c11-c81a-0af31127ffbd"
          ]
        },
        {
          "uuid": "f6bb61e2-874d-4313-af4e-cd6ef7c20b83",
          "code": "J3FP29R462",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "6735c6b3-a4d7-4619-bd1b-aa7a5547ef9d",
          "amount": {
            "uuid": "dc441f95-24fc-44ad-9785-2124c21383e4",
            "units": "PERCENT PEAK AREA",
            "high_limit": 2
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "962d3e9b-9294-2abd-85ad-b66a4be07eba"
          ],
          "related_substance": {
            "uuid": "94dea473-e152-4134-940d-74cb5658d50e",
            "refuuid": "63a43493-6f67-4156-bb3d-1d8f39d4083f",
            "name": "TRIPROLIDINE HYDROCHLORIDE",
            "unii": "YAN7R5L890",
            "linking_id": "YAN7R5L890",
            "ref_pname": "TRIPROLIDINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6bb04548-83d8-7e5e-05a1-2e0a9f8fd396",
          "name": "(Z)-2-(3-(1-PYRROLIDINYL)-1-P-TOLYLPROPENYL)PYRIDINE MONOHYDROCHLORIDE",
          "stdName": "(Z)-2-(3-(1-PYRROLIDINYL)-1-P-TOLYLPROPENYL)PYRIDINE MONOHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "962d3e9b-9294-2abd-85ad-b66a4be07eba"
          ],
          "display_name": false
        },
        {
          "uuid": "0e826ada-7429-9675-ad5b-812cd87d887f",
          "name": "PYRIDINE, 2-((1Z)-1-(4-METHYLPHENYL)-3-(1-PYRROLIDINYL)-1-PROPEN-1-YL)-, HYDROCHLORIDE (1:1)",
          "stdName": "PYRIDINE, 2-((1Z)-1-(4-METHYLPHENYL)-3-(1-PYRROLIDINYL)-1-PROPEN-1-YL)-, HYDROCHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0898b98-a04e-db19-f837-fc4363961275"
          ],
          "display_name": false
        },
        {
          "uuid": "87bcf8f7-5d96-7abe-1e99-07d444ca6bb9",
          "name": "PYRIDINE, 2-(1-(4-METHYLPHENYL)-3-(1-PYRROLIDINYL)-1-PROPENYL)-, MONOHYDROCHLORIDE, (Z)-",
          "stdName": "PYRIDINE, 2-(1-(4-METHYLPHENYL)-3-(1-PYRROLIDINYL)-1-PROPENYL)-, MONOHYDROCHLORIDE, (Z)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0898b98-a04e-db19-f837-fc4363961275"
          ],
          "display_name": false
        },
        {
          "uuid": "443e28a7-a567-44d9-bd22-ad998cc0fb74",
          "name": "Pyridine, 2-[(1Z)-1-(4-methylphenyl)-3-(1-pyrrolidinyl)-1-propenyl]-, monohydrochloride",
          "stdName": "PYRIDINE, 2-((1Z)-1-(4-METHYLPHENYL)-3-(1-PYRROLIDINYL)-1-PROPENYL)-, MONOHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e994f0e8-1bab-44ab-b23e-cff6518b6640"
          ],
          "display_name": true
        },
        {
          "uuid": "1e3371c7-287a-e576-609a-3c05897da537",
          "name": "TRIPROLIDINE HYDROCHLORIDE Z-ISOMER",
          "stdName": "TRIPROLIDINE HYDROCHLORIDE Z-ISOMER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "962d3e9b-9294-2abd-85ad-b66a4be07eba"
          ],
          "display_name": false
        },
        {
          "uuid": "73e75b7c-2610-3d51-1b7c-ccfa3e983693",
          "name": "TRIPROLIDINE HYDROCHLORIDE Z-ISOMER [USP IMPURITY]",
          "stdName": "TRIPROLIDINE HYDROCHLORIDE Z-ISOMER [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "962d3e9b-9294-2abd-85ad-b66a4be07eba"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "962d3e9b-9294-2abd-85ad-b66a4be07eba",
          "citation": "USP42-NF37 - 4492, Triprolidine Hydrochloride Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f0898b98-a04e-db19-f837-fc4363961275",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e994f0e8-1bab-44ab-b23e-cff6518b6640",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "22d299b2-4f38-4c11-c81a-0af31127ffbd",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3e1573ae-1ff3-c09f-09ce-57f9b6de0e39",
          "id": "3e1573ae-1ff3-c09f-09ce-57f9b6de0e39",
          "molfile": "\n  Marvin  01132103172D          \n\n  1  0  0  0  0  0            999 V2000\n   19.6715   -3.3512    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4b5fc168-80d0-4958-9e56-e3a89dcd6969"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b04d50d6-f7c9-2a3f-0084-6e80e7e1c1a1",
          "id": "b04d50d6-f7c9-2a3f-0084-6e80e7e1c1a1",
          "molfile": "\n  Marvin  01132109092D          \n\n 21 23  0  0  0  0            999 V2000\n   18.0216   -5.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3071   -5.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5928   -5.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8783   -5.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8783   -4.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5928   -3.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3071   -4.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1638   -3.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4493   -4.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7349   -3.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0205   -4.1762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9343   -4.9967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1273   -5.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7148   -4.4537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2668   -3.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1638   -2.9387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4493   -2.5262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4493   -1.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1638   -1.2888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8783   -1.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8783   -2.5262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 16  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 15  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)/C(=C/CN2CCCC2)/c3ccccn3",
          "formula": "C19H22N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "14f0fd25-556f-4d86-9955-54ce7dbb5301"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "278.3921",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "364195a4-2b23-4406-99ad-5e3843f19988",
      "version": "8",
      "structure": {
        "id": "2dcfbd94-8c7b-0274-f55f-9e4b6e4aff4c",
        "molfile": "\n  Marvin  01132102282D          \n\n 22 23  0  0  0  0            999 V2000\n   15.1638   -2.9387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4493   -2.5262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4493   -1.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1638   -1.2888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8783   -1.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8783   -2.5262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1638   -3.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4493   -4.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7349   -3.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8783   -4.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5928   -3.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3071   -5.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8783   -5.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3071   -4.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5928   -5.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0216   -5.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0205   -4.1762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9343   -4.9967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1273   -5.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7148   -4.4537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2668   -3.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6715   -3.3512    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 13  2  0  0  0  0\n 11 14  2  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  2  0  0  0  0\n 13 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n  7 10  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 17 21  1  0  0  0  0\n  9 17  1  0  0  0  0\n  1  7  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)/C(=C/CN2CCCC2)/c3ccccn3.Cl",
        "formula": "C19H22N2.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "314.853",
        "optical_activity": "NONE",
        "references": [
          "962d3e9b-9294-2abd-85ad-b66a4be07eba"
        ],
        "stereo_centers": 0
      },
      "unii": "J3FP29R462"
    }
  ]
}