{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "601860fe-a5ac-42e0-aef5-dc2537c58a1e",
          "code": "28772-56-7",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=28772-56-7",
          "code_system": "CAS",
          "references": [
            "b87315af-ef59-483f-a71b-c4ab8fc2da23",
            "6e30c59e-fadd-4a3a-ab29-c0baadaa1cdb"
          ]
        },
        {
          "uuid": "4538eba2-43fa-4527-a842-9ce1ce0598aa",
          "code": "249-205-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.718",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b87315af-ef59-483f-a71b-c4ab8fc2da23"
          ]
        },
        {
          "uuid": "81bd9854-f0ad-4915-9246-9b7918d4bdd8",
          "code": "m2659",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2659?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b87315af-ef59-483f-a71b-c4ab8fc2da23"
          ]
        },
        {
          "uuid": "845a707e-9b1a-40a3-960f-66b8e2913ddc",
          "code": "SUB33433",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b87315af-ef59-483f-a71b-c4ab8fc2da23"
          ]
        },
        {
          "uuid": "dd16545b-3e7c-4a60-8f7f-4150531ac08c",
          "code": "54680085",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54680085",
          "code_system": "PUBCHEM",
          "references": [
            "b87315af-ef59-483f-a71b-c4ab8fc2da23"
          ]
        },
        {
          "uuid": "7108a92f-4ea3-6864-cc20-c1290866e8b6",
          "code": "Bromadiolone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bromadiolone",
          "code_system": "WIKIPEDIA",
          "references": [
            "0b52bba3-edc3-b9c3-ea0e-144b67564655"
          ]
        },
        {
          "uuid": "b5cfb6a0-4f05-8e4f-1584-d9ef06fc5290",
          "code": "6458",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6458",
          "code_system": "HSDB",
          "references": [
            "5165d082-416d-439f-8bf4-7577b204d831"
          ]
        },
        {
          "uuid": "c229f7c7-e80a-4d97-9d7f-a13ceb126ea1",
          "code": "J2FR050NM5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f1afd875-372a-d035-57e1-cdb2c8f27cf4",
          "code": "100000126256",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c01ffede-3d57-36dd-a6cf-d73254ea01a3"
          ]
        },
        {
          "uuid": "d8487f42-b75a-4905-92f6-3772d50655bd",
          "code": "198015-14-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=198015-14-4",
          "code_system": "CAS",
          "references": [
            "6e30c59e-fadd-4a3a-ab29-c0baadaa1cdb"
          ]
        },
        {
          "uuid": "31383bb2-974f-42f2-7f9f-97630c178edc",
          "code": "bromadiolone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/bromadiolone.html",
          "code_system": "ALANWOOD",
          "references": [
            "0c8ace52-57f8-9f52-c258-00fb8c9a48fc"
          ]
        },
        {
          "uuid": "35e210f6-5c17-14ed-78f1-5444931bb7f8",
          "code": "DTXSID201337347",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201337347",
          "code_system": "EPA CompTox",
          "references": [
            "9896b65a-f561-21a3-9385-3ef1c0091106"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e59eb820-6309-43f5-9abf-cc9630fa0ec9",
          "name": "2H-1-BENZOPYRAN-2-ONE, 3-(3-(4'-BROMO(1,1'-BIPHENYL)-4-YL)-3-HYDROXY-1-PHENYLPROPYL)-4-HYDROXY-",
          "stdName": "2H-1-BENZOPYRAN-2-ONE, 3-(3-(4'-BROMO(1,1'-BIPHENYL)-4-YL)-3-HYDROXY-1-PHENYLPROPYL)-4-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea4158c5-7340-4c0e-b71c-1dbf0a1dc628",
            "f24fa94c-c7fa-4e91-ba2f-a262c5376d87"
          ],
          "display_name": false
        },
        {
          "uuid": "7ff30374-9d6a-4dda-a6fd-6828afb7778c",
          "name": "3-(3-(4'-BROMO-(1,1'-BIPHENYL)-4-YL)-3-HYDROXY-1-PHENYLPROPYL)-4-HYDROXYCOUMARIN",
          "stdName": "3-(3-(4'-BROMO-(1,1'-BIPHENYL)-4-YL)-3-HYDROXY-1-PHENYLPROPYL)-4-HYDROXYCOUMARIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6fd1930-58c7-445a-8d8b-bf213b4fa29f",
            "ea4158c5-7340-4c0e-b71c-1dbf0a1dc628"
          ],
          "display_name": false
        },
        {
          "uuid": "1aaedfe0-7e88-41f5-8386-97f535334b72",
          "name": "BROMADIOLONE",
          "stdName": "BROMADIOLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37449c52-551e-42ef-8b2e-cd202bf82c38",
            "b6fd1930-58c7-445a-8d8b-bf213b4fa29f",
            "c63e5b79-2c94-434f-9f12-ea01c705b7f4",
            "802ed59b-ed19-4ba5-8962-21481e849860",
            "ea4158c5-7340-4c0e-b71c-1dbf0a1dc628"
          ],
          "display_name": true
        },
        {
          "uuid": "bd52d17b-b39a-49f2-8b14-80397d0dafe1",
          "name": "BROMADIOLONE [ISO]",
          "stdName": "BROMADIOLONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6fd1930-58c7-445a-8d8b-bf213b4fa29f",
            "ea4158c5-7340-4c0e-b71c-1dbf0a1dc628"
          ],
          "display_name": false
        },
        {
          "uuid": "2df1d05d-17c8-4746-99c7-3ea25740e269",
          "name": "BROMADIOLONE [MI]",
          "stdName": "BROMADIOLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "802ed59b-ed19-4ba5-8962-21481e849860",
            "ea4158c5-7340-4c0e-b71c-1dbf0a1dc628"
          ],
          "display_name": false
        },
        {
          "uuid": "7b7f5ced-7b74-4c15-a002-b208971d96ae",
          "name": "BROMONE",
          "stdName": "BROMONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "802ed59b-ed19-4ba5-8962-21481e849860",
            "ea4158c5-7340-4c0e-b71c-1dbf0a1dc628"
          ],
          "display_name": false
        },
        {
          "uuid": "dd12eb72-722d-4be7-bc06-3ae36d7418f5",
          "name": "LM-637",
          "stdName": "LM-637",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "802ed59b-ed19-4ba5-8962-21481e849860",
            "ea4158c5-7340-4c0e-b71c-1dbf0a1dc628"
          ],
          "display_name": false
        },
        {
          "uuid": "82c752b6-10b0-46c4-b20b-7e19dff47d1e",
          "name": "MAKI",
          "stdName": "MAKI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "802ed59b-ed19-4ba5-8962-21481e849860",
            "ea4158c5-7340-4c0e-b71c-1dbf0a1dc628"
          ],
          "display_name": false
        },
        {
          "uuid": "3ca9daf2-b196-474d-8db7-49cb8c3fd993",
          "name": "SUPER-CAID",
          "stdName": "SUPER-CAID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "802ed59b-ed19-4ba5-8962-21481e849860",
            "ea4158c5-7340-4c0e-b71c-1dbf0a1dc628"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b6fd1930-58c7-445a-8d8b-bf213b4fa29f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ea4158c5-7340-4c0e-b71c-1dbf0a1dc628",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f24fa94c-c7fa-4e91-ba2f-a262c5376d87",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "802ed59b-ed19-4ba5-8962-21481e849860",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b87315af-ef59-483f-a71b-c4ab8fc2da23",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392805000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c49735d6-eff2-41d2-9ee5-b0102331a676",
          "citation": "SRS import [J2FR050NM5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J2FR050NM5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392805000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c63e5b79-2c94-434f-9f12-ea01c705b7f4",
          "citation": "BROMADIOLONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37449c52-551e-42ef-8b2e-cd202bf82c38",
          "citation": "BROMADIOLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0b52bba3-edc3-b9c3-ea0e-144b67564655",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Bromadiolone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5165d082-416d-439f-8bf4-7577b204d831",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+28772-56-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d41c6fd3-ce76-a0f8-c641-65f7a72fd80f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=28772-56-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0c8ace52-57f8-9f52-c258-00fb8c9a48fc",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "6e30c59e-fadd-4a3a-ab29-c0baadaa1cdb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9896b65a-f561-21a3-9385-3ef1c0091106",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "c01ffede-3d57-36dd-a6cf-d73254ea01a3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2c1fe502-05f6-4ec6-a323-5a2066a28558",
          "id": "2c1fe502-05f6-4ec6-a323-5a2066a28558",
          "molfile": "\n  Marvin  01072215012D          \n\n 35 39  0  0  1  0            999 V2000\n   11.8955   -4.2835    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.1747   -3.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8988   -5.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6092   -3.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4645   -4.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1747   -3.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1851   -5.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6126   -5.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3264   -4.2801    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.7370   -3.8802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4507   -5.1179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4507   -2.6216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8886   -2.6216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1885   -6.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6126   -6.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0367   -3.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3264   -5.1041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7370   -3.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0266   -4.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8988   -6.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7504   -4.2801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0263   -3.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0266   -2.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3095   -3.8802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4642   -3.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7366   -2.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3095   -3.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4642   -3.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1709   -2.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8882   -3.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1641   -1.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5984   -2.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8744   -1.3837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5950   -1.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3088   -1.3803    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  1  0  0  0\n  1  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6 12  1  0  0  0  0\n  6 13  2  0  0  0  0\n  7 14  1  0  0  0  0\n  8 15  2  0  0  0  0\n  9 16  1  0  0  0  0\n  9 17  1  6  0  0  0\n 10 18  1  0  0  0  0\n 10 19  2  0  0  0  0\n 12 18  1  0  0  0  0\n 14 20  2  0  0  0  0\n 15 20  1  0  0  0  0\n 16 21  2  0  0  0  0\n 16 22  1  0  0  0  0\n 18 23  2  0  0  0  0\n 19 24  1  0  0  0  0\n 21 25  1  0  0  0  0\n 22 26  2  0  0  0  0\n 23 27  1  0  0  0  0\n 24 27  2  0  0  0  0\n 25 28  2  0  0  0  0\n 26 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 29 31  1  0  0  0  0\n 30 32  1  0  0  0  0\n 31 33  2  0  0  0  0\n 32 34  2  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)[C@H](C[C@H](c2ccc(cc2)-c3ccc(cc3)Br)O)c4c(c5ccccc5oc4=O)O",
          "formula": "C30H23BrO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d27aef17-df7c-427c-bf14-a0a0f9feb6fb"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "527.4059",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ef53cddf-389b-4778-952c-a859c8bfb338",
      "version": "11",
      "structure": {
        "id": "24ac45fb-4d60-4843-bbae-ab6c1ec10822",
        "molfile": "\n   JSDraw201072215012D\n\n 35 39  0  0  0  0              0 V2000\n   22.4947   -8.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1318   -7.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5011   -9.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8444   -7.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7888   -8.1134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1318   -5.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1513  -10.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8508  -10.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2006   -8.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4130   -7.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7627   -9.6782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7627   -4.9576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4817   -4.9576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1579  -11.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8508  -11.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5438   -7.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2006   -9.6521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4130   -5.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0696   -8.1134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5011  -12.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8935   -8.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5242   -5.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0696   -4.9965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7135   -7.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2433   -7.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8674   -4.9706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7135   -5.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2433   -5.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5797   -4.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.9362   -5.7401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5669   -3.3991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.2792   -4.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.9101   -2.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.2728   -3.3991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   34.6225   -2.6102    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  1  0  0  0\n  1  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6 12  1  0  0  0  0\n  6 13  2  0  0  0  0\n  7 14  1  0  0  0  0\n  8 15  2  0  0  0  0\n  9 16  1  0  0  0  0\n  9 17  1  6  0  0  0\n 10 18  1  0  0  0  0\n 10 19  2  0  0  0  0\n 14 20  2  0  0  0  0\n 16 21  2  0  0  0  0\n 16 22  1  0  0  0  0\n 18 23  2  0  0  0  0\n 19 24  1  0  0  0  0\n 21 25  1  0  0  0  0\n 22 26  2  0  0  0  0\n 23 27  1  0  0  0  0\n 25 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 29 31  1  0  0  0  0\n 30 32  1  0  0  0  0\n 31 33  2  0  0  0  0\n 32 34  2  0  0  0  0\n 34 35  1  0  0  0  0\n 12 18  1  0  0  0  0\n 15 20  1  0  0  0  0\n 24 27  2  0  0  0  0\n 26 28  1  0  0  0  0\n 33 34  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)[C@H](C[C@H](c2ccc(cc2)-c3ccc(cc3)Br)O)c4c(c5ccccc5oc4=O)O",
        "formula": "C30H23BrO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "527.4059",
        "optical_activity": "( + / - )",
        "references": [
          "c49735d6-eff2-41d2-9ee5-b0102331a676",
          "b6fd1930-58c7-445a-8d8b-bf213b4fa29f"
        ],
        "stereo_centers": 2
      },
      "unii": "J2FR050NM5"
    }
  ]
}