{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "31007832-c84d-cac9-fd4a-843e0d1bdab2", "code": "837-73-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=837-73-0", "code_system": "CAS", "references": [ "b95b830b-234b-49ac-971c-9492b4bb7aa1" ] }, { "uuid": "1ddf74ae-1c14-8f2d-eea6-9792c35b412f", "code": "2016", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2016", "code_system": "PUBCHEM", "references": [ "441cb41d-3307-b6e4-aca0-3d11fa81cc85" ] }, { "uuid": "63b3b532-4021-ae61-3704-edaef0672647", "code": "DTXSID30232534", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30232534", "code_system": "EPA CompTox" }, { "uuid": "2f7077f9-d62f-4fa4-92dc-993557168648", "code": "J276XBF77Z", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "b95b830b-234b-49ac-971c-9492b4bb7aa1" ] } ], "relationships": [ { "uuid": "64d991af-1f66-4924-b6d5-f60bda53c160", "amount": { "uuid": "2b93adad-2b05-4341-a706-686d96e08152" }, "type": "SALT/SOLVATE->PARENT", "references": [ "b95b830b-234b-49ac-971c-9492b4bb7aa1" ], "related_substance": { "uuid": "8c0fee12-deab-4d16-94c1-68a4ee4c92d4", "refuuid": "62609a62-18b8-4868-9cc8-210946e7fabd", "name": "3,6-DIAMINO-10-METHYLACRIDINIUM CHLORIDE", "unii": "1TW3Q60E36", "linking_id": "1TW3Q60E36", "ref_pname": "3,6-DIAMINO-10-METHYLACRIDINIUM CHLORIDE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "6ed9e1da-3916-e13a-17a5-dd86a2040a24", "name": "10-Methylacridin-10-ium-3,6-diamine", "stdName": "10-METHYLACRIDIN-10-IUM-3,6-DIAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "51169ca1-4494-80e4-7655-a5b9892e18f7" ], "display_name": false }, { "uuid": "72049cf5-3937-4b4f-a621-5be0182becbe", "name": "3,6-Diamino-10-methylacridinium", "stdName": "3,6-DIAMINO-10-METHYLACRIDINIUM", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b95b830b-234b-49ac-971c-9492b4bb7aa1" ], "display_name": true }, { "uuid": "1fb879bc-766f-49ee-9c5e-740d27505cd7", "name": "Acridinium, 3,6-diamino-10-methyl-", "stdName": "ACRIDINIUM, 3,6-DIAMINO-10-METHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b95b830b-234b-49ac-971c-9492b4bb7aa1" ], "display_name": false }, { "uuid": "f314c4ab-927a-49bf-9cbb-b707bb9d77d8", "name": "Acriflavinium", "stdName": "ACRIFLAVINIUM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b95b830b-234b-49ac-971c-9492b4bb7aa1" ], "display_name": false } ], "references": [ { "uuid": "441cb41d-3307-b6e4-aca0-3d11fa81cc85", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "51169ca1-4494-80e4-7655-a5b9892e18f7", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "b95b830b-234b-49ac-971c-9492b4bb7aa1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ab95308a-a4aa-4d2b-96c8-eafe1f86b2c7", "id": "ab95308a-a4aa-4d2b-96c8-eafe1f86b2c7", "molfile": "\n Marvin 01132108542D \n\n 17 19 0 0 0 0 999 V2000\n 1.6500 -1.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 -1.4290 0.0000 N 0 3 0 0 0 4 0 0 0 0 0 0\n 0.4125 -0.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 1.4290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 -1.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -2.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 -2.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -3.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -3.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 -4.2868 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 -2.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -2.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 17 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 9 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 17 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 2 0 0 0 0\nM CHG 1 2 1\nM END", "smiles": "C[n+]1c2cc(ccc2cc3ccc(cc31)N)N", "formula": "C14H14N3", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "27184d44-7898-45ab-8780-3a74436df2b8" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "224.2816", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "7fcfdc16-ecd6-4a13-a2a8-c3f867dccfe7", "version": "8", "structure": { "id": "c14d9077-bcd6-4965-a5eb-fd0461760f16", "molfile": "\n JSDraw212052322582D\n\n 17 19 0 0 0 0 0 V2000\n 21.1120 -10.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1120 -8.4756 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 22.4632 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8145 -8.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1657 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1657 -6.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8145 -5.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4632 -6.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1120 -5.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7608 -6.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4095 -5.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0583 -6.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0583 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4095 -8.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7608 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7081 -8.4758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5159 -8.4758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 3 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 10 15 1 0 0 0 0\n 2 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 5 17 1 0 0 0 0\nM CHG 1 2 1\nM END", "smiles": "C[n+]1c2cc(ccc2cc3ccc(cc31)N)N", "formula": "C14H14N3", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "224.2816", "optical_activity": "NONE", "references": [ "51169ca1-4494-80e4-7655-a5b9892e18f7" ], "stereo_centers": 0 }, "unii": "J276XBF77Z" } ] }