{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f89ac56b-120e-4011-b8a0-b677aa94ff51",
          "code": "6807-17-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6807-17-6",
          "code_system": "CAS",
          "references": [
            "c29e26ea-b411-4846-a76e-c58f65bba3c8",
            "370cedd9-c851-4252-8376-6bbeae3e149d"
          ]
        },
        {
          "uuid": "dc5067de-dbe4-4dca-bd27-44d8c4b6bc72",
          "code": "401-720-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.100.362",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c29e26ea-b411-4846-a76e-c58f65bba3c8"
          ]
        },
        {
          "uuid": "5b12e0f2-4e8d-4b88-9531-82c731e5d4c5",
          "code": "81259",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/81259",
          "code_system": "PUBCHEM",
          "references": [
            "c29e26ea-b411-4846-a76e-c58f65bba3c8"
          ]
        },
        {
          "uuid": "97fadc03-e040-a953-0120-dcb3763f1202",
          "code": "DTXSID8029282",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8029282",
          "code_system": "EPA CompTox",
          "references": [
            "ad6ac411-5e1e-1f9c-46a1-8415d707ac1e"
          ]
        },
        {
          "uuid": "0aba25ed-9f9c-4820-aae3-16fa863a8535",
          "code": "J1B7N5N4M7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9ee75697-5dc4-931a-076d-5d741cc22883",
          "code": "73727",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=73727",
          "code_system": "NSC",
          "references": [
            "b70e1718-a54f-9aff-b689-1bb2bab34342"
          ]
        },
        {
          "uuid": "c4d87d15-7c3a-b4ce-2c0e-5de977c6cc42",
          "code": "300000053730",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f318b074-87c8-bc94-b255-282d9d128275"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "27c52355-76ab-4fe2-acf5-5336715755ff",
          "name": "2,2-(4-HYDROXYPHENYL)-4-METHYLPENTANE",
          "stdName": "2,2-(4-HYDROXYPHENYL)-4-METHYLPENTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "281d65a8-8aff-4cc5-a0e0-e008c4d65c96"
          ],
          "display_name": false
        },
        {
          "uuid": "cd881c0d-7690-4f48-a154-6fde10b95d86",
          "name": "2,2-BIS(4'-HYDROXYPHENYL)-4-METHYLPENTANE",
          "stdName": "2,2-BIS(4'-HYDROXYPHENYL)-4-METHYLPENTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55da244b-feae-4eb0-b7b5-ba64c4914806"
          ],
          "display_name": false
        },
        {
          "uuid": "9441bf9d-411f-4759-b583-c04a3d757cee",
          "name": "4,4'-(1,3-DIMETHYLBUTYLIDENE)BISPHENOL",
          "stdName": "4,4'-(1,3-DIMETHYLBUTYLIDENE)BISPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ec6efd5-f388-4b7c-b71a-af09b80c86c5"
          ],
          "display_name": false
        },
        {
          "uuid": "47059881-cc6e-4ba2-adaa-d358450f9d45",
          "name": "4,4'-(4-METHYLPENTANE-2,2-DIYL)DIPHENOL",
          "stdName": "4,4'-(4-METHYLPENTANE-2,2-DIYL)DIPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce3a7a5c-aa46-48b7-b4d2-6cebb4d26213"
          ],
          "display_name": true
        },
        {
          "uuid": "83cf75ac-8430-4b23-85f7-15c2dd9c0825",
          "name": "4,4-ISOBUTYLETHYLIDENEDIPHENOL",
          "stdName": "4,4-ISOBUTYLETHYLIDENEDIPHENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55da244b-feae-4eb0-b7b5-ba64c4914806"
          ],
          "display_name": false
        },
        {
          "uuid": "95a59c09-93df-4034-9bb5-c82a3b06e825",
          "name": "J878.905C",
          "stdName": "J878.905C",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ec6efd5-f388-4b7c-b71a-af09b80c86c5"
          ],
          "display_name": false
        },
        {
          "uuid": "d8850550-ed2a-b6f2-7d6f-1b58ca434ea0",
          "name": "NSC-73727",
          "stdName": "NSC-73727",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b70e1718-a54f-9aff-b689-1bb2bab34342"
          ],
          "display_name": false
        },
        {
          "uuid": "ff31cfc2-bc97-4588-a6fc-bcd7492a8996",
          "name": "PHENOL, 4,4'-(1,3-DIMETHYLBUTYLIDENE)BIS-",
          "stdName": "PHENOL, 4,4'-(1,3-DIMETHYLBUTYLIDENE)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "281d65a8-8aff-4cc5-a0e0-e008c4d65c96"
          ],
          "display_name": false
        },
        {
          "uuid": "73100f50-1201-4659-98ac-0226b015dc2e",
          "name": "PHENOL, 4,4'-(1,3-DIMETHYLBUTYLIDENE)DI-",
          "stdName": "PHENOL, 4,4'-(1,3-DIMETHYLBUTYLIDENE)DI-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "281d65a8-8aff-4cc5-a0e0-e008c4d65c96"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ce3a7a5c-aa46-48b7-b4d2-6cebb4d26213",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "281d65a8-8aff-4cc5-a0e0-e008c4d65c96",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ec6efd5-f388-4b7c-b71a-af09b80c86c5",
          "citation": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=200907074060120750&q=J878.905C&t=7",
          "url": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=200907074060120750&q=J878.905C&t=7",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55da244b-feae-4eb0-b7b5-ba64c4914806",
          "citation": "http://echa.europa.eu/substance-information/-/substanceinfo/100.100.362",
          "url": "http://echa.europa.eu/substance-information/-/substanceinfo/100.100.362",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c29e26ea-b411-4846-a76e-c58f65bba3c8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392154000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ccb76a9-05c3-4453-ae1f-27f0eb0e08f6",
          "citation": "SRS import [J1B7N5N4M7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J1B7N5N4M7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392154000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad6ac411-5e1e-1f9c-46a1-8415d707ac1e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6807-17-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b70e1718-a54f-9aff-b689-1bb2bab34342",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "370cedd9-c851-4252-8376-6bbeae3e149d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f318b074-87c8-bc94-b255-282d9d128275",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "66eeab50-bf82-4c66-91fb-33c0639274f6",
          "id": "66eeab50-bf82-4c66-91fb-33c0639274f6",
          "molfile": "\n  Marvin  01132105212D          \n\n 20 21  0  0  0  0            999 V2000\n    2.7925   -0.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9927   -0.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4173    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7775   -1.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3528   -1.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9422   -1.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9422   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7223   -3.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3024   -3.9572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0975   -3.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6776   -4.3361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3174   -2.9516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7421   -2.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7635   -2.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9682   -2.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3789   -2.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5894   -3.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.3080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3846   -3.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9740   -3.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n 14  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n 13  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 20 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CC(C)(c1ccc(cc1)O)c2ccc(cc2)O",
          "formula": "C18H22O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9978fc9c-fea4-452f-8b55-7b9e52c1f1df"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.3668",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9a8b7d3e-feff-44e3-ba43-e52b4b6bbe2c",
      "version": "6",
      "structure": {
        "id": "ed50be11-c13f-4230-baa3-a55dafe519c8",
        "molfile": "\n  Marvin  01132112162D          \n\n 20 21  0  0  0  0            999 V2000\n    4.0975   -3.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6776   -4.3361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3024   -3.9572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3174   -2.9516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7421   -2.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7223   -3.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9422   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5894   -3.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.3080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3789   -2.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3846   -3.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9740   -3.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9682   -2.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7635   -2.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3528   -1.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7775   -1.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9927   -0.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7925   -0.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9422   -1.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4173    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  7  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7 15  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 14  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 19  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 20  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CC(C)(c1ccc(cc1)O)c2ccc(cc2)O",
        "formula": "C18H22O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.3668",
        "optical_activity": "NONE",
        "references": [
          "ce3a7a5c-aa46-48b7-b4d2-6cebb4d26213",
          "6ccb76a9-05c3-4453-ae1f-27f0eb0e08f6"
        ],
        "stereo_centers": 0
      },
      "unii": "J1B7N5N4M7"
    }
  ]
}