{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "89f6b446-7ccb-4b3d-a923-6d3e76a0094d",
          "code": "145899-87-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=145899-87-2",
          "code_system": "CAS",
          "references": [
            "36c08584-19ae-4d7a-84b9-f8e6646ece81",
            "20496cee-dd59-4aa1-8c70-3ee2ce704e70"
          ]
        },
        {
          "uuid": "2c420d88-5c35-4dc8-a2f0-48d37037035a",
          "code": "71587517",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587517",
          "code_system": "PUBCHEM",
          "references": [
            "36c08584-19ae-4d7a-84b9-f8e6646ece81"
          ]
        },
        {
          "uuid": "696ad663-6374-4569-8891-90a71322b2d9",
          "code": "J19165E26R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3ea16bd8-6cb8-65a0-6e50-c1df32a9a106",
          "code": "DTXSID30163172",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30163172",
          "code_system": "EPA CompTox",
          "references": [
            "3e36e11e-9967-2ff5-a19c-e45b0600b7d2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d7ad5946-2b88-4ea2-ae43-39cb04f872c2",
          "name": "26-NOROLEAN-8-EN-29-OIC ACID, 3-(3-CARBOXY-1-OXOPROPOXY)-13-METHYL-, DIPOTASSIUM SALT, (3.BETA.,13.ALPHA.,14.BETA.,20.BETA.)-",
          "stdName": "26-NOROLEAN-8-EN-29-OIC ACID, 3-(3-CARBOXY-1-OXOPROPOXY)-13-METHYL-, DIPOTASSIUM SALT, (3.BETA.,13.ALPHA.,14.BETA.,20.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fee7d8b-3952-42b9-aaf3-82ad8ec3c230",
            "f82a54f9-0886-4674-a525-9cf273e3b0c1"
          ],
          "display_name": false
        },
        {
          "uuid": "50edd2e6-8941-4865-9dd9-0532ec7fff1b",
          "name": "26-NOROLEAN-8-EN-29-OIC ACID, 3-(3-CARBOXY-1-OXOPROPOXY)-13-METHYL-, POTASSIUM SALT (1:2), (3.BETA.,13.ALPHA.,14.BETA.,20.BETA.)-",
          "stdName": "26-NOROLEAN-8-EN-29-OIC ACID, 3-(3-CARBOXY-1-OXOPROPOXY)-13-METHYL-, POTASSIUM SALT (1:2), (3.BETA.,13.ALPHA.,14.BETA.,20.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fee7d8b-3952-42b9-aaf3-82ad8ec3c230",
            "f82a54f9-0886-4674-a525-9cf273e3b0c1"
          ],
          "display_name": false
        },
        {
          "uuid": "b1ed04c4-be62-4ede-80c8-5516a2f0c7a6",
          "name": "3-SUCCINYLBRYONOLIC ACID DIPOTASSIUM SALT",
          "stdName": "3-SUCCINYLBRYONOLIC ACID DIPOTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fee7d8b-3952-42b9-aaf3-82ad8ec3c230",
            "f82a54f9-0886-4674-a525-9cf273e3b0c1"
          ],
          "display_name": false
        },
        {
          "uuid": "4780f92c-5ae4-4c24-804c-00c3930ea4f8",
          "name": "DIPOTASSIUM BRYONOLYL SUCCINATE",
          "stdName": "DIPOTASSIUM BRYONOLYL SUCCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6f3f37a-ea33-406f-82b2-a6091f883047",
            "ea926a37-f5a9-49e3-a815-e0ab8a92a6d9",
            "f82a54f9-0886-4674-a525-9cf273e3b0c1"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5e9e55a7-18ad-43d1-9cc9-e957d26fce4a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f87f048b-283a-4290-a851-be46e10146cb",
          "name": "STABILIZED BA",
          "stdName": "STABILIZED BA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea926a37-f5a9-49e3-a815-e0ab8a92a6d9",
            "f82a54f9-0886-4674-a525-9cf273e3b0c1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ea926a37-f5a9-49e3-a815-e0ab8a92a6d9",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f82a54f9-0886-4674-a525-9cf273e3b0c1",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fee7d8b-3952-42b9-aaf3-82ad8ec3c230",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36c08584-19ae-4d7a-84b9-f8e6646ece81",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392301000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b31f004-a475-453b-80ed-f4b659e113e1",
          "citation": "SRS import [J19165E26R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J19165E26R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392301000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6f3f37a-ea33-406f-82b2-a6091f883047",
          "citation": "DIPOTASSIUM BRYONOLYL SUCCINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f9774b26-3812-925e-55e5-a39401f5a9c9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=145899-87-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e36e11e-9967-2ff5-a19c-e45b0600b7d2",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "20496cee-dd59-4aa1-8c70-3ee2ce704e70",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b198b639-73e6-4a5a-93e0-d99eee410c9e",
          "id": "b198b639-73e6-4a5a-93e0-d99eee410c9e",
          "molfile": "\n  Marvin  01132109122D          \n\n  1  0  0  0  1  0            999 V2000\n   11.8745   -3.9946    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "b6cf2ac4-f82c-45c7-a9dc-52a7c723e7aa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "c32ec20e-ebff-47d0-b369-c324c0fb42ce",
          "id": "c32ec20e-ebff-47d0-b369-c324c0fb42ce",
          "molfile": "\n  Marvin  01132110052D          \n\n 40 44  0  0  1  0            999 V2000\n    5.1256   -7.3950    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.1256   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8401   -6.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5545   -6.5700    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.5545   -5.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2690   -6.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9835   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9835   -7.3950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2690   -7.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5545   -7.3950    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.8401   -7.8074    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2526   -8.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3098   -8.4394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6979   -6.1574    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.6979   -6.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4124   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1269   -6.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1269   -5.3324    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.8414   -5.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8414   -4.9200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8414   -4.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1269   -3.6824    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.6572   -3.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4124   -4.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4124   -4.9200    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.6979   -5.3324    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.6979   -4.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9835   -4.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2690   -5.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5966   -3.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8788   -2.2752    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.7841   -3.1937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4112   -7.8074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6967   -7.3950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9822   -7.8074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6967   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9822   -6.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9822   -5.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6967   -4.9200    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.2678   -4.9200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1 11  1  0  0  0  0\n  1 33  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n 10  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n 29  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 14  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 15  1  1  0  0  0\n 14 16  1  0  0  0  0\n 26 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 25 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  6  0  0  0\n 24 22  1  0  0  0  0\n 22 30  1  0  0  0  0\n 25 24  1  6  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  6  0  0  0\n 26 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 30 31  1  0  0  0  0\n 30 32  2  0  0  0  0\n 34 33  1  0  0  0  0\n 34 35  2  0  0  0  0\n 36 34  1  0  0  0  0\n 37 36  1  0  0  0  0\n 38 37  1  0  0  0  0\n 38 39  1  0  0  0  0\n 38 40  2  0  0  0  0\nM  CHG  2  31  -1  39  -1\nM  END",
          "smiles": "CC1(C)[C@@H]2CCC3=C(CC[C@@]4(C)[C@@H]5C[C@](C)(CC[C@]5(C)CC[C@]34C)C(=O)[O-])[C@@]2(C)CC[C@@H]1OC(=O)CCC(=O)[O-]",
          "formula": "C34H50O6",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d55b1e8c-9dd5-4598-8253-d8a11e72f9aa"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "554.7585",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f3b47848-e91b-41f1-84c3-1c9788b76d6c",
      "version": "7",
      "structure": {
        "id": "c83f38ee-0ec9-4dee-aa93-007400de26eb",
        "molfile": "\n  Marvin  01132110212D          \n\n 44 46  0  0  1  0            999 V2000\n    9.4124   -4.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1269   -3.6824    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.5966   -3.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8788   -2.2752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7841   -3.1937    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.6572   -3.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8414   -4.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8414   -4.9200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1269   -5.3324    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.8414   -5.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4124   -4.9200    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.4124   -5.7450    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6979   -5.3324    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.6979   -4.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9835   -4.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2690   -5.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2690   -6.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5545   -6.5700    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5545   -5.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8401   -6.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1256   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1256   -7.3950    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.4112   -7.8074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6967   -7.3950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6967   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9822   -6.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9822   -5.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6967   -4.9200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2678   -4.9200    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.9822   -7.8074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8401   -7.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2526   -8.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3098   -8.4394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5545   -7.3950    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.5545   -8.2200    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2690   -7.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9835   -7.3950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9835   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6979   -6.1574    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.6979   -6.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4124   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1269   -6.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8745   -3.9946    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n   11.8745   -3.9946    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  2  6  1  6  0  0  0\n  7  2  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  1  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  2  0  0  0  0\n 27 29  1  0  0  0  0\n 24 30  2  0  0  0  0\n 22 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\n 34 31  1  0  0  0  0\n 34 18  1  0  0  0  0\n 34 35  1  6  0  0  0\n 34 36  1  0  0  0  0\n 36 37  1  0  0  0  0\n 38 37  1  0  0  0  0\n 38 17  2  0  0  0  0\n 39 38  1  0  0  0  0\n 39 13  1  0  0  0  0\n 39 40  1  1  0  0  0\n 39 41  1  0  0  0  0\n  9 42  1  0  0  0  0\n 41 42  1  0  0  0  0\nM  CHG  4   5  -1  29  -1  43   1  44   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  43  44\nM  SPA   1  1  43\nM  SDI   1  4   11.4545   -4.4146   11.4545   -3.5746\nM  SDI   1  4   12.2945   -3.5746   12.2945   -4.4146\nM  SMT   1 2\nM  END",
        "smiles": "CC1(C)[C@]2([H])CCC3=C(CC[C@@]4(C)[C@]5([H])C[C@](C)(CC[C@]5(C)CC[C@]34C)C(=O)[O-])[C@@]2(C)CC[C@@H]1OC(=O)CCC(=O)[O-].[K+].[K+]",
        "formula": "C34H50O6.2K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "632.9551",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3fee7d8b-3952-42b9-aaf3-82ad8ec3c230",
          "3b31f004-a475-453b-80ed-f4b659e113e1"
        ],
        "stereo_centers": 8
      },
      "unii": "J19165E26R"
    }
  ]
}