{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5b07c9dd-5b6f-4132-8727-7e66ede01e83",
          "code": "7303-80-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7303-80-2",
          "code_system": "CAS",
          "references": [
            "b6cd38e3-591c-49e9-ae30-fccdd5063e59",
            "993eeac4-5716-4987-8a48-8ee939a42a29"
          ]
        },
        {
          "uuid": "0832b479-37ff-4641-9157-97e28a5dc950",
          "code": "439713",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439713",
          "code_system": "PUBCHEM",
          "references": [
            "b6cd38e3-591c-49e9-ae30-fccdd5063e59"
          ]
        },
        {
          "uuid": "ca4d0673-45b6-4dc2-8a7a-dfd433edfe04",
          "code": "J120C6NTXH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ad50ee75-a034-973b-9fe3-694628e8be64",
          "code": "DTXSID30904502",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30904502",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "9e656bd5-d5e1-44a8-bf53-b2a5a20f5a69",
          "amount": {
            "uuid": "fec8942c-b32f-42a9-9a47-1ff29a7ec534"
          },
          "type": "RACEMATE->ENANTIOMER",
          "references": [
            "fef66976-d9da-443f-a9e9-9b4f1f7c127d"
          ],
          "related_substance": {
            "uuid": "734553bf-1cd3-41f9-9a09-f3668f163aba",
            "refuuid": "d108ef9f-3e3b-4676-a367-2b1283068899",
            "name": "Allantoin",
            "unii": "344S277G0Z",
            "linking_id": "344S277G0Z",
            "ref_pname": "Allantoin",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7d168b28-2183-4992-b7e0-1ae2b59ccef4",
          "name": "(-)-ALLANTOIN",
          "stdName": "(-)-ALLANTOIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f84d8d2d-c79a-4816-bb50-6c6e66ee8b22",
            "9fe0c4f5-43af-405d-ac29-c79056a59290"
          ],
          "display_name": false
        },
        {
          "uuid": "070643ef-6b82-471f-9378-f3c2214c3869",
          "name": "ALLANTOIN, (-)-",
          "stdName": "ALLANTOIN, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f259ec1-b8f6-4301-9837-ea75435bb95a",
            "f84d8d2d-c79a-4816-bb50-6c6e66ee8b22"
          ],
          "display_name": false
        },
        {
          "uuid": "e8ca13b0-bf7a-4904-b62e-ea85d68e8f48",
          "name": "Allantoin, (R)-",
          "stdName": "ALLANTOIN, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "993eeac4-5716-4987-8a48-8ee939a42a29"
          ],
          "display_name": true
        },
        {
          "uuid": "2c6ae2c7-ee99-47ab-94a3-b15ce86be55f",
          "name": "Allantoin, (R)-(-)-",
          "stdName": "ALLANTOIN, (R)-(-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f84d8d2d-c79a-4816-bb50-6c6e66ee8b22",
            "9fe0c4f5-43af-405d-ac29-c79056a59290"
          ],
          "display_name": false
        },
        {
          "uuid": "f3c39391-bc15-4423-8743-2d4ae130dcaa",
          "name": "Urea, N-[(4R)-2,5-dioxo-4-imidazolidinyl]-",
          "stdName": "UREA, N-((4R)-2,5-DIOXO-4-IMIDAZOLIDINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f84d8d2d-c79a-4816-bb50-6c6e66ee8b22",
            "9fe0c4f5-43af-405d-ac29-c79056a59290"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6f259ec1-b8f6-4301-9837-ea75435bb95a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f84d8d2d-c79a-4816-bb50-6c6e66ee8b22",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9fe0c4f5-43af-405d-ac29-c79056a59290",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6cd38e3-591c-49e9-ae30-fccdd5063e59",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bca0db1e-7399-4137-81ff-9623b9ed1cb6",
          "citation": "SRS import [J120C6NTXH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=J120C6NTXH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "993eeac4-5716-4987-8a48-8ee939a42a29",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fef66976-d9da-443f-a9e9-9b4f1f7c127d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d8ce55b4-abe5-46fb-8dd1-4475a14e7e5b",
          "id": "d8ce55b4-abe5-46fb-8dd1-4475a14e7e5b",
          "molfile": "\n  Marvin  01132111142D          \n\n 11 11  0  0  1  0            999 V2000\n   10.9175   -6.7991    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.6336   -6.3764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6819   -5.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4292   -5.1986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9952   -5.1014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1300   -6.5491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6466   -7.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8175   -7.2116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1383   -7.8866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9175   -7.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6300   -8.0366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  6  1  1  0  0  0  0\n  1 10  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\nM  END",
          "smiles": "[C@@H]1(C(=O)NC(=O)N1)NC(=O)N",
          "formula": "C4H6N4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "18ef9393-fefb-45db-b4f0-df14ba6c06bb"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "158.1156",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "488e49aa-bdb5-44a7-89f0-2814addcbc02",
      "version": "5",
      "structure": {
        "id": "11d7ff81-9e6f-41ab-88d1-e67e84f2b24e",
        "molfile": "\n  Marvin  01132101092D          \n\n 11 11  0  0  1  0            999 V2000\n   10.1383   -7.8866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6466   -7.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1300   -6.5491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9175   -6.7991    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.9175   -7.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6300   -8.0366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6336   -6.3764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6819   -5.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9952   -5.1014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4292   -5.1986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8175   -7.2116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  2  0  0  0  0\n  4  7  1  1  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11  2  2  0  0  0  0\nM  END",
        "smiles": "[C@@H]1(C(=O)NC(=O)N1)NC(=O)N",
        "formula": "C4H6N4O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "158.1156",
        "optical_activity": "( - )",
        "references": [
          "9fe0c4f5-43af-405d-ac29-c79056a59290",
          "bca0db1e-7399-4137-81ff-9623b9ed1cb6"
        ],
        "stereo_centers": 1
      },
      "unii": "J120C6NTXH"
    }
  ]
}