{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c632e541-fd87-44b3-b66f-3191e2220f35", "code": "474510-57-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=474510-57-1", "code_system": "CAS", "references": [ "ee4c6cff-ad5e-4eb3-b77c-59a1f6e6fc7d", "f2565ec7-0898-4eb2-b70a-d32401afd01a" ] }, { "uuid": "8a4a5ee6-81d7-4e09-81fc-7af54f4f33b8", "code": "22019754", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22019754", "code_system": "PUBCHEM", "references": [ "ee4c6cff-ad5e-4eb3-b77c-59a1f6e6fc7d" ] }, { "uuid": "c3a600cc-8809-0177-eb45-bcbdfc7939f9", "code": "DTXSID40621591", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40621591", "code_system": "EPA CompTox", "references": [ "0a09dbb3-1f42-a74e-41e0-1629245e3c7c" ] }, { "uuid": "b2fb779a-187f-4f82-b3d4-eff1a2d96177", "code": "IZJ9BVRDO7", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "28cd40db-9558-4820-a549-dd3feace1c61", "name": "1-PROPANONE, 1,1'-(METHYLENE-DI-4,1-PHENYLENE)BIS(2-HYDROXY-2-METHYL-", "stdName": "1-PROPANONE, 1,1'-(METHYLENE-DI-4,1-PHENYLENE)BIS(2-HYDROXY-2-METHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ec92dc7c-1402-4ee3-aef2-3549381e29dd" ], "display_name": false }, { "uuid": "31996302-274b-4ef3-aa2b-cbb079361ed8", "name": "BIS(4-(2-HYDROXY-2-METHYLPROPIONYL)PHENYL)METHANE", "stdName": "BIS(4-(2-HYDROXY-2-METHYLPROPIONYL)PHENYL)METHANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0d25e93d-398f-4bbe-0f61-17ee5da28c6a" ], "display_name": true } ], "references": [ { "uuid": "ec92dc7c-1402-4ee3-aef2-3549381e29dd", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ee4c6cff-ad5e-4eb3-b77c-59a1f6e6fc7d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392015000, "tags": [ "NOMEN" ] }, { "uuid": "0d25e93d-398f-4bbe-0f61-17ee5da28c6a", "citation": "Scifinder", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0a09dbb3-1f42-a74e-41e0-1629245e3c7c", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=474510-57-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f2565ec7-0898-4eb2-b70a-d32401afd01a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "accba8e9-fccf-4894-854f-8b9df7f5056e", "id": "accba8e9-fccf-4894-854f-8b9df7f5056e", "molfile": "\n Marvin 01132108582D \n\n 25 26 0 0 0 0 999 V2000\n 1.1285 -2.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7203 -2.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3041 -1.3526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4326 -1.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4326 -0.8244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1529 -2.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8732 -1.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5855 -2.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5855 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3058 -3.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0261 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7385 -3.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4587 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4587 -2.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7385 -1.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0261 -2.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1710 -1.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8914 -2.0729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1710 -0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3467 -0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1710 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0034 -0.8244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8732 -3.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1529 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 5 2 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 5 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 25 2 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 24 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 17 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 18 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 20 23 1 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "CC(C)(C(=O)c1ccc(cc1)Cc2ccc(cc2)C(=O)C(C)(C)O)O", "formula": "C21H24O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cadfc7ec-9ea0-46e3-89b3-724a066a2bfc" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "340.4137", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "62edaac4-8f1d-4c87-8711-62b8eb2f063b", "version": "6", "structure": { "id": "e3414ad3-1a17-46ce-8ba9-9a8540125dd7", "molfile": "\n Marvin 01132111462D \n\n 25 26 0 0 0 0 999 V2000\n 4.3058 -3.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1529 -2.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8732 -1.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5855 -2.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5855 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8732 -3.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1529 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4587 -2.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4587 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7385 -3.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0261 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0261 -2.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7385 -1.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4326 -1.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7203 -2.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1285 -2.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4326 -0.8244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3041 -1.3526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1710 -1.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1710 -0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3467 -0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8914 -2.0729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1710 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0034 -0.8244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 5 1 0 0 0 0\n 1 11 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 7 2 0 0 0 0\n 2 14 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 13 2 0 0 0 0\n 8 20 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 17 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 18 1 0 0 0 0\n 15 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 23 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 24 1 0 0 0 0\n 21 25 1 0 0 0 0\nM END", "smiles": "CC(C)(C(=O)c1ccc(cc1)Cc2ccc(cc2)C(=O)C(C)(C)O)O", "formula": "C21H24O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "340.4137", "optical_activity": "NONE", "references": [ "ec92dc7c-1402-4ee3-aef2-3549381e29dd" ], "stereo_centers": 0 }, "unii": "IZJ9BVRDO7" } ] }