{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9ff5a721-2955-4c67-89b6-b44933c1c055",
          "code": "84-69-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=84-69-5",
          "code_system": "CAS",
          "references": [
            "92b72671-88b0-4bb4-995e-7b0060843f6e",
            "6904d47c-a755-4fd8-904d-caa3ee09d8f2"
          ]
        },
        {
          "uuid": "48f5fcb7-02fc-464b-a425-e830c7ee103b",
          "code": "C025605",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67025605",
          "code_system": "MESH",
          "references": [
            "92b72671-88b0-4bb4-995e-7b0060843f6e"
          ]
        },
        {
          "uuid": "b6a25bcc-6904-44f5-92df-c523bccae168",
          "code": "DIISOBUTYL PHTHALATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diisobutyl_phthalate",
          "code_system": "WIKIPEDIA",
          "references": [
            "92b72671-88b0-4bb4-995e-7b0060843f6e"
          ]
        },
        {
          "uuid": "65408c11-fce0-4cfa-9732-9546c66ed84f",
          "code": "201-553-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.412",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "92b72671-88b0-4bb4-995e-7b0060843f6e"
          ]
        },
        {
          "uuid": "3adc6166-dc8a-4dfc-92d8-49873685f7f3",
          "code": "6782",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6782",
          "code_system": "PUBCHEM",
          "references": [
            "92b72671-88b0-4bb4-995e-7b0060843f6e"
          ]
        },
        {
          "uuid": "eb09b642-3686-2675-017d-58a18f6e1008",
          "code": "5247",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5247",
          "code_system": "HSDB",
          "references": [
            "05da84fc-cb3c-11e9-9c51-d5a726fd21e0"
          ]
        },
        {
          "uuid": "7a2da0d0-18a4-e967-e618-815ca3a60b4b",
          "code": "DTXSID9022522",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9022522",
          "code_system": "EPA CompTox",
          "references": [
            "e83586d2-51c0-c9ae-47e3-510793281154"
          ]
        },
        {
          "uuid": "36b9915e-dce2-4138-ab60-fd4dece442c8",
          "code": "IZ67FTN290",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8fea5469-d57b-4be1-84a8-5f4a6e101493",
          "code": "79053",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:79053",
          "code_system": "CHEBI",
          "references": [
            "abc8c1aa-398a-a213-c0d2-bf50d3c62018"
          ]
        },
        {
          "uuid": "73996082-5573-ade3-ff9b-3726f01b3b4f",
          "code": "300000018745",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ee88ef54-843c-c478-6749-e1c5b5fef594"
          ]
        },
        {
          "uuid": "855e0741-0707-4ff5-2331-ff74e0494fa1",
          "code": "15316",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=15316",
          "code_system": "NSC",
          "references": [
            "4628fd95-58cb-24ff-6b33-820f1a42f5e1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "819673c3-3197-4085-bd8d-19e43c6d1d5e",
          "name": "DIISOBUTYL PHTHALATE",
          "stdName": "DIISOBUTYL PHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d12500b7-81a3-48eb-a6fa-2f7847fd561a",
            "c345f16b-0a7b-4b17-99be-ac037cedc3a0"
          ],
          "display_name": true
        },
        {
          "uuid": "0a9ddd9a-ab92-412f-ad2a-3a2ea549514a",
          "name": "NSC-15316",
          "stdName": "NSC-15316",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d12500b7-81a3-48eb-a6fa-2f7847fd561a",
            "c345f16b-0a7b-4b17-99be-ac037cedc3a0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c345f16b-0a7b-4b17-99be-ac037cedc3a0",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d12500b7-81a3-48eb-a6fa-2f7847fd561a",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92b72671-88b0-4bb4-995e-7b0060843f6e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391628000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae0a015b-bf96-4ba3-ad9a-8474a2900d4a",
          "citation": "SRS import [IZ67FTN290]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IZ67FTN290",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391628000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82983c4e-ff6e-41e5-9b5a-50b0d73d8ff3",
          "citation": "CHEMID RECORD 84-69-5",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05da84fc-cb3c-11e9-9c51-d5a726fd21e0",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+84-69-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e83586d2-51c0-c9ae-47e3-510793281154",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=84-69-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "abc8c1aa-398a-a213-c0d2-bf50d3c62018",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6904d47c-a755-4fd8-904d-caa3ee09d8f2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4628fd95-58cb-24ff-6b33-820f1a42f5e1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ee88ef54-843c-c478-6749-e1c5b5fef594",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "24fb3c5a-21f4-41d3-9a9a-bda72e54e89a",
          "id": "24fb3c5a-21f4-41d3-9a9a-bda72e54e89a",
          "molfile": "\n  Marvin  01132102032D          \n\n 20 20  0  0  0  0            999 V2000\n    3.3094    1.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8876    0.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3094    0.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0626    0.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6482    0.0688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8194    0.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4088    0.7842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4088   -0.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8194   -1.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4088   -2.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4088   -2.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8194   -1.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4088   -0.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8194    0.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4088    0.7842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6482    0.0688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0644    0.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8876    0.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3057    1.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3057    0.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
          "smiles": "CC(C)COC(=O)c1ccccc1C(=O)OCC(C)C",
          "formula": "C16H22O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c3ed5ea4-1c72-4e85-8db9-0165b93bdc91"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "278.3441",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a394e70f-86f1-497f-b240-e0bbfa23e27f",
      "version": "7",
      "structure": {
        "id": "a7581f60-9db9-4966-995e-0141e17b4588",
        "molfile": "\n  Marvin  01132108412D          \n\n 20 20  0  0  0  0            999 V2000\n    0.4088   -0.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4088   -0.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8194    0.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8194   -1.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8194    0.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8194   -1.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6482    0.0688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4088    0.7842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4088   -2.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6482    0.0688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4088    0.7842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4088   -2.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0626    0.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0644    0.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8876    0.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8876    0.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3094    1.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3094    0.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3057    1.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3057    0.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6 12  2  0  0  0  0\n  7 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 16 20  1  0  0  0  0\n  9 12  1  0  0  0  0\nM  END",
        "smiles": "CC(C)COC(=O)c1ccccc1C(=O)OCC(C)C",
        "formula": "C16H22O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "278.3441",
        "optical_activity": "NONE",
        "references": [
          "ae0a015b-bf96-4ba3-ad9a-8474a2900d4a",
          "82983c4e-ff6e-41e5-9b5a-50b0d73d8ff3"
        ],
        "stereo_centers": 0
      },
      "unii": "IZ67FTN290"
    }
  ]
}