{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "58ab54b1-205b-4278-bfd6-f1318f0e0131",
          "code": "NOOTKATONE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=3982",
          "code_system": "JECFA EVALUATION",
          "references": [
            "963634d6-9ef7-46f4-a8a6-4d4622402ecd"
          ]
        },
        {
          "uuid": "61a0282b-caf2-4897-bee3-673e3856357a",
          "code": "4674-50-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4674-50-4",
          "code_system": "CAS",
          "references": [
            "963634d6-9ef7-46f4-a8a6-4d4622402ecd",
            "0a426ad4-2402-4a4b-bfa9-8dce539b9014"
          ]
        },
        {
          "uuid": "fd3a0360-717c-415b-b38a-916ee426619a",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "963634d6-9ef7-46f4-a8a6-4d4622402ecd"
          ]
        },
        {
          "uuid": "5be23d8d-59af-4d84-afca-c6258ec98ca7",
          "code": "NOOTKATONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Nootkatone",
          "code_system": "WIKIPEDIA",
          "references": [
            "963634d6-9ef7-46f4-a8a6-4d4622402ecd"
          ]
        },
        {
          "uuid": "9fe79ecb-9770-4c67-bbba-0bfdc2be9ee2",
          "code": "m8040",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8040?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "963634d6-9ef7-46f4-a8a6-4d4622402ecd"
          ]
        },
        {
          "uuid": "d3856668-3c9a-43a1-a653-78429c35cbaf",
          "code": "SUB184201",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "963634d6-9ef7-46f4-a8a6-4d4622402ecd"
          ]
        },
        {
          "uuid": "77188c57-3b4b-4eb9-a7e5-b927d72ca481",
          "code": "225-124-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.840",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "963634d6-9ef7-46f4-a8a6-4d4622402ecd"
          ]
        },
        {
          "uuid": "308a128a-5def-4ec4-8036-0a77e01218f9",
          "code": "1268142",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1268142",
          "code_system": "PUBCHEM",
          "references": [
            "963634d6-9ef7-46f4-a8a6-4d4622402ecd"
          ]
        },
        {
          "uuid": "6ef85816-b5f5-c6e7-a176-d27c3d55a17c",
          "code": "8272",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8272",
          "code_system": "HSDB",
          "references": [
            "d223d17f-1ad2-c4b9-c197-25e45684050f"
          ]
        },
        {
          "uuid": "57d22dc2-501c-e500-cd77-c74f0c1bbab9",
          "code": "DTXSID8047050",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8047050",
          "code_system": "EPA CompTox",
          "references": [
            "5bfd583a-d000-736a-98eb-4985b046dfdf"
          ]
        },
        {
          "uuid": "a0605e7d-3f13-4743-a040-a754f5f344fb",
          "code": "IZ2Y119N4J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "403530e7-2732-5291-a442-d9f839d1261f",
          "code": "81377",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81377",
          "code_system": "CHEBI",
          "references": [
            "771b8808-f32a-c492-da78-550382fb13d6"
          ]
        },
        {
          "uuid": "659d3cb3-3533-4131-8f41-021cdddbf6ae",
          "code": "100000170314",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6f777c26-b112-f7c1-a261-8e45370cb643"
          ]
        },
        {
          "uuid": "e9bbf28c-df5c-dba1-a388-a6b656565801",
          "code": "1397",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1397/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "36394e28-9a69-d9a0-c137-1d5df2f5a9e6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f2420c1d-271c-43f3-9e87-9a871cddc06a",
          "name": "(+)-NOOTKATONE",
          "stdName": "(+)-NOOTKATONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dabb1cb9-bf47-488b-8036-a7cb4ca4a904",
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a"
          ],
          "display_name": false
        },
        {
          "uuid": "dc8cdfda-b2ec-40a1-9f72-30d25ec0aba4",
          "name": "2(3H)-NAPHTHALENONE, 4,4A,5,6,7,8-HEXAHYDRO-4,4A-DIMETHYL-6-(1-METHYLETHENYL)-, (4R,4AS,6R)-",
          "stdName": "2(3H)-NAPHTHALENONE, 4,4A,5,6,7,8-HEXAHYDRO-4,4A-DIMETHYL-6-(1-METHYLETHENYL)-, (4R,4AS,6R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dabb1cb9-bf47-488b-8036-a7cb4ca4a904",
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a"
          ],
          "display_name": false
        },
        {
          "uuid": "e8aa5590-5ea9-4e51-94b4-c5c5e2d048ce",
          "name": "2(3H)-NAPHTHALENONE, 4,4A,5,6,7,8-HEXAHYDRO-4,4A-DIMETHYL-6-(1-METHYLETHENYL)-, (4R-(4.ALPHA.,4A.ALPHA.,6.BETA.))-",
          "stdName": "2(3H)-NAPHTHALENONE, 4,4A,5,6,7,8-HEXAHYDRO-4,4A-DIMETHYL-6-(1-METHYLETHENYL)-, (4R-(4.ALPHA.,4A.ALPHA.,6.BETA.))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dabb1cb9-bf47-488b-8036-a7cb4ca4a904",
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a"
          ],
          "display_name": false
        },
        {
          "uuid": "2726bede-4619-42a5-a11b-ff4f9335d411",
          "name": "4,4A,5,6,7,8-HEXAHYDRO-4,4A-DIMETHYL-6-(1-METHYLENE-ETHYL)-2(3H)-NAPHTHALENONE",
          "stdName": "4,4A,5,6,7,8-HEXAHYDRO-4,4A-DIMETHYL-6-(1-METHYLENE-ETHYL)-2(3H)-NAPHTHALENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a",
            "7cb6705b-8fb3-4a37-91d6-441270cfd0c1"
          ],
          "display_name": false
        },
        {
          "uuid": "845e05f2-8df4-4b87-86d3-edc41a6d8b80",
          "name": "4,4A,5,6,7,8-HEXAHYDRO-6-ISO-PROPENYL-4,4A-DIMETHYL-2(3H)-NAPHTHALENONE",
          "stdName": "4,4A,5,6,7,8-HEXAHYDRO-6-ISO-PROPENYL-4,4A-DIMETHYL-2(3H)-NAPHTHALENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a",
            "7cb6705b-8fb3-4a37-91d6-441270cfd0c1"
          ],
          "display_name": false
        },
        {
          "uuid": "93cf0fef-648c-4839-9dbd-43c1eb8a32ba",
          "name": "4.BETA.H,5.ALPHA.-EREMOPHILA-1(10),11-DIEN-2-ONE",
          "stdName": "4.BETA.H,5.ALPHA.-EREMOPHILA-1(10),11-DIEN-2-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dabb1cb9-bf47-488b-8036-a7cb4ca4a904",
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a"
          ],
          "display_name": false
        },
        {
          "uuid": "f0d10256-316f-4d49-adc2-095b54a3828b",
          "name": "5,6-DIMETHYL-8-ISOPROPENYL-BICYCLO(4,4,0)-DEC-1-EN-3-ONE",
          "stdName": "5,6-DIMETHYL-8-ISOPROPENYL-BICYCLO(4,4,0)-DEC-1-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3198fd6-8417-41d7-85bf-184799f3c196",
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a"
          ],
          "display_name": false
        },
        {
          "uuid": "f3894f35-6e8a-6ced-a680-1747bfef2882",
          "name": "FEMA NO. 4941",
          "stdName": "FEMA NO. 4941",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06e519b9-5370-a54f-3d87-30510a6ab6f0",
            "acf54143-6ef8-b2d4-ba0f-e7b1c7cc1316"
          ],
          "display_name": false
        },
        {
          "uuid": "2f5f266c-62ef-440d-999c-0b600d33330d",
          "name": "NOOTKANONE",
          "stdName": "NOOTKANONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dabb1cb9-bf47-488b-8036-a7cb4ca4a904",
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a"
          ],
          "display_name": false
        },
        {
          "uuid": "c02b37b5-759d-49c0-ae8f-d1a4443c9d45",
          "name": "NOOTKATONE",
          "stdName": "NOOTKATONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "640a95b2-ae31-456d-8681-3f70d022c1c7",
            "edf35473-aba9-43ff-9f84-c74398e86feb",
            "529ec0bf-d386-4b9d-927b-d457688d720a",
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a",
            "070a91a2-47b6-4543-8ffc-c2750f188021",
            "57618102-53d9-449e-a2b1-ac192a14d017"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "854b4fd5-26c6-4664-8f3e-c36b1773880f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cef6f3eb-84fa-45e5-904d-0e0c39cbc12a",
          "name": "NOOTKATONE [FHFI]",
          "stdName": "NOOTKATONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a",
            "070a91a2-47b6-4543-8ffc-c2750f188021"
          ],
          "display_name": false
        },
        {
          "uuid": "a63be410-b850-4523-9aed-60a4a34c29ad",
          "name": "NOOTKATONE [MI]",
          "stdName": "NOOTKATONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edf35473-aba9-43ff-9f84-c74398e86feb",
            "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "640a95b2-ae31-456d-8681-3f70d022c1c7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f0a3f15f-00e5-4cbe-bd24-fe142b974c4a",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dabb1cb9-bf47-488b-8036-a7cb4ca4a904",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cb6705b-8fb3-4a37-91d6-441270cfd0c1",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "070a91a2-47b6-4543-8ffc-c2750f188021",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3198fd6-8417-41d7-85bf-184799f3c196",
          "citation": "YES",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "edf35473-aba9-43ff-9f84-c74398e86feb",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "963634d6-9ef7-46f4-a8a6-4d4622402ecd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391383000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f80c99b-fd77-4177-9db5-2046a8555a3d",
          "citation": "SRS import [IZ2Y119N4J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IZ2Y119N4J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391383000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57618102-53d9-449e-a2b1-ac192a14d017",
          "citation": "NOOTKATONE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "529ec0bf-d386-4b9d-927b-d457688d720a",
          "citation": "NOOTKATONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d223d17f-1ad2-c4b9-c197-25e45684050f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+4674-50-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5bfd583a-d000-736a-98eb-4985b046dfdf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4674-50-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "acf54143-6ef8-b2d4-ba0f-e7b1c7cc1316",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "06e519b9-5370-a54f-3d87-30510a6ab6f0",
          "citation": "FHFI",
          "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0a426ad4-2402-4a4b-bfa9-8dce539b9014",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "771b8808-f32a-c492-da78-550382fb13d6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6f777c26-b112-f7c1-a261-8e45370cb643",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "36394e28-9a69-d9a0-c137-1d5df2f5a9e6",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e1ca4d05-5b10-475a-a756-341ff6383a94",
          "id": "e1ca4d05-5b10-475a-a756-341ff6383a94",
          "molfile": "\n  Marvin  01132111412D          \n\n 16 17  0  0  1  0            999 V2000\n    7.7911   -5.3868    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.7911   -6.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5047   -4.9727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5047   -4.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2183   -3.7305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7911   -3.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0775   -4.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3640   -3.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6504   -4.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6504   -4.9727    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.3640   -5.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0775   -4.9727    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.0775   -5.7656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9368   -5.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2144   -4.9727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9368   -6.2237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 12  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 12  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 14  1  6  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\nM  END",
          "smiles": "C=C(C)[C@@H]1CCC2=CC(=O)C[C@@H](C)[C@]2(C)C1",
          "formula": "C15H22O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6b741396-00e2-4a0c-89df-110b3a428703"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "218.3351",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7fd2c460-2b2b-4dd6-bc1c-80c87104d8bb",
      "version": "13",
      "structure": {
        "id": "47bb8787-a613-4b9d-bb6f-c96e997e5749",
        "molfile": "2(1H)-Naphthalenone, octahydro-4,4a-dimethyl-6-(1-methylethyl)-, (4R,4aS,6R,8...\n  Marvin  01132103462D          \n\n 16 17  0  0  1  0            999 V2000\n   14.9053   -3.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9053   -4.0701    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.9053   -4.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1908   -5.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4764   -4.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4764   -4.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1908   -3.6575    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.1908   -2.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7619   -5.3075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -5.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -4.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -4.0701    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.6197   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0487   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7631   -4.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0487   -2.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  5  9  2  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n  2 13  1  0  0  0  0\n 12 14  1  6  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
        "smiles": "C=C(C)[C@@H]1CCC2=CC(=O)C[C@@H](C)[C@]2(C)C1",
        "formula": "C15H22O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "218.3351",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0f80c99b-fd77-4177-9db5-2046a8555a3d",
          "dabb1cb9-bf47-488b-8036-a7cb4ca4a904",
          "acf54143-6ef8-b2d4-ba0f-e7b1c7cc1316",
          "06e519b9-5370-a54f-3d87-30510a6ab6f0"
        ],
        "stereo_centers": 3
      },
      "unii": "IZ2Y119N4J"
    }
  ]
}