{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "51fc14ed-7da6-4feb-a34f-2a25617e0855", "code": "1248-18-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1248-18-6", "code_system": "CAS", "references": [ "702c4555-f438-4b9f-b7d7-f3141418c22d", "3a555e15-1890-439a-be06-86f43d2b8532" ] }, { "uuid": "69282bc4-3d4f-40ab-9216-48192eb96798", "code": "214-998-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.013.635", "code_system": "ECHA (EC/EINECS)", "references": [ "702c4555-f438-4b9f-b7d7-f3141418c22d" ] }, { "uuid": "356e9f23-4eb8-d883-ad8a-9b2367c92c24", "code": "DTXSID2021230", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2021230", "code_system": "EPA CompTox", "references": [ "d5a92e77-25b9-d174-fa08-bfafa3834cf5" ] }, { "uuid": "4d570334-61ef-453e-a762-a9924a527e33", "code": "IY4YV0PVDA", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "3eb767ca-f6ed-43be-9184-1340b626e521", "name": "1-NAPHTHALENESULFONIC ACID, 2-((2-HYDROXY-1-NAPHTHALENYL)AZO)-, MONOSODIUM SALT", "stdName": "1-NAPHTHALENESULFONIC ACID, 2-((2-HYDROXY-1-NAPHTHALENYL)AZO)-, MONOSODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "3823f9c6-63d1-411f-9f7e-b6baca33b20a" ], "display_name": false }, { "uuid": "e8730151-fc2b-4fff-b82a-dd879b595be1", "name": "1-NAPHTHALENESULFONIC ACID, 2-(2-(2-HYDROXY-1-NAPHTHALENYL)DIAZENYL)-, SODIUM SALT (1:1)", "stdName": "1-NAPHTHALENESULFONIC ACID, 2-(2-(2-HYDROXY-1-NAPHTHALENYL)DIAZENYL)-, SODIUM SALT (1:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "3823f9c6-63d1-411f-9f7e-b6baca33b20a" ], "display_name": false }, { "uuid": "2a6c4ef4-3629-44d2-a7ad-a95dc7f199e8", "name": "AKA205", "stdName": "AKA205", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "ae7e3bcb-a552-477a-91e2-b10693160bf3", "fee163e4-985c-4b02-8c30-d4113759fcd5" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "720de9af-db2e-4a28-b130-3397e3188bbd", "name_org": "INCI" } ] }, { "uuid": "fe72489d-1037-4263-abc8-624444c4f1a0", "name": "ATUL PIGMENT RED RS SODIUM SALT", "stdName": "ATUL PIGMENT RED RS SODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "3823f9c6-63d1-411f-9f7e-b6baca33b20a" ], "display_name": false }, { "uuid": "57e7ef9a-7a6b-4ea4-bc46-4ffa0d269bca", "name": "C.I. 15630", "stdName": "C.I. 15630", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "3823f9c6-63d1-411f-9f7e-b6baca33b20a" ], "display_name": false }, { "uuid": "e8463b7f-24b7-4652-955b-9e723f54a93d", "name": "C.I. PIGMENT RED 49", "stdName": "C.I. PIGMENT RED 49", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "c2309a5f-8062-4918-8c3e-455f540391dc" ], "display_name": false }, { "uuid": "f40f801a-9b3d-43a6-9cdd-ebb3d394f72f", "name": "CI 15630", "stdName": "CI 15630", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "fee163e4-985c-4b02-8c30-d4113759fcd5", "23d9cdf7-afe1-4413-81cc-d0a1e804a283" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "409bbdfc-842b-457f-a63c-49f93e381ee6", "name_org": "INCI" } ] }, { "uuid": "6646a173-4d66-441c-b57f-62fb217eecc6", "name": "D&C RED NO. 10 (DELISTED)", "stdName": "D&C RED NO. 10 (DELISTED)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "a6a23798-5c12-412f-89cf-00e8ce7bb1af" ], "display_name": false }, { "uuid": "ae1d6d84-b519-421f-9ec5-382314db5a01", "name": "ENIALIT RED R", "stdName": "ENIALIT RED R", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "3823f9c6-63d1-411f-9f7e-b6baca33b20a" ], "display_name": false }, { "uuid": "1c141a2c-550f-4159-bb16-4f334c8a1d72", "name": "EXT. D&C RED NO. 10", "stdName": "EXT. D&C RED NO. 10", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "2def9367-b9f9-41af-afe2-071e5e680c29" ], "display_name": false }, { "uuid": "aaa55520-762c-4060-9574-09458905c047", "name": "EXT. D&C RED NO. 10 (DELISTED)", "stdName": "EXT. D&C RED NO. 10 (DELISTED)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "a6a23798-5c12-412f-89cf-00e8ce7bb1af" ], "display_name": false }, { "uuid": "5bd249d7-b8a5-4e1d-939d-0ec8ff8cf04e", "name": "LITHOL RED", "stdName": "LITHOL RED", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "c2309a5f-8062-4918-8c3e-455f540391dc" ], "display_name": false }, { "uuid": "caabd0ad-4b8f-4a62-9f80-43b84bf3b1dc", "name": "PIGMENT RED 49", "stdName": "PIGMENT RED 49", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0613f6af-4456-4ac1-b99c-caf2764530c0", "29564ab8-b10d-40ef-ac22-96956952d226" ], "display_name": true }, { "uuid": "35304ce6-3c0b-44ce-ae15-1b4f8b8cefef", "name": "RED NO. 205", "stdName": "RED NO. 205", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "fee163e4-985c-4b02-8c30-d4113759fcd5" ], "display_name": false }, { "uuid": "b2abc312-dd39-4d13-8e6b-2ef57b6b76c3", "name": "RESAMINE RED RC", "stdName": "RESAMINE RED RC", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "3823f9c6-63d1-411f-9f7e-b6baca33b20a" ], "display_name": false }, { "uuid": "e2179b12-f154-4eeb-a3ce-7431c7b39f2b", "name": "RW LITHOL RED R", "stdName": "RW LITHOL RED R", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "3166d83c-5ba3-4592-b0a6-31f36c66f51d" ], "display_name": false }, { "uuid": "89b5295a-f877-43f6-b90c-8954d9d0719b", "name": "SODIUM LITHOL", "stdName": "SODIUM LITHOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "29564ab8-b10d-40ef-ac22-96956952d226", "fee163e4-985c-4b02-8c30-d4113759fcd5" ], "display_name": false } ], "references": [ { "uuid": "3823f9c6-63d1-411f-9f7e-b6baca33b20a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "29564ab8-b10d-40ef-ac22-96956952d226", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a6a23798-5c12-412f-89cf-00e8ce7bb1af", "citation": "CFR", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fee163e4-985c-4b02-8c30-d4113759fcd5", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3166d83c-5ba3-4592-b0a6-31f36c66f51d", "citation": "Advanced Technology & Industrial - International Laboratory Catalog", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0613f6af-4456-4ac1-b99c-caf2764530c0", "citation": "BOC Sciences Product List", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c2309a5f-8062-4918-8c3e-455f540391dc", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2def9367-b9f9-41af-afe2-071e5e680c29", "citation": "http://www.ddwilliamson.com/EditorUpload/File/regulatory/North%20America/USA%20FDA%20Color%20Additiv", "url": "http://www.ddwilliamson.com/EditorUpload/File/regulatory/North%20America/USA%20FDA%20Color%20Additiv", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "702c4555-f438-4b9f-b7d7-f3141418c22d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390889000, "tags": [ "NOMEN" ] }, { "uuid": "2b738fdf-9f52-468c-bf83-126c80843395", "citation": "SRS import [IY4YV0PVDA]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IY4YV0PVDA", "doc_type": "SRS", "public_domain": true, "document_date": 1493390889000, "tags": [ "NOMEN" ] }, { "uuid": "0f6f989f-2a3f-45b8-a764-5dcf1a3173d5", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "23d9cdf7-afe1-4413-81cc-d0a1e804a283", "citation": "CI 15630 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ae7e3bcb-a552-477a-91e2-b10693160bf3", "citation": "AKA205 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d5a92e77-25b9-d174-fa08-bfafa3834cf5", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1248-18-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3a555e15-1890-439a-be06-86f43d2b8532", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f1b383d5-d053-4844-9eed-4d074201b17d", "id": "f1b383d5-d053-4844-9eed-4d074201b17d", "molfile": "\n Marvin 01132112322D \n\n 1 0 0 0 0 0 999 V2000\n 5.8172 -9.4876 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4dcbe1a8-b8ef-4bec-b29b-f72ae9fbb699" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "6eada55d-f9ce-4f15-bb6a-e7c207159d8e", "id": "6eada55d-f9ce-4f15-bb6a-e7c207159d8e", "molfile": "\n Marvin 01132105452D \n\n 27 30 0 0 0 0 999 V2000\n 7.0940 -6.4498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8912 -6.6592 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6384 -7.0094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6101 -7.4369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3030 -5.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8912 -5.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3030 -4.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1268 -4.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5386 -5.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3670 -5.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7789 -5.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3670 -6.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5386 -6.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1268 -5.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0674 -5.2340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6555 -4.5192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8317 -4.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4199 -3.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8317 -3.0894 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.5915 -3.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1796 -4.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5915 -5.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1796 -5.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5915 -6.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4199 -6.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8317 -5.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4199 -5.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 2 0 0 0 0\n 5 2 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 14 2 0 0 0 0\n 6 7 2 0 0 0 0\n 15 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 14 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 27 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 18 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 22 27 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\nM CHG 1 19 -1\nM END", "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccc4ccccc4c3S(=O)(=O)O)[O-]", "formula": "C20H13N2O4S", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5e9452d3-989f-4318-b4f8-7fb71e3608f2" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "377.3951", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "057da8d6-6088-47d6-9c46-2305328bc8b9", "version": "5", "structure": { "id": "62deda1b-6274-450e-8ed9-208de9408293", "molfile": "\n Marvin 01132105082D \n\n 28 30 0 0 0 0 999 V2000\n 4.5915 -3.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4199 -3.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8317 -4.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4199 -5.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5915 -5.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1796 -4.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1796 -5.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5915 -6.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4199 -6.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8317 -5.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6555 -4.5192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0674 -5.2340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8912 -5.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3030 -4.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1268 -4.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5386 -5.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1268 -5.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3030 -5.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8912 -6.6592 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0940 -6.4498 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.6384 -7.0094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6101 -7.4369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5386 -6.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3670 -6.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7789 -5.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3670 -5.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8317 -3.0894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8172 -9.4876 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 1 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 4 10 1 0 0 0 0\n 3 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 18 13 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 2 0 0 0 0\n 19 22 2 0 0 0 0\n 23 17 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 16 26 1 0 0 0 0\n 2 27 1 0 0 0 0\nM CHG 2 20 -1 28 1\nM END", "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccc4ccccc4c3S(=O)(=O)[O-])O.[Na+]", "formula": "C20H13N2O4S.Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "400.3848", "optical_activity": "NONE", "references": [ "2b738fdf-9f52-468c-bf83-126c80843395", "0f6f989f-2a3f-45b8-a764-5dcf1a3173d5" ], "stereo_centers": 0 }, "unii": "IY4YV0PVDA" } ] }