{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b993cf9d-0c22-4ac1-8309-f4d7a968717f", "code": "128489-04-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=128489-04-3", "code_system": "CAS", "references": [ "9c7b8eb4-2209-4888-bfb6-6677f143d140", "7cf92639-d086-4614-8a9a-8afdcfa15da2" ] }, { "uuid": "c577c493-bbe3-4553-806f-188696762513", "code": "19860086", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19860086", "code_system": "PUBCHEM", "references": [ "9c7b8eb4-2209-4888-bfb6-6677f143d140" ] }, { "uuid": "2c4debf7-a769-4b46-a66a-5133e271a7a8", "code": "IX7UXC994B", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "51f01326-3161-4e62-349e-26846520283e", "code": "DTXSID50888936", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50888936", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "a59eb7c6-5cf0-4cab-b35e-bc46e00c8c8e", "name": "2-METHOXY-4-(4-METHYLENETETRAHYDRO-2H-PYRAN-2-YL)PHENOL", "stdName": "2-METHOXY-4-(4-METHYLENETETRAHYDRO-2H-PYRAN-2-YL)PHENOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9a9fa38e-9d90-4e0d-bdd6-198a390d69dc" ], "display_name": false }, { "uuid": "4f6ab819-0976-4081-a56f-34b8c83f7919", "name": "2-METHOXY-4-(TETRAHYDRO-4-METHYLENE-2H-PYRAN-2-YL)PHENOL", "stdName": "2-METHOXY-4-(TETRAHYDRO-4-METHYLENE-2H-PYRAN-2-YL)PHENOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9a9fa38e-9d90-4e0d-bdd6-198a390d69dc" ], "display_name": true }, { "uuid": "dd320fe0-7c07-4ec6-9186-cacbe75bbdf5", "name": "PHENOL, 2-METHOXY-4-(TETRAHYDRO-4-METHYLENE-2H-PYRAN-2-YL)-", "stdName": "PHENOL, 2-METHOXY-4-(TETRAHYDRO-4-METHYLENE-2H-PYRAN-2-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "762486d2-7e7c-45fe-b006-81c028eeee96" ], "display_name": false } ], "references": [ { "uuid": "9a9fa38e-9d90-4e0d-bdd6-198a390d69dc", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9c7b8eb4-2209-4888-bfb6-6677f143d140", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392170000, "tags": [ "NOMEN" ] }, { "uuid": "9f74fd14-f488-4452-b769-eaf3d4b00543", "citation": "SRS import [IX7UXC994B]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IX7UXC994B", "doc_type": "SRS", "public_domain": true, "document_date": 1493392170000, "tags": [ "NOMEN" ] }, { "uuid": "762486d2-7e7c-45fe-b006-81c028eeee96", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7cf92639-d086-4614-8a9a-8afdcfa15da2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9d9eac77-d205-4a45-966e-369891b5a8e2", "id": "9d9eac77-d205-4a45-966e-369891b5a8e2", "molfile": "\n Marvin 01132108112D \n\n 16 17 0 0 0 0 999 V2000\n 7.3817 -6.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6695 -6.0201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6739 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3904 -4.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3948 -3.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6826 -3.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9659 -3.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9615 -4.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2449 -5.1876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1115 -3.5528 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.8238 -3.9691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5404 -3.5603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2527 -3.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5447 -2.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8325 -2.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1158 -2.7278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 16 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\nM END", "smiles": "C=C1CCOC(C1)c2ccc(c(c2)OC)O", "formula": "C13H16O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9bc6a63e-6f7c-48ee-bcd2-e3fc29a9cee8" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.2648", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "2af18ebf-8ab3-4c3c-a929-41363367e2f5", "version": "4", "structure": { "id": "5c146267-3178-44f8-98d1-0064b7173166", "molfile": "\n Marvin 01132104462D \n\n 16 17 0 0 0 0 999 V2000\n 8.1115 -3.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3948 -3.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6826 -3.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9659 -3.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9615 -4.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2449 -5.1876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6739 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6695 -6.0201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3817 -6.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3904 -4.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1158 -2.7278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8325 -2.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5447 -2.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5404 -3.5603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2527 -3.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8238 -3.9691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 7 10 2 0 0 0 0\n 10 2 1 0 0 0 0\n 1 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 16 14 1 0 0 0 0\n 1 16 1 0 0 0 0\nM END", "smiles": "C=C1CCOC(C1)c2ccc(c(c2)OC)O", "formula": "C13H16O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.2648", "optical_activity": "( + / - )", "references": [ "9f74fd14-f488-4452-b769-eaf3d4b00543", "762486d2-7e7c-45fe-b006-81c028eeee96" ], "stereo_centers": 1 }, "unii": "IX7UXC994B" } ] }