{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "67b98f5d-cbb9-4211-9426-7f89e705e315",
          "code": "2185863-15-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2185863-15-2",
          "code_system": "CAS",
          "references": [
            "1f3aa8e7-be3f-62a8-b624-6c1095d49501"
          ]
        },
        {
          "uuid": "57efc7e9-6d9d-49e0-b00e-3ee6993430ed",
          "code": "FUB-144",
          "comments": "FUB-144 (also known as FUB-UR-144) is an indole-based synthetic cannabinoid that is presumed to be a potent agonist of the CB1 receptor and has been sold online as a designer drug.(1) It is an analogue of UR-144 and XLR-11 where the pentyl chain has been replaced with fluorobenzyl.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/FUB-144",
          "code_system": "WIKIPEDIA",
          "references": [
            "e8054cb6-8789-442a-8bf3-624dfb8eccd4"
          ]
        },
        {
          "uuid": "77695aa5-dd23-4539-975a-0e8c334b16ea",
          "code": "FUB-144",
          "comments": "XLR11 (Item No. 11565) is a synthetic cannabinoid (CB) featuring a tetramethylcyclopropyl group, which reportedly confers selectivity for the peripheral CB2 receptor over the central CB1 receptor.1 It also features an N-(5-fluoropentyl) chain, which increases binding to both CB receptors.2 FUB-144 is a derivative of XLR11 in which the 5-fluoropentyl side chain is replaced by a 4-fluorobenzyl group, a functional group also found in the indazole-based synthetic cannabinoids AB-FUBINACA (Item No. 14292) and ADB-FUBINACA (Item No. 14039).3,4 The physiological and toxicological properties of this compound are not known.",
          "type": "PRIMARY",
          "url": "https://www.caymanchem.com/product/15537",
          "code_system": "MANUFACTURER PRODUCT INFORMATION",
          "references": [
            "e8054cb6-8789-442a-8bf3-624dfb8eccd4"
          ]
        },
        {
          "uuid": "4e88a1af-f7e7-44b9-bdf2-022728bb4e81",
          "code": "118796439",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/118796439",
          "code_system": "PUBCHEM",
          "references": [
            "e8054cb6-8789-442a-8bf3-624dfb8eccd4"
          ]
        },
        {
          "uuid": "c3885ff8-3f1e-47a9-a24f-cf37f51503da",
          "code": "7014",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "4e20dbde-7ab1-0368-f981-eee5e2d57ba1"
          ]
        },
        {
          "uuid": "aed3c86a-bb7e-490a-8007-eae992b0fb86",
          "code": "IWY4W66OKW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "656eca91-e374-4d12-7d27-83e6ce947427",
          "code": "Designer-drugs-FUB-144",
          "comments": "Wikipedia|List of designer drugs|Synthetic cannabinoids|Indole based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "f6429842-d32f-7a07-629d-13eeac25b079"
          ]
        },
        {
          "uuid": "19660e33-191c-1323-143c-bb45b8accc44",
          "code": "DTXSID201016907",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201016907",
          "code_system": "EPA CompTox",
          "references": [
            "f6429842-d32f-7a07-629d-13eeac25b079"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7ce96ed0-52ef-4b24-8a62-6edc3ff23e40",
          "amount": {
            "uuid": "dfb53e52-ffe8-4356-8f29-0c4c5ac2d04e"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "69c8f6b9-be0b-4bc3-a4cc-42926449caca",
            "refuuid": "600d4331-3bf0-4ed3-bb57-bfb8a6cea458",
            "name": "FUB-144",
            "unii": "IWY4W66OKW",
            "linking_id": "IWY4W66OKW",
            "ref_pname": "FUB-144",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3c8fa8a4-9071-b5cf-7de8-9ba88f7d31d5",
          "name": "(1-(4-FLUOROBENZYL)-1H-INDOL-3-YL)(2,2,3,3-TETRAMETHYLCYCLOPROPYL) METHANONE",
          "stdName": "(1-(4-FLUOROBENZYL)-1H-INDOL-3-YL)(2,2,3,3-TETRAMETHYLCYCLOPROPYL) METHANONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e20dbde-7ab1-0368-f981-eee5e2d57ba1"
          ],
          "display_name": false
        },
        {
          "uuid": "3aa6951e-72a8-477a-a094-f7340bf61b81",
          "name": "(1-(4-FLUOROBENZYL)-1H-INDOL-3-YL)(2,2,3,3-TETRAMETHYLCYCLOPROPYL)METHANONE",
          "stdName": "(1-(4-FLUOROBENZYL)-1H-INDOL-3-YL)(2,2,3,3-TETRAMETHYLCYCLOPROPYL)METHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73c875d7-4bc8-435c-aebb-b358aac67c1e"
          ],
          "display_name": false
        },
        {
          "uuid": "b2cb2fcc-cb64-4c30-8f0c-ce65b6cfca98",
          "name": "DEA NO. 7014",
          "stdName": "DEA NO. 7014",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e20dbde-7ab1-0368-f981-eee5e2d57ba1"
          ],
          "display_name": false
        },
        {
          "uuid": "88b0d480-f7eb-4e3c-9e0c-a52583f5a512",
          "name": "FUB-144",
          "stdName": "FUB-144",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7dfc6493-b70d-4f1c-9ae2-0b916398fbf7"
          ],
          "display_name": true
        },
        {
          "uuid": "abaa958b-5147-48f1-9803-60faf2602970",
          "name": "FUB-UR-144",
          "stdName": "FUB-UR-144",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73c875d7-4bc8-435c-aebb-b358aac67c1e"
          ],
          "display_name": false
        },
        {
          "uuid": "6865d098-e8c2-089d-8fa0-33ac12601eb7",
          "name": "METHANONE, (1-((4-FLUOROPHENYL)METHYL)-1H-INDOL-3-YL)(2,2,3,3-TETRAMETHYLCYCLOPROPYL)-",
          "stdName": "METHANONE, (1-((4-FLUOROPHENYL)METHYL)-1H-INDOL-3-YL)(2,2,3,3-TETRAMETHYLCYCLOPROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f3aa8e7-be3f-62a8-b624-6c1095d49501"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7dfc6493-b70d-4f1c-9ae2-0b916398fbf7",
          "citation": "https://en.wikipedia.org/wiki/FUB-144",
          "url": "https://en.wikipedia.org/wiki/FUB-144",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "73c875d7-4bc8-435c-aebb-b358aac67c1e",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8054cb6-8789-442a-8bf3-624dfb8eccd4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393367000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24192cf0-e0a3-4162-96be-a1906eb4d5a1",
          "citation": "SRS import [IWY4W66OKW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IWY4W66OKW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393367000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e20dbde-7ab1-0368-f981-eee5e2d57ba1",
          "citation": "Electronic Code of Federal Regulations, e-CFR data is current as of February 4, 2020",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "doc_type": "CFR",
          "public_domain": true
        },
        {
          "uuid": "1f3aa8e7-be3f-62a8-b624-6c1095d49501",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f6429842-d32f-7a07-629d-13eeac25b079",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0b115d6c-4958-43f8-8038-9f0443e26d4b",
          "id": "0b115d6c-4958-43f8-8038-9f0443e26d4b",
          "molfile": "\n  Marvin  01132100502D          \n\n 26 29  0  0  0  0            999 V2000\n    8.5292   -2.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7643   -2.8399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3271   -2.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9359   -3.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4879   -4.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2949   -4.0885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2329   -5.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7179   -5.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2329   -6.3795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4879   -7.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2949   -7.3357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5498   -8.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3568   -8.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9088   -7.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7158   -7.8502    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6538   -6.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8469   -6.7225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4483   -6.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7339   -6.5371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0194   -6.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0194   -5.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7339   -4.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4483   -5.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1512   -3.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5012   -2.8841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7639   -4.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2 24  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 24  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 23  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 18  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 17  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 23  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)C(C(=O)c2cn(Cc3ccc(cc3)F)c4ccccc24)C1(C)C",
          "formula": "C23H24FNO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "54c3dee0-b713-4d6d-83fa-5c66c7f6733b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "349.442",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "600d4331-3bf0-4ed3-bb57-bfb8a6cea458",
      "version": "11",
      "structure": {
        "id": "3854a11d-877f-40b4-adc9-9575996d86dc",
        "molfile": "\n  Marvin  01132102592D          \n\n 26 29  0  0  0  0            999 V2000\n   15.6899   -2.9425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8828   -3.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3308   -2.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1593   -1.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9241   -1.3848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7221   -0.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5461   -2.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8962   -1.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1588   -2.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6278   -3.8986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1128   -4.5661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6278   -5.2335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8828   -6.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6899   -6.1897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9448   -6.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7517   -7.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3037   -6.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1108   -6.7041    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0487   -5.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2419   -5.5765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8432   -4.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8432   -4.1535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1289   -3.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4143   -4.1535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4143   -4.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1289   -5.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  2 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 14 20  1  0  0  0  0\n 12 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 10 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 21 26  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)C(C(=O)c2cn(Cc3ccc(cc3)F)c4ccccc24)C1(C)C",
        "formula": "C23H24FNO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "349.442",
        "optical_activity": "NONE",
        "references": [
          "7dfc6493-b70d-4f1c-9ae2-0b916398fbf7",
          "24192cf0-e0a3-4162-96be-a1906eb4d5a1"
        ],
        "stereo_centers": 0
      },
      "unii": "IWY4W66OKW"
    }
  ]
}