{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ef58400a-4417-42f1-9e85-fa6191605457",
          "code": "N0000175486",
          "comments": "Established Pharmacologic Class [EPC]|Antiseptic [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175486",
          "code_system": "NDF-RT",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "654c68b7-94ae-4301-93cc-6e8af3b20a74",
          "code": "D08AE01",
          "comments": "ATC|DERMATOLOGICALS|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Phenol and derivatives|hexachlorophene",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D08AE01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "99fb91fd-5356-487e-99bd-f1641a56d085",
          "code": "QP52AG02",
          "comments": "VATC|ANTHELMINTICS|ANTHELMINTICS|Phenol derivatives, incl. salicylanilides|hexachlorophene",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP52AG02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "418adabb-10d2-4298-99b1-1cefcfa51700",
          "code": "QD08AE01",
          "comments": "VATC|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Phenol and derivatives|hexachlorophene",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD08AE01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "3fbd798d-9317-4cc6-8fb3-3b2595f69be8",
          "code": "70-30-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=70-30-4",
          "code_system": "CAS",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778",
            "d74415d2-d587-44c0-a531-8e2001199c1f"
          ]
        },
        {
          "uuid": "4fccc281-2f0c-4aab-bfde-22476d552bc2",
          "code": "D006582",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68006582",
          "code_system": "MESH",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "5b64b661-25a6-4c2e-9213-5d5b4375f58d",
          "code": "21 CFR 310.531",
          "comments": "PART 310 -- NEW DRUGS|Subpart E--Requirements for Specific New Drugs or Devices|Sec. 310.531 Drug products containing active ingredients offered over-the-counter (OTC) for the treatment of boils.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=310.531",
          "code_system": "CFR",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "faef0cbe-0b40-4d7b-a110-6467bc017fe2",
          "code": "21 CFR 250.250",
          "comments": "PART 250 -- SPECIAL REQUIREMENTS FOR SPECIFIC HUMAN DRUGS|Subpart D--Requirements for Drugs and Cosmetics|Sec. 250.250 Hexachlorophene, as a component of drug and cosmetic products.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=250.250",
          "code_system": "CFR",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "68b7d5ba-5481-40f0-a9f6-e143e1ac55b9",
          "code": "SUB08023MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "08bde426-b5b2-4fef-a1e8-9dda155feb9e",
          "code": "2033",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2033",
          "code_system": "INN",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "c0650711-2b8b-47fa-8137-43483a8b4067",
          "code": "C47556",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47556",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "57b8822a-d2a7-4371-a2b3-0acb1a59d1a0",
          "code": "5293",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/5293/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "4f55c276-03dc-46b3-b3c3-ff8334c7bbd5",
          "code": "m5986",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5986?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "758c7c6f-d485-4508-88e4-b5e5ab222fc2",
          "code": "DB00756",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00756",
          "code_system": "DRUG BANK",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "91a486f2-7432-4bd1-b34b-4951f90053f1",
          "code": "CHEMBL496",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL496",
          "code_system": "ChEMBL",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "4b1da395-08aa-4b66-8858-cc876fbdbf8b",
          "code": "200-733-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.667",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "ce7dad20-e779-4828-b736-a4de254042a1",
          "code": "3598",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3598",
          "code_system": "PUBCHEM",
          "references": [
            "f236418d-ca61-4b37-9a26-e0e386ce1778"
          ]
        },
        {
          "uuid": "c71147dd-27ca-662d-0b0c-bf505254964f",
          "code": "224",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/224",
          "code_system": "HSDB",
          "references": [
            "2870f46e-86c0-751c-d4d9-bcc24fab36ee"
          ]
        },
        {
          "uuid": "a85fc824-a997-c087-49ab-517f812982c0",
          "code": "DTXSID6020690",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6020690",
          "code_system": "EPA CompTox",
          "references": [
            "8caab924-0ab6-bb76-4677-6dba46a09e66"
          ]
        },
        {
          "uuid": "4659f3e4-b5f5-0b60-582a-8502d11a721b",
          "code": "Hexachlorophene",
          "comments": "IARC|GROUP 3 ( Not classifiable as to its carcinogenicity to humans)",
          "type": "PRIMARY",
          "code_system": "IARC",
          "references": [
            "e205049e-fc42-a766-8e29-ee3d150a95a3"
          ]
        },
        {
          "uuid": "85cd8fd0-42b1-1f37-0d00-39d591ed52dc",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c21d3a6e-f891-aa34-2ef0-bf7c26a27582"
          ]
        },
        {
          "uuid": "c3e618c7-8958-4c50-bf74-b8f7d03cd1b9",
          "code": "IWW5FV6NK2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "268f7408-2879-76e2-7fc8-9f608b612421",
          "code": "1364",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1364",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c21d3a6e-f891-aa34-2ef0-bf7c26a27582"
          ]
        },
        {
          "uuid": "f6043d11-c781-1487-ecc8-0239e60a8a60",
          "code": "5693",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5693",
          "code_system": "CHEBI",
          "references": [
            "c21d3a6e-f891-aa34-2ef0-bf7c26a27582"
          ]
        },
        {
          "uuid": "187582b4-6d3e-b2d1-1fdb-4be4c52d7fa0",
          "code": "Hexachlorophene",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hexachlorophene",
          "code_system": "WIKIPEDIA",
          "references": [
            "20414528-5bd6-c223-e83a-2fc480170a25"
          ]
        },
        {
          "uuid": "c38a6282-16a4-fba9-3e1f-3622cac345b2",
          "code": "1305008",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1305008",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "c21d3a6e-f891-aa34-2ef0-bf7c26a27582"
          ]
        },
        {
          "uuid": "33c02f6c-00ef-4835-c4e8-a8fcf2d101af",
          "code": "100000092137",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9a58a7d5-8e6b-8816-fe1b-49201ad0696f"
          ]
        },
        {
          "uuid": "af78ea55-a284-58d7-3fa9-0d8651c5839c",
          "code": "49115",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=49115",
          "code_system": "NSC",
          "references": [
            "e27d025d-1f0a-8179-9ffb-7ac07f65e0ab"
          ]
        },
        {
          "uuid": "7255e62e-0786-d035-4dec-7b21a4d215ea",
          "code": "IWW5FV6NK2",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=IWW5FV6NK2",
          "code_system": "DAILYMED",
          "references": [
            "dedfcc53-1fae-7ee8-53b5-47899416012a"
          ]
        },
        {
          "uuid": "f229ca58-29cc-c351-7d35-0e89850ad9ca",
          "code": "hexachlorophene",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/hexachlorophene.html",
          "code_system": "ALANWOOD",
          "references": [
            "dc499afe-4a80-9aa4-f74b-4ed56e322eff"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7a93451a-3181-487c-857c-e626eccc88f2",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e120c0d3-51fa-4fbf-bb27-afe933207b3f",
            "refuuid": "5001ad3b-e1e5-401f-968b-40b532245294",
            "name": "HEXACHLOROPHENE",
            "unii": "IWW5FV6NK2",
            "linking_id": "IWW5FV6NK2",
            "ref_pname": "HEXACHLOROPHENE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d162034d-f796-4c55-a40e-e3ee9a684faa",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "c67919f6-26e1-4b78-b1c0-388730e65dad",
            "refuuid": "98a06c54-eae6-4af9-811e-3a728dd68fdc",
            "name": "HEXACHLOROPHENE DISODIUM",
            "unii": "2D18IOW6VR",
            "linking_id": "2D18IOW6VR",
            "ref_pname": "HEXACHLOROPHENE DISODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1a53c38f-7c44-4525-beaf-0a843f74d14f",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "312161a3-1dfd-49fd-9b0e-b14c95a7799a",
            "refuuid": "6bb06b78-21a1-4f04-957b-cc6b3db47da2",
            "name": "HEXACHLOROPHENE SODIUM",
            "unii": "2VQ8FNO9NH",
            "linking_id": "2VQ8FNO9NH",
            "ref_pname": "HEXACHLOROPHENE SODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c71f458e-1e2b-4936-99fc-6c67d28d1d38",
          "name": "2,2'-METHYLENEBIS(3,4,6-TRICHLOROPHENOL)",
          "stdName": "2,2'-METHYLENEBIS(3,4,6-TRICHLOROPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e576554-69c9-4837-9078-8613ec3da694"
          ],
          "display_name": false
        },
        {
          "uuid": "92617254-7be2-498c-a9c0-8923bcab2a88",
          "name": "DIAL",
          "stdName": "DIAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e576554-69c9-4837-9078-8613ec3da694"
          ],
          "display_name": false
        },
        {
          "uuid": "60dab196-116e-45ad-9277-23b6377b3bf7",
          "name": "E-Z SCRUB",
          "stdName": "E-Z SCRUB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfb64ba-c209-417a-bf5d-bcb86ff71806"
          ],
          "display_name": false
        },
        {
          "uuid": "3469f50b-f968-4d1e-b073-ceed43e293ac",
          "name": "GAMOPHEN",
          "stdName": "GAMOPHEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e576554-69c9-4837-9078-8613ec3da694"
          ],
          "display_name": false
        },
        {
          "uuid": "398c584f-21c1-40cb-a79f-71d8d593ffad",
          "name": "GERMA-MEDICA",
          "stdName": "GERMA-MEDICA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e576554-69c9-4837-9078-8613ec3da694"
          ],
          "display_name": false
        },
        {
          "uuid": "fc454a3d-9793-4385-b41c-1733c5c4482e",
          "name": "HEXA-GERM",
          "stdName": "HEXA-GERM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfb64ba-c209-417a-bf5d-bcb86ff71806"
          ],
          "display_name": false
        },
        {
          "uuid": "79302bd8-6d64-4666-ba7d-a4fe6785f724",
          "name": "HEXACHLOROPHANE",
          "stdName": "HEXACHLOROPHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e576554-69c9-4837-9078-8613ec3da694"
          ],
          "display_name": false
        },
        {
          "uuid": "fb7d93c5-912b-40fa-accf-bc947ee88c12",
          "name": "HEXACHLOROPHENE",
          "stdName": "HEXACHLOROPHENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b04f368-53c1-4499-98bd-2ff29f70c4d4",
            "938e07d0-dca4-4ac5-9be4-0e137576d57d",
            "4a3a9250-6970-48ab-a346-86e2cc152f5b",
            "6f2d9feb-9934-4365-a523-6a55ea2a0493",
            "36463ee0-b393-42b1-b860-cacee08f0d84",
            "e207d6a1-d7cb-4663-a093-f1470f076845",
            "47a033eb-9f14-4c37-8432-f2d7395f9d95",
            "62d3e971-c0f8-42c4-98c6-5be027bfdf95",
            "4d14fb58-38f4-4039-b67b-55c6a53c2cd7",
            "95328abf-fd57-4625-afe7-ac5f4036cac3",
            "03cc5dbb-1415-404e-a2dc-df7a0e246675",
            "155a6fa5-5d8b-4ca4-bbac-ce1b4bd066d8",
            "97ba1553-da31-4ceb-bd98-13b2fc1d3a92",
            "6b417151-6a54-4a59-bd63-50ae4f555940",
            "ed73deaf-09bb-4484-8db0-168edb998321",
            "038e638c-1235-456b-bc31-3094ad8168fe",
            "2b16479b-14c8-42fd-a36c-0e09b23bf8d2",
            "de7ac3cd-de2f-4567-8cc2-941df77abcdd",
            "01e056bd-ed96-4fa6-b4ec-0a43ace63f11",
            "c8c913aa-252d-4b1a-bccf-2385d0498dd0",
            "b80288f3-0890-4cec-94ea-d67228f54eb7"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2cbbf0b5-2a88-473e-a6c1-d2dcaafd27a8",
              "name_org": "INN"
            },
            {
              "uuid": "bdcf239d-ab7f-4afb-ac0a-7a17dd8b696b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "3e770707-a715-418c-beab-b4376bdb196c",
          "name": "HEXACHLOROPHENE [HSDB]",
          "stdName": "HEXACHLOROPHENE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a3a9250-6970-48ab-a346-86e2cc152f5b"
          ],
          "display_name": false
        },
        {
          "uuid": "a2effd82-df50-2efe-0a91-938737023529",
          "name": "HEXACHLOROPHENE [IARC]",
          "stdName": "HEXACHLOROPHENE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e205049e-fc42-a766-8e29-ee3d150a95a3"
          ],
          "display_name": false
        },
        {
          "uuid": "54493877-818e-41df-bc85-7b45d244bf2f",
          "name": "HEXACHLOROPHENE [MART.]",
          "stdName": "HEXACHLOROPHENE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e207d6a1-d7cb-4663-a093-f1470f076845"
          ],
          "display_name": false
        },
        {
          "uuid": "074ccce7-df3b-4c73-a206-ed8499890c94",
          "name": "HEXACHLOROPHENE [MI]",
          "stdName": "HEXACHLOROPHENE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97ba1553-da31-4ceb-bd98-13b2fc1d3a92"
          ],
          "display_name": false
        },
        {
          "uuid": "78866dc1-cfeb-4b86-b48c-05429d455458",
          "name": "HEXACHLOROPHENE [ORANGE BOOK]",
          "stdName": "HEXACHLOROPHENE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b80288f3-0890-4cec-94ea-d67228f54eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "ac6bc824-d61a-462a-ddb4-7016054aecd6",
          "name": "HEXACHLOROPHENE [USP MONOGRAPH]",
          "stdName": "HEXACHLOROPHENE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b15a20c-b336-6e66-a694-65155a04c788"
          ],
          "display_name": false
        },
        {
          "uuid": "2cf35168-7d76-4e7b-a0d1-81bbe36947ec",
          "name": "HEXACHLOROPHENE [USP-RS]",
          "stdName": "HEXACHLOROPHENE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8c913aa-252d-4b1a-bccf-2385d0498dd0"
          ],
          "display_name": false
        },
        {
          "uuid": "984f7318-e58e-4161-841c-ca83c4c32810",
          "name": "HEXACHLOROPHENE [VANDF]",
          "stdName": "HEXACHLOROPHENE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4d14fb58-38f4-4039-b67b-55c6a53c2cd7"
          ],
          "display_name": false
        },
        {
          "uuid": "b90798eb-c25a-4b7b-836a-e120e0d60c1c",
          "name": "HEXASCRUB",
          "stdName": "HEXASCRUB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfb64ba-c209-417a-bf5d-bcb86ff71806"
          ],
          "display_name": false
        },
        {
          "uuid": "6dd18a96-446a-ea3c-0821-bbf4c97225a3",
          "name": "Hexachlorophene [WHO-DD]",
          "stdName": "HEXACHLOROPHENE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "591fcfab-d0fe-63b0-bee7-d0578e7f0cb3"
          ],
          "display_name": false
        },
        {
          "uuid": "99a63737-78b2-4ac5-906a-a6612d5ced52",
          "name": "NSC-49115",
          "stdName": "NSC-49115",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bd5fc80-c74d-421e-9183-25bc7b66841f"
          ],
          "display_name": false
        },
        {
          "uuid": "c269a2a8-6734-4659-b69a-09509b1be047",
          "name": "PHENOL, 2,2'-METHYLENEBIS(3,4,6-TRICHLORO-",
          "stdName": "PHENOL, 2,2'-METHYLENEBIS(3,4,6-TRICHLORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e576554-69c9-4837-9078-8613ec3da694"
          ],
          "display_name": false
        },
        {
          "uuid": "d291f605-669e-4c3d-98a4-333edc5cbdf0",
          "name": "PHISO-SCRUB",
          "stdName": "PHISO-SCRUB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfb64ba-c209-417a-bf5d-bcb86ff71806"
          ],
          "display_name": false
        },
        {
          "uuid": "87411bfe-ada2-4ebe-ba3b-019826d981ab",
          "name": "PHISOHEX",
          "stdName": "PHISOHEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e576554-69c9-4837-9078-8613ec3da694"
          ],
          "display_name": false
        },
        {
          "uuid": "64ff0ae0-e9b7-4aff-9b62-87981ed57c4e",
          "name": "PRE-OP",
          "stdName": "PRE-OP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e576554-69c9-4837-9078-8613ec3da694"
          ],
          "display_name": false
        },
        {
          "uuid": "09109f61-ce72-44c0-93b7-bc9c14bf438a",
          "name": "SCRUBTEAM SURGICAL SPONGEBRUSH",
          "stdName": "SCRUBTEAM SURGICAL SPONGEBRUSH",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfb64ba-c209-417a-bf5d-bcb86ff71806"
          ],
          "display_name": false
        },
        {
          "uuid": "f885eca5-5626-4e41-abdf-01566269333c",
          "name": "SEPTI-SOFT",
          "stdName": "SEPTI-SOFT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfb64ba-c209-417a-bf5d-bcb86ff71806"
          ],
          "display_name": false
        },
        {
          "uuid": "972ba127-029b-4f43-91f4-debb6c781bdf",
          "name": "SEPTISOL",
          "stdName": "SEPTISOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e576554-69c9-4837-9078-8613ec3da694"
          ],
          "display_name": false
        },
        {
          "uuid": "8123638b-8fa1-4511-ba7a-dab7fb785af4",
          "name": "SOY-DOME",
          "stdName": "SOY-DOME",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfb64ba-c209-417a-bf5d-bcb86ff71806"
          ],
          "display_name": false
        },
        {
          "uuid": "1953d1d6-c162-4aa4-abd9-cdc573b6ebc8",
          "name": "TURGEX",
          "stdName": "TURGEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e576554-69c9-4837-9078-8613ec3da694"
          ],
          "display_name": false
        },
        {
          "uuid": "33968cb4-cfbb-442a-b1b1-4413850ed6c4",
          "name": "hexachlorophene [INN]",
          "stdName": "HEXACHLOROPHENE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b16479b-14c8-42fd-a36c-0e09b23bf8d2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "36463ee0-b393-42b1-b860-cacee08f0d84",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1e576554-69c9-4837-9078-8613ec3da694",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acfb64ba-c209-417a-bf5d-bcb86ff71806",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b16479b-14c8-42fd-a36c-0e09b23bf8d2",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "038e638c-1235-456b-bc31-3094ad8168fe",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b80288f3-0890-4cec-94ea-d67228f54eb7",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e207d6a1-d7cb-4663-a093-f1470f076845",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97ba1553-da31-4ceb-bd98-13b2fc1d3a92",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01e056bd-ed96-4fa6-b4ec-0a43ace63f11",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a3a9250-6970-48ab-a346-86e2cc152f5b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8c913aa-252d-4b1a-bccf-2385d0498dd0",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "938e07d0-dca4-4ac5-9be4-0e137576d57d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d14fb58-38f4-4039-b67b-55c6a53c2cd7",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bd5fc80-c74d-421e-9183-25bc7b66841f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f236418d-ca61-4b37-9a26-e0e386ce1778",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389695000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61dc288b-ee8a-4984-8d43-bd0549762536",
          "citation": "SRS import [IWW5FV6NK2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IWW5FV6NK2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389695000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f2d9feb-9934-4365-a523-6a55ea2a0493",
          "citation": "HEXACHLOROPHENE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "de7ac3cd-de2f-4567-8cc2-941df77abcdd",
          "citation": "HEXACHLOROPHENE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "155a6fa5-5d8b-4ca4-bbac-ce1b4bd066d8",
          "citation": "HEXACHLOROPHENE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1b04f368-53c1-4499-98bd-2ff29f70c4d4",
          "citation": "HEXACHLOROPHENE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "47a033eb-9f14-4c37-8432-f2d7395f9d95",
          "citation": "HEXACHLOROPHENE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62d3e971-c0f8-42c4-98c6-5be027bfdf95",
          "citation": "HEXACHLOROPHENE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "95328abf-fd57-4625-afe7-ac5f4036cac3",
          "citation": "HEXACHLOROPHENE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ed73deaf-09bb-4484-8db0-168edb998321",
          "citation": "HEXACHLOROPHENE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "03cc5dbb-1415-404e-a2dc-df7a0e246675",
          "citation": "HEXACHLOROPHENE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6b417151-6a54-4a59-bd63-50ae4f555940",
          "citation": "HEXACHLOROPHENE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2870f46e-86c0-751c-d4d9-bcc24fab36ee",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+70-30-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8caab924-0ab6-bb76-4677-6dba46a09e66",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=70-30-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e205049e-fc42-a766-8e29-ee3d150a95a3",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "c21d3a6e-f891-aa34-2ef0-bf7c26a27582",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d74415d2-d587-44c0-a531-8e2001199c1f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "20414528-5bd6-c223-e83a-2fc480170a25",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "dc499afe-4a80-9aa4-f74b-4ed56e322eff",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "4b15a20c-b336-6e66-a694-65155a04c788",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "e27d025d-1f0a-8179-9ffb-7ac07f65e0ab",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "dedfcc53-1fae-7ee8-53b5-47899416012a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "591fcfab-d0fe-63b0-bee7-d0578e7f0cb3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9a58a7d5-8e6b-8816-fe1b-49201ad0696f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0f2a74cf-429e-437e-bd2e-e2f9fb3889d3",
          "id": "0f2a74cf-429e-437e-bd2e-e2f9fb3889d3",
          "molfile": "\n  Marvin  01132101012D          \n\n 21 22  0  0  0  0            999 V2000\n    4.7457   -0.0655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7457   -0.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4712   -1.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1548   -0.8171    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4555   -2.0979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7562   -2.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7693   -3.3157    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.0307   -2.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3812   -2.4671    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.0255   -1.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0512   -0.7936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1476   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4248   -0.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4169    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7255   -1.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8355    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7176   -2.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4326   -2.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4326   -3.2948    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1476   -2.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7841   -2.4357    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 10  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 20 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "C(c1c(c(cc(c1O)Cl)Cl)Cl)c2c(c(cc(c2O)Cl)Cl)Cl",
          "formula": "C13H6Cl6O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c13eb2f8-3607-43dc-b4b9-07597f40e8ec"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "406.9036",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5001ad3b-e1e5-401f-968b-40b532245294",
      "version": "25",
      "structure": {
        "id": "c4706404-ac80-4971-850e-34984b1fa245",
        "molfile": "\n  Marvin  01132110092D          \n\n 21 22  0  0  0  0            999 V2000\n    2.1476   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0255   -1.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0512   -0.7936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1476   -2.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0307   -2.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7457   -0.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4248   -0.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7562   -2.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4326   -2.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7255   -1.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4712   -1.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7176   -2.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4555   -2.0979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7841   -2.4357    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.3812   -2.4671    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4326   -3.2948    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1548   -0.8171    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7693   -3.3157    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8355    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7457   -0.0655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4169    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  2  2  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  7  2  0  0  0  0\n 11  6  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14  4  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16  9  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18  8  1  0  0  0  0\n 19 10  1  0  0  0  0\n 20  6  1  0  0  0  0\n 21  7  1  0  0  0  0\n 12  9  2  0  0  0  0\n 13  8  2  0  0  0  0\nM  END",
        "smiles": "C(c1c(c(cc(c1O)Cl)Cl)Cl)c2c(c(cc(c2O)Cl)Cl)Cl",
        "formula": "C13H6Cl6O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "406.9036",
        "optical_activity": "NONE",
        "references": [
          "36463ee0-b393-42b1-b860-cacee08f0d84",
          "61dc288b-ee8a-4984-8d43-bd0549762536",
          "2b16479b-14c8-42fd-a36c-0e09b23bf8d2"
        ],
        "stereo_centers": 0
      },
      "unii": "IWW5FV6NK2"
    }
  ]
}