{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "535b3fbf-015b-4189-be2d-b6c70c9378da",
          "code": "201301-83-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=201301-83-9",
          "code_system": "CAS",
          "references": [
            "33bea737-8709-4cde-9de1-705dac17b500",
            "6d82978c-463c-4014-a275-74caba421e4a"
          ]
        },
        {
          "uuid": "006637c0-bc83-425b-a5d5-40fe4a6e3220",
          "code": "5458879",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5458879",
          "code_system": "PUBCHEM",
          "references": [
            "33bea737-8709-4cde-9de1-705dac17b500"
          ]
        },
        {
          "uuid": "3f161b54-377c-bc22-6cef-7a16560c99c6",
          "code": "DTXSID10173951",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10173951",
          "code_system": "EPA CompTox",
          "references": [
            "77ddfc79-f92b-63ae-b797-39db46c00666"
          ]
        },
        {
          "uuid": "a2ca2802-e195-416f-ae7b-6e703dacabf8",
          "code": "IUC27Q8ACH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b83962b2-acce-41e4-9bcb-0facaf492831",
          "name": "2-PROPENAMIDE, N-(2-(5-HYDROXY-1H-INDOL-3-YL)ETHYL)-3-(4-HYDROXYPHENYL)-, (2E)-",
          "stdName": "2-PROPENAMIDE, N-(2-(5-HYDROXY-1H-INDOL-3-YL)ETHYL)-3-(4-HYDROXYPHENYL)-, (2E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1ef1f5e-59b9-4a0e-9b24-5d2c92d24211",
            "66383789-65da-4049-866c-0bfb96aa40f1"
          ],
          "display_name": false
        },
        {
          "uuid": "04a9c5d8-f2b5-424a-8ab0-12b5b18cbcf3",
          "name": "2-PROPENAMIDE, N-(2-(5-HYDROXY-1H-INDOL-3-YL)ETHYL)-3-(4-HYDROXYPHENYL)-, (E)-",
          "stdName": "2-PROPENAMIDE, N-(2-(5-HYDROXY-1H-INDOL-3-YL)ETHYL)-3-(4-HYDROXYPHENYL)-, (E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1ef1f5e-59b9-4a0e-9b24-5d2c92d24211",
            "66383789-65da-4049-866c-0bfb96aa40f1"
          ],
          "display_name": false
        },
        {
          "uuid": "57e976db-8d72-45bb-a304-ce48eb37f154",
          "name": "4-COUMAROYLSEROTONIN",
          "stdName": "4-COUMAROYLSEROTONIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1ef1f5e-59b9-4a0e-9b24-5d2c92d24211",
            "66383789-65da-4049-866c-0bfb96aa40f1"
          ],
          "display_name": false
        },
        {
          "uuid": "e3a5df1f-f7e5-48d2-8046-2a39deea815a",
          "name": "COUMAROYLSEROTONIN 98",
          "stdName": "COUMAROYLSEROTONIN 98",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66383789-65da-4049-866c-0bfb96aa40f1",
            "943a7462-7644-450c-a83a-c28d8b06eee7"
          ],
          "display_name": false
        },
        {
          "uuid": "2b82575f-1f7e-4452-84d9-c7f09ea4ce60",
          "name": "N-COUMAROYL SEROTONIN",
          "stdName": "N-COUMAROYL SEROTONIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66383789-65da-4049-866c-0bfb96aa40f1",
            "943a7462-7644-450c-a83a-c28d8b06eee7",
            "38c92ae9-6f29-45d8-a47f-53ba157f2d97"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "72d1b298-0c9a-43e2-be15-67997f81bc8c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "063b41a0-e12c-4f16-bb2f-ce1397a345c0",
          "name": "P-COUMAROYLSEROTONIN",
          "stdName": "P-COUMAROYLSEROTONIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1ef1f5e-59b9-4a0e-9b24-5d2c92d24211",
            "66383789-65da-4049-866c-0bfb96aa40f1"
          ],
          "display_name": false
        },
        {
          "uuid": "55b17ed3-07bc-4555-a150-6bcfc08ee7a5",
          "name": "TRANS-N-(P-COUMAROYL)SEROTONIN",
          "stdName": "TRANS-N-(P-COUMAROYL)SEROTONIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1ef1f5e-59b9-4a0e-9b24-5d2c92d24211",
            "66383789-65da-4049-866c-0bfb96aa40f1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "943a7462-7644-450c-a83a-c28d8b06eee7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "66383789-65da-4049-866c-0bfb96aa40f1",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1ef1f5e-59b9-4a0e-9b24-5d2c92d24211",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33bea737-8709-4cde-9de1-705dac17b500",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391546000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "526c48c6-e56f-44b0-9c1f-cf1ebb0900fa",
          "citation": "SRS import [IUC27Q8ACH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IUC27Q8ACH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391546000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38c92ae9-6f29-45d8-a47f-53ba157f2d97",
          "citation": "N-COUMAROYL SEROTONIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "77ddfc79-f92b-63ae-b797-39db46c00666",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=201301-83-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6d82978c-463c-4014-a275-74caba421e4a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "96f76075-6678-42ce-af78-7f6da50dfdda",
          "id": "96f76075-6678-42ce-af78-7f6da50dfdda",
          "molfile": "\n  Marvin  01132107502D          \n\n 24 26  0  0  0  0            999 V2000\n    9.6692   -9.5546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4142   -8.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9662   -8.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7113   -7.3723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9043   -7.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6494   -6.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8425   -6.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5875   -5.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1395   -4.8469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7806   -5.2885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5256   -4.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7186   -4.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4637   -3.5478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9486   -2.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4637   -2.2129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6791   -2.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9646   -2.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2502   -2.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2502   -3.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5357   -3.7053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9647   -3.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6791   -3.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3523   -7.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6073   -8.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 24  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 23  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 22  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 22  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1/C=C/C(=O)NCCc2c[nH]c3ccc(cc23)O)O",
          "formula": "C19H18N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e92c0bdd-e167-4816-b171-6ce203825f8b"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "322.3585",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "49f2858e-707e-4ef6-8774-98736aa34806",
      "version": "4",
      "structure": {
        "id": "537d6069-e771-4e64-bbb0-12cc349de8d4",
        "molfile": "\n  Marvin  01132104212D          \n\n 24 26  0  0  0  0            999 V2000\n    6.7806   -5.2885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5256   -4.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7186   -4.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4637   -3.5478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6791   -3.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6791   -2.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4637   -2.2129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9486   -2.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9646   -2.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2502   -2.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2502   -3.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5357   -3.7053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9647   -3.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1395   -4.8469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5875   -5.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8425   -6.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6494   -6.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6692   -9.5546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7113   -7.3723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9662   -8.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4142   -8.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6073   -8.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3523   -7.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9043   -7.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  6  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 13  5  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 24 17  1  0  0  0  0\n 21 18  1  0  0  0  0\n 24 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 15  1  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1/C=C/C(=O)NCCc2c[nH]c3ccc(cc23)O)O",
        "formula": "C19H18N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "322.3585",
        "optical_activity": "NONE",
        "references": [
          "d1ef1f5e-59b9-4a0e-9b24-5d2c92d24211",
          "526c48c6-e56f-44b0-9c1f-cf1ebb0900fa"
        ],
        "stereo_centers": 0
      },
      "unii": "IUC27Q8ACH"
    }
  ]
}