{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2a0a4785-1293-428f-8137-169fbbd1172f",
          "code": "458-37-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=458-37-7",
          "code_system": "CAS",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa",
            "59b34984-c9fa-48e6-9369-5ba984427a1e"
          ]
        },
        {
          "uuid": "52cabe90-f1dc-42b5-a703-fd280b09e295",
          "code": "C401",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C401",
          "code_system": "NCI_THESAURUS",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "2fcd5e75-9742-4380-9e7e-abbdca02da59",
          "code": "D003474",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68003474",
          "code_system": "MESH",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "22c7d938-2f0c-4953-810a-489d57391153",
          "code": "CURCUMIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Curcumin",
          "code_system": "WIKIPEDIA",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "2ea322e2-25df-49e0-b95f-f03f89cc9a77",
          "code": "E100(I)",
          "type": "PRIMARY",
          "url": "http://www.food-info.net/uk/e/e100.htm",
          "code_system": "EU FOOD ADDITIVES",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "98b23e86-02dd-4053-898b-b6a687ed703d",
          "code": "E 100",
          "type": "PRIMARY",
          "url": "https://webgate.ec.europa.eu/sanco_foods/main/?event=substance.view&identifier=5",
          "code_system": "EU FOOD ADDITIVES",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "779ad40f-e292-4402-a60e-c1b7312b7a18",
          "code": "INS-100(I)",
          "comments": "JECFA|Functional Classification|COLOUR",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=1355",
          "code_system": "JECFA EVALUATION",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "58cbe8b4-a5bc-4752-a564-4123ed1e52e2",
          "code": "INS-100(I)",
          "comments": "CODEX alimentarius|Colour",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=107",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "82e5986e-adab-4eac-be1a-0a6585783fff",
          "code": "2955",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2955/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "a2253f13-1a66-475a-88fa-5ad764e75a57",
          "code": "m3933",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3933?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "e520c825-6c2e-49cb-a169-28978be40841",
          "code": "SUB29071",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "657a5138-a3bc-48c6-9547-8696afc1e3e4",
          "code": "207-280-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.619",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "cfc6a733-d398-478a-bacf-efb629d67bdc",
          "code": "969516",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/969516",
          "code_system": "PUBCHEM",
          "references": [
            "021889c3-4c43-4b83-9252-2b8d0248f4fa"
          ]
        },
        {
          "uuid": "fb5c7f44-993a-12fd-e992-6a61191be2c0",
          "code": "4334",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4334",
          "code_system": "HSDB",
          "references": [
            "5dee61fb-4111-8e30-3fec-deed4feb8e5f"
          ]
        },
        {
          "uuid": "3cebcaeb-78fe-1432-3ca0-5e47c140eeb2",
          "code": "DTXSID8031077",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8031077",
          "code_system": "EPA CompTox",
          "references": [
            "0c5a2cdc-303e-577d-855c-29af9d111c63"
          ]
        },
        {
          "uuid": "28028772-a498-d44f-a2fa-88b8667c825f",
          "code": "167603",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of cystic fibrosis",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=167603",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "40bba18e-10c0-7d0a-e97b-1a4c20041845",
          "code": "C1323",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug[C257]|Cyclooxygenase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1323",
          "code_system": "NCI_THESAURUS",
          "references": [
            "51574e34-0cf9-a941-73d7-375e1ba1a300"
          ]
        },
        {
          "uuid": "fbe510bd-0cf3-1895-8184-aa74bc34f6ae",
          "code": "C1967",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Protein Kinase Inhibitor[C1404]|Tyrosine Kinase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1967",
          "code_system": "NCI_THESAURUS",
          "references": [
            "51574e34-0cf9-a941-73d7-375e1ba1a300"
          ]
        },
        {
          "uuid": "b2fb35d5-0592-b3b9-d00b-70efa0d4131a",
          "code": "2377 (Number of products:310)",
          "comments": "Dietary Supplement Label Database|chemical|Curcumin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2377&item=Curcumin",
          "code_system": "DSLD",
          "references": [
            "51574e34-0cf9-a941-73d7-375e1ba1a300"
          ]
        },
        {
          "uuid": "56715172-a93f-8480-fd75-5180d29c7edf",
          "code": "DB11672",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11672",
          "code_system": "DRUG BANK",
          "references": [
            "51574e34-0cf9-a941-73d7-375e1ba1a300"
          ]
        },
        {
          "uuid": "d0c6cf35-b7ac-4b21-a650-8b914d1df277",
          "code": "IT942ZTH98",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "91a54348-24dd-7d34-a00f-e2a76ee7813f",
          "code": "3962",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3962",
          "code_system": "CHEBI",
          "references": [
            "51574e34-0cf9-a941-73d7-375e1ba1a300"
          ]
        },
        {
          "uuid": "d2dc7499-408d-a92a-000b-22e7f0572624",
          "code": "1151855",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1151855",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "51574e34-0cf9-a941-73d7-375e1ba1a300"
          ]
        },
        {
          "uuid": "77999285-f0c9-d805-4932-af379d293596",
          "code": "100000093154",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ea5bde6d-c5eb-8c62-8803-d03ffffd5a52"
          ]
        },
        {
          "uuid": "ce49df96-6121-3dab-9805-63168c70d338",
          "code": "32982",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=32982",
          "code_system": "NSC",
          "references": [
            "becd1890-2cb9-d40d-5faa-8b89ac9cc1f9"
          ]
        },
        {
          "uuid": "5edcef2e-7db2-30e9-244c-cc0ccc0989c4",
          "code": "IT942ZTH98",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=IT942ZTH98",
          "code_system": "DAILYMED",
          "references": [
            "fe0594b4-4c69-9211-abcd-3d6b5d471ad6"
          ]
        },
        {
          "uuid": "8c84a570-5b0f-7602-10f0-2c84ac27c845",
          "code": "686",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=686",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "51574e34-0cf9-a941-73d7-375e1ba1a300"
          ]
        },
        {
          "uuid": "5bf77ae6-141e-8eda-1abd-aa16317992d0",
          "code": "822",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=822",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "51574e34-0cf9-a941-73d7-375e1ba1a300"
          ]
        },
        {
          "uuid": "c8e85735-b9c8-cfc7-4975-59737b80e0ab",
          "code": "687842",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=687842",
          "code_system": "NSC",
          "references": [
            "becd1890-2cb9-d40d-5faa-8b89ac9cc1f9"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "57c22549-f8ee-4dc3-a684-be4f430e0233",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "59015beb-d51f-4f6d-89e3-970931ac8748",
            "refuuid": "cf42852a-3942-4aea-a4d9-0842d85d210d",
            "name": "CURCUMIN",
            "unii": "IT942ZTH98",
            "linking_id": "IT942ZTH98",
            "ref_pname": "CURCUMIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fadb272f-d838-4567-a8b9-53a859df2d78",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "related_substance": {
            "uuid": "bfdd35e2-383d-4c40-a9df-ae9985d61de0",
            "refuuid": "a0b07518-e17a-4eee-a052-a006531fb25c",
            "name": "HEXAHYDROCURCUMIN",
            "unii": "RNL5XJ2BA7",
            "linking_id": "RNL5XJ2BA7",
            "ref_pname": "HEXAHYDROCURCUMIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "951c9ab9-7849-4dd3-b998-efcf7eaab96e",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "related_substance": {
            "uuid": "41bd6c4c-2c2f-43a2-87c4-0183af204d3d",
            "refuuid": "ddefb90d-a5b0-4ce9-9578-14af3c7c9a16",
            "name": "OCTAHYDROCURCUMIN",
            "unii": "YS2A8X6SX2",
            "linking_id": "YS2A8X6SX2",
            "ref_pname": "OCTAHYDROCURCUMIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "868c5946-1e78-420a-a9c5-338d3801fc02",
          "qualification": "Significant Metabolite",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "e7cde323-e854-4e9f-b3db-1d0e2bcf6ba3",
            "refuuid": "08271c0d-0e26-4319-a737-2351f56c223a",
            "name": "HEXAHYDROCURCUMIN .BETA.-O-GLUCURONIDE",
            "unii": "7K3QWL7KXP",
            "linking_id": "7K3QWL7KXP",
            "ref_pname": "HEXAHYDROCURCUMIN .BETA.-O-GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "065c24be-ddc3-4627-b79c-0192d1ca33db",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "references": [
            "5a229f32-73a9-461b-a976-d1358dca9661"
          ],
          "related_substance": {
            "uuid": "649ec933-9d71-4ae2-85cf-f48b9940ccf3",
            "refuuid": "dc831343-2956-4a32-bf37-3829090779db",
            "name": "CURCUMIN GLUCURONIDE",
            "unii": "BE1PK7RL4M",
            "linking_id": "BE1PK7RL4M",
            "ref_pname": "CURCUMIN GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f22fe3e4-1345-468c-b04f-29632c09b884",
          "amount": {
            "uuid": "05f040f5-c57b-4095-9fbe-3465b3be1eda",
            "type": "RELATIONSHIP_AMOUNT",
            "average": 2.04
          },
          "comments": "Unit: mcg/mL; Fraction of curcumin glucuronide in plasma at Cmax after administration of 10g curcumin (n=6); Total curcumin: 3.10 +/- 0.60 mcg/mL",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "references": [
            "a0469dc4-e298-432f-a7c3-ebb6229a96fb"
          ],
          "related_substance": {
            "uuid": "e9012e6a-1def-4927-899f-0b4db50d755a",
            "refuuid": "dc831343-2956-4a32-bf37-3829090779db",
            "name": "CURCUMIN GLUCURONIDE",
            "unii": "BE1PK7RL4M",
            "linking_id": "BE1PK7RL4M",
            "ref_pname": "CURCUMIN GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "07270b0a-efa5-48ae-b18c-9d8a01418ed7",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "related_substance": {
            "uuid": "154eea5d-d3c0-4039-809f-4c1add3b89c7",
            "refuuid": "7f606c20-c22f-4ae1-9b45-ec9786e113f1",
            "name": "DEMETHOXYCURCUMIN GLUCURONIDE",
            "unii": "S702I6I4FQ",
            "linking_id": "S702I6I4FQ",
            "ref_pname": "DEMETHOXYCURCUMIN GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fdd5bc8d-ba93-43fa-9c62-12a015cfbbd1",
          "amount": {
            "uuid": "d9fe2b26-44ca-41cd-8573-2bd51cddb96c",
            "type": "RELATIONSHIP_AMOUNT",
            "average": 0.87
          },
          "comments": "Unit: mcg/mL; Fraction of curcumin sulfate in plasma at Cmax after administration of 12 g curcumin; Total curcumin: 2.27 +/- 1.17 mcg/mL",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "references": [
            "a0469dc4-e298-432f-a7c3-ebb6229a96fb"
          ],
          "related_substance": {
            "uuid": "439c2303-b303-4278-99b9-c6ca7649bec7",
            "refuuid": "7eb60ac8-91a9-44c5-b332-d9328e1d1432",
            "name": "CURCUMIN SULFATE",
            "unii": "160DHE331M",
            "linking_id": "160DHE331M",
            "ref_pname": "CURCUMIN SULFATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "67f6089a-4ad1-41f4-94e3-88a25977cf9e",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "related_substance": {
            "uuid": "2b2bd35a-b8e4-457f-8dcd-b0cde51a24ff",
            "refuuid": "7eb60ac8-91a9-44c5-b332-d9328e1d1432",
            "name": "CURCUMIN SULFATE",
            "unii": "160DHE331M",
            "linking_id": "160DHE331M",
            "ref_pname": "CURCUMIN SULFATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "337f86e5-fb11-4ba4-96bd-e7d6cef5d068",
          "qualification": "Significant Metabolite",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "4f03c1d5-8aed-4157-89be-a07dba3b7dd3",
            "refuuid": "95cf6907-d68d-460a-9313-ad54a5053d54",
            "name": "DIHYDROCURCUMIN",
            "unii": "4YU9OA673J",
            "linking_id": "4YU9OA673J",
            "ref_pname": "DIHYDROCURCUMIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e7f85bfc-a15c-493e-a130-f8f1e4593cbe",
          "qualification": "Significant Metabolite",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "d0d9e914-4c38-4d3b-97f6-a458dfad0a7c",
            "refuuid": "9758ab33-f51d-4397-8d20-e96429b08245",
            "name": "TETRAHYDRODIFERULOYLMETHANE",
            "unii": "00U0645U03",
            "linking_id": "00U0645U03",
            "ref_pname": "TETRAHYDRODIFERULOYLMETHANE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "78f5ea0a-478e-48bc-8cec-b8e7742e44f7",
          "qualification": "Significant Metabolite",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "7dd1a7ba-8a81-42b6-9762-3846bee84ebd",
            "refuuid": "9415f5d4-02f7-49c0-bd3f-6e193b1dedd1",
            "name": "TETRAHYDROCURCUMIN .BETA.-O-GLUCURONIDE",
            "unii": "FA26VP94XR",
            "linking_id": "FA26VP94XR",
            "ref_pname": "TETRAHYDROCURCUMIN .BETA.-O-GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "25f3a5a5-3069-43f5-8141-763a995cb590",
          "amount": {
            "uuid": "20590593-8378-41fe-9a75-b4f3945e766e"
          },
          "type": "DERIVATIVE->PARENT",
          "references": [
            "e8d8371e-40b4-4dbb-9743-0fa320aa715e"
          ],
          "related_substance": {
            "uuid": "3ff9abfc-4b6c-4b0c-baae-5d5465510723",
            "refuuid": "9c3e85a9-42f5-4f61-b421-3a3683f35e67",
            "name": "TML-6",
            "unii": "394YU46YVB",
            "linking_id": "394YU46YVB",
            "ref_pname": "TML-6",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "19003c9d-9065-4604-8c5f-889741407341",
          "name": "(1E,6E)-1,7-BIS(4-HYDROXY-3-METHOXYPHENYL)-1,6-HEPTADIENE-3,5-DIONE",
          "stdName": "(1E,6E)-1,7-BIS(4-HYDROXY-3-METHOXYPHENYL)-1,6-HEPTADIENE-3,5-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "5e3f918a-ee6f-4d64-aba3-e036fd736e85"
          ],
          "display_name": false
        },
        {
          "uuid": "db37ab66-a5c5-4736-a453-a88f61424042",
          "name": "1,7-BIS-(4-HYDROXY-3-METHOXYPHENYL)-HEPTA-1,6-DIENE-3,5-DIONE",
          "stdName": "1,7-BIS-(4-HYDROXY-3-METHOXYPHENYL)-HEPTA-1,6-DIENE-3,5-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "7ecc36f1-8a01-4286-a349-99869d359eed"
          ],
          "display_name": false
        },
        {
          "uuid": "27cae609-79dd-46ed-8ff4-f542f615ec3b",
          "name": "C.I. 75300",
          "stdName": "C.I. 75300",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "5e3f918a-ee6f-4d64-aba3-e036fd736e85"
          ],
          "display_name": false
        },
        {
          "uuid": "1ec0cbf0-60f5-41b6-b95e-6f60dce1658f",
          "name": "C.I. NATURAL YELLOW 3",
          "stdName": "C.I. NATURAL YELLOW 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e3f918a-ee6f-4d64-aba3-e036fd736e85"
          ],
          "display_name": false
        },
        {
          "uuid": "9aa53210-a241-4212-bfee-df871c6d695e",
          "name": "CI 75300",
          "stdName": "CI 75300",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "5bf99694-0cca-4009-9dab-afe55893e445",
            "7469edeb-003b-46d8-9885-e7966a92f6ac"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "61c72fcb-aa2f-4c59-9db3-b8c9b4190210",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cbe03973-e5d3-4eaa-8321-4e8f9b89d69c",
          "name": "CURCUMIN",
          "stdName": "CURCUMIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "a34b2edb-e5c7-4455-8c34-88e733a20f65",
            "67657a19-db51-43bb-bc2b-dadb9a780830",
            "a34031d9-dcba-40ef-b8c3-2c334e4346a1",
            "71711963-1156-414b-a070-aaef3d5ec955",
            "625d7b26-da72-48cf-9773-e5f43bf45407",
            "5e3f918a-ee6f-4d64-aba3-e036fd736e85",
            "f6c75e89-00d0-4f23-95cd-59dd79c3a7ce",
            "bb6a8108-57ad-4310-bebc-5ca6694f9c51",
            "611556ff-9dbe-4deb-a0f5-f7d352610a9c",
            "818f0167-035b-43be-9905-732d2643e295",
            "c1fc2c94-1a7a-430e-a7e5-74903ce60fc8",
            "746d87bf-949b-46f1-8211-6e65f0ca92b4",
            "20680617-f3bd-4ff7-9e6b-e7e6c539a7fc"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5bddda91-15f1-423d-baa9-527a31d5842d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c4601580-560c-4826-b4c4-47dddae0acb6",
          "name": "CURCUMIN (CONSTITUENT OF TURMERIC) [DSC]",
          "stdName": "CURCUMIN (CONSTITUENT OF TURMERIC) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "f7f6366c-1545-48d0-a5b9-42556e2d9ef5"
          ],
          "display_name": false
        },
        {
          "uuid": "e0840730-48ac-4542-b407-9f940269e979",
          "name": "CURCUMIN E100",
          "stdName": "CURCUMIN E100",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "48839e83-a26d-412e-bc9c-fb9f1938d886"
          ],
          "display_name": false
        },
        {
          "uuid": "726ff5bf-2a93-4350-8707-3ba3a2c2d373",
          "name": "CURCUMIN [HSDB]",
          "stdName": "CURCUMIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67657a19-db51-43bb-bc2b-dadb9a780830",
            "a09585dd-55d4-4ea5-9168-f052486acf98"
          ],
          "display_name": false
        },
        {
          "uuid": "e71f27fc-61a5-4352-9cbf-6c05b0504bb7",
          "name": "CURCUMIN [MART.]",
          "stdName": "CURCUMIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "611556ff-9dbe-4deb-a0f5-f7d352610a9c"
          ],
          "display_name": false
        },
        {
          "uuid": "155127ed-8714-4e30-8669-ed1d15d62468",
          "name": "CURCUMIN [MI]",
          "stdName": "CURCUMIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "20680617-f3bd-4ff7-9e6b-e7e6c539a7fc"
          ],
          "display_name": false
        },
        {
          "uuid": "17fd4f52-234d-4ea9-9314-8faaf3771b58",
          "name": "CURCUMIN [USP-RS]",
          "stdName": "CURCUMIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "746d87bf-949b-46f1-8211-6e65f0ca92b4"
          ],
          "display_name": false
        },
        {
          "uuid": "6c0515e5-35ea-f94a-fe9b-7595f7b66281",
          "name": "Curcumin [WHO-DD]",
          "stdName": "CURCUMIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "755693a0-9e97-a389-e56d-06f0d90f5a4f"
          ],
          "display_name": false
        },
        {
          "uuid": "ed3c539e-e964-4800-a3ac-8c3c6928e133",
          "name": "DIFERULOYLMETHANE",
          "stdName": "DIFERULOYLMETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e3f918a-ee6f-4d64-aba3-e036fd736e85"
          ],
          "display_name": false
        },
        {
          "uuid": "2d9ea654-eb9a-4db7-b3fc-29c77eababca",
          "name": "E 100",
          "stdName": "E 100",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "8ca7112c-2506-4bab-9801-a35f3a55039c"
          ],
          "display_name": false
        },
        {
          "uuid": "1eff1a91-ddca-4044-9635-cd4f31f5d6e8",
          "name": "E-100",
          "stdName": "E-100",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "93aeb99b-a489-42f8-bd38-d5db1a601f24"
          ],
          "display_name": false
        },
        {
          "uuid": "86b3b766-ece5-489d-8326-a640ffb3cdc9",
          "name": "E100",
          "stdName": "E100",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "93aeb99b-a489-42f8-bd38-d5db1a601f24"
          ],
          "display_name": false
        },
        {
          "uuid": "3dfdd995-6440-4b60-9558-7a27c58d0f77",
          "name": "HALDAR",
          "stdName": "HALDAR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c1ee9e-0be5-47f6-b920-d22a9421c4db",
            "777be1f5-1d89-49cd-8721-dbbdd6547348"
          ],
          "display_name": false
        },
        {
          "uuid": "d09c6afe-3ad1-4967-ba95-2d5a8a264f37",
          "name": "INS NO. 100(I)",
          "stdName": "INS NO. 100(I)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "794b8084-8f23-4891-a094-ad67e5bea12e"
          ],
          "display_name": false
        },
        {
          "uuid": "5e335374-59f8-42e9-bc20-f83f703adf39",
          "name": "INS-100(I)",
          "stdName": "INS-100(I)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "794b8084-8f23-4891-a094-ad67e5bea12e"
          ],
          "display_name": false
        },
        {
          "uuid": "4c1b39bc-460b-4aa9-a6d3-943e1afed537",
          "name": "JIANGHUANGSU",
          "stdName": "JIANGHUANGSU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c1ee9e-0be5-47f6-b920-d22a9421c4db",
            "777be1f5-1d89-49cd-8721-dbbdd6547348"
          ],
          "display_name": false
        },
        {
          "uuid": "b427480d-ffa9-4c37-a114-d8f18985e5c9",
          "name": "KACHA HALDI",
          "stdName": "KACHA HALDI",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c1ee9e-0be5-47f6-b920-d22a9421c4db",
            "777be1f5-1d89-49cd-8721-dbbdd6547348"
          ],
          "display_name": false
        },
        {
          "uuid": "8384ab75-a177-42c4-970c-444790bd0af6",
          "name": "KURKUM",
          "stdName": "KURKUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "794b8084-8f23-4891-a094-ad67e5bea12e"
          ],
          "display_name": false
        },
        {
          "uuid": "ac99c6ec-0b75-437d-97bf-96d201376096",
          "name": "LIPOCURC",
          "stdName": "LIPOCURC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c1ee9e-0be5-47f6-b920-d22a9421c4db",
            "777be1f5-1d89-49cd-8721-dbbdd6547348"
          ],
          "display_name": false
        },
        {
          "uuid": "214de753-270d-4ef0-9f17-124c99b21e0b",
          "name": "MERITA EARTH",
          "stdName": "MERITA EARTH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c1ee9e-0be5-47f6-b920-d22a9421c4db",
            "777be1f5-1d89-49cd-8721-dbbdd6547348"
          ],
          "display_name": false
        },
        {
          "uuid": "8fe6480b-b35c-40fb-a03b-14a1ce65adaa",
          "name": "NANOCURC",
          "stdName": "NANOCURC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c1ee9e-0be5-47f6-b920-d22a9421c4db",
            "777be1f5-1d89-49cd-8721-dbbdd6547348"
          ],
          "display_name": false
        },
        {
          "uuid": "f2f5b28b-892d-4da6-a954-7d52d6c1203f",
          "name": "NSC-32982",
          "stdName": "NSC-32982",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "f6c1ee9e-0be5-47f6-b920-d22a9421c4db"
          ],
          "display_name": false
        },
        {
          "uuid": "935ff7bf-2938-49de-9d0b-68b5d1523df3",
          "name": "NSC-687842",
          "stdName": "NSC-687842",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09585dd-55d4-4ea5-9168-f052486acf98",
            "8ddb1ae3-f8fd-4a05-94c4-60b544967462"
          ],
          "display_name": false
        },
        {
          "uuid": "2fc74255-6ed0-48c7-bbd9-7da0a5af869f",
          "name": "TURMERIC YELLOW",
          "stdName": "TURMERIC YELLOW",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e3f918a-ee6f-4d64-aba3-e036fd736e85"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5e3f918a-ee6f-4d64-aba3-e036fd736e85",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a09585dd-55d4-4ea5-9168-f052486acf98",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93aeb99b-a489-42f8-bd38-d5db1a601f24",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ca7112c-2506-4bab-9801-a35f3a55039c",
          "citation": "EMA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "611556ff-9dbe-4deb-a0f5-f7d352610a9c",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20680617-f3bd-4ff7-9e6b-e7e6c539a7fc",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a34b2edb-e5c7-4455-8c34-88e733a20f65",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67657a19-db51-43bb-bc2b-dadb9a780830",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "746d87bf-949b-46f1-8211-6e65f0ca92b4",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb6a8108-57ad-4310-bebc-5ca6694f9c51",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7469edeb-003b-46d8-9885-e7966a92f6ac",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "777be1f5-1d89-49cd-8721-dbbdd6547348",
          "citation": "YES",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6c1ee9e-0be5-47f6-b920-d22a9421c4db",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "794b8084-8f23-4891-a094-ad67e5bea12e",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=107",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=107",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7f6366c-1545-48d0-a5b9-42556e2d9ef5",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48839e83-a26d-412e-bc9c-fb9f1938d886",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ecc36f1-8a01-4286-a349-99869d359eed",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ddb1ae3-f8fd-4a05-94c4-60b544967462",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "021889c3-4c43-4b83-9252-2b8d0248f4fa",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "128c981e-25be-4ed1-a44e-15e647a152a4",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05b0b99c-7b34-492a-8224-34e86209405b",
          "citation": "BR J CANCER 90 1011 (2004)",
          "url": "http://www.nature.com/bjc/journal/v90/n5/full/6601623a.html",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c05503f1-7f05-4a18-acb0-f583fc7d74fc",
          "citation": "BR J CANCER 90 1011 (2004)",
          "url": "http://www.ncbi.nlm.nih.gov/pubmed/?term=14997198",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db7c2a92-f191-4b96-8e12-20cb07ba951d",
          "citation": "CURR MED CHEM 17 4072 (2010)",
          "url": "http://www.ncbi.nlm.nih.gov/pubmed/?term=20939821",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0469dc4-e298-432f-a7c3-ebb6229a96fb",
          "citation": "CANCER EPIDEMIOL BIOMARKERS PREV 17 1411 (2008)",
          "url": "http://cebp.aacrjournals.org/content/17/6/1411.long",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7de4430-358a-4110-b77a-acfd6004f540",
          "citation": "CLIN CANCER RES 10 6847 (2004)",
          "url": "http://clincancerres.aacrjournals.org/content/10/20/6847.long",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98c5070a-8ca0-4107-9621-1d704f891dd6",
          "citation": "CURR MED CHEM 17 4702 (2010)",
          "url": "http://www.ncbi.nlm.nih.gov/pubmed/?term=20939821",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3715c235-225e-4d4e-a876-9b21b55d6eca",
          "citation": "SRS import [IT942ZTH98]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IT942ZTH98",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71711963-1156-414b-a070-aaef3d5ec955",
          "citation": "CURCUMIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "625d7b26-da72-48cf-9773-e5f43bf45407",
          "citation": "CURCUMIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f6c75e89-00d0-4f23-95cd-59dd79c3a7ce",
          "citation": "CURCUMIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "818f0167-035b-43be-9905-732d2643e295",
          "citation": "CURCUMIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a34031d9-dcba-40ef-b8c3-2c334e4346a1",
          "citation": "CURCUMIN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c1fc2c94-1a7a-430e-a7e5-74903ce60fc8",
          "citation": "CURCUMIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5bf99694-0cca-4009-9dab-afe55893e445",
          "citation": "CI 75300 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5dee61fb-4111-8e30-3fec-deed4feb8e5f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+458-37-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0c5a2cdc-303e-577d-855c-29af9d111c63",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=458-37-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "51574e34-0cf9-a941-73d7-375e1ba1a300",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "59b34984-c9fa-48e6-9369-5ba984427a1e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4c1b9a2c-287c-43e4-a057-c041625aca15",
          "citation": "Sordillo, Peter P., and Lawrence Helson. \"Curcumin suppression of cytokine release and cytokine storm. A potential therapy for patients with Ebola and other severe viral infections.\" in vivo 29.1 (2015): 1-4.",
          "url": "http://iv.iiarjournals.org/content/29/1/1.full",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a229f32-73a9-461b-a976-d1358dca9661",
          "citation": "Cancer Res. 2001 Feb 1;61(3):1058-64.",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "755693a0-9e97-a389-e56d-06f0d90f5a4f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "becd1890-2cb9-d40d-5faa-8b89ac9cc1f9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "fe0594b4-4c69-9211-abcd-3d6b5d471ad6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ea5bde6d-c5eb-8c62-8803-d03ffffd5a52",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e8d8371e-40b4-4dbb-9743-0fa320aa715e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9862a1c9-dc3a-450a-bbc9-5b8bef426512",
          "id": "9862a1c9-dc3a-450a-bbc9-5b8bef426512",
          "molfile": "\n  Marvin  01132107552D          \n\n 27 28  0  0  0  0            999 V2000\n   -1.7739   -5.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0144   -4.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2812   -5.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4284   -4.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1511   -5.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1511   -6.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4363   -6.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2812   -6.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9986   -6.4675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8606   -4.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5807   -5.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2981   -4.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2981   -3.9919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0313   -5.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7304   -4.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7304   -3.9762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4505   -5.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1679   -4.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8853   -5.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8853   -6.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6080   -6.4517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3176   -6.0339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0298   -6.4517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3176   -5.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1323   -4.7409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9522   -5.2139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6001   -4.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 27  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 24  2  0  0  0  0\n 25 24  1  0  0  0  0\n 27 24  1  0  0  0  0\n 26 25  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(c(c2)OC)O)ccc1O",
          "formula": "C21H20O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1f2e9127-667a-499c-8af9-f2c4506ecd8e"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "368.3807",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cf42852a-3942-4aea-a4d9-0842d85d210d",
      "version": "49",
      "structure": {
        "id": "c8f22cd6-7de6-4b61-ad77-2b412bb77fae",
        "molfile": "\n  Marvin  01132110232D          \n\n 27 28  0  0  0  0            999 V2000\n    8.3176   -5.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2812   -5.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4505   -5.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5807   -5.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1679   -4.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8606   -4.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3176   -6.0339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2812   -6.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7304   -4.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2981   -4.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0313   -5.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4284   -4.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6001   -4.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8853   -5.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1511   -5.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7304   -3.9762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2981   -3.9919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6080   -6.4517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4363   -6.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1511   -6.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8853   -6.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0144   -4.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1323   -4.7409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9986   -6.4675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0298   -6.4517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7739   -5.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9522   -5.2139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2 12  2  0  0  0  0\n  3  5  2  0  0  0  0\n  4 10  1  0  0  0  0\n  5 14  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  1  2  0  0  0  0\n  8 19  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 15  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15  6  1  0  0  0  0\n 16  9  2  0  0  0  0\n 17 10  2  0  0  0  0\n 18  7  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 15  2  0  0  0  0\n 21 14  1  0  0  0  0\n 22  2  1  0  0  0  0\n 23  1  1  0  0  0  0\n 24  8  1  0  0  0  0\n 25  7  1  0  0  0  0\n 26 22  1  0  0  0  0\n 27 23  1  0  0  0  0\n 21 18  2  0  0  0  0\n  8  2  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(c(c2)OC)O)ccc1O",
        "formula": "C21H20O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "368.3807",
        "optical_activity": "NONE",
        "references": [
          "3715c235-225e-4d4e-a876-9b21b55d6eca",
          "5e3f918a-ee6f-4d64-aba3-e036fd736e85"
        ],
        "stereo_centers": 0
      },
      "unii": "IT942ZTH98"
    }
  ]
}