{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7d18d655-af66-4d3d-b7bc-d7673590fab9",
          "code": "119168-77-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=119168-77-3",
          "code_system": "CAS",
          "references": [
            "cd66adf3-1aa4-4e97-b547-74f377e4899e",
            "14cf9dc0-e2db-48b3-807f-a2c06cc4143e"
          ]
        },
        {
          "uuid": "894c0b15-ffd8-4ebd-a09c-32509a75eb73",
          "code": "TEBUFENPYRAD",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tebufenpyrad",
          "code_system": "WIKIPEDIA",
          "references": [
            "cd66adf3-1aa4-4e97-b547-74f377e4899e"
          ]
        },
        {
          "uuid": "f222caac-9aac-466a-8596-3e56332c8978",
          "code": "90102",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:318",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "cd66adf3-1aa4-4e97-b547-74f377e4899e"
          ]
        },
        {
          "uuid": "8beb279b-79ac-452f-9400-aace4ce0841c",
          "code": "m10501",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10501?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "cd66adf3-1aa4-4e97-b547-74f377e4899e"
          ]
        },
        {
          "uuid": "232f4e54-ffa3-4a7d-88b2-077bd853f159",
          "code": "86354",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86354",
          "code_system": "PUBCHEM",
          "references": [
            "cd66adf3-1aa4-4e97-b547-74f377e4899e"
          ]
        },
        {
          "uuid": "1d37de4a-711e-6f94-de70-08882764b2d9",
          "code": "7271",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7271",
          "code_system": "HSDB",
          "references": [
            "b842032a-c543-444f-df76-fdbb59d74d18"
          ]
        },
        {
          "uuid": "9a0165a2-6027-db3d-c29d-c8570f5f534a",
          "code": "DTXSID0034223",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0034223",
          "code_system": "EPA CompTox",
          "references": [
            "4d74ddbd-f7ef-af52-fc41-89cd94943aff"
          ]
        },
        {
          "uuid": "b9420249-de5d-4894-a0b5-fbce04adf84d",
          "code": "IRU3P7ZB3F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "429a88e0-32ad-8e53-7331-f14449215d92",
          "code": "9422",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9422",
          "code_system": "CHEBI",
          "references": [
            "3dbd8919-6539-e11f-31e3-3db8f7847a0b"
          ]
        },
        {
          "uuid": "de6d0e17-a996-bced-1aa1-4027a7fecf41",
          "code": "tebufenpyrad",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tebufenpyrad.html",
          "code_system": "ALANWOOD",
          "references": [
            "932f1fe8-c7fc-95f3-3c7d-d8a869de51fe"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8b57f30c-581c-4dc1-825e-2f2484b335d6",
          "name": "4-CHLORO-N-((4-(1,1-DIMETHYLETHYL)PHENYL)METHYL)-3-ETHYL-1-METHYL-1H-PYRAZOLE-5-CARBOXAMIDE",
          "stdName": "4-CHLORO-N-((4-(1,1-DIMETHYLETHYL)PHENYL)METHYL)-3-ETHYL-1-METHYL-1H-PYRAZOLE-5-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0cac1a27-12f5-4863-ac5f-c029ce267bc6",
            "959246c9-e068-4cc7-9eb7-6a83068a2fff"
          ],
          "display_name": false
        },
        {
          "uuid": "1ae6ee4c-814f-4ee5-b273-a7ac75cabf02",
          "name": "MK-239",
          "stdName": "MK-239",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02d239fa-f37f-4518-a5ce-f842b0f86e09",
            "07f229ae-eeeb-4055-8baf-0ed0bacf628f"
          ],
          "display_name": false
        },
        {
          "uuid": "d07760d9-c0b1-4739-be73-7e03269d3356",
          "name": "N-(4-TERT-BUTYLBENZYL)-4-CHLORO-3-ETHYL-1-METHYLPYRAZOLE-5-CARBOXAMIDE",
          "stdName": "N-(4-TERT-BUTYLBENZYL)-4-CHLORO-3-ETHYL-1-METHYLPYRAZOLE-5-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0cac1a27-12f5-4863-ac5f-c029ce267bc6",
            "17486997-839a-4142-8b00-40e9ffe9470f"
          ],
          "display_name": false
        },
        {
          "uuid": "0d0e23d2-89f4-448b-b7e3-3c30c77e4cc5",
          "name": "PYRANICA",
          "stdName": "PYRANICA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02d239fa-f37f-4518-a5ce-f842b0f86e09",
            "07f229ae-eeeb-4055-8baf-0ed0bacf628f"
          ],
          "display_name": false
        },
        {
          "uuid": "f507162c-0a26-4e3b-a782-ca4f553dd717",
          "name": "TEBUFENPYRAD",
          "stdName": "TEBUFENPYRAD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59aabd5a-f411-48de-8e48-142e973fb33b",
            "743da3ff-dd21-4ab3-972f-bab8074ae781",
            "49af4346-075b-4189-8004-a73337691d5b",
            "3b40bd18-afee-4e9f-8076-fb5fc8ff3c64",
            "84962329-1803-4320-a833-6f750db2bc4e",
            "07f229ae-eeeb-4055-8baf-0ed0bacf628f",
            "c65de34d-7937-4875-87f4-0670dd426896",
            "ae133df1-1dc8-4a63-b69b-71fa237d9268"
          ],
          "display_name": true
        },
        {
          "uuid": "f987a9b7-4a70-42ac-9f36-1ca9e76c5476",
          "name": "TEBUFENPYRAD [HSDB]",
          "stdName": "TEBUFENPYRAD [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59aabd5a-f411-48de-8e48-142e973fb33b",
            "07f229ae-eeeb-4055-8baf-0ed0bacf628f"
          ],
          "display_name": false
        },
        {
          "uuid": "e5d6630e-9c9f-4469-b222-8cbce5eadfdf",
          "name": "TEBUFENPYRAD [ISO]",
          "stdName": "TEBUFENPYRAD [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c65de34d-7937-4875-87f4-0670dd426896",
            "07f229ae-eeeb-4055-8baf-0ed0bacf628f"
          ],
          "display_name": false
        },
        {
          "uuid": "4033d4b4-9f5f-478d-b4a2-3ebedee89f66",
          "name": "TEBUFENPYRAD [MI]",
          "stdName": "TEBUFENPYRAD [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "743da3ff-dd21-4ab3-972f-bab8074ae781",
            "07f229ae-eeeb-4055-8baf-0ed0bacf628f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "84962329-1803-4320-a833-6f750db2bc4e",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0cac1a27-12f5-4863-ac5f-c029ce267bc6",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17486997-839a-4142-8b00-40e9ffe9470f",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "959246c9-e068-4cc7-9eb7-6a83068a2fff",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "743da3ff-dd21-4ab3-972f-bab8074ae781",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07f229ae-eeeb-4055-8baf-0ed0bacf628f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02d239fa-f37f-4518-a5ce-f842b0f86e09",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59aabd5a-f411-48de-8e48-142e973fb33b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c65de34d-7937-4875-87f4-0670dd426896",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd66adf3-1aa4-4e97-b547-74f377e4899e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b5495b2-f366-4695-a926-d95da3d5d14b",
          "citation": "SRS import [IRU3P7ZB3F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IRU3P7ZB3F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56cf8f4e-49a7-42cb-9363-bd4342ac5c9b",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae133df1-1dc8-4a63-b69b-71fa237d9268",
          "citation": "TEBUFENPYRAD [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "49af4346-075b-4189-8004-a73337691d5b",
          "citation": "TEBUFENPYRAD [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3b40bd18-afee-4e9f-8076-fb5fc8ff3c64",
          "citation": "TEBUFENPYRAD [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b842032a-c543-444f-df76-fdbb59d74d18",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+119168-77-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4d74ddbd-f7ef-af52-fc41-89cd94943aff",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=119168-77-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "932f1fe8-c7fc-95f3-3c7d-d8a869de51fe",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "14cf9dc0-e2db-48b3-807f-a2c06cc4143e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3dbd8919-6539-e11f-31e3-3db8f7847a0b",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5918fd4c-ea2a-4128-8d14-560d6b716e7e",
          "id": "5918fd4c-ea2a-4128-8d14-560d6b716e7e",
          "molfile": "\n  Marvin  01132104372D          \n\n 23 24  0  0  0  0            999 V2000\n    9.8664   -6.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3489   -5.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0106   -4.8309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4138   -4.1159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8661   -3.5049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0404   -2.6942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1079   -3.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3935   -3.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3935   -2.6027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6841   -3.8385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6841   -4.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9669   -5.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2528   -4.6652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5407   -5.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5407   -5.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2528   -6.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9669   -5.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8252   -6.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2373   -7.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4183   -5.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1102   -6.7239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1934   -4.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5808   -5.2139    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n 22  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 22  2  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 17 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 18  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "CCc1c(c(C(=O)NCc2ccc(cc2)C(C)(C)C)n(C)n1)Cl",
          "formula": "C18H24ClN3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cb7e541a-65d6-4e8c-b232-e474da05d69a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "333.8563",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "76ad7a3e-72e3-46ae-b1f5-772a55f9237e",
      "version": "6",
      "structure": {
        "id": "836fadb5-0aa2-4827-ad6c-e24844b10826",
        "molfile": "\n  Marvin  01132106492D          \n\n 23 24  0  0  0  0            999 V2000\n    8.5802   -5.2135    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.1928   -4.6609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0099   -4.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3482   -5.5815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8657   -6.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4131   -4.1156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8654   -3.5047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0397   -2.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1073   -3.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3929   -3.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3929   -2.6025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6836   -3.8382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6836   -4.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9664   -5.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2524   -4.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5403   -5.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5403   -5.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8249   -6.3160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2369   -7.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4180   -5.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1099   -6.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2524   -6.3175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9664   -5.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  3  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9  2  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 17 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 14  2  0  0  0  0\nM  END",
        "smiles": "CCc1c(c(C(=O)NCc2ccc(cc2)C(C)(C)C)n(C)n1)Cl",
        "formula": "C18H24ClN3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "333.8563",
        "optical_activity": "NONE",
        "references": [
          "56cf8f4e-49a7-42cb-9363-bd4342ac5c9b",
          "4b5495b2-f366-4695-a926-d95da3d5d14b"
        ],
        "stereo_centers": 0
      },
      "unii": "IRU3P7ZB3F"
    }
  ]
}